2011-01-29  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r77050.
        http://trac.webkit.org/changeset/77050
        https://bugs.webkit.org/show_bug.cgi?id=53371

        Caused a crash in Chromium's test_shell_tests (Requested by
        rniwa on #webkit).

        * html/parser/HTMLTreeBuilder.cpp:
        (WebCore::HTMLTreeBuilder::FragmentParsingContext::FragmentParsingContext):
        (WebCore::HTMLTreeBuilder::FragmentParsingContext::document):
        (WebCore::HTMLTreeBuilder::FragmentParsingContext::finished):
        * html/parser/HTMLTreeBuilder.h:

2011-01-28  Eric Seidel  <eric@webkit.org>

        Reviewed by Darin Adler.

        HTML5 TreeBuilder regressed a Peacekeeper DOM test by 40%
        https://bugs.webkit.org/show_bug.cgi?id=48719

        It's unclear exactly what the Peacekeeper benchmark is testing,
        because I haven't found a way to run it myself.

        However, I constructed a benchmark which shows at least one possible slow point.
        The HTML5 spec talks about creating a new document for every time we use
        the fragment parsing algorithm.  Document() it turns out, it a huge bloated
        mess, and the constructor and destructor do a huge amount of work.
        To avoid constructing (or destructing) documents for each innerHTML call,
        this patch adds a shared dummy document used by all innerHTML calls.

        This patch brings us from 7x slower than Safari 5 on tiny-innerHTML
        to only 1.5x slower than Safari 5.  I'm sure there is more work to do here.

        Saving a shared Document like this is error prone.  Currently
        DummyDocumentFactory::releaseDocument() calls removeAllChildren()
        in an attempt to clear the Document's state. However it's possible
        that that call is not sufficient and we'll have future bugs here.

        * html/parser/HTMLTreeBuilder.cpp:
        (WebCore::DummyDocumentFactory::createDummyDocument):
        (WebCore::DummyDocumentFactory::releaseDocument):
        (WebCore::HTMLTreeBuilder::FragmentParsingContext::FragmentParsingContext):
        (WebCore::HTMLTreeBuilder::FragmentParsingContext::document):
        (WebCore::HTMLTreeBuilder::FragmentParsingContext::finished):
        * html/parser/HTMLTreeBuilder.h:

2011-01-28  Johnny Ding  <jnd@chromium.org>

        Reviewed by Adam Barth.

        Gesture API: Don't use current gesture status to set "forceUserGesture" parameter when calling ScriptController::executeScript.
        The "forceUserGesture" parameter should be only set when you are definitely sure that the running script is from a hyper-link.
        https://bugs.webkit.org/show_bug.cgi?id=53244

        Test: fast/events/popup-blocked-from-iframe-src.html

        * bindings/ScriptControllerBase.cpp:
        (WebCore::ScriptController::executeIfJavaScriptURL):

2011-01-28  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Gavin Barraclough.

        Add various clampToInt() methods to MathExtras.h
        https://bugs.webkit.org/show_bug.cgi?id=52910

        Use clampToInteger() from MathExtras.h

        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseCounter):

2011-01-28  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r77006 and r77020.
        http://trac.webkit.org/changeset/77006
        http://trac.webkit.org/changeset/77020
        https://bugs.webkit.org/show_bug.cgi?id=53360

        "Broke Windows tests" (Requested by rniwa on #webkit).

        * ForwardingHeaders/runtime/WriteBarrier.h: Removed.
        * WebCore.exp.in:
        * bindings/js/DOMWrapperWorld.h:
        * bindings/js/JSAudioConstructor.cpp:
        (WebCore::JSAudioConstructor::JSAudioConstructor):
        * bindings/js/JSDOMBinding.cpp:
        (WebCore::markDOMNodesForDocument):
        (WebCore::markDOMObjectWrapper):
        (WebCore::markDOMNodeWrapper):
        * bindings/js/JSDOMGlobalObject.cpp:
        (WebCore::JSDOMGlobalObject::markChildren):
        (WebCore::JSDOMGlobalObject::setInjectedScript):
        (WebCore::JSDOMGlobalObject::injectedScript):
        * bindings/js/JSDOMGlobalObject.h:
        (WebCore::JSDOMGlobalObject::JSDOMGlobalObjectData::JSDOMGlobalObjectData):
        (WebCore::getDOMConstructor):
        * bindings/js/JSDOMWindowCustom.cpp:
        (WebCore::JSDOMWindow::setLocation):
        (WebCore::DialogHandler::dialogCreated):
        * bindings/js/JSDOMWindowShell.cpp:
        (WebCore::JSDOMWindowShell::JSDOMWindowShell):
        (WebCore::JSDOMWindowShell::setWindow):
        (WebCore::JSDOMWindowShell::markChildren):
        (WebCore::JSDOMWindowShell::unwrappedObject):
        * bindings/js/JSDOMWindowShell.h:
        (WebCore::JSDOMWindowShell::window):
        (WebCore::JSDOMWindowShell::setWindow):
        * bindings/js/JSDeviceMotionEventCustom.cpp:
        (WebCore::createAccelerationObject):
        (WebCore::createRotationRateObject):
        * bindings/js/JSEventListener.cpp:
        (WebCore::JSEventListener::JSEventListener):
        (WebCore::JSEventListener::markJSFunction):
        * bindings/js/JSEventListener.h:
        (WebCore::JSEventListener::jsFunction):
        * bindings/js/JSHTMLDocumentCustom.cpp:
        (WebCore::JSHTMLDocument::setAll):
        * bindings/js/JSImageConstructor.cpp:
        (WebCore::JSImageConstructor::JSImageConstructor):
        * bindings/js/JSImageDataCustom.cpp:
        (WebCore::toJS):
        * bindings/js/JSJavaScriptCallFrameCustom.cpp:
        (WebCore::JSJavaScriptCallFrame::scopeChain):
        (WebCore::JSJavaScriptCallFrame::scopeType):
        * bindings/js/JSNodeFilterCondition.cpp:
        (WebCore::JSNodeFilterCondition::markAggregate):
        (WebCore::JSNodeFilterCondition::acceptNode):
        * bindings/js/JSNodeFilterCondition.h:
        * bindings/js/JSNodeFilterCustom.cpp:
        * bindings/js/JSOptionConstructor.cpp:
        (WebCore::JSOptionConstructor::JSOptionConstructor):
        * bindings/js/JSSQLResultSetRowListCustom.cpp:
        (WebCore::JSSQLResultSetRowList::item):
        * bindings/js/ScriptCachedFrameData.cpp:
        (WebCore::ScriptCachedFrameData::restore):
        * bindings/js/ScriptObject.cpp:
        (WebCore::ScriptGlobalObject::set):
        * bindings/js/SerializedScriptValue.cpp:
        (WebCore::CloneDeserializer::putProperty):
        * bindings/scripts/CodeGeneratorJS.pm:
        * bridge/qt/qt_runtime.cpp:
        (JSC::Bindings::QtRuntimeMetaMethod::QtRuntimeMetaMethod):
        (JSC::Bindings::QtRuntimeMetaMethod::markChildren):
        (JSC::Bindings::QtRuntimeMetaMethod::connectGetter):
        (JSC::Bindings::QtRuntimeMetaMethod::disconnectGetter):
        * bridge/qt/qt_runtime.h:
        * bridge/runtime_root.cpp:
        (JSC::Bindings::RootObject::invalidate):
        * bridge/runtime_root.h:
        * dom/Document.h:

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        XSSFilter should log to the console when it blocks something
        https://bugs.webkit.org/show_bug.cgi?id=53354

        This patch refactors a bunch of methods in XSSFilter to return a bool
        indicating whether they blocked anything.  Using this bool, we decide
        whether to log to the console.  We're using the same log message as the
        XSSAuditor, but it seems likely we can improve this message in the
        future (especially by piping in the correct line number, which is now
        accessible via the parser).

        * html/parser/XSSFilter.cpp:
        (WebCore::HTMLNames::isNameOfInlineEventHandler):
        (WebCore::XSSFilter::filterToken):
        (WebCore::XSSFilter::filterTokenInitial):
        (WebCore::XSSFilter::filterTokenAfterScriptStartTag):
        (WebCore::XSSFilter::filterScriptToken):
        (WebCore::XSSFilter::filterObjectToken):
        (WebCore::XSSFilter::filterEmbedToken):
        (WebCore::XSSFilter::filterAppletToken):
        (WebCore::XSSFilter::filterMetaToken):
        (WebCore::XSSFilter::filterBaseToken):
        (WebCore::XSSFilter::eraseInlineEventHandlersIfInjected):
        * html/parser/XSSFilter.h:

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Daniel Bates.

        Wire up settings->xssAuditorEnabled to XSSFilter
        https://bugs.webkit.org/show_bug.cgi?id=53345

        * html/parser/XSSFilter.cpp:
        (WebCore::XSSFilter::XSSFilter):
        (WebCore::XSSFilter::filterToken):
        * html/parser/XSSFilter.h:

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Daniel Bates.

        Teach XSSFilter about <meta> and <base> tags
        https://bugs.webkit.org/show_bug.cgi?id=53339

        I'm not 100% sure we need to block <meta http-equiv>, but it seems
        prudent given how powerful that attribute is.  We definitely need to
        block injection of <base href> because that can redirect script tags
        that use relative URLs.

        * html/parser/XSSFilter.cpp:
        (WebCore::XSSFilter::filterToken):
        (WebCore::XSSFilter::filterMetaToken):
        (WebCore::XSSFilter::filterBaseToken):
        * html/parser/XSSFilter.h:

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Daniel Bates.

        Teach XSSFilter about <applet>
        https://bugs.webkit.org/show_bug.cgi?id=53338

        HTML5 is pretty light on information about how the <applet> tag works.
        According to this site:

        http://download.oracle.com/javase/1.4.2/docs/guide/misc/applet.html

        The "code" and "object" attributes are the essential attributes for
        determining which piece of Java to run.  We might need to expand to the
        codebase and archive attributes at some point, but hopefully code and
        object will be sufficient.

        * html/parser/XSSFilter.cpp:
        (WebCore::XSSFilter::filterToken):
        (WebCore::XSSFilter::filterAppletToken):
        * html/parser/XSSFilter.h:

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Daniel Bates.

        Teach the XSSFilter about object and embed tags
        https://bugs.webkit.org/show_bug.cgi?id=53336

        For <object> and <embed>, we filter out attribute values that either
        indicate which piece of media to load or which plugin to load.  In a
        perfect world, we'd only need to filter out the URLs of the media, but
        some plug-ins (like Flash) have lots of fun places you can hide the
        URL (e.g., the "movie" <param>).

        * html/parser/XSSFilter.cpp:
        (WebCore::XSSFilter::filterToken):
        (WebCore::XSSFilter::filterScriptToken):
        (WebCore::XSSFilter::filterObjectToken):
        (WebCore::XSSFilter::filterEmbedToken):
        (WebCore::XSSFilter::eraseAttributeIfInjected):
        * html/parser/XSSFilter.h:

2011-01-28  Oliver Hunt  <oliver@apple.com>

        Fix Qt build.

        * bridge/qt/qt_runtime.cpp:
        (JSC::Bindings::QtRuntimeMetaMethod::QtRuntimeMetaMethod):
        (JSC::Bindings::QtRuntimeMetaMethod::markChildren):
        (JSC::Bindings::QtRuntimeMetaMethod::connectGetter):
        (JSC::Bindings::QtRuntimeMetaMethod::disconnectGetter):
        * bridge/qt/qt_runtime.h:

2011-01-28  Antti Koivisto  <antti@apple.com>

        Reviewed by Simon Fraser.

        CSS styles are shared based on uninitialized property values
        https://bugs.webkit.org/show_bug.cgi?id=53285
        
        Null test.

        * dom/NamedNodeMap.cpp:
        (WebCore::NamedNodeMap::mappedMapsEquivalent):

2011-01-27  Oliver Hunt  <oliver@apple.com>

        Reviewed by Geoffrey Garen.

        Convert markstack to a slot visitor API
        https://bugs.webkit.org/show_bug.cgi?id=53219

        Update WebCore to the new marking apis, correct bindings
        codegen. 

        * ForwardingHeaders/runtime/WriteBarrier.h: Added.
        * WebCore.exp.in:
        * bindings/js/DOMWrapperWorld.h:
        (WebCore::DOMWrapperWorld::globalData):
        * bindings/js/JSAudioConstructor.cpp:
        (WebCore::JSAudioConstructor::JSAudioConstructor):
        * bindings/js/JSDOMBinding.cpp:
        (WebCore::markDOMNodesForDocument):
        (WebCore::markDOMObjectWrapper):
        (WebCore::markDOMNodeWrapper):
        * bindings/js/JSDOMGlobalObject.cpp:
        (WebCore::JSDOMGlobalObject::markChildren):
        (WebCore::JSDOMGlobalObject::setInjectedScript):
        (WebCore::JSDOMGlobalObject::injectedScript):
        * bindings/js/JSDOMGlobalObject.h:
        (WebCore::JSDOMGlobalObject::JSDOMGlobalObjectData::JSDOMGlobalObjectData):
        (WebCore::getDOMConstructor):
        * bindings/js/JSDOMWindowCustom.cpp:
        (WebCore::JSDOMWindow::setLocation):
        (WebCore::DialogHandler::dialogCreated):
        * bindings/js/JSDOMWindowShell.cpp:
        (WebCore::JSDOMWindowShell::JSDOMWindowShell):
        (WebCore::JSDOMWindowShell::setWindow):
        (WebCore::JSDOMWindowShell::markChildren):
        (WebCore::JSDOMWindowShell::unwrappedObject):
        * bindings/js/JSDOMWindowShell.h:
        (WebCore::JSDOMWindowShell::window):
        (WebCore::JSDOMWindowShell::setWindow):
        * bindings/js/JSEventListener.cpp:
        (WebCore::JSEventListener::JSEventListener):
        (WebCore::JSEventListener::markJSFunction):
        * bindings/js/JSEventListener.h:
        (WebCore::JSEventListener::jsFunction):
        * bindings/js/JSHTMLDocumentCustom.cpp:
        (WebCore::JSHTMLDocument::setAll):
        * bindings/js/JSImageConstructor.cpp:
        (WebCore::JSImageConstructor::JSImageConstructor):
        * bindings/js/JSImageDataCustom.cpp:
        (WebCore::toJS):
        * bindings/js/JSJavaScriptCallFrameCustom.cpp:
        (WebCore::JSJavaScriptCallFrame::scopeChain):
        (WebCore::JSJavaScriptCallFrame::scopeType):
        * bindings/js/JSNodeFilterCondition.cpp:
        (WebCore::JSNodeFilterCondition::markAggregate):
        (WebCore::JSNodeFilterCondition::acceptNode):
        * bindings/js/JSNodeFilterCondition.h:
        * bindings/js/JSNodeFilterCustom.cpp:
        * bindings/js/JSOptionConstructor.cpp:
        (WebCore::JSOptionConstructor::JSOptionConstructor):
        * bindings/js/JSSQLResultSetRowListCustom.cpp:
        (WebCore::JSSQLResultSetRowList::item):
        * bindings/js/ScriptCachedFrameData.cpp:
        (WebCore::ScriptCachedFrameData::restore):
        * bindings/js/ScriptObject.cpp:
        (WebCore::ScriptGlobalObject::set):
        * bindings/js/SerializedScriptValue.cpp:
        (WebCore::CloneDeserializer::putProperty):
        * bindings/scripts/CodeGeneratorJS.pm:
        * dom/Document.h:

2011-01-28  Sam Weinig  <sam@webkit.org>

        Reviewed by Anders Carlsson.

        Keyboard scrolling doesn’t work in WebKit2
        <rdar://problem/8909672>

        * platform/mac/ScrollAnimatorMac.mm:
        (-[ScrollAnimationHelperDelegate convertSizeToBacking:]):
        (-[ScrollAnimationHelperDelegate convertSizeFromBacking:]):
        Add additional necessary delegate methods.

2011-01-29  Darin Adler  <darin@apple.com>

        Reviewed by Dan Bernstein.

        Re-land this patch with the missing null check that caused crashes in layout tests.

        Changing cursor style has no effect until the mouse moves
        https://bugs.webkit.org/show_bug.cgi?id=14344
        rdar://problem/7563712

        No tests added because we don't have infrastructure for testing actual cursor
        changes (as opposed to cursor style computation) at this time. We might add it later.

        * page/EventHandler.cpp:
        (WebCore::EventHandler::dispatchFakeMouseMoveEventSoon): Added.
        * page/EventHandler.h: Ditto.

        * rendering/RenderObject.cpp:
        (WebCore::areNonIdenticalCursorListsEqual): Added.
        (WebCore::areCursorsEqual): Added.
        (WebCore::RenderObject::styleDidChange): Call dispatchFakeMouseMoveEventSoon if
        cursor styles changed.

2011-01-28  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Eric Seidel.

        We should hold RefPtrs to SVG font faces
        https://bugs.webkit.org/show_bug.cgi?id=53270

        Test: svg/custom/use-multiple-on-nested-disallowed-font.html

        * css/CSSFontFaceSource.cpp:
        (WebCore::CSSFontFaceSource::getFontData):
        * css/CSSFontFaceSource.h:
        * svg/SVGFontFaceElement.cpp:
        (WebCore::SVGFontFaceElement::associatedFontElement):
        * svg/SVGFontFaceElement.h:

2011-01-28  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        uniformN*v should generate INVALID_VALUE of the array size is not a multiple of N
        https://bugs.webkit.org/show_bug.cgi?id=53306

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::validateUniformMatrixParameters):

2011-01-28  Tom Sepez  <tsepez@chromium.org>

        Reviewed by Eric Seidel.

        NULL pointer crash in TextIterator::handleTextBox()
        https://bugs.webkit.org/show_bug.cgi?id=53267

        Test: fast/css/rtl-nth-child-first-letter-crash.html

        * editing/TextIterator.cpp:
        (WebCore::TextIterator::handleTextBox):

2011-01-28  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        [chromium] Remove a spurious diagnostic CRASH check.
        https://bugs.webkit.org/show_bug.cgi?id=52379

        * platform/graphics/chromium/LayerTilerChromium.cpp:
        (WebCore::LayerTilerChromium::invalidateRect):

2011-01-28  Dan Bernstein  <mitz@apple.com>

        Reviewed by Sam Weinig.

        <rdar://problem/4761512> <select> can't display right-to-left (rtl) languages
        https://bugs.webkit.org/show_bug.cgi?id=19785

        Changed <select> pop-up menus on Mac OS X Snow Leopard and later to have their items aligned in the
        direction corresponding to the writing direction of the <select> element, with the checkmarks
        on the "start" side, and use the <option>'s writing direction rather than "natural". Made the
        pop-up button match the menu by adding a Chrome boolean function, selectItemAlignmentFollowsMenuWritingDirection(),
        which returns true for this pop-up behavior.

        * loader/EmptyClients.h:
        (WebCore::EmptyChromeClient::selectItemAlignmentFollowsMenuWritingDirection): Added.
        * manual-tests/pop-up-alignment-and-direction.html: Added.
        * page/Chrome.cpp:
        (WebCore::Chrome::selectItemAlignmentFollowsMenuWritingDirection): Added. Calls through to the
        client.
        * page/Chrome.h:
        * page/ChromeClient.h:
        * platform/PopupMenuStyle.h:
        (WebCore::PopupMenuStyle::PopupMenuStyle): Added hasTextDirectionOverride parameter and member
        variable initialization.
        (WebCore::PopupMenuStyle::hasTextDirectionOverride): Added this accessor.
        * platform/mac/PopupMenuMac.mm:
        (WebCore::PopupMenuMac::populate): Set the pop-up's layout direction and items' text alignment
        to match the menu's writing direction. Set items' writing direction and direction override
        according to their styles.
        * rendering/RenderMenuList.cpp:
        (WebCore::RenderMenuList::RenderMenuList): Removed unncesaary initialization of a smart pointer.
        (WebCore::RenderMenuList::adjustInnerStyle): If the alignment of items in the menu follows the
        menu's writing direction, use that alignment for the button as well. Also in this mode, use the
        item's writing direction and override setting.
        (WebCore::RenderMenuList::setTextFromOption): Store the option element's style.
        (WebCore::RenderMenuList::itemStyle): Pass the text direction override value.
        (WebCore::RenderMenuList::menuStyle): Ditto. Also use the button's direction, not the inner text's.
        * rendering/RenderMenuList.h:
        * rendering/RenderTextControlSingleLine.cpp:
        (WebCore::RenderTextControlSingleLine::menuStyle): Pass the text direction override value.

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Daniel Bates.

        Teach XSSFilter how to filter <script> elements
        https://bugs.webkit.org/show_bug.cgi?id=53279

        This patch adds the ability for the XSSFilter to block injected
        <script> elements.  Handling script elements is slightly subtle because
        these elements act very differently depending on whether they have a
        src attribute.
        
        In the "src case", which check whether the src attribute was present in
        the request.  In the "non-src case", we check whether the start tag and
        the body of the script element was included in the request.  Checking
        for the whole start tag means we miss out on some attribute splitting
        attacks inside of script tags, but that doesn't seem like that big a
        deal.

        This patch also introduces some amount of state into the XSSFilter
        because inline script elements span multiple tokens.  There's a lot of
        tuning and optimization left in these cases, some of which I've noted
        with FIXMEs.

        To test this patch, I played around with some of the existing
        XSSAuditor tests.  Hopefully I'll be able to run the test suite more
        systematically in the future.

        * html/parser/HTMLToken.h:
        (WebCore::HTMLToken::eraseCharacters):
        (WebCore::HTMLToken::eraseValueOfAttribute):
        * html/parser/XSSFilter.cpp:
        (WebCore::HTMLNames::hasName):
        (WebCore::HTMLNames::findAttributeWithName):
        (WebCore::HTMLNames::isNameOfScriptCarryingAttribute):
        (WebCore::XSSFilter::XSSFilter):
        (WebCore::XSSFilter::filterToken):
        (WebCore::XSSFilter::filterTokenAfterScriptStartTag):
        (WebCore::XSSFilter::filterScriptToken):
        (WebCore::XSSFilter::snippetForRange):
        (WebCore::XSSFilter::snippetForAttribute):
        * html/parser/XSSFilter.h:

2011-01-28  Adam Barth  <abarth@webkit.org>

        Reviewed by Daniel Bates.

        Sketch out new XSS filter design (disabled by default)
        https://bugs.webkit.org/show_bug.cgi?id=53205

        This patch adds a basic sketch of the new XSS filter design.  Rather
        than watching scripts as they execute, in this design, we watch tokens
        emitted by the tokenizer.  We then map the tokens directly back into
        input characters, which lets us skip all the complicated logic related
        to HTML entities and double-decoding of JavaScript URLs.

        This patch contains only the bare essentially machinery.  I'll add more
        in future patches and eventually remove the previous code once this
        code is up and running correctly.

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * html/parser/HTMLDocumentParser.cpp:
        (WebCore::HTMLDocumentParser::HTMLDocumentParser):
        (WebCore::HTMLDocumentParser::pumpTokenizer):
        (WebCore::HTMLDocumentParser::sourceForToken):
        * html/parser/HTMLDocumentParser.h:
        * html/parser/XSSFilter.cpp: Added.
        * html/parser/XSSFilter.h: Added.

2011-01-28  Michael Saboff  <msaboff@apple.com>

        Reviewed by Geoffrey Garen.

        Potentially Unsafe HashSet of RuntimeObject* in RootObject definition
        https://bugs.webkit.org/show_bug.cgi?id=53271

        Reapplying this patch with the change that the second ASSERT in 
        RootObject::removeRuntimeObject was changed to use
        .uncheckedGet() instead of the failing .get().  The object in question
        could be in the process of being GC'ed.  The get() call will not return
        such an object while the uncheckedGet() call will return the (unsafe) 
        object.  This is the behavior we want.

        Precautionary change.
        Changed RootObject to use WeakGCMap instead of HashSet.
        Found will looking for another issue, but can't produce a test case
        that is problematic.  THerefore there aren't any new tests.

        * bridge/runtime_root.cpp:
        (JSC::Bindings::RootObject::invalidate):
        (JSC::Bindings::RootObject::addRuntimeObject):
        (JSC::Bindings::RootObject::removeRuntimeObject):
        * bridge/runtime_root.h:

2011-01-28  Adam Roben  <aroben@apple.com>

        Notify CACFLayerTreeHost when the context is flushed

        LegacyCACFLayerTreeHost was keeping this a secret, which meant that WebCore's animation
        timers were never starting.

        Fixes <http://webkit.org/b/53302> [Windows 7 Release Tests] changesets 76853, 76856, and
        76858 broke ~36 animations, compositing, and transitions tests

        Reviewed by Sam Weinig.

        * platform/graphics/ca/win/LegacyCACFLayerTreeHost.cpp:
        (WebCore::LegacyCACFLayerTreeHost::contextDidChange): Call up to the base class after we
        start our render timer.

2011-01-28  Antti Koivisto  <antti@apple.com>

        Reviewed by Dan Bernstein.

        Remove dead code that tried to map from CSS values to parser values
        https://bugs.webkit.org/show_bug.cgi?id=53318

        * css/CSSFunctionValue.cpp:
        * css/CSSFunctionValue.h:
        * css/CSSPrimitiveValue.cpp:
        * css/CSSPrimitiveValue.h:
        * css/CSSValue.h:
        * css/CSSValueList.cpp:
        * css/CSSValueList.h:

2011-01-28  Enrica Casucci  <enrica@apple.com>

        Reviewed by Adam Roben.

        Some drag and drop tests fail since r76824
        https://bugs.webkit.org/show_bug.cgi?id=53304

        There were '||' instead of '&&' in the checks for valid
        clipboard content.
        
        * platform/win/ClipboardWin.cpp:
        (WebCore::ClipboardWin::getData):
        (WebCore::ClipboardWin::types):
        (WebCore::ClipboardWin::files):

2011-01-28  Martin Robinson  <mrobinson@igalia.com>

        [GTK] AudioProcessingEvent.h and JSJavaScriptAudioNode.h: No such file or directory
        https://bugs.webkit.org/show_bug.cgi?id=52889

        Build fix for WebAudio. Include WebAudio source files on the source
        list when WebAudio is enabled.

        * GNUmakefile.am: Include missing source files.

2011-01-28  Sam Weinig  <sam@webkit.org>

        Reviewed by Maciej Stachowiak.

        Add basic rubber banding support
        <rdar://problem/8219429>
        https://bugs.webkit.org/show_bug.cgi?id=53277

        * page/EventHandler.cpp:
        (WebCore::EventHandler::handleGestureEvent):
        Pass gesture events to the FrameView.

        * platform/ScrollAnimator.cpp:
        (WebCore::ScrollAnimator::handleGestureEvent):
        * platform/ScrollAnimator.h:
        Add stubbed out implementation.

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::ScrollView):
        (WebCore::ScrollView::overhangAmount):
        (WebCore::ScrollView::wheelEvent):
        * platform/ScrollView.h:
        * platform/ScrollableArea.cpp:
        (WebCore::ScrollableArea::ScrollableArea):
        (WebCore::ScrollableArea::handleGestureEvent):
        * platform/ScrollableArea.h:
        (WebCore::ScrollableArea::constrainsScrollingToContentEdge):
        (WebCore::ScrollableArea::setConstrainsScrollingToContentEdge):
        Move constrains scrolling bit to ScrollableArea from ScrollView.

        (WebCore::ScrollableArea::contentsSize):
        (WebCore::ScrollableArea::overhangAmount):
        Add additional virtual functions for information needed by the animator.

        * platform/mac/ScrollAnimatorMac.h:
        * platform/mac/ScrollAnimatorMac.mm:
        (WebCore::ScrollAnimatorMac::ScrollAnimatorMac):
        (WebCore::ScrollAnimatorMac::immediateScrollByDeltaX):
        (WebCore::ScrollAnimatorMac::immediateScrollByDeltaY):
        (WebCore::elasticDeltaForTimeDelta):
        (WebCore::elasticDeltaForReboundDelta):
        (WebCore::reboundDeltaForElasticDelta):
        (WebCore::scrollWheelMultiplier):
        (WebCore::ScrollAnimatorMac::handleWheelEvent):
        (WebCore::ScrollAnimatorMac::handleGestureEvent):
        (WebCore::ScrollAnimatorMac::pinnedInDirection):
        (WebCore::ScrollAnimatorMac::allowsVerticalStretching):
        (WebCore::ScrollAnimatorMac::allowsHorizontalStretching):
        (WebCore::ScrollAnimatorMac::smoothScrollWithEvent):
        (WebCore::ScrollAnimatorMac::beginScrollGesture):
        (WebCore::ScrollAnimatorMac::endScrollGesture):
        (WebCore::ScrollAnimatorMac::snapRubberBand):
        (WebCore::roundTowardZero):
        (WebCore::roundToDevicePixelTowardZero):
        (WebCore::ScrollAnimatorMac::snapRubberBandTimerFired):
        Implement basic rubber banding.

2011-01-28  Dan Bernstein  <mitz@apple.com>

        Reviewed by Anders Carlsson.

        Changing unicode-bidi doesn’t force layout
        https://bugs.webkit.org/show_bug.cgi?id=53311

        Test: fast/dynamic/unicode-bidi.html

        * rendering/style/RenderStyle.cpp:
        (WebCore::RenderStyle::diff): Return a layout difference if unicode-bidi values differ.

2011-01-27  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Kent Tamura.

        Change HTMLInputElement-derived parts of media element shadow DOM to use shadowPseudoId.
        https://bugs.webkit.org/show_bug.cgi?id=53122

        This is the first step in converting HTMLMediaElement to the new shadow DOM.

        Should not regress any existing tests. No observable change in behavior.

        * css/CSSSelector.cpp:
        (WebCore::CSSSelector::pseudoId): Removed now-unnecessary hard-coded pseudo-element selectors.
        (WebCore::nameToPseudoTypeMap): Ditto.
        (WebCore::CSSSelector::extractPseudoType): Ditto.
        * css/CSSSelector.h: Ditto.
        * css/mediaControls.css: Added proper initial values, now that elements use the proper selector pipeline.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlInputElement::MediaControlInputElement): Removed the switch statement,
            which is now replaced with virtual shadowPseudoId on each corresponding class.
        (WebCore::MediaControlInputElement::styleForElement): Changed to use element pipeline.
        (WebCore::MediaControlMuteButtonElement::MediaControlMuteButtonElement): Changed to set
            display type in constructor.
        (WebCore::MediaControlMuteButtonElement::create): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlMuteButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::MediaControlVolumeSliderMuteButtonElement): Added
            to disambiguate from the MediaControlMuteButtonElement.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::create): Added.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlPlayButtonElement::MediaControlPlayButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlPlayButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlSeekButtonElement::MediaControlSeekButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlSeekForwardButtonElement::MediaControlSeekForwardButtonElement): Added.
        (WebCore::MediaControlSeekForwardButtonElement::create): Added.
        (WebCore::MediaControlSeekForwardButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlSeekBackButtonElement::MediaControlSeekBackButtonElement): Added.
        (WebCore::MediaControlSeekBackButtonElement::create): Added.
        (WebCore::MediaControlSeekBackButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlRewindButtonElement::MediaControlRewindButtonElement): Added.
        (WebCore::MediaControlRewindButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlReturnToRealtimeButtonElement::MediaControlReturnToRealtimeButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlReturnToRealtimeButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlToggleClosedCaptionsButtonElement::MediaControlToggleClosedCaptionsButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlToggleClosedCaptionsButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlTimelineElement::MediaControlTimelineElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlTimelineElement::shadowPseudoId): Added.
        (WebCore::MediaControlVolumeSliderElement::MediaControlVolumeSliderElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlVolumeSliderElement::shadowPseudoId): Added.
        (WebCore::MediaControlFullscreenButtonElement::MediaControlFullscreenButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlFullscreenButtonElement::shadowPseudoId): Added.
        * rendering/MediaControlElements.h:
        (WebCore::MediaControlSeekForwardButtonElement::isForwardButton): Added.
        (WebCore::MediaControlSeekBackButtonElement::isForwardButton): Added.
        * rendering/RenderMedia.cpp:
        (WebCore::RenderMedia::createMuteButton): Changed to use new constructor.
        (WebCore::RenderMedia::createSeekBackButton): Ditto.
        (WebCore::RenderMedia::createSeekForwardButton): Ditto.
        (WebCore::RenderMedia::createVolumeSliderMuteButton): Ditto.
        * rendering/style/RenderStyleConstants.h: Removed constants that are no longer used.

2011-01-27  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Eric Carlson.

        Split MediaControls out of RenderMedia.
        https://bugs.webkit.org/show_bug.cgi?id=53252

        Near-mechanical moving of stuff, no change in behavior, thus no new tests.

        * Android.mk: Added MediaControls to build system.
        * CMakeLists.txt: Ditto.
        * GNUmakefile.am: Ditto.
        * WebCore.gypi: Ditto.
        * WebCore.pro: Ditto.
        * WebCore.vcproj/WebCore.vcproj: Ditto.
        * WebCore.xcodeproj/project.pbxproj: Ditto.
        * html/HTMLMediaElement.cpp:
        (WebCore::HTMLMediaElement::defaultEventHandler): Changed to forward events to MediaControls.
        * html/shadow/MediaControls.cpp: Copied all controls-related methods from
            Source/WebCore/rendering/RenderMedia.cpp, pulled them into their own class called MediaControls. 
        * html/shadow/MediaControls.h: Ditto from Source/WebCore/rendering/RenderMedia.h.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlTimelineElement::defaultEventHandler): Changed to use MediaControls.
        * rendering/RenderMedia.cpp:
        (WebCore::RenderMedia::RenderMedia): Moved relevant constructor initializers out to MediaControls.
        (WebCore::RenderMedia::destroy): Changed to use MediaControls.
        (WebCore::RenderMedia::styleDidChange): Ditto.
        (WebCore::RenderMedia::layout): Ditto.
        (WebCore::RenderMedia::updateFromElement): Ditto.
        * rendering/RenderMedia.h: Updated defs accordingly and removed player() accessor, which
            is only used by sub-class RenderVideo.
        (WebCore::RenderMedia::controls): Added.
        * rendering/RenderVideo.cpp:
        (WebCore::RenderVideo::~RenderVideo): Changed to access MediaPlayer* directly from mediaElement().
        (WebCore::RenderVideo::calculateIntrinsicSize): Ditto.
        (WebCore::RenderVideo::paintReplaced): Ditto.
        (WebCore::RenderVideo::updatePlayer): Ditto.
        (WebCore::RenderVideo::supportsAcceleratedRendering): Ditto.
        (WebCore::RenderVideo::acceleratedRenderingStateChanged): Ditto.

2011-01-28  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: allow remote debugging with front-end
        served from the cloud.
        https://bugs.webkit.org/show_bug.cgi?id=53303

        * inspector/front-end/inspector.js:

2011-01-28  Aparna Nandyal  <aparna.nand@wipro.com>

        Reviewed by Andreas Kling.

        Setting value of m_PressedPos to make scrolling smooth

        Page scroll popup menu "Scroll here" option not working when cliking above scroll slider/handler.
        https://bugs.webkit.org/show_bug.cgi?id=51349

        The value of m_PressedPos was getting set before moveThumb() call
        in all other scenarios except when "Scroll Here" option is used.
        Hence scrolling with this option was not as expected even in cases
        where scrolling was happening. The thumb would move in unexpected
        direction. m_PressedPos is now set to pressed position so delta is
        calculated.
        Unable to write a test case as the test needs to click on "Scroll
        Here" option of context sensitive menu and QTest is unable to do it.
        Besides no new functionality introduced.

        * platform/qt/ScrollbarQt.cpp:
        (WebCore::Scrollbar::contextMenu):

2011-01-28  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Extensions API] add JSON schema for extensions API
        https://bugs.webkit.org/show_bug.cgi?id=53236

        * inspector/front-end/ExtensionAPISchema.json: Added.

2011-01-27  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Remove _LENGTH enumerants
        https://bugs.webkit.org/show_bug.cgi?id=53259

        * html/canvas/WebGLRenderingContext.cpp: Remove queries for *LENGTH.
        (WebCore::WebGLRenderingContext::getProgramParameter):
        (WebCore::WebGLRenderingContext::getShaderParameter):
        * html/canvas/WebGLRenderingContext.idl: Remove *LENGTH.

2011-01-28  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: syntax highlight inline JS and CSS in HTML resources
        https://bugs.webkit.org/show_bug.cgi?id=30831

        * inspector/front-end/SourceHTMLTokenizer.js:
        (WebInspector.SourceHTMLTokenizer):
        (WebInspector.SourceHTMLTokenizer.prototype.set line):
        (WebInspector.SourceHTMLTokenizer.prototype.nextToken):
        * inspector/front-end/SourceHTMLTokenizer.re2js:

2011-01-28  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [STYLES] Up/Down-suggestion breaks an existing keyword
        https://bugs.webkit.org/show_bug.cgi?id=53295

        Select the current word suffix before switching to the next suggestion.

        * inspector/front-end/StylesSidebarPane.js:
        ():

2011-01-28  Alejandro G. Castro  <alex@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Fix dist compilation for the release
        https://bugs.webkit.org/show_bug.cgi?id=53290

        * GNUmakefile.am: Added inspector files to the extra dist.

2011-01-28  Ilya Sherman  <isherman@chromium.org>

        Reviewed by Andreas Kling.

        Const-correct HTMLSelectElement and WebSelectElement
        https://bugs.webkit.org/show_bug.cgi?id=53293

        * html/HTMLSelectElement.cpp:
        (WebCore::HTMLSelectElement::value): const.
        * html/HTMLSelectElement.h:

2011-01-28  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76893.
        http://trac.webkit.org/changeset/76893
        https://bugs.webkit.org/show_bug.cgi?id=53287

        It made some tests crash on GTK and Qt debug bots (Requested
        by Ossy on #webkit).

        * bridge/runtime_root.cpp:
        (JSC::Bindings::RootObject::invalidate):
        (JSC::Bindings::RootObject::addRuntimeObject):
        (JSC::Bindings::RootObject::removeRuntimeObject):
        * bridge/runtime_root.h:

2011-01-27  Greg Coletta  <greg.coletta@nokia.com>

        Reviewed by Laszlo Gombos.

        Get rid of prefix header dependency for WebKit2 build system
        https://bugs.webkit.org/show_bug.cgi?id=50174

        Guard EmptyProtocalDefinitions.h to make sure it's not included twice.

        * platform/mac/EmptyProtocolDefinitions.h:

2011-01-27  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Dan Bernstein.

        Recalc table sections if needed before calculating the first line
        box baseline.
        https://bugs.webkit.org/show_bug.cgi?id=53265

        When we try to calculate the baseline position of a table cell,
        we recurse through all the child sibling boxes (when children are
        non inline) and add their first linebox baseline values. If one of
        the children is a table with pending section recalc, we will access
        wrong table section values. We recalc table sections if it is needed.

        Test: fast/table/recalc-section-first-body-crash-main.html

        * rendering/RenderTable.cpp:
        (WebCore::RenderTable::firstLineBoxBaseline):

2011-01-27  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        [chromium] Add CRASH calls to further debug tiled compositor memcpy crash.
        https://bugs.webkit.org/show_bug.cgi?id=52379

        Test: LayoutTests/compositing (to verify these weren't triggered)

        * platform/graphics/chromium/LayerTilerChromium.cpp:
        (WebCore::LayerTilerChromium::invalidateRect):
        (WebCore::LayerTilerChromium::update):

2011-01-27  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [STYLES] Cancelled suggestion of a property name results in a visual artifact
        https://bugs.webkit.org/show_bug.cgi?id=53242

        * inspector/front-end/StylesSidebarPane.js:
        (WebInspector.StylePropertyTreeElement.prototype):

2011-01-27  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76891.
        http://trac.webkit.org/changeset/76891
        https://bugs.webkit.org/show_bug.cgi?id=53280

        Makes every layout test crash (Requested by othermaciej on
        #webkit).

        * page/EventHandler.cpp:
        * page/EventHandler.h:
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::styleDidChange):

2011-01-27  Ryosuke Niwa  <rniwa@webkit.org>

        Unreviewed, rolling out r76839.
        http://trac.webkit.org/changeset/76839
        https://bugs.webkit.org/show_bug.cgi?id=49744

        broke pixel tests

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::localCaretRect):

2011-01-27  Emil A Eklund  <eae@chromium.org>

        Reviewed by Darin Adler.

        contentEditable formatBlock crashes on divs with contenteditable="false"
        https://bugs.webkit.org/show_bug.cgi?id=53263

        Check if editableRootForPosition returns null for position.

        Test: editing/execCommand/format-block-contenteditable-false.html

        * editing/FormatBlockCommand.cpp:
        (WebCore::FormatBlockCommand::formatRange):

2011-01-27  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Darin Adler.

        Remove RenderMedia members that aren't used.
        https://bugs.webkit.org/show_bug.cgi?id=53245

        Refactoring, no change in behavior, so no new tests.

        * rendering/RenderMedia.h: Removed unused member variables.

2011-01-27  Michael Saboff  <msaboff@apple.com>

        Reviewed by Darin Adler.

        Potentially Unsafe HashSet of RuntimeObject* in RootObject definition
        https://bugs.webkit.org/show_bug.cgi?id=53271

        Precautionary change.
        Changed RootObject to use WeakGCMap instead of HashSet.
        Found will looking for another issue, but can't produce a test case
        that is problematic.  THerefore there aren't any new tests.

        * bridge/runtime_root.cpp:
        (JSC::Bindings::RootObject::invalidate):
        (JSC::Bindings::RootObject::addRuntimeObject):
        (JSC::Bindings::RootObject::removeRuntimeObject):
        * bridge/runtime_root.h:

2011-01-27  Kenneth Russell  <kbr@google.com>

        Reviewed by James Robinson.

        Rename Typed Array slice() to subset()
        https://bugs.webkit.org/show_bug.cgi?id=53273

        * bindings/js/JSArrayBufferViewHelper.h:
        (WebCore::constructArrayBufferView):
        * bindings/v8/custom/V8ArrayBufferViewCustom.h:
        (WebCore::constructWebGLArray):
        * html/canvas/Float32Array.cpp:
        (WebCore::Float32Array::subset):
        * html/canvas/Float32Array.h:
        * html/canvas/Float32Array.idl:
        * html/canvas/Int16Array.cpp:
        (WebCore::Int16Array::subset):
        * html/canvas/Int16Array.h:
        * html/canvas/Int16Array.idl:
        * html/canvas/Int32Array.cpp:
        (WebCore::Int32Array::subset):
        * html/canvas/Int32Array.h:
        * html/canvas/Int32Array.idl:
        * html/canvas/Int8Array.cpp:
        (WebCore::Int8Array::subset):
        * html/canvas/Int8Array.h:
        * html/canvas/Int8Array.idl:
        * html/canvas/TypedArrayBase.h:
        (WebCore::TypedArrayBase::subsetImpl):
        * html/canvas/Uint16Array.cpp:
        (WebCore::Uint16Array::subset):
        * html/canvas/Uint16Array.h:
        * html/canvas/Uint16Array.idl:
        * html/canvas/Uint32Array.cpp:
        (WebCore::Uint32Array::subset):
        * html/canvas/Uint32Array.h:
        * html/canvas/Uint32Array.idl:
        * html/canvas/Uint8Array.cpp:
        (WebCore::Uint8Array::subset):
        * html/canvas/Uint8Array.h:
        * html/canvas/Uint8Array.idl:

2011-01-27  Darin Adler  <darin@apple.com>

        Reviewed by Dan Bernstein.

        Changing cursor style has no effect until the mouse moves
        https://bugs.webkit.org/show_bug.cgi?id=14344
        rdar://problem/7563712

        No tests added because we don't have infrastructure for testing actual cursor
        changes (as opposed to cursor style computation) at this time. We might add it later.

        * page/EventHandler.cpp:
        (WebCore::EventHandler::dispatchFakeMouseMoveEventSoon): Added.
        * page/EventHandler.h: Ditto.

        * rendering/RenderObject.cpp:
        (WebCore::areNonIdenticalCursorListsEqual): Added.
        (WebCore::areCursorsEqual): Added.
        (WebCore::RenderObject::styleDidChange): Call dispatchFakeMouseMoveEventSoon if
        cursor styles changed.

2011-01-27  Leo Yang  <leo.yang@torchmobile.com.cn>

        Reviewed by Dirk Schulze.

        SVG Use Cycle is not detected
        https://bugs.webkit.org/show_bug.cgi?id=52544

        We should check if SVGUseElement::buildInstanceTree finds problem
        for every child node. If it finds problem for any children we must
        return immediately because otherwise the foundProblem variable may
        be rewritten to false.

        Test: svg/custom/recursive-use2.svg

        * svg/SVGUseElement.cpp:
        (WebCore::SVGUseElement::buildInstanceTree):

2011-01-27  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        texSubImage2D's format/type needs to match the internalformat/type from the previous texImage2D call
        https://bugs.webkit.org/show_bug.cgi?id=53054

        Test: fast/canvas/webgl/tex-sub-image-2d-bad-args.html

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::texSubImage2DBase): Check format/type match.

2011-01-27  Yi Shen  <yi.4.shen@nokia.com>, Tor Arne Vestbø <tor.arne.vestbo@nokia.com>

        Reviewed by Andreas Kling.

        [Qt] Add fullscreen media control button for html video
        https://bugs.webkit.org/show_bug.cgi?id=51543

        Implement media control fullscreen button for QtWebKit html5 video.

        * css/mediaControlsQt.css:
        (video::-webkit-media-controls-fullscreen-button):
        * platform/qt/RenderThemeQt.cpp:
        (WebCore::RenderThemeQt::paintMediaFullscreenButton):

2011-01-27  Nate Chapin  <japhet@chromium.org>

        Reviewed by Adam Barth.

        Remove FrameLoader::url() and update callers to use
        Document::url().
        https://bugs.webkit.org/show_bug.cgi?id=41165

        Refactor, no new tests.

        * WebCore.exp.in:
        * dom/Document.cpp:
        (WebCore::Document::processHttpEquiv):
        (WebCore::Document::removePendingSheet):
        * history/CachedFrame.cpp:
        (WebCore::CachedFrameBase::CachedFrameBase):
        * history/PageCache.cpp:
        (WebCore::logCanCacheFrameDecision):
        (WebCore::PageCache::canCachePageContainingThisFrame):
        * html/HTMLFrameElementBase.cpp:
        (WebCore::HTMLFrameElementBase::isURLAllowed):
        * html/HTMLPlugInImageElement.cpp:
        (WebCore::HTMLPlugInImageElement::allowedToLoadFrameURL):
        * inspector/InspectorAgent.cpp:
        (WebCore::InspectorAgent::inspectedURL):
        * inspector/InspectorResourceAgent.cpp:
        (WebCore::buildObjectForFrame):
        * loader/DocumentWriter.cpp:
        (WebCore::DocumentWriter::replaceDocument):
        (WebCore::DocumentWriter::deprecatedFrameEncoding):
        * loader/FrameLoader.cpp:
        * loader/FrameLoader.h:
        * loader/HistoryController.cpp:
        (WebCore::HistoryController::updateForStandardLoad):
        (WebCore::HistoryController::updateForRedirectWithLockedBackForwardList):
        (WebCore::HistoryController::updateForSameDocumentNavigation):
        * loader/NavigationScheduler.cpp:
        (WebCore::ScheduledHistoryNavigation::fire):
        (WebCore::NavigationScheduler::scheduleLocationChange):
        (WebCore::NavigationScheduler::scheduleRefresh):
        * page/FrameView.cpp:
        (WebCore::FrameView::updateControlTints):
        * page/Location.cpp:
        (WebCore::Location::url):
        (WebCore::Location::setProtocol):
        (WebCore::Location::setHost):
        (WebCore::Location::setHostname):
        (WebCore::Location::setPort):
        (WebCore::Location::setPathname):
        (WebCore::Location::setSearch):
        (WebCore::Location::setHash):
        (WebCore::Location::reload):
        * page/Page.cpp:
        (WebCore::Page::goToItem):

2011-01-27  Stephen White  <senorblanco@chromium.org>

        Reviewed by Darin Adler.

        Fix performance regression in ImageQualityController::objectDestroyed().
        https://bugs.webkit.org/show_bug.cgi?id=52645

        In r72282, I inadvertently introduced this regression by using a
        linear search through the hash map on object destruction.  This was
        because the hash key consisted of both object pointer and layer id,
        but on object destruction we only know the object pointer, requiring
        a search to find all the layers. 
        By replacing the hash map with two nested hash maps, where the outer key
        is the object and the inner key is the layer, we can find all the
        relevant data for an object in one hash lookup.

        * rendering/RenderBoxModelObject.cpp:
        Replace the (object,layer)->size HashMap with object->layer and
        layer->size HashMaps.
        (WebCore::ImageQualityController::isEmpty):
        Implement isEmpty() for the outer HashMap.
        (WebCore::ImageQualityController::removeLayer):
        When a layer is removed, remove it from the inner hash map.
        (WebCore::ImageQualityController::set):
        Implement set():  if the inner map exists, set the layer->size tuple
        directly.  If not, create a new inner map, set the tuple, and insert
        it in the outer map.
        (WebCore::ImageQualityController::objectDestroyed):
        Look up the object in the outer map only.
        (WebCore::ImageQualityController::highQualityRepaintTimerFired):
        Cosmetic changes for the renamed now-outer hash map.
        (WebCore::ImageQualityController::shouldPaintAtLowQuality):
        Do both outer and inner hash map lookups.  Call set() to add/update
        entries to the hash maps.  keyDestroyed() is now removeLayer().
        (WebCore::imageQualityController):
        Make the ImageQualityController a file-static global, so it can be
        created and destroyed on the fly.
        (WebCore::RenderBoxModelObject::~RenderBoxModelObject):
        If there is no ImageQualityController, don't call objectDestroyed().
        If it's empty, delete it.
        * rendering/RenderImage.cpp:
        (WebCore::RenderImage::paintIntoRect):
        Also pass the Image* as the (void*) layer, since 0 is not a valid
        HashMap key.

2011-01-27  Adrienne Walker  <enne@google.com>

        Reviewed by James Robinson.

        [chromium] Tiled compositor crashes if compositing turned off mid-paint
        https://bugs.webkit.org/show_bug.cgi?id=53198

        * platform/graphics/chromium/LayerRendererChromium.cpp:
        (WebCore::LayerRendererChromium::drawLayers):
        * platform/graphics/chromium/LayerTilerChromium.cpp:
        (WebCore::LayerTilerChromium::update):
        (WebCore::LayerTilerChromium::draw):

2011-01-27  Carol Szabo <carol.szabo@nokia.com>

        Reviewed by David Hyatt.

        A corrupted counter tree is created when renderers are added to the
        tree bypassing RenderObject::addChild
        https://bugs.webkit.org/show_bug.cgi?id=51270

        No new tests. This patch reimplements the fix for bugs 43812 and
        51637 and hence all tests are already there as part of the original
        fixes for those bugs.

        * rendering/RenderCounter.cpp:
        (WebCore::findPlaceForCounter):
        Removed old workaround as this patch hopefully fixes the real
        problem.
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::addChild):
        Removed call to counter updater as it was moved to a lower level.
        (WebCore::RenderObject::destroy):
        Moved attached counter nodes destruction to after the node is
        removed from the tree.
        * rendering/RenderObjectChildList.cpp:
        (WebCore::RenderObjectChildList::removeChildNode):
        (WebCore::RenderObjectChildList::appendChildNode):
        (WebCore::RenderObjectChildList::insertChildNode):
        Added notifications to the Counter system such that the
        CounterForest reflects the changes to the RendererTree.
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::destroy):
        Applied the same changes as for RenderObject::destroy()
        since RenderObject::destroy() is not called from here.

2011-01-27  Adam Roben  <aroben@apple.com>

        Add WKCACFViewLayerTreeHost

        This is a class that derives from CACFLayerTreeHost and uses a WKCACFView to render.

        Fixes <http://webkit.org/b/53251> <rdar://problem/8925496> CACFLayerTreeHost should use
        WKCACFView for rendering

        * WebCore.vcproj/WebCore.vcproj: Added WKCACFViewLayerTreeHost.{cpp,h}.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp:
        (WebCore::CACFLayerTreeHost::acceleratedCompositingAvailable): Make the test window have a
        non-zero size. WKCACFView will always say it can't render if you pass it a 0-sized window,
        so we need a non-empty window to perform a valid test.
        (WebCore::CACFLayerTreeHost::create): First try to create a WKCACFViewLayerTreeHost, then
        fall back to a LegacyCACFLayerTreeHost.
        (WebCore::CACFLayerTreeHost::flushPendingLayerChangesNow): Moved code to react to the
        context flush from here...
        (WebCore::CACFLayerTreeHost::contextDidChange): ...to here. Derived classes are required to
        call this function whenever changes are flushed to the context.

        * platform/graphics/ca/win/CACFLayerTreeHost.h: Added contextDidChange.

        * platform/graphics/ca/win/LegacyCACFLayerTreeHost.cpp:
        (WebCore::LegacyCACFLayerTreeHost::createRenderer):
        (WebCore::LegacyCACFLayerTreeHost::resize):
        Changed to use flushContext instead of flushing the context manually so that we will always
        notify the base class when the context gets flushed.

        (WebCore::LegacyCACFLayerTreeHost::flushContext): Added a call to contextDidChange so the
        base class will know what happened. Moved code to schedule a render from here...
        (WebCore::LegacyCACFLayerTreeHost::contextDidChange): ...to here.

        * platform/graphics/ca/win/LegacyCACFLayerTreeHost.h: Added contextDidChange.

        * platform/graphics/ca/win/WKCACFViewLayerTreeHost.cpp: Added.
        (WebCore::WKCACFViewLayerTreeHost::create): If WebKitQuartzCoreAdditions, which provides
        WKCACFView, isn't present, bail. Otherwise allocate and return a new host.
        (WebCore::WKCACFViewLayerTreeHost::WKCACFViewLayerTreeHost): Initialize members.
        (WebCore::WKCACFViewLayerTreeHost::updateViewIfNeeded): Update the view if we previously
        marked that we needed to do so, and flush the context if our layer's bounds have changed.
        (WebCore::WKCACFViewLayerTreeHost::contextDidChangeCallback): Call through to
        contextDidChange.
        (WebCore::WKCACFViewLayerTreeHost::contextDidChange): Tell the WKCACFView to start rendering
        (if we didn't already), then call up to the base class.
        (WebCore::WKCACFViewLayerTreeHost::initializeContext): Set the context's user data, the
        view's layer, and hook up our "context did change" callback.
        (WebCore::WKCACFViewLayerTreeHost::resize): Mark that the view needs to be updated the next
        time we paint.
        (WebCore::WKCACFViewLayerTreeHost::createRenderer): Update our view and return whether it is
        able to render or not.
        (WebCore::WKCACFViewLayerTreeHost::destroyRenderer): Clear out all the info we passed down
        to the view.
        (WebCore::WKCACFViewLayerTreeHost::lastCommitTime): Call through to the view.
        (WebCore::WKCACFViewLayerTreeHost::flushContext): Ditto.
        (WebCore::WKCACFViewLayerTreeHost::paint): Update the view so it will draw at the right
        size, then call up to the base class.
        (WebCore::WKCACFViewLayerTreeHost::render): Invalidate the view using the passed-in dirty
        rects, then ask it to draw.

        * platform/graphics/ca/win/WKCACFViewLayerTreeHost.h: Copied from Source/WebCore/platform/graphics/ca/win/LegacyCACFLayerTreeHost.h.

2011-01-27  Adam Roben  <aroben@apple.com>

        Move LegacyCACFLayerTreeHost into its own files

        More preparation for <http://webkit.org/b/53251> <rdar://problem/8925496> CACFLayerTreeHost
        should use WKCACFView for rendering

        Reviewed by Simon Fraser.

        * WebCore.vcproj/WebCore.vcproj: Added LegacyCACFLayerTreeHost.{cpp,h}.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp: Moved code from here to new files.

        * platform/graphics/ca/win/LegacyCACFLayerTreeHost.cpp: Added.
        * platform/graphics/ca/win/LegacyCACFLayerTreeHost.h: Added.

2011-01-27  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r76824.

        * platform/wince/DragDataWinCE.cpp:
        (WebCore::DragData::dragDataMap):

2011-01-27  Adam Roben  <aroben@apple.com>

        Split CACFLayerTreeHost into base and derived classes

        The derived class, LegacyCACFLayerTreeHost, contains all the D3D-related code. A later patch
        will add a new derived class that replaces the D3D code with a different rendering API.

        For now, LegacyCACFLayerTreeHost lives in CACFLayerTreeHost.cpp. This keeps the diff a
        little smaller. A later patch will move it to its own source files.

        Preparation for <http://webkit.org/b/53251> <rdar://problem/8925496> CACFLayerTreeHost
        should use WKCACFView for rendering

        Reviewed by Simon Fraser.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp:
        (WebCore::CACFLayerTreeHost::acceleratedCompositingAvailable): Clear the window before
        destroying the host, as that is now the API contract that clients must fulfill.
        (WebCore::LegacyCACFLayerTreeHost::create): Added. Simple creator.
        (WebCore::CACFLayerTreeHost::create): Now instantiates a LegacyCACFLayerTreeHost. Calls the
        new initialize function to perform initialization that has to happen after the vtable has
        been set up.

        (WebCore::LegacyCACFLayerTreeHost::LegacyCACFLayerTreeHost):
        (WebCore::CACFLayerTreeHost::CACFLayerTreeHost):
        (WebCore::LegacyCACFLayerTreeHost::initializeContext):
        (WebCore::CACFLayerTreeHost::initialize):
        Moved some initialization code from the CACFLayerTreeHost constructor into these new
        functions.

        (WebCore::LegacyCACFLayerTreeHost::~LegacyCACFLayerTreeHost): Added. Moved code here from
        ~CACFLayerTreeHost.
        (WebCore::CACFLayerTreeHost::~CACFLayerTreeHost): Rather than clearing the window at this
        point (which would be too late, since we won't be able to call into the derived class's
        virtual functions), just assert that it has already been cleared (or was never set in the
        first place).
        (WebCore::LegacyCACFLayerTreeHost::createRenderer): Renamed from
        CACFLayerTreeHost::createRenderer, and changed to use getters instead of accessing
        CACFLayerTreeHost's data members directly.

        (WebCore::LegacyCACFLayerTreeHost::destroyRenderer):
        (WebCore::CACFLayerTreeHost::destroyRenderer):
        Moved some code to the new LegacyCACFLayerTreeHost function.

        (WebCore::LegacyCACFLayerTreeHost::resize):
        (WebCore::LegacyCACFLayerTreeHost::renderTimerFired):
        Moved these functions to LegacyCACFLayerTreeHost.

        (WebCore::LegacyCACFLayerTreeHost::paint):
        (WebCore::CACFLayerTreeHost::paint):
        Moved some code to the new LegacyCACFLayerTreeHost function.

        (WebCore::LegacyCACFLayerTreeHost::render):
        (WebCore::LegacyCACFLayerTreeHost::renderSoon):
        Moved these functions to LegacyCACFLayerTreeHost.

        (WebCore::CACFLayerTreeHost::flushPendingLayerChangesNow): Moved code to flush the context
        from here...
        (WebCore::LegacyCACFLayerTreeHost::flushContext): ...to this new function.

        (WebCore::LegacyCACFLayerTreeHost::lastCommitTime): Moved code to get the last commit time
        to this new function...
        (WebCore::CACFLayerTreeHost::notifyAnimationsStarted): ...from here.

        (WebCore::LegacyCACFLayerTreeHost::initD3DGeometry):
        (WebCore::LegacyCACFLayerTreeHost::resetDevice):
        Moved these functions to LegacyCACFLayerTreeHost.

        * platform/graphics/ca/win/CACFLayerTreeHost.h: Made some functions virtual, removed some
        members that have moved to LegacyCACFLayerTreeHost, grouped remaining members more
        logically, and added some getters used by LegacyCACFLayerTreeHost.

2011-01-27  Adam Roben  <aroben@apple.com>

        Move CACFLayerTreeHostClient to its own header file

        Rubber-stamped by Steve Falkenburg.

        * WebCore.vcproj/WebCore.vcproj: Added CACFLayerTreeHostClient.h. Also let VS have its way
        with the file.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp: Added new #include.

        * platform/graphics/ca/win/CACFLayerTreeHost.h: Removed CACFLayerTreeHostClient.

        * platform/graphics/ca/win/CACFLayerTreeHostClient.h: Added.

        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp: Moved some #includes here
        from the header file.

        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h: Replaced broader #includes
        with more specific ones, plus a forward-declaration.

2011-01-27  James Simonsen  <simonjam@chromium.org>

        Reviewed by Tony Chang.

        [Chromium] Simplify small caps logic in complex text on linux
        https://bugs.webkit.org/show_bug.cgi?id=53207

        Test: fast/text/atsui-multiple-renderers.html
              fast/text/atsui-small-caps-punctuation-size.html

        * platform/graphics/chromium/ComplexTextControllerLinux.cpp:
        (WebCore::ComplexTextController::nextScriptRun): Remove redundant logic. Case changes in a text run imply FontData changes.
        (WebCore::ComplexTextController::setupFontForScriptRun): Update comment to reflect above.

2011-01-27  Adam Barth  <abarth@webkit.org>

        In which I attempt to fix the EFL build.

        * CMakeLists.txt:

2011-01-25  Levi Weintraub  <leviw@chromium.org>

        Reviewed by Darin Adler.

        Adding border and padding to the calculation of the local caret rect for RenderBoxes.
        Corrected for mistake in r76625

        Undo moves caret to invalid position
        https://bugs.webkit.org/show_bug.cgi?id=49744

        Tests: editing/selection/caret-painting-after-paste-undo-rtl.html
               editing/selection/caret-painting-after-paste-undo.html

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::localCaretRect):

2011-01-27  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76825.
        http://trac.webkit.org/changeset/76825
        https://bugs.webkit.org/show_bug.cgi?id=53256

        "caused crashes on GTK and chromium" (Requested by rniwa on
        #webkit).

        * rendering/RenderBoxModelObject.cpp:
        (WebCore::ImageQualityController::keyDestroyed):
        (WebCore::ImageQualityController::objectDestroyed):
        (WebCore::ImageQualityController::highQualityRepaintTimerFired):
        (WebCore::ImageQualityController::shouldPaintAtLowQuality):
        (WebCore::imageQualityController):
        (WebCore::RenderBoxModelObject::~RenderBoxModelObject):

2011-01-27  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        Generalize the mechanism view-source uses to remember the source for an HTMLToken
        https://bugs.webkit.org/show_bug.cgi?id=53200

        Currently view-source tracks the source associated with each HTMLToken.
        We want to re-use this mechanism for the new XSS auditor.  This patch
        moves this code into its own class so it can be shared between the
        view-source parser and the general HTML parser.  This patch also add
        support for tracking the source of tokens that span document.write
        boundaries.

        No functional change.  This code change is somewhat tested by our
        view-source layout tests.

        * Android.mk:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
            - Fun with updating build files.
        * html/parser/HTMLDocumentParser.cpp:
        (WebCore::HTMLDocumentParser::pumpTokenizer):
            - Teach HTMLDocumentParser to track the source for HTMLTokens.
              Currently, this information isn't used, but it will be shortly.
              I ran the HTML parser benchmark and this change didn't have a
              measurable effect.
        * html/parser/HTMLDocumentParser.h:
            - Composite in the HTMLSourceTracker.
        * html/parser/HTMLSourceTracker.cpp: Added.
        (WebCore::HTMLSourceTracker::HTMLSourceTracker):
        (WebCore::HTMLSourceTracker::start):
        (WebCore::HTMLSourceTracker::end):
            - This function should eventualy be folded into HTMLTokenizer.
        (WebCore::HTMLSourceTracker::sourceForToken):
        * html/parser/HTMLSourceTracker.h: Added.
        * html/parser/HTMLToken.h:
            - Now HTMLTokens always have a start index of zero.  To do the job
              of the old start index, this patch introduces the notion of a
              baseOffset.  Unlike the start index (which was used as the base
              offset for all the other indicies), the baseOffset can change
              over the lifetime of the token.  We need the flexibility to
              change the offset for tokens that span document.write boundaries.
              Values are now normalized to zero-offset when stored.
        (WebCore::HTMLToken::clear):
        (WebCore::HTMLToken::setBaseOffset):
        (WebCore::HTMLToken::end):
        (WebCore::HTMLToken::beginAttributeName):
        (WebCore::HTMLToken::endAttributeName):
        (WebCore::HTMLToken::beginAttributeValue):
        (WebCore::HTMLToken::endAttributeValue):
        * html/parser/HTMLViewSourceParser.cpp:
            - Updates the HTMLViewSourceParser to use the new
              HTMLSourceTracker.
        (WebCore::HTMLViewSourceParser::pumpTokenizer):
        (WebCore::HTMLViewSourceParser::append):
        (WebCore::HTMLViewSourceParser::sourceForToken):
            - This function now just calls through to HTMLSourceTracker.
        * html/parser/HTMLViewSourceParser.h:
        * platform/text/SegmentedString.cpp:
        (WebCore::SegmentedString::currentColumn):
        (WebCore::SegmentedString::setCurrentPosition):
        * platform/text/SegmentedString.h:
        (WebCore::SegmentedString::numberOfCharactersConsumed):
            - We need to handle the general case now.  The "slow" version
              doesn't turn out to be any slower in practice anyway.

2011-01-27  Sam Weinig  <sam@webkit.org>

        Fix all the builds.

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::paintOverhangAreas): Add parameters.

2011-01-27  Sam Weinig  <sam@webkit.org>

        Reviewed by Dave Hyatt.

        Add ability to do an unconstrained scroll on a ScrollView
        https://bugs.webkit.org/show_bug.cgi?id=53249

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::ScrollView):
        Initialize m_constrainsScrollingToContentEdge to true.

        (WebCore::ScrollView::setScrollOffset):
        Only constrain the offset if the m_constrainsScrollingToContentEdge is set.

        (WebCore::ScrollView::updateScrollbars):
        Simplify expression converting an IntSize to an IntPoint.
        
        (WebCore::ScrollView::paint):
        Paint the overhang if there is any.
        
        (WebCore::ScrollView::calculateOverhangAreasForPainting):
        Calculate the overhang in viewport coordinates for painting.

        * platform/ScrollView.h:
        (WebCore::ScrollView::constrainsScrollingToContentEdge):
        (WebCore::ScrollView::setConstrainsScrollingToContentEdge):
        Add bit to control whether the scroll position should be constrained
        to the content edge when set.

        * platform/ScrollbarThemeComposite.cpp:
        (WebCore::usedTotalSize):
        (WebCore::ScrollbarThemeComposite::thumbPosition):
        (WebCore::ScrollbarThemeComposite::thumbLength):
        * platform/mac/ScrollbarThemeMac.mm:
        (WebCore::ScrollbarThemeMac::paint):
        Improve calculations of thumb size and position to take overhang into account.

2011-01-27  Dirk Schulze  <krit@webkit.org>

        Reviewed by Nikolas Zimmermann.

        SVG animation of Paths with segments of different coordinate modes on begin and end
        https://bugs.webkit.org/show_bug.cgi?id=52984

        At the moment we just support SVG path animations, if the number of segments on the given start path
        is the same as the number of segments on the given end path. But a segment on a given position must be identical
        on both paths as well. Not only the segment type, also the coordinate mode of the segments must be identical.
        If MoveToRel is on the second position on the start path a MoveToRel must be on the second position
        of the end path too. According to the SVG spec, at least the coordinate mode can differ. Means, if we have MoveToRel
        in the start path, we can use MoveToAbs on the same position in the end path.

        This patch fixes the blending code to follow the spec here. It was necessary to track the current position of
        both paths, transform coordinates to the same coordinate mode and transform the resulting animation coordinate back
        to the coordinate mode of either the start or the end path. Which mode is taken depends on the progress of the
        animation.

        Tests: svg/animations/animate-path-animation-Cc-Ss.html
               svg/animations/animate-path-animation-Ll-Vv-Hh.html
               svg/animations/animate-path-animation-Qq-Tt.html
               svg/animations/animate-path-animation-cC-sS-inverse.html
               svg/animations/animate-path-animation-lL-vV-hH-inverse.html
               svg/animations/animate-path-animation-qQ-tT-inverse.html

        * svg/SVGPathBlender.cpp:
        (WebCore::blendFloatPoint):
        (WebCore::blendAnimatedFloat):
        (WebCore::SVGPathBlender::blendAnimatedDimensionalFloat):
        (WebCore::SVGPathBlender::blendAnimatedFloatPoint):
        (WebCore::SVGPathBlender::blendMoveToSegment):
        (WebCore::SVGPathBlender::blendLineToSegment):
        (WebCore::SVGPathBlender::blendLineToHorizontalSegment):
        (WebCore::SVGPathBlender::blendLineToVerticalSegment):
        (WebCore::SVGPathBlender::blendCurveToCubicSegment):
        (WebCore::SVGPathBlender::blendCurveToCubicSmoothSegment):
        (WebCore::SVGPathBlender::blendCurveToQuadraticSegment):
        (WebCore::SVGPathBlender::blendCurveToQuadraticSmoothSegment):
        (WebCore::SVGPathBlender::blendArcToSegment):
        (WebCore::coordinateModeOfCommand):
        (WebCore::isSegmentEqual):
        (WebCore::SVGPathBlender::blendAnimatedPath):
        (WebCore::SVGPathBlender::cleanup):
        * svg/SVGPathBlender.h:

2011-01-27  Cris Neckar  <cdn@chromium.org>

        Reviewed by Dimitri Glazkov.

        Clear the parent on a css keyframe's m_style when removing it from the stylesheet.
        https://bugs.webkit.org/show_bug.cgi?id=52320

        Test: fast/css/css-keyframe-style-crash.html

        * css/CSSRuleList.cpp:
        (WebCore::CSSRuleList::deleteRule):
        * css/WebKitCSSKeyframesRule.cpp:
        (WebCore::WebKitCSSKeyframesRule::~WebKitCSSKeyframesRule):

2011-01-27  Rob Buis  <rwlbuis@gmail.com>

        Reviewed by Kent Tamura.

        Color changes to option elements in a select multiple aren't drawn immediately
        https://bugs.webkit.org/show_bug.cgi?id=49790

        Redirect style changes on <option> element to the owner <select> element.

        Test: fast/repaint/select-option-background-color.html

        * html/HTMLOptionElement.cpp:
        (WebCore::HTMLOptionElement::setRenderStyle):

2011-01-19  Stephen White  <senorblanco@chromium.org>

        Reviewed by Darin Adler.

        Fix performance regression in ImageQualityController::objectDestroyed().
        https://bugs.webkit.org/show_bug.cgi?id=52645

        In r72282, I inadvertently introduced this regression by using a
        linear search through the hash map on object destruction.  This was
        because the hash key consisted of both object pointer and layer id,
        but on object destruction we only know the object pointer, requiring
        a search to find all the layers. 
        By replacing the hash map with two nested hash maps, where the outer key
        is the object and the inner key is the layer, we can find all the
        relevant data for an object in one hash lookup.

        * rendering/RenderBoxModelObject.cpp:
        Replace the (object,layer)->size HashMap with object->layer and
        layer->size HashMaps.
        (WebCore::ImageQualityController::isEmpty):
        Implement isEmpty() for the outer HashMap.
        (WebCore::ImageQualityController::removeLayer):
        When a layer is removed, remove it from the inner hash map.
        (WebCore::ImageQualityController::set):
        Implement set():  if the inner map exists, set the layer->size tuple
        directly.  If not, create a new inner map, set the tuple, and insert
        it in the outer map.
        (WebCore::ImageQualityController::objectDestroyed):
        Look up the object in the outer map only.
        (WebCore::ImageQualityController::highQualityRepaintTimerFired):
        Cosmetic changes for the renamed now-outer hash map.
        (WebCore::ImageQualityController::shouldPaintAtLowQuality):
        Do both outer and inner hash map lookups.  Call set() to add/update
        entries to the hash maps.  keyDestroyed() is now removeLayer().
        (WebCore::imageQualityController):
        Make the ImageQualityController a file-static global, so it can be
        created and destroyed on the fly.
        (WebCore::RenderBoxModelObject::~RenderBoxModelObject):
        If there is no ImageQualityController, don't call objectDestroyed().
        If it's empty, delete it.


2011-01-26  Enrica Casucci  <enrica@apple.com>

        Reviewed by Darin Adler and Adam Roben.

        WebKit2: add support for drag and drop on Windows
        https://bugs.webkit.org/show_bug.cgi?id=52775
        <rdar://problem/8514409>
        
        On Windows the access to the content being dragged is
        provided via the IDataObject interface that is made available
        to the window that registers itself as drop target.
        Since this interface cannot be accessed from the WebProcess,
        in every call to one of the methods of the IDropTarget interface
        we serialize the content of the drag clipboard and send it over to
        the WebProcess.
        The bulk of this patch consists in the refactoring needed in DragData
        and ClipboardWin classes to extract the data from the serialized object.
        
        * platform/DragData.cpp:
        * platform/DragData.h:
        * platform/win/ClipboardUtilitiesWin.cpp:
        (WebCore::getWebLocData):
        (WebCore::getURL):
        (WebCore::getPlainText):
        (WebCore::getTextHTML):
        (WebCore::getCFHTML):
        (WebCore::fragmentFromFilenames):
        (WebCore::containsFilenames):
        (WebCore::fragmentFromHTML):
        (WebCore::containsHTML):
        (WebCore::getClipboardData):
        * platform/win/ClipboardUtilitiesWin.h:
        * platform/win/ClipboardWin.cpp:
        (WebCore::Clipboard::create):
        (WebCore::ClipboardWin::ClipboardWin):
        (WebCore::ClipboardWin::getData):
        (WebCore::ClipboardWin::types):
        (WebCore::ClipboardWin::files):
        (WebCore::ClipboardWin::hasData):
        * platform/win/ClipboardWin.h:
        (WebCore::ClipboardWin::create):
        * platform/win/DragDataWin.cpp:
        (WebCore::DragData::DragData):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::dragDataMap):
        (WebCore::DragData::asURL):
        (WebCore::DragData::containsFiles):
        (WebCore::DragData::asFilenames):
        (WebCore::DragData::containsPlainText):
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::canSmartReplace):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::asFragment):

2011-01-27  Mario Sanchez Prada  <msanchez@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Space characters in source document interfere with reported caret offset
        https://bugs.webkit.org/show_bug.cgi?id=53033

        Calculate caret offset from rendered text instead of from node contents.

        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
        (objectAndOffsetUnignored): Calculate the caret offset based only
        on positions and ranges, instead of using the computed offset in
        the container node.

2011-01-26  Alexey Proskuryakov  <ap@apple.com>

        Reviewed by Darin Adler.

        https://bugs.webkit.org/show_bug.cgi?id=53197
        <rdar://problem/8895682> Make WebKit2 printing asynchronous

        * WebCore.exp.in: Export more PrintContext methods that we didn't use on Mac before.

        * page/PrintContext.cpp: (WebCore::PrintContext::spoolRect): Changed to make the same
        transformation as spoolPages does for consistency.

2011-01-27  David Grogan  <dgrogan@google.com>

        Reviewed by Jeremy Orlow.

        initial support for close() in indexeddb backend
        https://bugs.webkit.org/show_bug.cgi?id=53150

        Test: storage/indexeddb/transaction-after-close.html

        * storage/IDBDatabase.cpp:
        (WebCore::IDBDatabase::IDBDatabase):
        (WebCore::IDBDatabase::transaction):
        (WebCore::IDBDatabase::close):
        * storage/IDBDatabase.h:
        * storage/IDBDatabase.idl:
        * storage/IDBDatabaseBackendImpl.cpp:
        (WebCore::IDBDatabaseBackendImpl::transaction):
        (WebCore::IDBDatabaseBackendImpl::close):

2011-01-27  Dirk Schulze  <krit@webkit.org>

        Reviewed by Nikolas Zimmermann.

        SVG animation doesn't support calcMode discrete for number and color values.
        https://bugs.webkit.org/show_bug.cgi?id=53189

        Add support for calcMode discrete on number and color animation.

        Tests: svg/animations/animate-color-calcMode-discrete.html
               svg/animations/animate-number-calcMode-discrete.html

        * svg/SVGAnimateElement.cpp:
        (WebCore::SVGAnimateElement::calculateAnimatedValue):

2011-01-26  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        shaderSource needs to preserve original source
        https://bugs.webkit.org/show_bug.cgi?id=52833

        Test: fast/canvas/webgl/gl-getshadersource.html

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::getShaderParameter): Intercept SHADER_SOURCE_LENGTH.
        (WebCore::WebGLRenderingContext::getShaderSource): Intercept the call.
        (WebCore::WebGLRenderingContext::shaderSource): Cache the source.
        * html/canvas/WebGLShader.cpp: Cache shader source.
        (WebCore::WebGLShader::WebGLShader):
        * html/canvas/WebGLShader.h: Ditto.
        (WebCore::WebGLShader::getSource):
        (WebCore::WebGLShader::setSource):

2011-01-27  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r76743.

        * platform/graphics/wince/FontWinCE.cpp:
        (WebCore::TextRunComponent::TextRunComponent):

2011-01-27  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: Closure and Global variable details automatically collapsing on each step through JavaScript code.
        https://bugs.webkit.org/show_bug.cgi?id=53234

        * inspector/front-end/ScopeChainSidebarPane.js:
        (WebInspector.ScopeChainSidebarPane):
        (WebInspector.ScopeChainSidebarPane.prototype.update):

2011-01-27  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76789.
        http://trac.webkit.org/changeset/76789
        https://bugs.webkit.org/show_bug.cgi?id=53238

        Broke GTK layout tests (Requested by podivilov on #webkit).

        * inspector/front-end/ScopeChainSidebarPane.js:
        (WebInspector.ScopeChainSidebarPane):
        (WebInspector.ScopeChainSidebarPane.prototype.update):

2011-01-27  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: store all settings related to the agents on the frontend side
        https://bugs.webkit.org/show_bug.cgi?id=53174

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.exp.in:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/ScriptDebugServer.cpp:
        * bindings/js/ScriptDebugServer.h:
        * bindings/js/ScriptProfiler.cpp:
        * bindings/js/ScriptProfiler.h:
        * bindings/v8/ScriptDebugServer.cpp:
        * bindings/v8/ScriptDebugServer.h:
        * bindings/v8/ScriptProfiler.cpp:
        * bindings/v8/ScriptProfiler.h:
        * inspector/Inspector.idl:
        * inspector/InspectorAgent.cpp: profiler and debugger enablement state is now stored
        on the front-end side and will be pushed to the backend when the frontend is loaded.
        (WebCore::InspectorAgent::InspectorAgent):
        (WebCore::InspectorAgent::disconnectFrontend):
        (WebCore::InspectorAgent::restoreDebugger):
        (WebCore::InspectorAgent::restoreProfiler):
        (WebCore::InspectorAgent::enableProfiler):
        (WebCore::InspectorAgent::disableProfiler):
        (WebCore::InspectorAgent::showAndEnableDebugger):
        (WebCore::InspectorAgent::enableDebugger):
        (WebCore::InspectorAgent::disableDebugger):
        * inspector/InspectorAgent.h:
        * inspector/InspectorConsoleAgent.cpp: XHR failures will be logged to the console only
        if the front-end was opened during current browser session and XHR logging is turned on
        there.
        (WebCore::InspectorConsoleAgent::setMonitoringXHREnabled):
        (WebCore::InspectorConsoleAgent::setConsoleMessagesEnabled):
        * inspector/InspectorDebuggerAgent.cpp:
        * inspector/InspectorDebuggerAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::identifierForInitialRequestImpl):
        (WebCore::InspectorInstrumentation::didLoadResourceFromMemoryCacheImpl):
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::InspectorProfilerAgent):
        (WebCore::InspectorProfilerAgent::startUserInitiatedProfiling):
        * inspector/InspectorSettings.cpp: Removed.
        * inspector/InspectorSettings.h: Removed.
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher.dispatcher.consoleMessagesCleared):
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher):
        (WebInspector.ConsoleView.prototype._handleContextMenuEvent.itemAction):
        (WebInspector.ConsoleView.prototype._handleContextMenuEvent):
        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel.prototype._toggleProfiling):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._toggleDebugging):
        * inspector/front-end/Settings.js:
        (WebInspector.Settings):
        * inspector/front-end/inspector.js:

2011-01-27  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: Closure and Global variable details automatically collapsing on each step through JavaScript code.
        https://bugs.webkit.org/show_bug.cgi?id=53234

        * inspector/front-end/ScopeChainSidebarPane.js:
        (WebInspector.ScopeChainSidebarPane):
        (WebInspector.ScopeChainSidebarPane.prototype.update):

2011-01-27  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Elements panel] Tooltip for relative links incorrectly identifies current URL
        https://bugs.webkit.org/show_bug.cgi?id=53171

        * inspector/front-end/inspector.js:
        (WebInspector.completeURL): Taught to understand partial href's that start with "?" (contain GET parameters only)

2011-01-27  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        [V8] Crash in WebCore::addMessageToConsole
        https://bugs.webkit.org/show_bug.cgi?id=53227

        * bindings/v8/V8Proxy.cpp: check that the Frame where the error
        occured still has a page before getting a console object from it.
        (WebCore::V8Proxy::reportUnsafeAccessTo):

2011-01-27  Hans Wennborg  <hans@chromium.org>

        Reviewed by Jeremy Orlow.

        IndexedDB: Remove IDBCallbacks::onSuccess() used for null values.
        https://bugs.webkit.org/show_bug.cgi?id=53178

        Remove the IDBCallbacks::onSuccess() function that was used for
        null values, and replace such calls with calls to
        IDBCallBacks::onSuccess(SerializedScriptValue::nullValue())
        instead.

        No new functionality, so no new tests.

        * storage/IDBCallbacks.h:
        * storage/IDBCursorBackendImpl.cpp:
        (WebCore::IDBCursorBackendImpl::updateInternal):
        (WebCore::IDBCursorBackendImpl::continueFunctionInternal):
        * storage/IDBIndexBackendImpl.cpp:
        (WebCore::IDBIndexBackendImpl::openCursorInternal):
        * storage/IDBObjectStoreBackendImpl.cpp:
        (WebCore::IDBObjectStoreBackendImpl::deleteInternal):
        (WebCore::IDBObjectStoreBackendImpl::openCursorInternal):
        * storage/IDBRequest.cpp:
        * storage/IDBRequest.h:

2011-01-27  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76773.
        http://trac.webkit.org/changeset/76773
        https://bugs.webkit.org/show_bug.cgi?id=53230

        breaks multiple GTK media tests (Requested by philn-tp on
        #webkit).

        * platform/graphics/gstreamer/MediaPlayerPrivateGStreamer.cpp:
        (WebCore::mimeTypeCache):

2011-01-27  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76770.
        http://trac.webkit.org/changeset/76770
        https://bugs.webkit.org/show_bug.cgi?id=53229

        Some inspector tests fail (Requested by yurys on #webkit).

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.exp.in:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::isDebuggerAlwaysEnabled):
        * bindings/js/ScriptDebugServer.h:
        * bindings/js/ScriptProfiler.cpp:
        (WebCore::ScriptProfiler::isProfilerAlwaysEnabled):
        * bindings/js/ScriptProfiler.h:
        * bindings/v8/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::isDebuggerAlwaysEnabled):
        * bindings/v8/ScriptDebugServer.h:
        * bindings/v8/ScriptProfiler.cpp:
        (WebCore::ScriptProfiler::isProfilerAlwaysEnabled):
        * bindings/v8/ScriptProfiler.h:
        * inspector/Inspector.idl:
        * inspector/InspectorAgent.cpp:
        (WebCore::InspectorAgent::InspectorAgent):
        (WebCore::InspectorAgent::disconnectFrontend):
        (WebCore::InspectorAgent::restoreDebugger):
        (WebCore::InspectorAgent::restoreProfiler):
        (WebCore::InspectorAgent::ensureSettingsLoaded):
        (WebCore::InspectorAgent::enableProfiler):
        (WebCore::InspectorAgent::disableProfiler):
        (WebCore::InspectorAgent::showAndEnableDebugger):
        (WebCore::InspectorAgent::enableDebugger):
        (WebCore::InspectorAgent::disableDebugger):
        * inspector/InspectorAgent.h:
        (WebCore::InspectorAgent::settings):
        * inspector/InspectorConsoleAgent.cpp:
        (WebCore::InspectorConsoleAgent::setMonitoringXHREnabled):
        (WebCore::InspectorConsoleAgent::setConsoleMessagesEnabled):
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::isDebuggerAlwaysEnabled):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::identifierForInitialRequestImpl):
        (WebCore::InspectorInstrumentation::didLoadResourceFromMemoryCacheImpl):
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::InspectorProfilerAgent):
        (WebCore::InspectorProfilerAgent::startUserInitiatedProfiling):
        * inspector/InspectorSettings.cpp: Added.
        (WebCore::InspectorSettings::InspectorSettings):
        (WebCore::InspectorSettings::getBoolean):
        (WebCore::InspectorSettings::setBoolean):
        (WebCore::InspectorSettings::getLong):
        (WebCore::InspectorSettings::setLong):
        (WebCore::InspectorSettings::registerBoolean):
        (WebCore::InspectorSettings::registerLong):
        * inspector/InspectorSettings.h: Copied from Source/WebCore/bindings/v8/ScriptProfiler.h.
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher.dispatcher.monitoringXHRStateChanged):
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher):
        (WebInspector.ConsoleView.prototype._handleContextMenuEvent):
        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel.prototype._toggleProfiling):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._toggleDebugging):
        * inspector/front-end/Settings.js:
        (WebInspector.Settings):
        * inspector/front-end/inspector.js:

2011-01-26  Philippe Normand  <pnormand@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] LayoutTests/media/audio-mpeg4-supported.html fails
        https://bugs.webkit.org/show_bug.cgi?id=53125

        * platform/graphics/gstreamer/MediaPlayerPrivateGStreamer.cpp:
        (WebCore::mimeTypeCache): Add audio/x-m4a mimetype in the cache.

2011-01-26  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: store all settings related to the agents on the frontend side
        https://bugs.webkit.org/show_bug.cgi?id=53174

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.exp.in:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/Inspector.idl:
        * inspector/InspectorAgent.cpp: profiler and debugger enablement state is now stored
        on the front-end side and will be pushed to the backend when the frontend is loaded.
        (WebCore::InspectorAgent::InspectorAgent):
        (WebCore::InspectorAgent::disconnectFrontend):
        (WebCore::InspectorAgent::restoreDebugger):
        (WebCore::InspectorAgent::restoreProfiler):
        (WebCore::InspectorAgent::enableProfiler):
        (WebCore::InspectorAgent::disableProfiler):
        (WebCore::InspectorAgent::showAndEnableDebugger):
        (WebCore::InspectorAgent::enableDebugger):
        (WebCore::InspectorAgent::disableDebugger):
        * inspector/InspectorAgent.h:
        * inspector/InspectorConsoleAgent.cpp: XHR failures will be logged to the console only
        if the front-end was opened during current browser session and XHR logging is turned on
        there.
        (WebCore::InspectorConsoleAgent::setMonitoringXHREnabled):
        (WebCore::InspectorConsoleAgent::setConsoleMessagesEnabled):
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::identifierForInitialRequestImpl):
        (WebCore::InspectorInstrumentation::didLoadResourceFromMemoryCacheImpl):
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::enable):
        (WebCore::InspectorProfilerAgent::startUserInitiatedProfiling):
        * inspector/InspectorProfilerAgent.h:
        * inspector/InspectorSettings.cpp: Removed.
        * inspector/InspectorSettings.h: Removed.
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher.dispatcher.consoleMessagesCleared):
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher):
        (WebInspector.ConsoleView.prototype._handleContextMenuEvent.itemAction):
        (WebInspector.ConsoleView.prototype._handleContextMenuEvent):
        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel.prototype._toggleProfiling):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._toggleDebugging):
        * inspector/front-end/Settings.js:
        (WebInspector.Settings):
        * inspector/front-end/inspector.js:

2011-01-27  Dan Bernstein  <mitz@apple.com>

        Reviewed by Sam Weinig.

        REGRESSION (r76743): Uneven spacing in right-to-left justified text
        https://bugs.webkit.org/show_bug.cgi?id=53225

        Fixes failure in fast/text/atsui-spacing-features.html

        There was an inconsistency between rendering code and font code in the interpretation of
        'after expansion' and 'trailing expansion'. Changed all code to interpret these in terms of
        visual order rather than logical.

        * platform/graphics/Font.cpp:
        (WebCore::Font::expansionOpportunityCount): Added a text direction parameter and changed to
        iterate in visual order accordingly.
        * platform/graphics/Font.h:
        * platform/graphics/WidthIterator.cpp:
        (WebCore::WidthIterator::WidthIterator): Pass the run direction to expansionOpportunityCount().
        (WebCore::WidthIterator::advance): For right-to-left runs, evaluate the trailing expansion
        condition with respect to the first character, which is the trailing character in visual order.
        * platform/graphics/mac/ComplexTextController.cpp:
        (WebCore::ComplexTextController::ComplexTextController): Pass the run direction to
        expansionOpportunityCount().
        * rendering/RenderBlockLineLayout.cpp:
        (WebCore::RenderBlock::computeInlineDirectionPositionsForLine): Ditto.

2011-01-26  Adam Roben  <aroben@apple.com>

        Don't create the Direct3D device before it's first needed

        We only need the device once we decide to render. There's no point in creating it before
        then.

        Reviewed by Sam Weinig.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp:
        (WebCore::CACFLayerTreeHost::setWindow): Removed the call to createRenderer() from here.
        We already have code to create it when we first try to draw.
        (WebCore::CACFLayerTreeHost::createRenderer): Flush the context after we set our layer's
        bounds so that the bounds will take effect the next time we render (which could be just
        after this function returns).

2011-01-26  Adam Roben  <aroben@apple.com>

        Add assertions that CACFLayerTreeHost gains and loses an HWND only once

        CACFLayerTreeHost doesn't support any other use pattern.

        Reviewed by Sam Weinig.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp:
        (WebCore::CACFLayerTreeHost::CACFLayerTreeHost): Initialize new member.
        (WebCore::CACFLayerTreeHost::setWindow): Assert that we transition from not having a window,
        to having a window, to not having a window just once over the lifetime of this object.

        * platform/graphics/ca/win/CACFLayerTreeHost.h: Added m_state.

2011-01-26  Adam Roben  <aroben@apple.com>

        Notify layers that their animations have started when we flush the context, not when we
        render

        r76372 separated context flushing from rendering, but this bit of code got left behind.

        Reviewed by Sam Weinig.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp:
        (WebCore::CACFLayerTreeHost::render): Moved code to notify the layers from here to
        notifyAnimationsStarted.
        (WebCore::CACFLayerTreeHost::flushPendingLayerChangesNow): Added a call to
        notifyAnimationsStarted after we flush the context.
        (WebCore::CACFLayerTreeHost::notifyAnimationsStarted): Added. Code came from render. Changed
        to call PlatformCALayer::animationStarted rather than calling through to the client
        directly.

        * platform/graphics/ca/win/CACFLayerTreeHost.h: Added notifyAniamtionsStarted.

2011-01-26  Adam Roben  <aroben@apple.com>

        Small cleanup in MediaPlayerPrivateFullscreenWindow

        Reviewed by Sam Weinig.

        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
        (WebCore::MediaPlayerPrivateFullscreenWindow::~MediaPlayerPrivateFullscreenWindow): Moved
        code here from close(), since this was the only place that called it after the following
        change to createWindow.
        (WebCore::MediaPlayerPrivateFullscreenWindow::createWindow): Replaced code that handled the
        case where we had already created the window with an assertion that we have not already done
        so. Our single caller (FullscreenVideoController) did not require this behavior.

        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h: Removed layerView.

2011-01-26  Sam Weinig  <sam@webkit.org>

        Reviewed by Adam Roben.

        Move ScrollView scroll wheel code to ScrollAnimator.

        * platform/ScrollAnimator.cpp:
        (WebCore::ScrollAnimator::handleWheelEvent):
        * platform/ScrollAnimator.h:
        Moved implementation of handleWheelEvent from ScrollView::wheelEvent.

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::wheelEvent):
        Call down to the ScrollableArea.

        * platform/ScrollableArea.cpp:
        (WebCore::ScrollableArea::handleWheelEvent):
        Call down to the ScrollAnimator.

        * platform/ScrollableArea.h:
        (WebCore::ScrollableArea::scrollPosition):
        (WebCore::ScrollableArea::minimumScrollPosition):
        (WebCore::ScrollableArea::maximumScrollPosition):
        (WebCore::ScrollableArea::visibleContentRect):
        (WebCore::ScrollableArea::visibleHeight):
        (WebCore::ScrollableArea::visibleWidth):
        Add functions needed to implement wheel event in the animator.

2011-01-26  David Kilzer  <ddkilzer@apple.com>

        <http://webkit.org/b/53192> Add experimental support for HTTP pipelining in CFNetwork
        <rdar://problem/8821760>

        Reviewed by Antti Koivisto.

        This adds support for HTTP pipelining in CFNetwork, but does not
        enable it.  To enable it post-SnowLeopard, use this command:

            defaults write BUNDLE.ID WebKitEnableHTTPPipelining -bool YES

        Once enabled, it is possible to force the same load priority
        (high) to be sent to CFNetwork to allow WebCore to handle the
        scheduling:

            defaults write BUNDLE.ID WebKitForceHTTPPipeliningPriorityHigh -bool YES

        * WebCore.exp.in: Export _wkGetHTTPPipeliningPriority and
        _wkSetHTTPPipeliningPriority.

        * loader/DocumentThreadableLoader.cpp:
        (WebCore::DocumentThreadableLoader::makeCrossOriginAccessRequestWithPreflight):
        Copy the priority to preflightRequest.

        * loader/ResourceLoadScheduler.cpp:
        (WebCore::ResourceLoadScheduler::scheduleLoad): Refactored code
        at the end of the method to use an early return.

        * loader/cache/CachedResourceRequest.cpp:
        (WebCore::CachedResourceRequest::load): Set the priority on the
        ResourceRequest object based on the priority of the
        CachedResourceRequest before calling
        ResourceLoadScheduler::scheduleSubresourceLoad().

        * loader/icon/IconLoader.cpp:
        (WebCore::IconLoader::startLoading): Create a ResourceRequest
        object and set its priority to ResourceLoadPriorityLow before
        passing it to ResourceLoadScheduler::scheduleSubresourceLoad().

        * platform/mac/WebCoreSystemInterface.h:
        (wkGetHTTPPipeliningPriority): Added.
        (wkSetHTTPPipeliningPriority): Added.
        * platform/mac/WebCoreSystemInterface.mm:
        (wkGetHTTPPipeliningPriority): Added.
        (wkSetHTTPPipeliningPriority): Added.

        * platform/network/ResourceRequestBase.cpp:
        (WebCore::ResourceRequestBase::adopt): Set m_priority when
        adopting a CrossThreadResourceRequestData.
        (WebCore::ResourceRequestBase::copyData): Set m_priority when
        creating a CrossThreadResourceRequestData.
        (WebCore::ResourceRequestBase::priority): Added.
        (WebCore::ResourceRequestBase::setPriority): Added.
        (WebCore::equalIgnoringHeaderFields): Priorities must match when
        comparing two ResourceRequest objects.

        * platform/network/ResourceRequestBase.h:
        (WebCore::ResourceRequestBase::ResourceRequestBase): Set default
        priority of new objects to ResourceLoadPriorityLow.
        (WebCore::ResourceRequestBase::priority): Added declaration.
        (WebCore::ResourceRequestBase::setPriority): Added declaration.
        (WebCore::isHTTPPipeliningEnabled): Added.
        (WebCore::shouldUseHTTPPipeliningPriority): Added.

        * platform/network/cf/ResourceRequestCFNet.cpp: Updated so that
        Mac OS X and Windows share code.
        (WebCore::initializeMaximumHTTPConnectionCountPerHost): Always
        set the HTTP connection count per host, but return an
        'unlimited' value when using HTTP pipelining.  This method used
        to be defined in ResourceRequestMac.mm for Mac OS X.
        (WebCore::readBooleanPreference): Added.  Helper method for
        reading boolean user defaults.
        (WebCore::isHTTPPipeliningEnabled): Returns value of user
        default key WebKitEnableHTTPPipelining, or false if not set.
        (WebCore::shouldUseHTTPPipeliningPriority): Returns value of
        user default key WebKitForceHTTPPipeliningPriorityHigh, or false
        if not set.
        * platform/network/cf/ResourceRequestCFNet.h: Updated so that
        Mac OS X and Windows share code.  Fixed indentation.
        (WebCore::mapHTTPPipeliningPriorityToResourceLoadPriority): Added.
        (WebCore::mapResourceLoadPriorityToHTTPPipeliningPriority): Added.

        * platform/network/mac/ResourceRequestMac.mm:
        (WebCore::ResourceRequest::doUpdatePlatformRequest): Update
        HTTP pipelining priority on NSMutableFURLRequest object.
        (WebCore::ResourceRequest::doUpdateResourceRequest): Update
        m_priority from the NSURLRequest object.
        (WebCore::initializeMaximumHTTPConnectionCountPerHost): Removed.
        Code is now shared with Windows in ResourceRequestCFNet.cpp.

2011-01-26  Beth Dakin  <bdakin@apple.com>

        Reviewed by Darin Adler.

        Fix for <rdar://problem/8895140> Adopt WKScrollbar metrics 
        when using WKScrollbars.

        New WebKitSystemInterface Functionality.
        * WebCore.exp.in:
        * platform/mac/WebCoreSystemInterface.h:
        * platform/mac/WebCoreSystemInterface.mm:

        Some of the terrible static arrays are now only needed in the 
        old non-WK code, so they are if-def'd now.
        * platform/mac/ScrollbarThemeMac.mm:
        
        Just patching this function in a better way than I did
        before.
        (WebCore::updateArrowPlacement):
        
        Call into WK for the right values.
        (WebCore::ScrollbarThemeMac::scrollbarThickness):
        (WebCore::ScrollbarThemeMac::hasThumb):
        (WebCore::ScrollbarThemeMac::minimumThumbLength):
        
        Return false if there are no buttons.
        (WebCore::ScrollbarThemeMac::hasButtons):

        Return an empty IntRect if there are not buttons.
        (WebCore::buttonRepaintRect):

2011-01-26  Sam Weinig  <sam@webkit.org>

        Reviewed by Maciej Stachowiak.

        Add events to represent the start/end of a gesture scroll
        https://bugs.webkit.org/show_bug.cgi?id=53215

        * WebCore.exp.in: 
        Add new file.

        * WebCore.xcodeproj/project.pbxproj:
        Add new file.

        * page/EventHandler.cpp:
        (WebCore::EventHandler::handleGestureEvent):
        * page/EventHandler.h:
        Add entry point for handling gesture events.

        * platform/PlatformGestureEvent.h: Added.
        (WebCore::PlatformGestureEvent::PlatformGestureEvent):
        (WebCore::PlatformGestureEvent::type):
        (WebCore::PlatformGestureEvent::position):
        (WebCore::PlatformGestureEvent::globalPosition):
        (WebCore::PlatformGestureEvent::timestamp):
        Add platform agnostic representation of a gesture event.

2011-01-26  Dan Bernstein  <mitz@apple.com>

        Reviewed by Dave Hyatt.

        <rdar://problem/8446709> Allow inter-ideograph justification for CJK
        https://bugs.webkit.org/show_bug.cgi?id=53184

        Tests: fast/text/justify-ideograph-complex.html
               fast/text/justify-ideograph-simple.html
               fast/text/justify-ideograph-vertical.html

        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::drawTextInternal): Corrected the type of the third parameter
        passed to the TextRun constructor and added the trailingExpansionBehavior parameter.
        * platform/graphics/Font.cpp:
        (WebCore::Font::expansionOpportunityCount): Added. Returns the number of expansion opportunities
        for text justification. On entry, isAfterExpansion says whether an expansion opportunity exists
        before the first character. On return, isAfterExpansion says whether an expansion opportunity
        exists after the last character.
        * platform/graphics/Font.h: 
        * platform/graphics/GlyphBuffer.h:
        (WebCore::GlyphBuffer::expandLastAdvance): Added.
        * platform/graphics/TextRun.h:
        (WebCore::TextRun::TextRun): Added a TrailingExpansionBehavior parameter to the constructors.
        Renamed padding to expansion.
        (WebCore::TextRun::expansion): Renamed padding() to this.
        (WebCore::TextRun::allowsTrailingExpansion): Added this accessor.
        * platform/graphics/WidthIterator.cpp:
        (WebCore::WidthIterator::WidthIterator): Initialize m_isAfterExpansion. Use Font::expansionOpportunityCount()
        and adjust the count if it includes a trailing expansion opportunity but the run disallows trailing
        expansion.
        (WebCore::WidthIterator::advance): Apply expansion before and after CJK ideographs.
        (WebCore::WidthIterator::advanceOneCharacter): Changed to not clear the GlyphBuffer so that advance()
        can expand the last advance if it is followed by a CJK ideograph.
        * platform/graphics/WidthIterator.h: Renamed m_padding to m_expansion and m_padPerSpace
        to m_expansionPerOpportunity.
        * platform/graphics/chromium/FontChromiumWin.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/chromium/FontLinux.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/efl/FontEfl.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/gtk/FontGtk.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/haiku/FontHaiku.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/mac/ComplexTextController.cpp:
        (WebCore::ComplexTextController::ComplexTextController): Initialize m_isAfterExpansion. Use
        Font::expansionOpportunityCount() and adjust the count if it includes a trailing expansion
        opportunity but the run disallows trailing expansion.
        (WebCore::ComplexTextController::adjustGlyphsAndAdvances): Moved the definition and initialization
        of hasExtraSpacing outside the loop. Apply expansion before and after CJK ideographs.
        * platform/graphics/mac/ComplexTextController.h: Renamed m_padding to m_expansion and m_padPerSpace
        to m_expansionPerOpportunity.
        * platform/graphics/mac/FontMac.mm:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/qt/FontQt.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/win/FontWin.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/win/UniscribeController.cpp:
        (WebCore::UniscribeController::UniscribeController): Updated for rename.
        * platform/graphics/wince/FontWinCE.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * platform/graphics/wx/FontWx.cpp:
        (WebCore::Font::canExpandAroundIdeographsInComplexText): Added.
        * rendering/EllipsisBox.cpp:
        (WebCore::EllipsisBox::paint): Pass a TrailingExpansionBehavior to the TextRun constructor.
        (WebCore::EllipsisBox::selectionRect): Ditto.
        (WebCore::EllipsisBox::paintSelection): Ditto.
        * rendering/InlineBox.h:
        (WebCore::InlineBox::InlineBox): Renamed m_toAdd to m_expansion.
        (WebCore::InlineBox::expansion): Renamed toAdd() to this.
        * rendering/InlineTextBox.cpp:
        (WebCore::InlineTextBox::selectionRect): Pass a TrailingExpansionBehavior to the TextRun constructor.
        (WebCore::InlineTextBox::paint): Ditto.
        (WebCore::InlineTextBox::paintSelection): Ditto.
        (WebCore::InlineTextBox::paintCompositionBackground): Ditto.
        (WebCore::InlineTextBox::paintSpellingOrGrammarMarker): Ditto.
        (WebCore::InlineTextBox::paintTextMatchMarker): Ditto.
        (WebCore::InlineTextBox::computeRectForReplacementMarker): Ditto.
        (WebCore::InlineTextBox::offsetForPosition): Ditto.
        (WebCore::InlineTextBox::positionForOffset): Ditto.
        * rendering/InlineTextBox.h:
        (WebCore::InlineTextBox::setExpansion): Renamed setSpaceAdd() to this.
        (WebCore::InlineTextBox::trailingExpansionBehavior): Added. Trailing expansion is allowed if this
        is not the last leaf box on the line.
        * rendering/RenderBlockLineLayout.cpp:
        (WebCore::RenderBlock::computeInlineDirectionPositionsForLine): Keep expansion opportunity counts
        in a vector instead of computing them twice. Discard the trailing expansion opportunity in the
        last text box.
        * rendering/RenderFileUploadControl.cpp:
        (WebCore::RenderFileUploadControl::paintObject): Pass a TrailingExpansionBehavior to the TextRun constructor.
        (WebCore::RenderFileUploadControl::computePreferredLogicalWidths): Ditto.
        * rendering/RenderListBox.cpp:
        (WebCore::RenderListBox::updateFromElement): Ditto.
        (WebCore::RenderListBox::paintItemForeground): Ditto. Also corrected the type of the second parameter.
        * rendering/RenderTextControl.cpp:
        (WebCore::RenderTextControl::getAvgCharWidth): Ditto.
        (WebCore::RenderTextControl::paintPlaceholder): Ditto.
        * rendering/svg/SVGInlineTextBox.cpp:
        (WebCore::SVGInlineTextBox::constructTextRun): Ditto.

2011-01-26  Andy Estes  <aestes@apple.com>

        Rubber-stamped by Darin Adler.

        Inline HTMLObjectElement::hasValidClassId().

        * html/HTMLObjectElement.cpp:
        (WebCore::HTMLObjectElement::hasValidClassId):

2011-01-26  Evan Martin  <evan@chromium.org>

        Reviewed by Tony Chang.

        [chromium] crash on getBoundingClientRect in complex text
        https://bugs.webkit.org/show_bug.cgi?id=53199

        Use the correct array bound; we want the number of characters processed by
        the shaper, not the longest continuous script run length.

        Test: platform/chromium-linux/fast/text/international/complex-text-rectangle.html

        * platform/graphics/chromium/ComplexTextControllerLinux.cpp:
        (WebCore::ComplexTextController::nextScriptRun):
        * platform/graphics/chromium/ComplexTextControllerLinux.h:
        (WebCore::ComplexTextController::numCodePoints):

2011-01-26  Emil A Eklund  <eae@chromium.org>

        Reviewed by Alexey Proskuryakov.

        Remove cached document reference from CSSStyleSheet and XSLStyleSheet.
        https://bugs.webkit.org/show_bug.cgi?id=52084

        Test: fast/dom/css-delete-doc.html

        * css/CSSMediaRule.cpp:
        (WebCore::CSSMediaRule::insertRule):
        (WebCore::CSSMediaRule::deleteRule):
        * css/CSSStyleSheet.cpp:
        (WebCore::CSSStyleSheet::CSSStyleSheet):
        (WebCore::CSSStyleSheet::document):
        * css/CSSStyleSheet.h:
        * xml/XSLStyleSheet.h:
        (WebCore::XSLStyleSheet::parentStyleSheet):
        * xml/XSLStyleSheetLibxslt.cpp:
        (WebCore::XSLStyleSheet::XSLStyleSheet):
        (WebCore::XSLStyleSheet::cachedResourceLoader):
        (WebCore::XSLStyleSheet::setParentStyleSheet):
        (WebCore::XSLStyleSheet::ownerDocument):
        * xml/XSLStyleSheetQt.cpp:
        (WebCore::XSLStyleSheet::XSLStyleSheet):
        (WebCore::XSLStyleSheet::cachedResourceLoader):
        (WebCore::XSLStyleSheet::ownerDocument):

2011-01-25  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Kent Tamura.

        Reduce ref-count churn in shadowPseudoId.
        https://bugs.webkit.org/show_bug.cgi?id=53136

        Refactoring, so no new tests.

        * dom/Element.h:
        (WebCore::Element::shadowPseudoId): Changed signature to use const AtomicString&
        * html/ValidationMessage.cpp:
        (WebCore::ElementWithPseudoId::shadowPseudoId): Ditto.
        * html/shadow/SliderThumbElement.cpp:
        (WebCore::SliderThumbElement::shadowPseudoId): Ditto, plus moved from the header file.
        * html/shadow/SliderThumbElement.h: Ditto.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlMuteButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlPlayButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlSeekForwardButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlSeekBackButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlRewindButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlReturnToRealtimeButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlToggleClosedCaptionsButtonElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlTimelineElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlVolumeSliderElement::shadowPseudoId): Ditto.
        (WebCore::MediaControlFullscreenButtonElement::shadowPseudoId): Ditto.
        * rendering/MediaControlElements.h: Ditto.

2011-01-26  Dave Hyatt  <hyatt@apple.com>

        Reviewed by Dan Bernstein.

        https://bugs.webkit.org/show_bug.cgi?id=46421, make multi-column layout work with vertical text.

        Added new tests in fast/multicol/vertical-lr and fast/multicol/vertical-rl.

        * css/html.css:
        Update p, blockquote and h1-h6 to respect directionality so that column layout tests that use those
        elements work properly.

        * rendering/InlineFlowBox.cpp:
        (WebCore::InlineFlowBox::placeBoxesInBlockDirection):
        Fix a flipping bug with the computation of lineTopIncludingMargins where it could be incorrectly shrunk
        in some cases (causing lines to all stack on top of one another).

        * rendering/InlineTextBox.h:
        (WebCore::InlineTextBox::calculateBoundaries):
        Fix calculateBoundaries to be physical rather than logical.

        * rendering/LayoutState.cpp:
        (WebCore::LayoutState::addForcedColumnBreak):
        * rendering/LayoutState.h:
        Rename childY to childLogicalOffset.

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::layoutBlock):
        (WebCore::RenderBlock::addOverflowFromChildren):
        (WebCore::RenderBlock::addOverflowFromFloats):
        (WebCore::RenderBlock::collapseMargins):
        (WebCore::RenderBlock::estimateLogicalTopPosition):
        (WebCore::RenderBlock::layoutBlockChild):
        (WebCore::RenderBlock::markForPaginationRelayoutIfNeeded):
        (WebCore::RenderBlock::paintColumnRules):
        (WebCore::RenderBlock::paintColumnContents):
        (WebCore::RenderBlock::paintFloats):
        (WebCore::RenderBlock::selectionGaps):
        (WebCore::RenderBlock::removeFloatingObjectsBelow):
        (WebCore::RenderBlock::addOverhangingFloats):
        (WebCore::RenderBlock::hitTestFloats):
        (WebCore::RenderBlock::hitTestColumns):
        (WebCore::RenderBlock::calcColumnWidth):
        (WebCore::RenderBlock::desiredColumnWidth):
        (WebCore::RenderBlock::columnRectAt):
        (WebCore::RenderBlock::layoutColumns):
        (WebCore::RenderBlock::adjustPointToColumnContents):
        (WebCore::RenderBlock::adjustRectForColumns):
        (WebCore::RenderBlock::flipForWritingModeIncludingColumns):
        (WebCore::RenderBlock::adjustForColumns):
        (WebCore::RenderBlock::adjustForBorderFit):
        (WebCore::RenderBlock::nextPageLogicalTop):
        (WebCore::RenderBlock::applyBeforeBreak):
        (WebCore::RenderBlock::applyAfterBreak):
        (WebCore::RenderBlock::adjustForUnsplittableChild):
        (WebCore::RenderBlock::adjustLinePositionForPagination):
        * rendering/RenderBlock.h:
        (WebCore::RenderBlock::logicalRightOffsetForContent):
        (WebCore::RenderBlock::logicalLeftOffsetForContent):
        (WebCore::RenderBlock::leftForFloatIncludingMargin):
        (WebCore::RenderBlock::topForFloatIncludingMargin):
        * rendering/RenderBlockLineLayout.cpp:
        (WebCore::RenderBlock::layoutInlineChildren):
        (WebCore::RenderBlock::determineStartPosition):
        Reworking of all the RenderBlock column functions to support flipping and vertical modes.

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::offsetFromContainer):
        (WebCore::RenderBox::flipForWritingModeIncludingColumns):
        Patch offsetFromContainer to be aware of flipped block writing modes when dealing with column layouts.

        * rendering/RenderBox.h:
        (WebCore::RenderBox::clientLogicalBottom):
        Fix a bug in clientLogicalBottom where it didn't add in the right border/padding.
        
        * rendering/RenderFlexibleBox.cpp:
        (WebCore::RenderFlexibleBox::layoutBlock):
        Better terminology for pagination.

        * rendering/RenderInline.cpp:
        (WebCore::RenderInline::offsetFromContainer):
        (WebCore::RenderInline::mapLocalToContainer):
        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::paintChildLayerIntoColumns):
        (WebCore::RenderLayer::hitTestChildLayerColumns):
        (WebCore::RenderLayer::localBoundingBox):
        (WebCore::RenderLayer::boundingBox):
        Patch painting in RenderLayers to be vertical-text-aware.
    
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::mapLocalToContainer):
        Add code to be flipped block-aware with columns.

        * rendering/RenderTable.cpp:
        (WebCore::RenderTable::layout):
        * rendering/RenderTableRow.cpp:
        (WebCore::RenderTableRow::layout):
        * rendering/RenderTableSection.cpp:
        (WebCore::RenderTableSection::layoutRows):
        Fix pagination to use better terminology.
        
        * rendering/RenderText.cpp:
        (WebCore::RenderText::absoluteQuads):
        (WebCore::RenderText::absoluteQuadsForRange):
        Fix a bug where vertical text wasn't taken into account.

2011-01-26  Dimitri Glazkov  <dglazkov@chromium.org>

        Unreviewed, rolling out r76719.
        http://trac.webkit.org/changeset/76719
        https://bugs.webkit.org/show_bug.cgi?id=53122

        Broke a bunch of media tests in Chromium/Qt/GTK.

2011-01-26  Tony Chang  <tony@chromium.org>

        Reviewed by Ryosuke Niwa.

        [gtk] strip NUL characters when copying text/html on GTK+
        https://bugs.webkit.org/show_bug.cgi?id=52508

        Putting NUL characters in the text/html clipboard doesn't work in
        WebKit GTK+ (the pasted value is truncated at the NUL).  Since we're
        already stripping this character for plain text (for Windows), strip
        it in text/html too.

        * editing/MarkupAccumulator.h: mark function as virtual
        * editing/markup.cpp:
        (WebCore::StyledMarkupAccumulator::appendString):
        (WebCore::StyledMarkupAccumulator::takeResults): strip nulls

2011-01-26  Mario Sanchez Prada  <msanchez@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Reliable crash with getTextAtOffset()
        https://bugs.webkit.org/show_bug.cgi?id=53131

        Properly calculate length in bytes for a UTF8 substring.

        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
        (utf8Substr): Use character instead of bytes as units to
        calculate the length in bytes for the UTF8 string.

2011-01-25  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Kent Tamura.

        Change HTMLInputElement-derived parts of media element shadow DOM to use shadowPseudoId.
        https://bugs.webkit.org/show_bug.cgi?id=53122

        This is the first step in converting HTMLMediaElement to the new shadow DOM.

        Should not regress any existing tests. No observable change in behavior.

        * css/CSSSelector.cpp:
        (WebCore::CSSSelector::pseudoId): Removed now-unnecessary hard-coded pseudo-element selectors.
        (WebCore::nameToPseudoTypeMap): Ditto.
        (WebCore::CSSSelector::extractPseudoType): Ditto.
        * css/CSSSelector.h: Ditto.
        * css/mediaControls.css: Added proper initial values, now that elements use the proper selector pipeline.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlInputElement::MediaControlInputElement): Removed the switch statement,
            which is now replaced with virtual shadowPseudoId on each corresponding class.
        (WebCore::MediaControlInputElement::styleForElement): Changed to use element pipeline.
        (WebCore::MediaControlMuteButtonElement::MediaControlMuteButtonElement): Changed to set
            display type in constructor.
        (WebCore::MediaControlMuteButtonElement::create): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlMuteButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::MediaControlVolumeSliderMuteButtonElement): Added
            to disambiguate from the MediaControlMuteButtonElement.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::create): Added.
        (WebCore::MediaControlVolumeSliderMuteButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlPlayButtonElement::MediaControlPlayButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlPlayButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlSeekButtonElement::MediaControlSeekButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlSeekForwardButtonElement::MediaControlSeekForwardButtonElement): Added.
        (WebCore::MediaControlSeekForwardButtonElement::create): Added.
        (WebCore::MediaControlSeekForwardButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlSeekBackButtonElement::MediaControlSeekBackButtonElement): Added.
        (WebCore::MediaControlSeekBackButtonElement::create): Added.
        (WebCore::MediaControlSeekBackButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlRewindButtonElement::MediaControlRewindButtonElement): Added.
        (WebCore::MediaControlRewindButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlReturnToRealtimeButtonElement::MediaControlReturnToRealtimeButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlReturnToRealtimeButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlToggleClosedCaptionsButtonElement::MediaControlToggleClosedCaptionsButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlToggleClosedCaptionsButtonElement::shadowPseudoId): Added.
        (WebCore::MediaControlTimelineElement::MediaControlTimelineElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlTimelineElement::shadowPseudoId): Added.
        (WebCore::MediaControlVolumeSliderElement::MediaControlVolumeSliderElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlVolumeSliderElement::shadowPseudoId): Added.
        (WebCore::MediaControlFullscreenButtonElement::MediaControlFullscreenButtonElement): Changed to not take PseudoId as
            constructor argument.
        (WebCore::MediaControlFullscreenButtonElement::shadowPseudoId): Added.
        * rendering/MediaControlElements.h:
        (WebCore::MediaControlSeekForwardButtonElement::isForwardButton): Added.
        (WebCore::MediaControlSeekBackButtonElement::isForwardButton): Added.
        * rendering/RenderMedia.cpp:
        (WebCore::RenderMedia::createMuteButton): Changed to use new constructor.
        (WebCore::RenderMedia::createSeekBackButton): Ditto.
        (WebCore::RenderMedia::createSeekForwardButton): Ditto.
        (WebCore::RenderMedia::createVolumeSliderMuteButton): Ditto.
        * rendering/style/RenderStyleConstants.h: Removed constants that are no longer used.

2011-01-26  Kenneth Russell  <kbr@google.com>

        Reviewed by James Robinson.

        Fix multisampling support in DrawingBuffer
        https://bugs.webkit.org/show_bug.cgi?id=53154

        In DrawingBuffer's multisampling code path, fixed enum usage and a
        bug where it would incorrectly redefine the depth and stencil
        buffers. Hooked up multisampling code path in Chromium port.

        Tested manually with some accelerated 2D canvas content.
        Multisampling isn't being switched on for the accelerated 2D
        canvas at the current time because it will increase fill rate
        requirements and cause a large number of rebaselines.

        * platform/graphics/Extensions3D.h:
        * platform/graphics/chromium/DrawingBufferChromium.cpp:
        (WebCore::DrawingBuffer::publishToPlatformLayer):
        * platform/graphics/chromium/Extensions3DChromium.h:
        * platform/graphics/gpu/DrawingBuffer.cpp:
        (WebCore::DrawingBuffer::create):
        (WebCore::DrawingBuffer::reset):
        * platform/graphics/opengl/Extensions3DOpenGL.cpp:
        (WebCore::Extensions3DOpenGL::supports):

2011-01-26  Tony Chang  <tony@chromium.org>

        Unreviewed.

        [chromium] revert r68310 because of race conditions detected by tsans
        https://bugs.webkit.org/show_bug.cgi?id=53185

        Causes stability problems for Chromium, http://crbug.com/70589

        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
        (WebCore::SQLiteFileSystem::registerSQLiteVFS):

2011-01-26  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Adam Barth.

        Make fireEventsAndUpdateStyle use stack local vectors. 
        https://bugs.webkit.org/show_bug.cgi?id=46760

        Test: animations/animation-add-events-in-handler.html

        * page/animation/AnimationController.cpp:
        (WebCore::AnimationControllerPrivate::fireEventsAndUpdateStyle):

2011-01-26  Nate Chapin  <japhet@chromium.org>

        Reviewed by Adam Barth.

        Remove m_URL from FrameLoader and depend on Document::url()
        instead. FrameLoader::url() will be removed in a followup patch.
        https://bugs.webkit.org/show_bug.cgi?id=41165

        Refactor only, no new tests.

        * WebCore.exp.in:
        * dom/Document.cpp:
        (WebCore::Document::Document):
        (WebCore::Document::updateURLForPushOrReplaceState):
        * loader/DocumentWriter.cpp:
        (WebCore::DocumentWriter::begin):
        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::iconURL):
        (WebCore::FrameLoader::didOpenURL):
        (WebCore::FrameLoader::didExplicitOpen):
        (WebCore::FrameLoader::receivedFirstData):
        (WebCore::FrameLoader::url):
        (WebCore::FrameLoader::setOutgoingReferrer):
        (WebCore::FrameLoader::startIconLoader):
        (WebCore::FrameLoader::commitIconURLToIconDatabase):
        (WebCore::FrameLoader::finishedParsing):
        (WebCore::FrameLoader::checkIfDisplayInsecureContent):
        (WebCore::FrameLoader::checkIfRunInsecureContent):
        (WebCore::FrameLoader::updateFirstPartyForCookies):
        (WebCore::FrameLoader::loadInSameDocument):
        (WebCore::FrameLoader::commitProvisionalLoad):
        (WebCore::FrameLoader::open):
        (WebCore::FrameLoader::shouldScrollToAnchor):
        * loader/FrameLoader.h: Rename setURL() to setOutgoingReferrer().

2011-01-25  Brian Weinstein  <bweinstein@apple.com>

        Reviewed by Antti Koivisto.

        Crashes loading pages when cancelling subresource loads through WebKit
        https://bugs.webkit.org/show_bug.cgi?id=53123
        <rdar://problem/8914361>
        
        Fix a crash that happened when cancelling subresource loads through WebKit.
        
        When a load is cancelled synchronously (via the WebKit client), CachedResourceLoader::requestResource 
        can be called recursively on the same function, either leading to infinite recursion, or deleting 
        an object when it is not done being used.
        
        The fix for this was to call checkForPendingPreloads and servePendingRequests asynchronously when 
        CachedResourceLoader::loadDone was called synchronously (due to the load being cancelled synchronously).

        Test: fast/loader/willSendRequest-null-for-preload.html

        * loader/DocumentLoader.cpp:
        (WebCore::DocumentLoader::setRequest): Only dispatch didReceiveServerRedirectForProvisionalLoadForFrame 
            if our new URL is non-null.
        * loader/cache/CachedResourceLoader.cpp:
        (WebCore::CachedResourceLoader::CachedResourceLoader): Initialize our timer.
        (WebCore::CachedResourceLoader::loadDone): If the CachedResource we were passed in was 0, that means this 
            function was called synchronously
            from CachedResourceRequest::load, and we don't want to call into checkForPendingPreloads synchronously, 
            so put it on a 0-delay timer to make the calls to checkForPendingPreloads and servePendingRequests asynchronous.
        (WebCore::CachedResourceLoader::loadDonePendingActionTimerFired): Call checkForPendingPreloads and servePendingRequests.
        (WebCore::CachedResourceLoader::checkForPendingPreloads): m_pendingPreloads is now a Deque instead of a Vector, 
            so use Deque methods.
        * loader/cache/CachedResourceLoader.h: Add the timer, the timer callback function, and make m_pendingPreloads a Deque.

2011-01-25  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: evaluate in console may not work when window.console is substituted or deleted.
        https://bugs.webkit.org/show_bug.cgi?id=53072

        Test: inspector/console-substituted.html

        * inspector/InjectedScriptSource.js:
        (.):

2011-01-26  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [cairo] Use CAIRO_OPERATOR_DARKEN when available
        https://bugs.webkit.org/show_bug.cgi?id=53084

        Use CAIRO_OPERATOR_DARKEN for CompositePlusDarker instead of
        CAIRO_OPERATOR_SATURATE when building with cairo version >= 1.10.

        * platform/graphics/cairo/CairoUtilities.cpp:
        (WebCore::toCairoOperator):

2011-01-26  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: visualize \n in strings as unicode cr
        symbol in stack variables sidebar.
        https://bugs.webkit.org/show_bug.cgi?id=53162

        * inspector/front-end/ObjectPropertiesSection.js:
        (WebInspector.ObjectPropertyTreeElement.prototype.update):

2011-01-26  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: size is wrong for cached resources in Network panel
        - Set the size for 304/not modified resources from cached resource.
        - Add response headers size to resource transfer size.
        https://bugs.webkit.org/show_bug.cgi?id=52886

        * inspector/InspectorResourceAgent.cpp:
        (WebCore::InspectorResourceAgent::didReceiveResponse):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource):
        (WebInspector.Resource.prototype.get transferSize):
        (WebInspector.Resource.prototype.set responseHeaders):
        (WebInspector.Resource.prototype._headersSize):
        (WebInspector.Resource.prototype._mimeTypeIsConsistentWithType):

2011-01-26  Carol Szabo  <carol.szabo@nokia.com>

        Reviewed by Simon Hausmann.

        Fixed TiledBacking store to take into account new dirty regions caused by
        paint time layouts.

        Flawed rendering design for QtWebKit resulting in artifacts being displayed
        https://bugs.webkit.org/show_bug.cgi?id=49184

        There are no new tests as this patch aims at fixing flicker that
        happen randomly, mostly on slow hardware, thus are hard to reproduce
        consistently in an automated test.

        This patch does not fully address the said bug but it is a step in the
        right direction. A full solution to the bug, as currently perceived,
        requires either a Qt GUI API change, a performance hit for QtWebKit,
        or a hack, until a full solution is provided this patch is progress.

        * platform/graphics/TiledBackingStore.cpp:
        (WebCore::TiledBackingStore::updateTileBuffers):
        Changed to take into account newly dirtied areas created during
        tile update initiated layouts during the same update.

2011-01-26  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Andreas Kling.

        [SKIA] Remove "current path" of GraphicsContext
        https://bugs.webkit.org/show_bug.cgi?id=53124

        * platform/graphics/GraphicsContext.h:
        * platform/graphics/skia/GraphicsContextSkia.cpp:
        (WebCore::GraphicsContext::clipPath):
        (WebCore::GraphicsContext::fillPath):
        (WebCore::GraphicsContext::strokePath):
        * platform/graphics/skia/PathSkia.cpp:
        (WebCore::Path::strokeBoundingRect):
        * platform/graphics/skia/PlatformContextSkia.cpp:
        * platform/graphics/skia/PlatformContextSkia.h:

2011-01-26  Zalan Bujtas <zbujtas@gmail.com>

        Reviewed by Andreas Kling.

        [Qt] Path::normalAngleAtLength() returns incorrect value on ACID3.

        QPainterPath returns angle values with the origo being at the top left corner,
        we need to account for this in normalAngleAtLength().
        This Regressed with r66979.

        No new tests as this is already covered by ACID3.

        * platform/graphics/qt/PathQt.cpp:
        (WebCore::Path::normalAngleAtLength):

2011-01-26  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: live edit does not update source snippet.
        https://bugs.webkit.org/show_bug.cgi?id=53097

        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._scriptSourceChanged):

2011-01-26  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Incorrect on-hover evaluation of a variable named 'profile'.
        https://bugs.webkit.org/show_bug.cgi?id=53018

        * inspector/InjectedScript.cpp:
        (WebCore::InjectedScript::evaluate):
        (WebCore::InjectedScript::evaluateOnCallFrame):
        (WebCore::InjectedScript::getCompletions):
        (WebCore::InjectedScript::getCompletionsOnCallFrame):
        * inspector/InjectedScript.h:
        * inspector/InjectedScriptSource.js:
        (.):
        * inspector/Inspector.idl:
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::evaluateOnCallFrame):
        (WebCore::InspectorDebuggerAgent::getCompletionsOnCallFrame):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/InspectorRuntimeAgent.cpp:
        (WebCore::InspectorRuntimeAgent::evaluate):
        (WebCore::InspectorRuntimeAgent::getCompletions):
        * inspector/InspectorRuntimeAgent.h:
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype.completions):
        (WebInspector.ConsoleView.prototype.evalInInspectedWindow):
        (WebInspector.ConsoleView.prototype._enterKeyPressed):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.evaluateInSelectedCallFrame.updatingCallbackWrapper):
        (WebInspector.ScriptsPanel.prototype.evaluateInSelectedCallFrame):
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype._showPopup):
        * inspector/front-end/WatchExpressionsSidebarPane.js:
        (WebInspector.WatchExpressionsSection.prototype.update):

2011-01-26  Hironori Bono  <hbono@chromium.org>

        Reviewed by Kent Tamura.

        A speculative fix for Bug 52422 - [chromium] More crash in
        FontFallbackList::determinePitch(const Font* font)
        https://bugs.webkit.org/show_bug.cgi?id=52422

        My previous change may not work on non-US Windows whose system fonts
        have localized aliases matching to the system locale because of a
        font-name mismatch in createFontIndirectAndGetWinName(). This change
        tries all the fonts installed in a PC and returns the first font that we
        can create without errors.

        * platform/graphics/chromium/FontCacheChromiumWin.cpp:
        (WebCore::GetLastResortFallbackFontProcData::GetLastResortFallbackFontProcData):
        Added a struct used for getLastResortFallbackFontProc().
        (WebCore::getLastResortFallbackFontProc): Added a callback for EnumFontFamilies().
        (WebCore::FontCache::getLastResortFallbackFont): Use EnumFontFamilies() to find a last-resort font.

2011-01-26  James Robinson  <jamesr@chromium.org>

        Reviewed by Nate Chapin.

        Add a DOMTimeStamp parameter to the requestAnimationFrame callback
        https://bugs.webkit.org/show_bug.cgi?id=53142

        This adds a DOMTimeStamp parameter to the requestAnimationFrame callback to more
        closely match mozilla's proposal.  This is useful if the page has multiple imperative animations
        and wants to ensure that they all remain synchronized.  If each callback used Date.now() to
        update its animation state, they would potentially be out of sync with each other.  If they use
        the timestamp then all callbacks for the same "frame" will update to the same state.

        Test: fast/animation/request-animation-frame-timestamps.html

        * bindings/scripts/CodeGeneratorV8.pm:
        * bindings/scripts/test/V8/V8TestCallback.cpp:
        (WebCore::V8TestCallback::callbackWithClass2Param):
        * dom/Document.cpp:
        (WebCore::Document::serviceScriptedAnimations):
        * dom/Document.h:
        * dom/RequestAnimationFrameCallback.h:
        * dom/RequestAnimationFrameCallback.idl:
        * page/FrameView.cpp:
        (WebCore::FrameView::serviceScriptedAnimations):
        * page/FrameView.h:

2011-01-25  Yuzo Fujishima  <yuzo@google.com>

        Unreviewed attempt to fix compilation error for Chromium Clang.

        * platform/graphics/mac/ComplexTextController.cpp:
        (WebCore::ComplexTextController::advance):

2011-01-25  Ned Holbrook  <nholbrook@apple.com>

        Reviewed by Dan Bernstein.

        ComplexTextController incorrectly conflates string length and range of indexes
        https://bugs.webkit.org/show_bug.cgi?id=52760

        Test: fast/text/offsetForPosition-complex-fallback.html

        * platform/graphics/mac/ComplexTextController.cpp:
        (WebCore::ComplexTextController::offsetForPosition):
        (WebCore::ComplexTextController::ComplexTextRun::ComplexTextRun):
        (WebCore::ComplexTextController::ComplexTextRun::setIsNonMonotonic):
        (WebCore::ComplexTextController::advance):
        * platform/graphics/mac/ComplexTextController.h:
        (WebCore::ComplexTextController::ComplexTextRun::create):
        (WebCore::ComplexTextController::ComplexTextRun::indexEnd):
        * platform/graphics/mac/ComplexTextControllerATSUI.cpp:
        (WebCore::ComplexTextController::ComplexTextRun::ComplexTextRun):
        * platform/graphics/mac/ComplexTextControllerCoreText.cpp:
        (WebCore::ComplexTextController::ComplexTextRun::ComplexTextRun):
        (WebCore::ComplexTextController::collectComplexTextRunsForCharactersCoreText):

2011-01-25  Sam Weinig  <sam@webkit.org>

        Reviewed by David Hyatt.

        Scrollbars don't work correctly for top-to-bottom text in an overflow: scroll area
        https://bugs.webkit.org/show_bug.cgi?id=53048

        Test: fast/overflow/overflow-rtl-vertical-origin.html

        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::scrollPosition):
        (WebCore::RenderLayer::updateScrollInfoAfterLayout):
        Take the scroll origin into account when calculating scrollbars in more places.

2011-01-25  Steve Falkenburg  <sfalken@apple.com>

        Windows production build fix.
        Use correct configuration-specific path in makefile.

        * WebCore.vcproj/WebCore.make:

2011-01-25  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        Radio button group state is not restored correctly
        https://bugs.webkit.org/show_bug.cgi?id=50442

        Fixes a bug that radio button states are not restored correctly in
        a case that non-first radio button in a group is checked.

        If "checked" attribute is present, the radio button is checked and
        other radio buttons in the group are unchecked. This behavior
        disturbs form state restoring. This patch changes this behavior so
        that the "checked" attribute handling is delayed after form state
        restoring.

        Test: fast/forms/state-restore-radio-group.html

        * html/HTMLFormControlElement.h:
         Make finishParsingChildren() protected so that HTMLInpuElement can call it.
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::HTMLInputElement):
         - Add createdByParser parameter.
         - Initialize m_stateRestored and m_parsingInProgress.
        (WebCore::HTMLInputElement::create): Sync with the constructor.
        (WebCore::HTMLInputElement::restoreFormControlState):
         Set m_stateRestored in order to refer it in finishParsingChildren().
        (WebCore::HTMLInputElement::parseMappedAttribute):
         Don't call setChecked() during parsing. Move setNeedsValidityCheck()
         to setChecked().
        (WebCore::HTMLInputElement::finishParsingChildren):
         Call setChecked() if form state is not restored.
        (WebCore::HTMLInputElement::setChecked):
         Move setNeedsValidityCheck() from parseMappedAttribute() because
         finishParsingChildren() also needs to call setNeedsValidityCheck().
        * html/HTMLInputElement.h:
         - Remove the default value of HTMLFormElement* of the HTMLInputElement
           constructor, and add createdByParser parameter.
         - Introduce m_parsingInProgress and m_stateRestored.
        * html/HTMLIsIndexElement.cpp:
        (WebCore::HTMLIsIndexElement::HTMLIsIndexElement):
         Sync with the HTMLInputElement constructor change.
        * html/HTMLTagNames.in: Add constructorNeedsCreatedByParser flag.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlInputElement::MediaControlInputElement):
         Sync with the HTMLInputElement constructor change.
        * rendering/ShadowElement.cpp:
        (WebCore::ShadowInputElement::ShadowInputElement): ditto.
        * rendering/ShadowElement.h:
        (WebCore::ShadowElement::ShadowElement): ditto.

2011-01-25  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        HTMLFormElement::checkValidity() returns incorrect result if 'invalid' events are canceled.
        https://bugs.webkit.org/show_bug.cgi?id=52565

        * html/HTMLFormElement.cpp:
        (WebCore::HTMLFormElement::validateInteractively):
          Check checkInvalidControlsAndCollectUnhandled() result instead of
          checking emptiness of unhandled invalid controls list.
        (WebCore::HTMLFormElement::checkValidity): ditto.
        (WebCore::HTMLFormElement::checkInvalidControlsAndCollectUnhandled):
          Renamed from collectUnhandledInvalidControls().
          Returns true if there is any invalid control regardless of event canceling.
        * html/HTMLFormElement.h: Rename collectUnhandledInvalidControls() to
          checkInvalidControlsAndCollectUnhandled().

2011-01-25  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        Range and number inputs should reject increment and decrement by
        keyboard or mouse wheel if they are disabled or read-only
        https://bugs.webkit.org/show_bug.cgi?id=53151

        * html/RangeInputType.cpp:
        (WebCore::RangeInputType::handleKeydownEvent): Check disabled() and readOnly().
        * html/TextFieldInputType.cpp:
        (WebCore::TextFieldInputType::handleKeydownEventForSpinButton): ditto.
        (WebCore::TextFieldInputType::handleWheelEventForSpinButton): ditto.

2011-01-25  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        API to support localized numbers for <input type=number>
        https://bugs.webkit.org/show_bug.cgi?id=45730

        Introduce platform/text/LocalizedNumber.h, and
        LocalizedNumberNone.cpp, which is an empty implementation of the
        functions in LocalizedNumber.h.  We use LocalizedNumberNone.cpp in
        all platforms for now.

        A string in a type=number field is parsed as a localized number
        first. If the parsing fails, it is parsed as the HTML5 number.

        We introduce HTMLInputElement::visibleValue(). It represents a value
        which should be drawn by a renderer. HTMLInputElement::value() always
        returns a number formatted for HTML5, and visibleValue() may return a
        localized number.

        No new tests because this doesn't change any behavior.

        * Android.mk: Add LocalizedNumber.h and/or LocalizedNumberNone.cpp.
        * CMakeLists.txt: ditto.
        * GNUmakefile.am: ditto.
        * WebCore.gypi: ditto.
        * WebCore.pro: ditto.
        * WebCore.vcproj/WebCore.vcproj: ditto.
        * WebCore.xcodeproj/project.pbxproj: ditto.
        * dom/InputElement.h: Add visibleValue().
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::visibleValue): Added.  Just call InputType::visibleValue().
        * html/HTMLInputElement.h: Declare visibleValue().
        * html/InputType.cpp:
        (WebCore::InputType::visibleValue): Add the default implementation of
          visibleValue(), which returns HTMLInputElement::value().
        * html/InputType.h: Add declarations.
        * html/NumberInputType.cpp:
        (WebCore::isHTMLNumberCharacter): Renamed from isNumberCharacter().
        (WebCore::isNumberCharacter): Calls isLocalizedNumberCharacter() and isHTMLNumberCharacter().
        (WebCore::NumberInputType::visibleValue):
          Returns a localized number string produced by formatLocalizedNumber().
        (WebCore::NumberInputType::isAcceptableValue): Calls parseLocalizedNumber().
        (WebCore::NumberInputType::sanitizeValue): Calls parseLocalizedNumber().
        * html/NumberInputType.h: Add declarations.
        * platform/text/LocalizedNumber.h: Added.
        * platform/text/LocalizedNumberNone.cpp: Added.
        (WebCore::parseLocalizedNumber):
        (WebCore::formatLocalizedNumber):
        (WebCore::isLocalizedNumberCharacter):
        * rendering/RenderTextControlSingleLine.cpp:
        (WebCore::RenderTextControlSingleLine::updateFromElement):
          Calls InputElement::visibleValue() instead of value().
        * wml/WMLInputElement.h:
        (WebCore::WMLInputElement::visibleValue): Added. It just calls value().

2011-01-25  Alexey Proskuryakov  <ap@apple.com>

        Reviewed by Darin Adler.

        https://bugs.webkit.org/show_bug.cgi?id=53143
        Add IntRectHash

        * WebCore.xcodeproj/project.pbxproj:
        * platform/graphics/IntRectHash.h: Added.

        * platform/graphics/IntSizeHash.h: Don't do "using WebCore::IntSize"!

2011-01-25  Ilya Sherman  <isherman@chromium.org>

        Reviewed by Ryosuke Niwa.

        Remove trailing whitespace in HTMLInputElement.cpp
        https://bugs.webkit.org/show_bug.cgi?id=53152

        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::updateCheckedRadioButtons):
        (WebCore::HTMLInputElement::applyStep):
        (WebCore::HTMLInputElement::updateFocusAppearance):
        (WebCore::HTMLInputElement::mapToEntry):
        (WebCore::HTMLInputElement::setAutofilled):
        (WebCore::HTMLInputElement::willMoveToNewOwnerDocument):
        (WebCore::HTMLInputElement::didMoveToNewOwnerDocument):

2011-01-25  Mike Reed  <reed@google.com>

        Reviewed by James Robinson.

        DrawingBufer::reset() today checks if the new size is the same as its
        m_size, and if so, returns immediately. This does not match the
        semantics of <canvas>, which wants to clear its contents anytime the
        size is specified.
        https://bugs.webkit.org/show_bug.cgi?id=53149

        Test: Covered by existing <canvas> tests using gpu.

        * platform/graphics/chromium/DrawingBufferChromium.cpp:
        (WebCore::DrawingBuffer::DrawingBuffer):
        * platform/graphics/gpu/DrawingBuffer.cpp:
        (WebCore::DrawingBuffer::reset):

2011-01-25  Cris Neckar  <cdn@chromium.org>

        Reviewed by Adam Barth.

        Add a hashset of DOMURLs to ScriptExecutionContext to track back references.
        https://bugs.webkit.org/show_bug.cgi?id=53038

        Test: fast/dom/window-domurl-crash.html

        * dom/ScriptExecutionContext.cpp:
        (WebCore::ScriptExecutionContext::~ScriptExecutionContext):
        (WebCore::ScriptExecutionContext::createdDomUrl):
        (WebCore::ScriptExecutionContext::destroyedDomUrl):
        * dom/ScriptExecutionContext.h:
        (WebCore::ScriptExecutionContext::domUrls):
        * html/DOMURL.cpp:
        (WebCore::DOMURL::DOMURL):
        (WebCore::DOMURL::~DOMURL):
        (WebCore::DOMURL::contextDestroyed):
        * html/DOMURL.h:
        (WebCore::DOMURL::scriptExecutionContext):

2011-01-23  Antti Koivisto  <antti@apple.com>

        Reviewed by Darin Adler.

        https://bugs.webkit.org/show_bug.cgi?id=52983
        Eliminate m_tagHistory pointer from CSSSelector

        Keep the component selectors in the array in CSSSelectorList instead
        of maintaining a linked list between them. This allows eliminating
        m_tagHistory pointer, shrinking CSSSelector by 25% (selection performance
        seems to improve some too due to better locality).

        * WebCore.xcodeproj/project.pbxproj:
        
            Make CSSSelector.h a private header.
        
        * css/CSSGrammar.y:
        
            Use CSSParserSelector during parsing to keep the tag history in 
            a linked list. This is flattened to an array after parsing.
            Use accessors for setting selector values.
            Use OwnPtr in selector vector.
            
        * css/CSSPageRule.cpp:
        (WebCore::CSSPageRule::CSSPageRule):
        * css/CSSPageRule.h:
        (WebCore::CSSPageRule::create):
        
            Simplify.
    
        * css/CSSParser.cpp:
        (WebCore::CSSParser::~CSSParser):
        (WebCore::CSSParser::createFloatingSelector):
        (WebCore::CSSParser::sinkFloatingSelector):
        (WebCore::CSSParser::createStyleRule):
        (WebCore::CSSParser::updateSpecifiersWithElementName):
        (WebCore::CSSParser::createPageRule):
        * css/CSSParser.h:
        (WebCore::CSSParser::reusableSelectorVector):
        
            CSSSelector -> CSSParserSelector.
            Use OwnPtr in selector vector.
            
        * css/CSSParserValues.cpp:
        (WebCore::CSSParserSelector::CSSParserSelector):
        (WebCore::CSSParserSelector::~CSSParserSelector):
        * css/CSSParserValues.h:
        (WebCore::CSSParserSelector::releaseSelector):
        (WebCore::CSSParserSelector::setTag):
        (WebCore::CSSParserSelector::setValue):
        (WebCore::CSSParserSelector::setAttribute):
        (WebCore::CSSParserSelector::setArgument):
        (WebCore::CSSParserSelector::setSimpleSelector):
        (WebCore::CSSParserSelector::setMatch):
        (WebCore::CSSParserSelector::setRelation):
        (WebCore::CSSParserSelector::setForPage):
        (WebCore::CSSParserSelector::pseudoType):
        (WebCore::CSSParserSelector::isUnknownPseudoElement):
        (WebCore::CSSParserSelector::isSimple):
        (WebCore::CSSParserSelector::tagHistory):
        (WebCore::CSSParserSelector::setTagHistory):
        
            Linked list used during parsing.
            Avoid recursive destruction.

        * css/CSSSelector.cpp:
        (WebCore::CSSSelector::extractPseudoType):
        (WebCore::CSSSelector::operator==):
        (WebCore::CSSSelector::selectorText):
        (WebCore::CSSSelector::setSimpleSelector):
        * css/CSSSelector.h:
        (WebCore::CSSSelector::CSSSelector):
        (WebCore::CSSSelector::~CSSSelector):
        (WebCore::CSSSelector::tagHistory):
        (WebCore::CSSSelector::tag):
        (WebCore::CSSSelector::value):
        (WebCore::CSSSelector::setTag):
        (WebCore::CSSSelector::isLastInTagHistory):
        (WebCore::CSSSelector::setNotLastInTagHistory):
        (WebCore::CSSSelector::RareData::RareData):
        (WebCore::CSSSelector::RareData::~RareData):
        (WebCore::CSSSelector::createRareData):
        (WebCore::CSSSelector::setValue):
        
            Remove m_tagHistory.
            Keep m_value in the union with the rare data pointer instead.
            Make m_value and m_tag private, implement accessors.
            Add a new bit to indicate end of the tag history (multipart selector).
            Eliminate complex destruction. Selectors are now deleted as an array or by a CSSParserSelector chain.
            
        * css/CSSSelectorList.cpp:
        (WebCore::CSSSelectorList::adoptSelectorVector):
        
            Flatten everything to an array.
        
        (WebCore::SelectorNeedsNamespaceResolutionFunctor::operator()):
        * css/CSSSelectorList.h:
        (WebCore::CSSSelectorList::hasOneSelector):
        (WebCore::CSSSelectorList::next):
        
            Skip over the subparts of multipart selectors to find the next selector.
    
        * css/CSSStyleRule.h:
        (WebCore::CSSStyleRule::adoptSelectorVector):
        
            CSSSelector -> CSSParserSelector.
            
        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::SelectorChecker::checkOneSelector):
        (WebCore::CSSRuleSet::addRule):
        (WebCore::collectIdsAndSiblingRulesFromList):
        (WebCore::CSSStyleSelector::matchPageRulesForList):
        * dom/Node.cpp:
        (WebCore::Node::querySelector):
        * dom/SelectorNodeList.cpp:
        (WebCore::createSelectorNodeList):
        
            Use accessors.

2011-01-25  James Simonsen  <simonjam@chromium.org>

        Reviewed by Tony Chang.

        [Chromium] Support small caps in complex text on linux
        https://bugs.webkit.org/show_bug.cgi?id=53051

        * platform/graphics/chromium/ComplexTextControllerLinux.cpp:
        (WebCore::ComplexTextController::nextScriptRun): Break runs at small caps boundaries.
        (WebCore::ComplexTextController::setupFontForScriptRun): Setup small caps font data if needed.
        * platform/graphics/chromium/ComplexTextControllerLinux.h: Store small caps text in separate string.

2011-01-25  Steve Falkenburg  <sfalken@apple.com>

        Rubber-stamped by Adam Roben.

        Windows production build fix.
        Use correct environment variable escaping

        * WebCore.vcproj/WebCore.make:

2011-01-25  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        Empty URLs are never display isolated
        https://bugs.webkit.org/show_bug.cgi?id=53053

        This check mirrors the check in the local case.  There isn't a good way
        to test this with a LayoutTest, but it is tested in Chromium (where
        this registry is used).

        * platform/SchemeRegistry.cpp:
        (WebCore::SchemeRegistry::shouldTreatURLSchemeAsDisplayIsolated):

2011-01-25  Sam Weinig  <sam@webkit.org>

        Reviewed by Anders Carlsson.

        Pipe a timestamp down into the PlatformWheelEvent for the Mac.
        https://bugs.webkit.org/show_bug.cgi?id=53111

        * platform/PlatformWheelEvent.h:
        (WebCore::PlatformWheelEvent::PlatformWheelEvent):
        (WebCore::PlatformWheelEvent::timestamp):
        Add timestamp member.

        * platform/mac/WheelEventMac.mm:
        (WebCore::PlatformWheelEvent::PlatformWheelEvent):
        Initialize the timestamp from the event.

2011-01-25  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76625.
        http://trac.webkit.org/changeset/76625
        https://bugs.webkit.org/show_bug.cgi?id=53119

        "incorrect pixel test results" (Requested by rniwa on
        #webkit).

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::localCaretRect):

2011-01-25  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r76614.

        * platform/FileSystem.h:

2011-01-21  Levi Weintraub  <leviw@chromium.org>

        Reviewed by Darin Adler.

        Adding border and padding to the calculation of the local caret rect for RenderBoxes.

        Undo moves caret to invalid position
        https://bugs.webkit.org/show_bug.cgi?id=49744

        Tests: editing/selection/caret-painting-after-paste-undo-rtl.html
               editing/selection/caret-painting-after-paste-undo.html

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::localCaretRect):

2011-01-25  Sam Weinig  <sam@webkit.org>

        Reviewed by Anders Carlsson.

        Add hasPreciseScrollingDeltas bit to PlatformWheelEvent on the Mac.
        https://bugs.webkit.org/show_bug.cgi?id=53107

        * platform/PlatformWheelEvent.h:
        (WebCore::PlatformWheelEvent::PlatformWheelEvent):
        (WebCore::PlatformWheelEvent::hasPreciseScrollingDeltas):
        * platform/mac/WheelEventMac.mm:
        (WebCore::PlatformWheelEvent::PlatformWheelEvent):

2011-01-20  Jer Noble  <jer.noble@apple.com>

        Reviewed by Eric Carlson.

        REGRESSION (r72119): Audio never plays on Star Wars intro animation
        https://bugs.webkit.org/show_bug.cgi?id=52467
        
        QuickTime's eat/m4a movie importer compontent doesn't list audio/m4a as a mime
        type which it supports, though it handles .m4a files just fine.  Change the way
        we build the list of supported MIME Types through a new WebKitSystemInterface
        function.
        
        Caused by r72119, which adds system-specific extension->MIME entries to the cache
        before global entries, and the system-specific entries include QuickTime's registry 
        entries which contain the audio/m4a MIME type, while its components do not.

        Test: media/audio-mpeg4-supported.html

        * WebCore.vcproj/QTMovieWinCommon.vsprops:
        * platform/graphics/win/QTMovie.cpp:
        (getMIMETypeCallBack):
        (initializeSupportedTypes):
        (QTMovie::countSupportedTypes): gSupportedTypes is now a CFArrayRef.
        (QTMovie::getSupportedType): Ditto.

2011-01-25  Hans Wennborg  <hans@chromium.org>

        Reviewed by Jeremy Orlow.

        IndexedDB: Remove PlatformBridge::idbShutdown()
        https://bugs.webkit.org/show_bug.cgi?id=53077

        Since Chromium r72157, this is not used anymore. The previous use was
        to signal to the embedder that IndexedDB was shutting down, but we
        agreed it is better if the embedder keeps track of that itself.

        No new tests: this does not change any functionality.

        * platform/chromium/PlatformBridge.h:
        * storage/IDBFactoryBackendInterface.cpp:
        * storage/IDBFactoryBackendInterface.h:
        (WebCore::IDBFactoryBackendInterface::~IDBFactoryBackendInterface):
        * storage/chromium/IDBFactoryBackendInterface.cpp:

2011-01-25  Darin Adler  <darin@apple.com>

        Reviewed by Anders Carlsson.

        WebKit is using CSBackupSetItemExcluded incorrectly
        https://bugs.webkit.org/show_bug.cgi?id=53095
        rdar://problem/8790540

        * loader/icon/IconDatabase.cpp:
        (WebCore::IconDatabase::performOpenInitialization): Added code to
        exclude the database from backup one time, and record inside the
        database that this has been done.
        (WebCore::IconDatabase::wasExcludedFromBackup): Added.
        (WebCore::IconDatabase::setWasExcludedFromBackup): Added.
        * loader/icon/IconDatabase.h: Added new functions above.

        * platform/FileSystem.cpp:
        (WebCore::canExcludeFromBackup): Added.
        (WebCore::excludeFromBackup): Added.

        * platform/FileSystem.h: Added canExcludeFromBackup, excludeFromBackup,
        and pathAsURL functions. Cleaned up ifdefs and comments a bit and sorted
        things alphabetically, particularly platform-specific sections.

        * platform/cf/FileSystemCF.cpp:
        (WebCore::pathAsURL): Added.

        * platform/mac/FileSystemMac.mm:
        (WebCore::canExcludeFromBackup): Added.
        (WebCore::excludeFromBackup): Added.

        * platform/network/cf/FormDataStreamCFNet.cpp:
        (WebCore::advanceCurrentStream): Changed to call pathAsURL.
        * platform/network/mac/FormDataStreamMac.mm:
        (WebCore::advanceCurrentStream): Ditto.

2011-01-25  Helder Correia  <helder@sencha.com>

        Reviewed by Dirk Schulze.

        REGRESSION(75139): SVG gradients are not applied to texts
        https://bugs.webkit.org/show_bug.cgi?id=52531

        CGContextConcatCTM should use the CGLayer context, not the
        GraphicsContext. Also, the CTM needs to be adjusted (translated).
        This fixes SVG text gradient fill.

        Test: svg/css/composite-shadow-text.svg

        * platform/graphics/cg/GraphicsContextCG.cpp:
        (WebCore::GraphicsContext::fillRect):

2011-01-25  Benjamin Kalman  <kalman@chromium.org>

        Reviewed by Ryosuke Niwa.

        Cannot extend or modify forward by word over a non-contenteditable region
        https://bugs.webkit.org/show_bug.cgi?id=53070

        Test: editing/selection/extend-forward-by-word-over-non-editable.html

        Change all instances of honorEditableBoundaryAtOrAfter to honorEditableBoundaryAtOrBefore and vice versa in the
        functions which determine the end/start of words/lines/sentences in visible_units.cpp.

        This fixes the bug where moving forwards by a word over a non-contenteditable region would place the cursor
        inside that region, and then get moved back to the start of the word due to honorEditableBoundaryAtOrBefore.
        The cursor is now moved to the end of the region (which is effectively a noop in this case).

        * editing/visible_units.cpp: Change all instances of honorEditableBoundaryAtOrAfter to
        honorEditableBoundaryAtOrBefore and vice versa.
        (WebCore::previousWordPosition):
        (WebCore::nextWordPosition):
        (WebCore::startOfLine):
        (WebCore::endOfLine):
        (WebCore::previousSentencePosition):
        (WebCore::nextSentencePosition):
        (WebCore::logicalStartOfLine):
        (WebCore::logicalEndOfLine):

2011-01-25  Yael Aharon  <yael.aharon@nokia.com>

        Unreviewed build fix.
        After r76466, efsrv.lib is used unconditionally.
        Don't guard it with ENABLE_NETSCAPE_PLUGIN_API.

        * WebCore.pro:

2011-01-24  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Style cleanup for WebGLRenderingContext
        https://bugs.webkit.org/show_bug.cgi?id=52352

        * html/canvas/WebGLBuffer.cpp:
        * html/canvas/WebGLBuffer.h:
        * html/canvas/WebGLObject.cpp:
        * html/canvas/WebGLProgram.cpp:
        * html/canvas/WebGLRenderbuffer.cpp:
        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::create):
        (WebCore::WebGLRenderingContext::blendFunc):
        (WebCore::WebGLRenderingContext::createShader):
        (WebCore::WebGLRenderingContext::deleteBuffer):
        (WebCore::WebGLRenderingContext::deleteShader):
        (WebCore::WebGLRenderingContext::deleteTexture):
        (WebCore::WebGLRenderingContext::disableVertexAttribArray):
        (WebCore::WebGLRenderingContext::validateIndexArrayPrecise):
        (WebCore::WebGLRenderingContext::validateRenderingState):
        (WebCore::WebGLRenderingContext::enableVertexAttribArray):
        (WebCore::WebGLRenderingContext::getUniform):
        (WebCore::WebGLRenderingContext::detachAndRemoveAllObjects):
        * html/canvas/WebGLRenderingContext.h:
        * html/canvas/WebGLShader.cpp:
        * html/canvas/WebGLTexture.cpp:
        * html/canvas/WebGLUniformLocation.cpp:
        * html/canvas/WebGLUniformLocation.h:

2011-01-24  Chris Marrin  <cmarrin@apple.com>

        Reviewed by Eric Seidel.

        Change ENABLE_3D_CANVAS to ENABLE_WEBGL
        https://bugs.webkit.org/show_bug.cgi?id=53041

        * Configurations/FeatureDefines.xcconfig:
        * DerivedSources.cpp:
        * GNUmakefile.am:
        * WebCore.pro:
        * bindings/generic/RuntimeEnabledFeatures.h:
        * bindings/js/JSArrayBufferCustom.cpp:
        * bindings/js/JSCanvasRenderingContextCustom.cpp:
        (WebCore::toJS):
        * bindings/js/JSDOMWindowCustom.cpp:
        * bindings/js/JSDataViewCustom.cpp:
        * bindings/js/JSDocumentCustom.cpp:
        * bindings/js/JSFloat32ArrayCustom.cpp:
        * bindings/js/JSHTMLCanvasElementCustom.cpp:
        (WebCore::JSHTMLCanvasElement::getContext):
        * bindings/js/JSInt16ArrayCustom.cpp:
        * bindings/js/JSInt32ArrayCustom.cpp:
        * bindings/js/JSInt8ArrayCustom.cpp:
        * bindings/js/JSUint16ArrayCustom.cpp:
        * bindings/js/JSUint32ArrayCustom.cpp:
        * bindings/js/JSUint8ArrayCustom.cpp:
        * bindings/js/JSWebGLRenderingContextCustom.cpp:
        * bindings/js/JSXMLHttpRequestCustom.cpp:
        (WebCore::JSXMLHttpRequest::markChildren):
        (WebCore::JSXMLHttpRequest::send):
        (WebCore::JSXMLHttpRequest::response):
        * bindings/v8/custom/V8ArrayBufferCustom.cpp:
        * bindings/v8/custom/V8ArrayBufferViewCustom.h:
        * bindings/v8/custom/V8DataViewCustom.cpp:
        * bindings/v8/custom/V8DocumentCustom.cpp:
        (WebCore::V8Document::getCSSCanvasContextCallback):
        * bindings/v8/custom/V8Float32ArrayCustom.cpp:
        * bindings/v8/custom/V8HTMLCanvasElementCustom.cpp:
        (WebCore::V8HTMLCanvasElement::getContextCallback):
        * bindings/v8/custom/V8Int16ArrayCustom.cpp:
        * bindings/v8/custom/V8Int32ArrayCustom.cpp:
        * bindings/v8/custom/V8Int8ArrayCustom.cpp:
        * bindings/v8/custom/V8Uint16ArrayCustom.cpp:
        * bindings/v8/custom/V8Uint32ArrayCustom.cpp:
        * bindings/v8/custom/V8Uint8ArrayCustom.cpp:
        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
        * bindings/v8/custom/V8XMLHttpRequestCustom.cpp:
        (WebCore::V8XMLHttpRequest::responseAccessorGetter):
        (WebCore::V8XMLHttpRequest::sendCallback):
        * features.pri:
        * html/HTMLCanvasElement.cpp:
        (WebCore::HTMLCanvasElement::getContext):
        (WebCore::HTMLCanvasElement::reset):
        * html/HTMLCanvasElement.h:
        * html/canvas/ArrayBuffer.cpp:
        * html/canvas/ArrayBuffer.idl:
        * html/canvas/ArrayBufferView.cpp:
        * html/canvas/ArrayBufferView.idl:
        * html/canvas/DataView.cpp:
        * html/canvas/DataView.idl:
        * html/canvas/Float32Array.cpp:
        * html/canvas/Float32Array.idl:
        * html/canvas/Int16Array.cpp:
        * html/canvas/Int16Array.idl:
        * html/canvas/Int32Array.cpp:
        * html/canvas/Int32Array.idl:
        * html/canvas/Int8Array.cpp:
        * html/canvas/Int8Array.idl:
        * html/canvas/OESStandardDerivatives.cpp:
        * html/canvas/OESStandardDerivatives.idl:
        * html/canvas/OESTextureFloat.cpp:
        * html/canvas/OESTextureFloat.idl:
        * html/canvas/Uint16Array.cpp:
        * html/canvas/Uint16Array.idl:
        * html/canvas/Uint32Array.cpp:
        * html/canvas/Uint32Array.idl:
        * html/canvas/Uint8Array.cpp:
        * html/canvas/Uint8Array.idl:
        * html/canvas/WebGLActiveInfo.idl:
        * html/canvas/WebGLBuffer.cpp:
        * html/canvas/WebGLBuffer.idl:
        * html/canvas/WebGLContextAttributes.cpp:
        * html/canvas/WebGLContextAttributes.idl:
        * html/canvas/WebGLContextEvent.idl:
        * html/canvas/WebGLExtension.cpp:
        * html/canvas/WebGLFramebuffer.cpp:
        * html/canvas/WebGLFramebuffer.idl:
        * html/canvas/WebGLGetInfo.cpp:
        * html/canvas/WebGLObject.cpp:
        * html/canvas/WebGLProgram.cpp:
        * html/canvas/WebGLProgram.idl:
        * html/canvas/WebGLRenderbuffer.cpp:
        * html/canvas/WebGLRenderbuffer.idl:
        * html/canvas/WebGLRenderingContext.cpp:
        * html/canvas/WebGLRenderingContext.idl:
        * html/canvas/WebGLShader.cpp:
        * html/canvas/WebGLShader.idl:
        * html/canvas/WebGLTexture.cpp:
        * html/canvas/WebGLTexture.idl:
        * html/canvas/WebGLUniformLocation.cpp:
        * html/canvas/WebGLUniformLocation.idl:
        * html/canvas/WebKitLoseContext.cpp:
        * html/canvas/WebKitLoseContext.idl:
        * page/DOMWindow.idl:
        * platform/graphics/ANGLEWebKitBridge.cpp:
        * platform/graphics/GraphicsContext3D.cpp:
        * platform/graphics/cg/GraphicsContext3DCG.cpp:
        * platform/graphics/gpu/DrawingBuffer.cpp:
        * platform/graphics/gpu/mac/DrawingBufferMac.mm:
        * platform/graphics/mac/GraphicsContext3DMac.mm:
        * platform/graphics/mac/WebGLLayer.mm:
        * platform/graphics/opengl/Extensions3DOpenGL.cpp:
        * platform/graphics/opengl/GraphicsContext3DOpenGL.cpp:
        * platform/graphics/qt/Extensions3DQt.cpp:
        * platform/graphics/qt/GraphicsContext3DQt.cpp:
        * platform/graphics/qt/GraphicsLayerQt.cpp:
        (WebCore::GraphicsLayerQtImpl::GraphicsLayerQtImpl):
        (WebCore::GraphicsLayerQtImpl::paint):
        (WebCore::GraphicsLayerQtImpl::flushChanges):
        * platform/graphics/qt/GraphicsLayerQt.h:
        * platform/graphics/skia/GraphicsContext3DSkia.cpp:
        * platform/graphics/texmap/GraphicsLayerTextureMapper.h:
        * rendering/RenderLayerBacking.cpp:
        (WebCore::isAcceleratedCanvas):
        (WebCore::RenderLayerBacking::updateGraphicsLayerConfiguration):
        (WebCore::RenderLayerBacking::containsPaintedContent):
        (WebCore::RenderLayerBacking::contentChanged):
        * webaudio/AudioBuffer.cpp:
        * webaudio/AudioBuffer.idl:
        * webaudio/RealtimeAnalyser.cpp:
        * webaudio/RealtimeAnalyser.h:
        * webaudio/RealtimeAnalyserNode.h:
        * webaudio/RealtimeAnalyserNode.idl:
        * xml/XMLHttpRequest.cpp:
        (WebCore::XMLHttpRequest::setResponseType):
        (WebCore::XMLHttpRequest::clearResponse):
        (WebCore::XMLHttpRequest::didReceiveData):
        * xml/XMLHttpRequest.h:

2011-01-25  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Chromium] Prepare for landing of detailed heap snapshots.

        - Introduce Preferences.detailedHeapProfiles flag for controlling
          querying of detailed heap snapshots.
        - Add boilerplate code for the new view.
        - Factor out common code.

        https://bugs.webkit.org/show_bug.cgi?id=52624

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * bindings/js/ScriptProfiler.h:
        (WebCore::ScriptProfiler::HeapSnapshotControl::~HeapSnapshotControl):
        (WebCore::ScriptProfiler::takeHeapSnapshot):
        * bindings/v8/ScriptProfiler.cpp:
        (WebCore::ScriptProfiler::takeHeapSnapshot):
        * bindings/v8/ScriptProfiler.h:
        (WebCore::ScriptProfiler::HeapSnapshotControl::~HeapSnapshotControl):
        * inspector/Inspector.idl:
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::takeHeapSnapshot):
        * inspector/InspectorProfilerAgent.h:
        * inspector/front-end/DetailedHeapshotView.js: Added.
        (WebInspector.DetailedHeapshotView):
        (WebInspector.DetailedHeapshotView.prototype.get statusBarItems):
        (WebInspector.DetailedHeapshotView.prototype.get profile):
        (WebInspector.DetailedHeapshotView.prototype.set profile):
        (WebInspector.DetailedHeapshotView.prototype.show):
        (WebInspector.DetailedHeapshotView.prototype.hide):
        (WebInspector.DetailedHeapshotProfileType):
        (WebInspector.DetailedHeapshotProfileType.prototype.get buttonTooltip):
        (WebInspector.DetailedHeapshotProfileType.prototype.get buttonStyle):
        (WebInspector.DetailedHeapshotProfileType.prototype.buttonClicked):
        (WebInspector.DetailedHeapshotProfileType.prototype.get welcomeMessage):
        (WebInspector.DetailedHeapshotProfileType.prototype.createSidebarTreeElementForProfile):
        (WebInspector.DetailedHeapshotProfileType.prototype.createView):
        * inspector/front-end/HeapSnapshot.js: Added.
        (WebInspector.HeapSnapshotEdgesIterator):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.get done):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.get isElement):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.get isHidden):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.get name):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.next):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.get node):
        (WebInspector.HeapSnapshotEdgesIterator.prototype.get nodeIndex):
        (WebInspector.HeapSnapshotEdgesIterator.prototype._getNameOrIndex):
        (WebInspector.HeapSnapshotEdgesIterator.prototype._getType):
        (WebInspector.HeapSnapshotNodeWrapper):
        (WebInspector.HeapSnapshotNodeWrapper.prototype.get edges):
        (WebInspector.HeapSnapshotNodeWrapper.prototype.get edgesCount):
        (WebInspector.HeapSnapshotNodeWrapper.prototype.get instancesCount):
        (WebInspector.HeapSnapshotNodeWrapper.prototype.get isHidden):
        (WebInspector.HeapSnapshotNodeWrapper.prototype.get name):
        (WebInspector.HeapSnapshotNodeWrapper.prototype.get selfSize):
        (WebInspector.HeapSnapshotNodeWrapper.prototype._getName):
        (WebInspector.HeapSnapshotNodeWrapper.prototype._getEdges):
        (WebInspector.HeapSnapshotNodeWrapper.prototype._getType):
        (WebInspector.HeapSnapshot):
        (WebInspector.HeapSnapshot.prototype._init):
        (WebInspector.HeapSnapshot.prototype.get rootEdges):
        * inspector/front-end/HeapSnapshotView.js:
        (WebInspector.HeapSnapshotProfileType.prototype.buttonClicked):
        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel.prototype._setRecordingProfile):
        (WebInspector.ProfilesPanel.prototype._reportHeapSnapshotProgress):
        (WebInspector.ProfilerDispatcher.prototype.setRecordingProfile):
        (WebInspector.ProfilerDispatcher.prototype.reportHeapSnapshotProgress):
        * inspector/front-end/Settings.js:
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/inspector.html:
        * inspector/front-end/inspector.js:
        (WebInspector._createPanels):

2011-01-25  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: remove "attached" state related methods from InspectorAgent
        https://bugs.webkit.org/show_bug.cgi?id=53086

        * WebCore.exp.in:
        * inspector/InspectorAgent.cpp:
        * inspector/InspectorAgent.h:
        * inspector/InspectorFrontendClientLocal.cpp:
        (WebCore::InspectorFrontendClientLocal::changeAttachedWindowHeight):
        (WebCore::InspectorFrontendClientLocal::restoreAttachedWindowHeight):
        * inspector/InspectorSettings.cpp:
        (WebCore::InspectorSettings::InspectorSettings):
        * inspector/InspectorSettings.h:

2011-01-25  Qi Zhang  <qi.2.zhang@nokia.com>

        Reviewed by Laszlo Gombos.

        [Symbian] RVCT fails to compile [U|I]nt[8|16|32]Array.h
        https://bugs.webkit.org/show_bug.cgi?id=51873
        
        Replace the using declaration, because it doesn't compile on RVCT, and WINSCW has the same issue.
        No new functionality so no new tests.

        * html/canvas/Int32Array.h:
        (WebCore::Int32Array::set):
        * html/canvas/Int8Array.h:
        (WebCore::Int8Array::set):
        * html/canvas/Uint16Array.h:
        (WebCore::Uint16Array::set):
        * html/canvas/Uint32Array.h:
        (WebCore::Uint32Array::set):
        * html/canvas/Uint8Array.h:
        (WebCore::Uint8Array::set):

2011-01-25  Zoltan Herczeg  <zherczeg@webkit.org>

        Reviewed by Dirk Schulze.

        Repaint SVG elements with filter instead of relayout where possible
        https://bugs.webkit.org/show_bug.cgi?id=52200

        This patch allows repainting of filters, when their
        attribute changes does not require relayout.

        Existing dynamic-update tests cover this feature.

        * platform/graphics/filters/FilterEffect.cpp:
        (WebCore::FilterEffect::clearResult): Clearing the currently stored image
        before repainting.
        * platform/graphics/filters/FilterEffect.h:
        * rendering/RenderObject.h:
        (WebCore::RenderObject::isSVGResourceFilter): Not only the filter primitives,
        but filters should also be detected to allow safe testing and casting.
        * rendering/svg/RenderSVGResourceFilter.cpp:
        (WebCore::RenderSVGResourceFilter::buildPrimitives): Passing the renderer.
        (WebCore::RenderSVGResourceFilter::applyResource):
        determineFilterPrimitiveSubregion does not require the filter anymore.
        (WebCore::RenderSVGResourceFilter::postApplyResource): Repaint
        if lastEffect->hasResult() is false.
        (WebCore::RenderSVGResourceFilter::primitiveAttributeChanged):
        Searching for all FilterEffects, whose created by the current FilterElement,
        and clearing all resulting images depending on those FilterEffects.
        * rendering/svg/RenderSVGResourceFilter.h:
        (WebCore::RenderSVGResourceFilter::isSVGResourceFilter):
        * rendering/svg/RenderSVGResourceFilterPrimitive.cpp:
        (WebCore::RenderSVGResourceFilterPrimitive::determineFilterPrimitiveSubregion):
        The filter argument is unnecessary anymore. But is is still kept as a static
        member, since the primitive renderer still does not know about the
        FilterEffect objects.
        * rendering/svg/RenderSVGResourceFilterPrimitive.h:
        (WebCore::RenderSVGResourceFilterPrimitive::RenderSVGResourceFilterPrimitive):
        (WebCore::RenderSVGResourceFilterPrimitive::primitiveAttributeChanged):
        Calls RenderSVGResourceFilter::primitiveAttributeChanged.
        * svg/SVGFEDiffuseLightingElement.cpp:
        (WebCore::SVGFEDiffuseLightingElement::setFilterEffectAttribute):
        Setting the new attribute value for each FilterEffect.
        (WebCore::SVGFEDiffuseLightingElement::svgAttributeChanged):
        * svg/SVGFEDiffuseLightingElement.h:
        Calling primitiveAttributeChanged.
        * svg/SVGFilterPrimitiveStandardAttributes.cpp:
        (WebCore::SVGFilterPrimitiveStandardAttributes::setFilterEffectAttribute):
        This function will be removed when all FilterElement implements
        their setFilterEffectAttribute
        * svg/SVGFilterPrimitiveStandardAttributes.h:
        (WebCore::SVGFilterPrimitiveStandardAttributes::primitiveAttributeChanged):
        * svg/graphics/filters/SVGFilterBuilder.cpp:
        (WebCore::SVGFilterBuilder::appendEffectToEffectReferences): The
        renderers are assigned to the filter effects.
        (WebCore::SVGFilterBuilder::clearEffects):
        (WebCore::SVGFilterBuilder::clearResultsRecursive): Recursively
        clearing the result images for those filters, whose depend on
        the starting filter.
        * svg/graphics/filters/SVGFilterBuilder.h:
        (WebCore::SVGFilterBuilder::effectReferences): 'get' is unnecessary
        (WebCore::SVGFilterBuilder::effectByRenderer): returns the
        FilterEffect belongs to this RenderObject.

2011-01-25  Dirk Schulze  <krit@webkit.org>

        Reviewed by Nikolas Zimmermann.

        SVG is missing to-animation support for Path
        https://bugs.webkit.org/show_bug.cgi?id=52982

        SVG was missing 'to' animation support for SVG paths. Even the fallback to discrete
        animation did not work and an assert was thrown, because of the missing m_fromPath.
        This also influences a test of the W3C test suite. Subtest 2 of animate-elem-83-t.svg passes now.

        Test: svg/animations/animate-path-to-animation.html

        * svg/SVGAnimateElement.cpp:
        (WebCore::SVGAnimateElement::calculateAnimatedValue): Take the value of the last SVGAnimateElement for
        m_fromPath, since 'to' animations are accumulative.
        (WebCore::SVGAnimateElement::calculateFromAndToValues): Added support for 'to' animations.
        (WebCore::SVGAnimateElement::resetToBaseValue): Set m_animatedPath on the first animation element to baseVal.
        * svg/SVGPathByteStream.h:
        (WebCore::SVGPathByteStream::copySVGPathByteStream): Return copy of current byte stream.

2011-01-25  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: bind resources to URLs upon adding them into the tree.
        https://bugs.webkit.org/show_bug.cgi?id=53013

        * inspector/front-end/AuditRules.js:
        (WebInspector.AuditRules.UnusedCssRule.prototype.doRun.evalCallback.selectorsCallback):
        * inspector/front-end/CSSStyleModel.js:
        (WebInspector.CSSStyleModel.prototype._styleSheetChanged.callback):
        (WebInspector.CSSStyleModel.prototype._styleSheetChanged):
        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel.prototype._parsedScriptSource):
        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager.prototype._processCachedResources):
        (WebInspector.NetworkManager.prototype.inflightResourceForURL):
        (WebInspector.NetworkDispatcher):
        (WebInspector.NetworkDispatcher.prototype.willSendRequest):
        (WebInspector.NetworkDispatcher.prototype.markResourceAsCached):
        (WebInspector.NetworkDispatcher.prototype.didReceiveResponse):
        (WebInspector.NetworkDispatcher.prototype.didReceiveContentLength):
        (WebInspector.NetworkDispatcher.prototype.didFinishLoading):
        (WebInspector.NetworkDispatcher.prototype.didFailLoading):
        (WebInspector.NetworkDispatcher.prototype.willSendWebSocketHandshakeRequest):
        (WebInspector.NetworkDispatcher.prototype.didReceiveWebSocketHandshakeResponse):
        (WebInspector.NetworkDispatcher.prototype.didCloseWebSocket):
        (WebInspector.NetworkDispatcher.prototype._appendRedirect):
        (WebInspector.NetworkDispatcher.prototype._startResource):
        (WebInspector.NetworkDispatcher.prototype._finishResource):
        (WebInspector.NetworkDispatcher.prototype._createResource):
        * inspector/front-end/ResourceTreeModel.js:
        (WebInspector.ResourceTreeModel.prototype.addResourceToFrame):
        (WebInspector.ResourceTreeModel.prototype._bindResourceURL):
        (WebInspector.ResourceTreeModel.prototype._clearResources):
        (WebInspector.ResourceTreeModel.prototype._unbindResourceURL):
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel.prototype.canShowSourceLine):
        (WebInspector.ResourcesPanel.prototype.showSourceLine):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._parsedScriptSource):
        (WebInspector.ScriptsPanel.prototype._addScript):

2011-01-25  Nikolas Zimmermann  <nzimmermann@rim.com>

        Reviewed by Dirk Schulze.

        Introduce FontMetrics abstraction
        https://bugs.webkit.org/show_bug.cgi?id=51456

        Use accurate floating-point metrics for SVG Font calculations instead of casting float -> integer.
        This hopefully fixes differences between 32/64 bit bots.

        Needs new layout test results for several platforms, which need to be taken from the bots landing afterwards.

        * platform/graphics/SimpleFontData.cpp:
        (WebCore::SimpleFontData::SimpleFontData):
        (WebCore::SimpleFontData::initCharWidths):

2011-01-24  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: debugger and browser debugger agents should manage sticky breakpoints independently.
        https://bugs.webkit.org/show_bug.cgi?id=52999

        * inspector/Inspector.idl:
        * inspector/InspectorAgent.cpp:
        (WebCore::InspectorAgent::didCommitLoad):
        (WebCore::InspectorAgent::enableDebugger):
        (WebCore::InspectorAgent::inspectedURLWithoutFragment):
        * inspector/InspectorAgent.h:
        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::setAllBrowserBreakpoints):
        (WebCore::InspectorBrowserDebuggerAgent::inspectedURLChanged):
        (WebCore::InspectorBrowserDebuggerAgent::restoreStickyBreakpoint):
        * inspector/InspectorBrowserDebuggerAgent.h:
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::InspectorDebuggerAgent):
        (WebCore::InspectorDebuggerAgent::setAllJavaScriptBreakpoints):
        (WebCore::InspectorDebuggerAgent::inspectedURLChanged):
        (WebCore::InspectorDebuggerAgent::restoreBreakpoints):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/BreakpointManager.js:
        (WebInspector.BreakpointManager):
        (WebInspector.BreakpointManager.prototype._projectChanged):
        (WebInspector.BreakpointManager.prototype._saveBreakpoints):
        (WebInspector.BreakpointManager.prototype._pushBreakpointsToBackend):

2011-01-25  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Crash in some pages containing flash
        https://bugs.webkit.org/show_bug.cgi?id=53016

        Flash plugin can produce X errors that are handled by the GDK X
        error handler, which exits the process. Since we don't want to
        crash due to flash bugs, we install a custom error handler to show
        a warning when a X error happens without aborting.

        * plugins/gtk/PluginPackageGtk.cpp:
        (WebCore::webkitgtkXError):
        (WebCore::PluginPackage::load):

2011-01-25  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Implement spin buttons in RenderThemeGtk
        https://bugs.webkit.org/show_bug.cgi?id=51454

        Paint inner up/down buttons for spin button elements when building
        with GTK+ 3.x.

        Test results will land with the GTK+ 2.x version of this patch.

        * platform/gtk/RenderThemeGtk.h:
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::adjustInnerSpinButtonStyle):
        (WebCore::RenderThemeGtk::paintInnerSpinButton):
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::spinButtonArrowSize):
        (WebCore::RenderThemeGtk::adjustInnerSpinButtonStyle):
        (WebCore::paintSpinArrowButton):
        (WebCore::RenderThemeGtk::paintInnerSpinButton):

2011-01-24  Mihai Parparita  <mihaip@chromium.org>

        Unreviewed. Missed move of one m_deleted use to be outside NDEBUG block
        in r76575.

        * loader/cache/CachedResource.cpp:
        (WebCore::CachedResource::~CachedResource):

2011-01-24  Mihai Parparita  <mihaip@chromium.org>

        Reviewed by Tony Chang.

        Add runtime checks for invariants in memory cache
        https://bugs.webkit.org/show_bug.cgi?id=53059
        
        To help track down bug 53045, add some CRASH calls in addition to
        ASSERTs, so that we can track down failures in reliability bots.

        Just some checks, no new tests necessary.
        
        * css/CSSImageValue.cpp:
        (WebCore::CSSImageValue::cachedImage):
        * loader/cache/CachedResource.h:
        * loader/cache/CachedResource.cpp:
        (WebCore::CachedResource::~CachedResource):

2011-01-24  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dan Bernstein.

        Leaking CSSRuleDataList objects
        https://bugs.webkit.org/show_bug.cgi?id=53062

        Fix leaked CSSRuleDataLists added to the m_pseudoRules hash.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSRuleSet::~CSSRuleSet):

2011-01-24  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Eric Seidel.

        Refcount Images used in rendering code
        https://bugs.webkit.org/show_bug.cgi?id=52701

        Change StyleImage::image(RenderObject*, const IntSize&) and
        CSSImageGeneratorValue::image(RenderObject*, const IntSize&) to
        return PassRefPtr<Image>, and adjust other code accordingly.
        
        This allows us to return one-time images, for example for CSS gradients
        whose appearance may change depending on factors other than the renderer
        and the destination size.

        * css/CSSCanvasValue.cpp:
        (WebCore::CSSCanvasValue::image):
        * css/CSSCanvasValue.h:
        * css/CSSGradientValue.cpp:
        (WebCore::CSSGradientValue::image):
        * css/CSSGradientValue.h:
        * css/CSSImageGeneratorValue.h:
        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
        (WebCore::RenderBoxModelObject::paintNinePieceImage):
        * rendering/RenderImage.cpp:
        (WebCore::RenderImage::paintReplaced):
        (WebCore::RenderImage::paintIntoRect):
        * rendering/RenderImageResource.h:
        (WebCore::RenderImageResource::image):
        * rendering/RenderImageResourceStyleImage.h:
        (WebCore::RenderImageResourceStyleImage::image):
        * rendering/RenderListMarker.cpp:
        (WebCore::RenderListMarker::paint):
        * rendering/style/StyleCachedImage.cpp:
        (WebCore::StyleCachedImage::image):
        * rendering/style/StyleCachedImage.h:
        * rendering/style/StyleGeneratedImage.cpp:
        (WebCore::StyleGeneratedImage::image):
        * rendering/style/StyleGeneratedImage.h:
        * rendering/style/StyleImage.h:
        * rendering/style/StylePendingImage.h:
        (WebCore::StylePendingImage::image):
        * rendering/svg/RenderSVGImage.cpp:
        (WebCore::RenderSVGImage::paint):

2011-01-24  Tony Chang  <tony@chromium.org>

        Unreviewed, round ascent and descent to match old code.

        * platform/graphics/chromium/SimpleFontDataLinux.cpp:
        (WebCore::SimpleFontData::platformInit):

2011-01-24  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Chris Marrin.

        perspective() transform function should take lengths
        https://bugs.webkit.org/show_bug.cgi?id=52683
        
        The argument to the perspective() transform function should
        be a Length, rather than a bare number. Bare numbers are still
        accepted (and treated as px), but this behavior is deprecated.

        Test: animations/3d/transform-perspective.html
              transforms/3d/general/3dtransform-values.html

        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseTransform): Check the units for the perspective()
        function. Allow bare numbers for backwards compatibility.
        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::createTransformOperations): Convert
        value to Length.
        * platform/graphics/transforms/PerspectiveTransformOperation.cpp:
        (WebCore::clampToPostiveInteger): Helper.
        (WebCore::PerspectiveTransformOperation::blend): Blend via Lengths.
        * platform/graphics/transforms/PerspectiveTransformOperation.h:
        (WebCore::PerspectiveTransformOperation::create): double -> Length.
        (WebCore::PerspectiveTransformOperation::perspective): Ditto.
        (WebCore::PerspectiveTransformOperation::isIdentity): Ditto.
        (WebCore::PerspectiveTransformOperation::apply): Ditto.
        (WebCore::PerspectiveTransformOperation::PerspectiveTransformOperation): Assert
        that the Length is a fixed type.

2011-01-24  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        [Windows] Textfield <input>s have different widths.
        https://bugs.webkit.org/show_bug.cgi?id=48405

        - Apply the padding override for type=text to other textfield types too.
        - Reset margin value of outer spin button, which is not used in Windows.
        - Don't add inner spin button width to the preferred text field width.
          Text fields should have the identical widths regardless of the
          existence of spin buttons.

        Test: fast/forms/input-widths.html

        * css/themeWin.css:
        (input[type="week"]):
        (input[type="week"]:disabled):
        (input[type="search"]::-webkit-search-cancel-button):
        (input::-webkit-outer-spin-button):
        * rendering/RenderTextControlSingleLine.cpp:
        (WebCore::RenderTextControlSingleLine::preferredContentWidth):
        Don't add inner spin button width to the preferred width.

2011-01-24  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        Some bugs of search cancel button and spin button about state change in
        an event handler.
        https://bugs.webkit.org/show_bug.cgi?id=46950

        Fix the following problems:
         * Type=search field didn't release event capturing
         * Assertion failure when an input field with spin buttons was changed
           to another type on focus event.
         * A input field with spin button didn't release event capturing when it
           was changed to another type on focus event.

        Tests: fast/forms/input-number-change-type-on-focus.html
               fast/forms/search-hide-cancel-on-cancel.html

        * rendering/TextControlInnerElements.cpp:
        (WebCore::SearchFieldCancelButtonElement::defaultEventHandler):
         - Make the variable 'input' RefPtr.  It makes the code simpler.
         - Remove visibility check on mouseup event. We should release capturing
           anyway because the cancel button may be invisible if JavaScript code
           called by the focus event removes the input value.
        (WebCore::SpinButtonElement::detach):
         - Release capturing on detach because it is possible that a spin button
           node is detached while it is capturing events.
        (WebCore::SpinButtonElement::defaultEventHandler):
          Take a reference to this and check renderer() after some functions which
          may run JavaScript code.
        (WebCore::InputFieldSpeechButtonElement::defaultEventHandler):
          Make the variable 'input' RefPtr to align other functions in this file.
        (WebCore::InputFieldSpeechButtonElement::setRecognitionResult): ditto.
        * rendering/TextControlInnerElements.h: Declare SpinButtonElement::detach().

2011-01-24  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Ojan Vafai.

        Inserting multiple whitespace using text composition (IME) should insert interleaved nbsp and whitespace.
        https://bugs.webkit.org/show_bug.cgi?id=52781

        The bug was caused by stringWithRebalancedWhitespace's replacing the space at the beginning of a paragraph
        and the end of a paragraph by a non-breaking space after it replaced two consecutive spaces by a space and
        non-breaking space pattern, thereby replacing more spaces by non-breaking spaces than needed.

        Rewrote the function using Vector<UChar> to fix the bug. New function no longer calls String::replace
        multiple times but instead it traverses through the string and replaces a space that immediately follows
        another space or appears at the beginning of a paragraph or at the end of a paragraph by a non-break space.

        * editing/CompositeEditCommand.cpp:
        * editing/htmlediting.cpp:
        (WebCore::stringWithRebalancedWhitespace): Written.
        * editing/htmlediting.h:
        (WebCore::isWhitespace): Removed from CompositeEditCommand.cpp

2011-01-24  Kenneth Russell  <kbr@google.com>

        Reviewed by James Robinson.

        Web Audio API: port FFTFrame to FFTW
        https://bugs.webkit.org/show_bug.cgi?id=52989

        Ported FFTFrame class to the open-source FFTW library. Tested with
        unit tests from Chris Rogers. Made preliminary changes to GYP
        files for conditional compilation of these files; will need to be
        adjusted once FFTW is integrated as third-party source.

        * WebCore.gyp/WebCore.gyp:
        * WebCore.gypi:
        * platform/audio/FFTFrame.h:
        * platform/audio/fftw: Added.
        * platform/audio/fftw/FFTFrameFFTW.cpp: Added.
        (WebCore::FFTFrame::FFTFrame):
        (WebCore::FFTFrame::~FFTFrame):
        (WebCore::FFTFrame::multiply):
        (WebCore::FFTFrame::doFFT):
        (WebCore::FFTFrame::doInverseFFT):
        (WebCore::FFTFrame::cleanup):
        (WebCore::FFTFrame::realData):
        (WebCore::FFTFrame::imagData):
        (WebCore::FFTFrame::fftwPlanForSize):

2011-01-24  Anders Carlsson  <andersca@apple.com>

        Reviewed by Dan Bernstein.

        Reset the page scale factor on standard frame loads
        https://bugs.webkit.org/show_bug.cgi?id=53058
        <rdar://problem/8908844>

        Add a symbol needed by WebKit2.

        * WebCore.exp.in:

2011-01-24  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        Stop instantiating legacy editing positions in InsertTextCommand, MoveSelectionCommand,
        ReplaceSelectionCommand, SelectionController, SpellChecker, TypingCommand, and markup.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52676

        Stop instantiating legacy editing positions in the following files.

        * editing/InsertTextCommand.cpp:
        (WebCore::InsertTextCommand::prepareForTextInsertion):
        (WebCore::InsertTextCommand::performTrivialReplace):
        (WebCore::InsertTextCommand::input):
        (WebCore::InsertTextCommand::insertTab):
        * editing/MoveSelectionCommand.cpp:
        (WebCore::MoveSelectionCommand::doApply):
        * editing/ReplaceSelectionCommand.cpp:
        (WebCore::ReplaceSelectionCommand::removeUnrenderedTextNodesAtEnds):
        (WebCore::ReplaceSelectionCommand::mergeEndIfNeeded):
        (WebCore::ReplaceSelectionCommand::doApply):
        (WebCore::ReplaceSelectionCommand::shouldRemoveEndBR):
        (WebCore::ReplaceSelectionCommand::performTrivialReplace):
        * editing/SelectionController.cpp:
        (WebCore::SelectionController::setSelectionFromNone):
        * editing/SpellChecker.cpp:
        (WebCore::SpellChecker::didCheck):
        * editing/TypingCommand.cpp:
        (WebCore::TypingCommand::makeEditableRootEmpty):
        (WebCore::TypingCommand::deleteKeyPressed):
        (WebCore::TypingCommand::forwardDeleteKeyPressed):
        * editing/markup.cpp:
        (WebCore::StyledMarkupAccumulator::appendText):
        (WebCore::StyledMarkupAccumulator::serializeNodes):
        (WebCore::highestAncestorToWrapMarkup):
        (WebCore::createMarkup):

2011-01-24  Peter Kasting  <pkasting@google.com>

        Reviewed by Darin Adler.

        Roll back r67261 ("Don't fire onclick on middle clicks") due to
        regressions.
        https://bugs.webkit.org/show_bug.cgi?id=46733

        * html/HTMLAnchorElement.cpp:
        (WebCore::isLinkClick):
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::preDispatchEventHandler):
        (WebCore::HTMLInputElement::postDispatchEventHandler):
        (WebCore::HTMLInputElement::defaultEventHandler):
        * page/EventHandler.cpp:
        (WebCore::EventHandler::handleMouseDoubleClickEvent):
        (WebCore::EventHandler::handleMouseReleaseEvent):

2011-01-24  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Eric Seidel.

        [GTK] Many DOM XHTML tests time out
        https://bugs.webkit.org/show_bug.cgi?id=52553

        Properly handle the situation where a synchronous load fails before the inner
        event loop has started. In this case, we simply do not run the inner event loop,
        or else it will block indefinitely (since no GIO or libsoup callbacks will fire).

        * platform/network/soup/ResourceHandleSoup.cpp:
        (WebCore::ResourceHandle::loadResourceSynchronously): Bail out of a synchronous
        load if it fails up front.

2011-01-24  Zhenyao Mo  <zmo@google.com>

        Reviewed by Eric Seidel.

        Cleanup WebGLGetInfo and related get*Parameter helpers in WebGLRenderingContext
        https://bugs.webkit.org/show_bug.cgi?id=52338

        Removed the long/unsigned long types and corresponding get functions
        and use int/unsigned int instead.

        * bindings/js/JSWebGLRenderingContextCustom.cpp:
        (WebCore::toJS):
        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
        (WebCore::toV8Object):
        * html/canvas/WebGLGetInfo.cpp:
        (WebCore::WebGLGetInfo::WebGLGetInfo):
        (WebCore::WebGLGetInfo::getInt):
        (WebCore::WebGLGetInfo::getUnsignedInt):
        * html/canvas/WebGLGetInfo.h:
        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::getBufferParameter):
        (WebCore::WebGLRenderingContext::getFramebufferAttachmentParameter):
        (WebCore::WebGLRenderingContext::getParameter):
        (WebCore::WebGLRenderingContext::getProgramParameter):
        (WebCore::WebGLRenderingContext::getRenderbufferParameter):
        (WebCore::WebGLRenderingContext::getShaderParameter):
        (WebCore::WebGLRenderingContext::getTexParameter):
        (WebCore::WebGLRenderingContext::getUniform):
        (WebCore::WebGLRenderingContext::getVertexAttrib):
        (WebCore::WebGLRenderingContext::getIntParameter):
        (WebCore::WebGLRenderingContext::getUnsignedIntParameter):
        * html/canvas/WebGLRenderingContext.h:

2011-01-24  Zhenyao Mo  <zmo@google.com>

        Reviewed by Darin Adler.

        Remove sizeInBytes from GraphicsContext3D's various implementations
        https://bugs.webkit.org/show_bug.cgi?id=52339

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::sizeInBytes):
        * platform/graphics/GraphicsContext3D.h:
        * platform/graphics/opengl/GraphicsContext3DOpenGL.cpp:
        * platform/graphics/qt/GraphicsContext3DQt.cpp:

2011-01-24  Adam Roben  <aroben@apple.com>

        Windows Production build fix

        * WebCore.vcproj/WebCore.make: Update for move of WebCore into Source.

2011-01-24  Anton Muhin  <antonm@chromium.org>

        Reviewed by Nate Chapin.

        [v8] Refactoring: extract IntrusiveDOMWrapperMap into a seprate class and files.
        https://bugs.webkit.org/show_bug.cgi?id=52911

        Plain refactoring, covered by the existing tests.

        * WebCore.gypi: IntrusiveDOMWrapperMap.h added.
        * bindings/v8/DOMDataStore.cpp: IntrusiveDOMWrapperMap is moved out of DOMDataStore class.
        * bindings/v8/DOMDataStore.h: IntrusiveDOMWrapperMap is moved out of DOMDataStore class.
        * bindings/v8/IntrusiveDOMWrapperMap.h: Added.
        (WebCore::ChunkedTable::ChunkedTable):
        (WebCore::ChunkedTable::add):
        (WebCore::ChunkedTable::remove):
        (WebCore::ChunkedTable::clear):
        (WebCore::ChunkedTable::visit):
        (WebCore::ChunkedTable::Chunk::Chunk):
        (WebCore::ChunkedTable::clearEntries):
        (WebCore::ChunkedTable::visitEntries):
        (WebCore::IntrusiveDOMWrapperMap::IntrusiveDOMWrapperMap):
        (WebCore::IntrusiveDOMWrapperMap::get):
        (WebCore::IntrusiveDOMWrapperMap::set):
        (WebCore::IntrusiveDOMWrapperMap::contains):
        (WebCore::IntrusiveDOMWrapperMap::visit):
        (WebCore::IntrusiveDOMWrapperMap::removeIfPresent):
        (WebCore::IntrusiveDOMWrapperMap::clear):
        (WebCore::IntrusiveDOMWrapperMap::ChunkedTableTraits::move):
        (WebCore::IntrusiveDOMWrapperMap::ChunkedTableTraits::clear):
        (WebCore::IntrusiveDOMWrapperMap::ChunkedTableTraits::visit):
        * bindings/v8/StaticDOMDataStore.h: include added.

2011-01-24  Shane Stephens  <shanestephens@google.com>

        Reviewed by Chris Marrin.

        TransformationMatrix multiply operations apply operands in wrong order.
        https://bugs.webkit.org/show_bug.cgi?id=52780

        Rename TranformationMatrix::multLeft into multiply (the method does a multRight,
        not a multLeft).

        Remove TransformationMatrix::multiply, which was actually doing a multLeft.

        Fix TransformationMatrix::operator* and operator*= such that the operand is
        applied to the right-hand side of the matrix that the method is called on.
        i.e., previously "a * b" used to compute "b * a", and "a *= b" used to store
        "b * a" in "a".  This has now been fixed so "a * b" computes "a * b" and
        "a *= b" stores "a * b" in "a".

        Convert all call sites for these methods to provide operands in the correct order.

        No new tests as patch adds no new functionality.

        * css/WebKitCSSMatrix.cpp:
        (WebCore::WebKitCSSMatrix::multiply):
        * platform/graphics/transforms/Matrix3DTransformOperation.h:
        (WebCore::Matrix3DTransformOperation::apply):
        * platform/graphics/transforms/MatrixTransformOperation.h:
        (WebCore::MatrixTransformOperation::apply):
        * platform/graphics/transforms/TransformationMatrix.cpp:
        (WebCore::TransformationMatrix::scaleNonUniform):
        (WebCore::TransformationMatrix::scale3d):
        (WebCore::TransformationMatrix::rotate3d):
        (WebCore::TransformationMatrix::skew):
        (WebCore::TransformationMatrix::applyPerspective):
        (WebCore::TransformationMatrix::multiply):
        (WebCore::TransformationMatrix::recompose):
        * platform/graphics/transforms/TransformationMatrix.h:
        (WebCore::TransformationMatrix::operator*=):
        (WebCore::TransformationMatrix::operator*):
        * rendering/RenderLayer.cpp:
        (WebCore::transparencyClipBox):
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::getTransformFromContainer):
        * rendering/TransformState.cpp:
        (WebCore::TransformState::applyTransform):
        (WebCore::HitTestingTransformState::applyTransform):

2011-01-24  Andrei Popescu  <andreip@google.com>

        Reviewed by Nate Chapin.

        IndexedDatabase methods should not take arguments of type OptionsObject
        https://bugs.webkit.org/show_bug.cgi?id=53012

        This patch reverts all IDB methods, except IDBDatabase::createObjectStore and
        IDBObjectStore::createIndex, to using a plain list of arguments instead of
        grouping the various parameters inside a single OptionsObject argument.
        This decision was made on public-webapps@w3.org mailing list.

        We also add support (v8 only for now) for passing DOMStringList objects as arguments to native
        methods. The code for obtaining a DOMStringList object from a JS array of strings existed already
        in OptionsObject.cpp, I just copied it to V8Bindings.cpp and taught the v8 code generator how to
        use it.

        * bindings/scripts/CodeGeneratorV8.pm:
        * bindings/v8/V8Binding.cpp:
        (WebCore::v8ValueToWebCoreDOMStringList):
        * bindings/v8/V8Binding.h:
        * storage/IDBDatabase.cpp:
        (WebCore::IDBDatabase::transaction):
        * storage/IDBDatabase.h:
        (WebCore::IDBDatabase::transaction):
        * storage/IDBDatabase.idl:
        * storage/IDBIndex.cpp:
        (WebCore::IDBIndex::openCursor):
        (WebCore::IDBIndex::openKeyCursor):
        * storage/IDBIndex.h:
        (WebCore::IDBIndex::openCursor):
        (WebCore::IDBIndex::openKeyCursor):
        * storage/IDBIndex.idl:
        * storage/IDBObjectStore.cpp:
        (WebCore::IDBObjectStore::openCursor):
        * storage/IDBObjectStore.h:
        (WebCore::IDBObjectStore::openCursor):
        * storage/IDBObjectStore.idl:

2011-01-24  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: extract dispatch API from network manager.
        https://bugs.webkit.org/show_bug.cgi?id=53009

        * WebCore.xcodeproj/project.pbxproj:
        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager):
        (WebInspector.NetworkManager.prototype.reset):
        (WebInspector.NetworkManager.prototype.requestContent):
        (WebInspector.NetworkManager.prototype._processCachedResources):
        (WebInspector.NetworkDispatcher):
        (WebInspector.NetworkDispatcher.prototype._updateResourceWithRequest):
        (WebInspector.NetworkDispatcher.prototype._updateResourceWithResponse):
        (WebInspector.NetworkDispatcher.prototype._updateResourceWithCachedResource):
        (WebInspector.NetworkDispatcher.prototype.identifierForInitialRequest):
        (WebInspector.NetworkDispatcher.prototype.willSendRequest):
        (WebInspector.NetworkDispatcher.prototype.didReceiveResponse):
        (WebInspector.NetworkDispatcher.prototype.didLoadResourceFromMemoryCache):
        (WebInspector.NetworkDispatcher.prototype.didCommitLoadForFrame):
        (WebInspector.NetworkDispatcher.prototype.didCreateWebSocket):
        (WebInspector.NetworkDispatcher.prototype._appendRedirect):
        (WebInspector.NetworkDispatcher.prototype._startResource):
        (WebInspector.NetworkDispatcher.prototype._updateResource):
        (WebInspector.NetworkDispatcher.prototype._finishResource):
        (WebInspector.NetworkDispatcher.prototype._addFramesRecursively):
        (WebInspector.NetworkDispatcher.prototype._dispatchEventToListeners):
        (WebInspector.NetworkDispatcher.prototype._createResource):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource.prototype._innerRequestContent):
        * inspector/front-end/ResourceTreeModel.js:
        (WebInspector.ResourceTreeModel):
        (WebInspector.ResourceTreeModel.prototype.reset):
        (WebInspector.ResourceTreeModel.prototype.unbindResourceURL):

2011-01-24  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [JSC] remove ScriptDebugServer::pageCreated
        https://bugs.webkit.org/show_bug.cgi?id=53007

        It's impossible to create "provisional" inspector for pages which are
        not yet created so there is no need to listen for page creation in ScriptDebugServer.

        * bindings/js/ScriptDebugServer.cpp:
        * bindings/js/ScriptDebugServer.h:
        * page/Page.cpp:
        (WebCore::Page::Page):

2011-01-24  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [REGRESSION] AppCache view on resources panel is broken.
        https://bugs.webkit.org/show_bug.cgi?id=53002


        * inspector/front-end/ApplicationCacheItemsView.js:
        (WebInspector.ApplicationCacheItemsView.prototype._update):
        * inspector/front-end/DOMAgent.js:
        (WebInspector.ApplicationCacheDispatcher.getApplicationCachesAsync):

2011-01-24  Andreas Kling  <kling@webkit.org>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Fix warnings about unregistering an invalid timer
        https://bugs.webkit.org/show_bug.cgi?id=53006

        The ShadowBuffer's purge timer ID was initialized with 0 which lead
        to us calling QObject::killTimer(0), causing some qWarnings.

        * platform/graphics/qt/ContextShadowQt.cpp:
        (WebCore::ShadowBuffer::ShadowBuffer):
        (WebCore::ShadowBuffer::schedulePurge):

2011-01-21  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Chromium] Fix heap snapshot table sorting.

        Fix table sorting to avoid qsort instability artefacts.

        https://bugs.webkit.org/show_bug.cgi?id=52914

        * inspector/front-end/HeapSnapshotView.js:
        (WebInspector.HeapSnapshotView.prototype._sortData):
        (WebInspector.HeapSnapshotDataGridList.propertyComparator.comparator):
        (WebInspector.HeapSnapshotDataGridList.propertyComparator):

2011-01-24  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Find duplicate strings in localizedStrings.js, update it.

        https://bugs.webkit.org/show_bug.cgi?id=53005

        * English.lproj/localizedStrings.js:

2011-01-24  Pavel Podivilov  <podivilov@chromium.org>

        Unreviewed, build fix  for r76509.

        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::setBreakpoint):

2011-01-24  Pavel Podivilov  <podivilov@chromium.org>

        Unreviewed, build fix  for r76509.

        * bindings/js/ScriptDebugServer.h:

2011-01-24  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: set breakpoints by line:column.
        https://bugs.webkit.org/show_bug.cgi?id=52615

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::setBreakpoint):
        (WebCore::ScriptDebugServer::removeBreakpoint):
        (WebCore::ScriptDebugServer::hasBreakpoint):
        (WebCore::ScriptDebugServer::clearBreakpoints):
        * bindings/js/ScriptDebugServer.h:
        * bindings/v8/DebuggerScript.js:
        ():
        * bindings/v8/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::setBreakpoint):
        * bindings/v8/ScriptDebugServer.h:
        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::restoreStickyBreakpoint):
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::setStickyBreakpoint):
        (WebCore::InspectorDebuggerAgent::setBreakpoint):
        (WebCore::InspectorDebuggerAgent::restoreBreakpoint):
        (WebCore::InspectorDebuggerAgent::didParseSource):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/ScriptBreakpoint.cpp: Removed.
        * inspector/ScriptBreakpoint.h:
        (WebCore::ScriptBreakpoint::ScriptBreakpoint):
        * inspector/front-end/Breakpoint.js:
        (WebInspector.Breakpoint):
        (WebInspector.Breakpoint.prototype.get url):
        * inspector/front-end/BreakpointManager.js:
        (WebInspector.JavaScriptBreakpoint.prototype._serializeToJSON):
        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel.prototype.continueToLine):
        (WebInspector.DebuggerModel.prototype.setBreakpoint):
        (WebInspector.DebuggerModel.prototype._breakpointSetOnBackend):
        (WebInspector.DebuggerDispatcher.prototype.breakpointResolved):

2011-01-24  Peter Beverloo  <peter@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: recognize application/x-font-woff as a valid mime-type.
        https://bugs.webkit.org/show_bug.cgi?id=52977

        No new tests.

        * inspector/front-end/inspector.js:

2011-01-24  Pavel Podivilov  <podivilov@chromium.org>

        Unreviewed, fix for r76497.

        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel.prototype.show):

2011-01-24  Andreas Kling  <kling@webkit.org>

        Reviewed by Tor Arne Vestbø.

        [Qt] Use rad2deg() from WTF instead of rolling our own.
        https://bugs.webkit.org/show_bug.cgi?id=52993

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::rotate):
        * platform/graphics/qt/PathQt.cpp:
        (WebCore::Path::addArc):

2011-01-24  Sergio Villar Senin  <svillar@igalia.com>

        Reviewed by Martin Robinson.

        [Gtk] ResourceHandleSoup: do not wait for streams to close to issue didFinishLoading
        https://bugs.webkit.org/show_bug.cgi?id=52885

        No new tests as it does not change functionality. We will not wait for
        the the input stream to close to issue didFinishLoading to
        WebCore. We expect a subtle performance improvement with this
        patch when loading complex web pages, as we wouldn't have to wait
        for the stream to close (which involves creating a thread among
        other things).

        * platform/network/soup/ResourceHandleSoup.cpp:
        (WebCore::closeCallback):
        (WebCore::readCallback):

2011-01-21  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: eliminate SourceView and ScriptView classes.
        https://bugs.webkit.org/show_bug.cgi?id=52896

        SourceView and ScriptView delegate everything to SourceFrame and should be eliminated.

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * inspector/front-end/GoToLineDialog.js:
        (WebInspector.GoToLineDialog.prototype._highlightSelectedLine):
        * inspector/front-end/ResourceView.js:
        (WebInspector.ResourceView.createResourceView):
        (WebInspector.ResourceView.resourceViewTypeMatchesResource):
        (WebInspector.SourceFrameContentProviderForResource):  Moved from SourceView.
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel.prototype.show):
        (WebInspector.ResourcesPanel.prototype._applyDiffMarkup):
        (WebInspector.FrameResourceTreeElement.prototype._errorsWarningsUpdated):
        * inspector/front-end/ScriptView.js: Removed.
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._scriptSourceChanged):
        (WebInspector.ScriptsPanel.prototype._sourceFrameForScriptOrResource):
        (WebInspector.ScriptsPanel.prototype._showScriptOrResource):
        (WebInspector.ScriptsPanel.prototype._setPauseOnExceptions):
        (WebInspector.ScriptsPanel.prototype._formatScript):
        (WebInspector.SourceFrameContentProviderForScript): Moved from ScriptView.
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame):
        (WebInspector.SourceFrame.prototype.show):
        (WebInspector.SourceFrame.prototype.hide):
        (WebInspector.SourceFrame.prototype.hasContent):
        (WebInspector.SourceFrame.prototype._createTextViewer):
        (WebInspector.SourceFrame.prototype.performSearch.doFindSearchMatches):
        (WebInspector.SourceFrame.prototype.performSearch):
        * inspector/front-end/SourceView.js: Removed.
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/inspector.html:

2011-01-24  Andras Becsi  <abecsi@webkit.org>

        Reviewed by Csaba Osztrogonác.

        [Qt] Move project files into Source
        https://bugs.webkit.org/show_bug.cgi?id=52891

        No new tests needed.

        * WebCore.pri:
        * WebCore.pro:

2011-01-24  Kent Tamura  <tkent@chromium.org>

        Unreviewed, trivial fix.

        Fix a Chromium-only assertion failure by r76491.
        https://bugs.webkit.org/show_bug.cgi?id=38982

        Separate icon loading from the FileChooser constructor in order to avoid
        ref() before adoptRef().

        * platform/FileChooser.cpp:
        (WebCore::FileChooser::FileChooser):
        (WebCore::FileChooser::initialize):
        (WebCore::FileChooser::create):
        * platform/FileChooser.h:

2011-01-24  MORITA Hajime  <morrita@google.com>

        Reviewed by Kent Tamura.

        TextControlInnerElement::m_shadowParent should be removed.
        https://bugs.webkit.org/show_bug.cgi?id=52998

        No new tests. No behavioral change.

        * rendering/TextControlInnerElements.cpp:
        (WebCore::TextControlInnerElement::TextControlInnerElement):
        * rendering/TextControlInnerElements.h:

2011-01-24  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        REGRESSION (r72895): console.trace crashes
        https://bugs.webkit.org/show_bug.cgi?id=52981

        - Use local RefPtr variable for accessing PassRefPtr arguments to make sure the PassRefPtr has
        non-null value.
        - Use PassRefPtr for objects whos ownership is passed to the inspector.

        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/InspectorConsoleInstrumentation.h: Added. Extract inline methods called from the console into their
        own header to reduce compilation time of other classes that depend on the inspector instrumentation.
        (WebCore::InspectorInstrumentation::addMessageToConsole):
        (WebCore::InspectorInstrumentation::consoleCount):
        (WebCore::InspectorInstrumentation::startConsoleTiming):
        (WebCore::InspectorInstrumentation::stopConsoleTiming):
        (WebCore::InspectorInstrumentation::consoleMarkTimeline):
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsole):
        (WebCore::InspectorInstrumentation::addProfile):
        (WebCore::InspectorInstrumentation::profilerEnabled):
        (WebCore::InspectorInstrumentation::getCurrentUserInitiatedProfileName):
        * inspector/InspectorDatabaseInstrumentation.h: Added. Extract inline methods called from the datanase code into their
        own header to reduce compilation time of other classes that depend on the inspector instrumentation.
        (WebCore::InspectorInstrumentation::didOpenDatabase):
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::addMessageToConsoleImpl):
        (WebCore::InspectorInstrumentation::consoleCountImpl):
        (WebCore::InspectorInstrumentation::stopConsoleTimingImpl):
        (WebCore::InspectorInstrumentation::consoleMarkTimelineImpl):
        (WebCore::InspectorInstrumentation::addProfileImpl):
        (WebCore::InspectorInstrumentation::didOpenDatabaseImpl):
        * inspector/InspectorInstrumentation.h:
        * page/Console.cpp: use RefPtr local variable instead of accessing PassRefPtr argument directly.
        (WebCore::Console::addMessage):
        (WebCore::Console::trace):
        (WebCore::Console::count):
        (WebCore::Console::markTimeline):
        (WebCore::Console::profileEnd):
        (WebCore::Console::timeEnd):
        (WebCore::Console::group):
        (WebCore::Console::groupCollapsed):
        * storage/Database.cpp:
        (WebCore::Database::openDatabase):

2010-01-24  Kent Tamura  <tkent@chromium.org>

        Reviewed by Darin Fisher.

        [Chromium] Support icon loading for <input type=file>
        https://bugs.webkit.org/show_bug.cgi?id=38982

        An icon data in Chromium port is represented as WebCore::Image. We
        don't need OS-specific code anymore.

        * WebCore.gypi:
        * platform/graphics/Icon.h:
        (WebCore::Icon::create): Add Chromium-specific factory.
        * platform/graphics/chromium/IconChromium.cpp: Added.
        * platform/graphics/chromium/IconChromiumLinux.cpp: Removed.
        * platform/graphics/chromium/IconChromiumMac.cpp: Removed.
        * platform/graphics/chromium/IconChromiumWin.cpp: Removed.
        * platform/graphics/chromium/PlatformIcon.h:

2011-01-21  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: move search functions from SourceView to SourceFrame.
        https://bugs.webkit.org/show_bug.cgi?id=52895

        This is the last step before eliminating SourceView and ScriptView since
        this classes just delegate everything to SourceFrame.

        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype.set visible):
        (WebInspector.SourceFrame.prototype._clearLineHighlight):
        (WebInspector.SourceFrame.prototype._createTextViewer):
        (WebInspector.SourceFrame.prototype.performSearch.doFindSearchMatches):
        (WebInspector.SourceFrame.prototype.performSearch):
        (WebInspector.SourceFrame.prototype.searchCanceled):
        (WebInspector.SourceFrame.prototype.jumpToFirstSearchResult):
        (WebInspector.SourceFrame.prototype.jumpToLastSearchResult):
        (WebInspector.SourceFrame.prototype.jumpToNextSearchResult):
        (WebInspector.SourceFrame.prototype.jumpToPreviousSearchResult):
        (WebInspector.SourceFrame.prototype.showingFirstSearchResult):
        (WebInspector.SourceFrame.prototype.showingLastSearchResult):
        (WebInspector.SourceFrame.prototype._jumpToSearchResult):
        * inspector/front-end/SourceView.js:
        (WebInspector.SourceView.prototype.hide):
        (WebInspector.SourceView.prototype.searchCanceled):
        (WebInspector.SourceView.prototype.performSearch):
        (WebInspector.SourceView.prototype.jumpToFirstSearchResult):
        (WebInspector.SourceView.prototype.jumpToLastSearchResult):
        (WebInspector.SourceView.prototype.jumpToNextSearchResult):
        (WebInspector.SourceView.prototype.jumpToPreviousSearchResult):
        (WebInspector.SourceView.prototype.showingFirstSearchResult):
        (WebInspector.SourceView.prototype.showingLastSearchResult):
        (WebInspector.SourceView.prototype.clearMessages):

2011-01-24  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76463.
        http://trac.webkit.org/changeset/76463
        https://bugs.webkit.org/show_bug.cgi?id=52993

        It broke canvas/philip/tests/2d.path.stroke.skew.html
        (Requested by Ossy on #webkit).

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::rotate):
        * platform/graphics/qt/PathQt.cpp:
        (WebCore::Path::addArc):

2011-01-23  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: summary bar is not resized properly with the rest of network panel
        https://bugs.webkit.org/show_bug.cgi?id=52881

        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkPanel.prototype.updateSidebarWidth):
        (WebInspector.NetworkPanel.prototype._positionSummaryBar):
        (WebInspector.NetworkPanel.prototype._toggleGridMode):

2011-01-19  MORITA Hajime  <morrita@google.com>

        Reviewed by Ryosuke Niwa.

        Space and tab characters "sent" by an input method give totally different results than typing them directly
        https://bugs.webkit.org/show_bug.cgi?id=5241
        
        * Introduced TextEvent::InputTypeComposition and TypingCommand::TextCompositionType to 
          distinguish text input which is originated by composition.
        * Generalized rebalanceWhitespaceAt() to rebalanceWhitespaceOnTextSubstring() to rebalancing 
          range of string on text node, instead of surrounding part of that.

        Test: editing/inserting/insert-composition-whitespace.html

        * dom/TextEvent.h:
        (WebCore::TextEvent::isComposition):
        * dom/TextEventInputType.h: Added TextEventInputComposition as a member of TextEvent::InputType
        * editing/CompositeEditCommand.cpp:
        (WebCore::containsOnlyWhitespace):
        (WebCore::CompositeEditCommand::shouldRebalanceLeadingWhitespaceFor):
        (WebCore::CompositeEditCommand::canRebalance):
        (WebCore::CompositeEditCommand::rebalanceWhitespaceAt):
        (WebCore::CompositeEditCommand::rebalanceWhitespaceOnTextSubstring): Added: A generalized version of rebalanceWhitespaceAt(), which takes a range inside Text string.
        * editing/CompositeEditCommand.h:
        * editing/Editor.cpp:
        (WebCore::Editor::insertTextForConfirmedComposition): Added.
        (WebCore::Editor::insertTextWithoutSendingTextEvent):
        (WebCore::Editor::confirmComposition): Now uses insertTextForConfirmedComposition().
        (WebCore::Editor::setComposition):
        * editing/Editor.h:
        * editing/InsertTextCommand.cpp:
        (WebCore::InsertTextCommand::input):
        * editing/InsertTextCommand.h:
        * editing/TypingCommand.cpp:
        (WebCore::TypingCommand::TypingCommand):
        (WebCore::TypingCommand::insertText):
        (WebCore::TypingCommand::insertTextRunWithoutNewlines):
        * editing/TypingCommand.h: Added TypingCommand::m_compositionType and TypingCommand::TextCompositionType
        (WebCore::TypingCommand::setCompositionType): Added.
        (WebCore::TypingCommand::create):

2011-01-23  Mark Rowe  <mrowe@apple.com>

        Follow-up to r76477.

        Fix the scripts that detect problematic code such as static initializers
        and destructors, weak vtables, inappropriate files in the framework wrappers,
        and public headers including private headers. These had all been broken
        since the projects were moved in to the Source directory as the paths to the
        scripts were not updated at that time.

        Stop copying an IDL file in to the framework wrapper. Doing that doesn't even make sense.

        * WebCore.xcodeproj/project.pbxproj:

2011-01-23  Mark Rowe  <mrowe@apple.com>

        Build fix after r76459.

        Static member variables or globals of types that have constructors or destructors are bad as
        they generate static initializers and destructors. This is code that is run either at link time
        when the library is loaded in to memory or at application termination time. Both of these are
        terrible for performance and are thus outlawed in WebKit code.

        The typical solution is to replace the static member or global with a function that allocates
        the necessary variable on the heap. The variable is leaked to prevent it from being destroyed
        at application termination time. The DEFINE_STATIC_LOCAL macro wraps this in to a concise little
        package, but sadly fails to work in this case due to the type containing multiple template
        parameters.
        
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::inspectorAgents):
        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::bindInspectorAgent):
        (WebCore::InspectorInstrumentation::unbindInspectorAgent):
        (WebCore::InspectorInstrumentation::inspectorAgentForPage):

2011-01-21  Vangelis Kokkevis  <vangelis@chromium.org>

        Reviewed by Kenneth Russell.

        [chromium] Add support for -webkit-mask properties to the
        accelerated compositing path.
        https://bugs.webkit.org/show_bug.cgi?id=49780
         
        Tests: Existing tests in LayoutTests/compositing/masks

        * platform/graphics/chromium/ContentLayerChromium.cpp:
        (WebCore::ContentLayerChromium::draw):
        (WebCore::ContentLayerChromium::unreserveContentsTexture):
        (WebCore::ContentLayerChromium::bindContentsTexture):
        * platform/graphics/chromium/ContentLayerChromium.h:
        * platform/graphics/chromium/GraphicsLayerChromium.cpp:
        (WebCore::GraphicsLayerChromium::setMaskLayer):
        * platform/graphics/chromium/GraphicsLayerChromium.h:
        * platform/graphics/chromium/LayerChromium.cpp:
        (WebCore::LayerChromium::LayerChromium):
        * platform/graphics/chromium/LayerChromium.h:
        (WebCore::LayerChromium::setMaskLayer):
        (WebCore::LayerChromium::maskLayer):
        (WebCore::LayerChromium::unreserveContentsTexture):
        (WebCore::LayerChromium::bindContentsTexture):
        * platform/graphics/chromium/LayerRendererChromium.cpp:
        (WebCore::LayerRendererChromium::updateLayersRecursive):
        * platform/graphics/chromium/LayerTexture.cpp:
        (WebCore::LayerTexture::bindTexture):
        * platform/graphics/chromium/RenderSurfaceChromium.cpp:
        (WebCore::RenderSurfaceChromium::SharedValues::SharedValues):
        (WebCore::RenderSurfaceChromium::SharedValues::~SharedValues):
        (WebCore::RenderSurfaceChromium::RenderSurfaceChromium):
        (WebCore::RenderSurfaceChromium::draw):
        * platform/graphics/chromium/RenderSurfaceChromium.h:
        (WebCore::RenderSurfaceChromium::SharedValues::maskShaderProgram):
        (WebCore::RenderSurfaceChromium::SharedValues::maskShaderSamplerLocation):
        (WebCore::RenderSurfaceChromium::SharedValues::maskShaderMaskSamplerLocation):
        (WebCore::RenderSurfaceChromium::SharedValues::maskShaderMatrixLocation):
        (WebCore::RenderSurfaceChromium::SharedValues::maskShaderAlphaLocation):

2011-01-23  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Darin Adler.

        Use WTF::StringHasher in WebCore
        https://bugs.webkit.org/show_bug.cgi?id=52934

        * loader/appcache/ApplicationCacheStorage.cpp:
        (WebCore::urlHostHash):
        * platform/LinkHash.cpp:
        (WebCore::visitedLinkHashInline):
        * platform/cf/BinaryPropertyList.cpp:
        (WebCore::IntegerArrayHash::hash):
        * platform/graphics/wx/FontPlatformDataWx.cpp:
        (WebCore::FontPlatformData::computeHash):
        * platform/network/ProtectionSpaceHash.h:
        (WebCore::ProtectionSpaceHash::hash):

2011-01-23  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by David Kilzer.

        Add an overload to base64Encode with String output
        https://bugs.webkit.org/show_bug.cgi?id=50122

        This change removes duplicated code.

        * inspector/InspectorResourceAgent.cpp:
        (WebCore::InspectorResourceAgent::resourceContentBase64):
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::btoa):
        * platform/graphics/skia/FontCustomPlatformData.cpp:
        (WebCore::createUniqueFontName):
        * platform/graphics/win/FontCustomPlatformData.cpp:
        (WebCore::createUniqueFontName):
        * platform/graphics/wince/FontCustomPlatformData.cpp:
        (WebCore::createUniqueFontName):
        * platform/network/cf/ResourceHandleCFNet.cpp:
        (WebCore::encodeBasicAuthorization):
        * platform/network/mac/ResourceHandleMac.mm:
        (WebCore::encodeBasicAuthorization):
        * platform/text/Base64.cpp:
        (WebCore::base64Encode):
        * platform/text/Base64.h:
        (WebCore::base64Encode):
        * platform/wince/KeygenWinCE.cpp:
        (WebCore::WebCore::signedPublicKeyAndChallengeString):

2011-01-23  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by David Kilzer.

        Add String::containsOnlyLatin1()
        https://bugs.webkit.org/show_bug.cgi?id=52979

        Use String::containsOnlyLatin1() instead of isSafeToConvertCharList().

        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::btoa):
        (WebCore::DOMWindow::atob):

2011-01-23  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Andreas Kling.

        [CMake] Add missing CodeGenerator dependencies
        https://bugs.webkit.org/show_bug.cgi?id=52976

        * CMakeLists.txt:

2011-01-23  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt][Symbian] Fix --minimal build
        https://bugs.webkit.org/show_bug.cgi?id=52839

        Some of the plugins' functionality is reimplemented in
        Symbian specific files.
        Some of this functionality should be compiled in even if 
        the guard NETSCAPE_PLUGIN_API is turned off.
        This patch moves that functionality out of the
        NETSCAPE_PLUGIN_API guard.

        Build fix so no new tests.

        * WebCore.pro:
        * plugins/symbian/PluginPackageSymbian.cpp:

2011-01-23  Andreas Kling  <kling@webkit.org>

        Reviewed by Tor Arne Vestbø.

        [Qt] Use rad2deg() from WTF instead of rolling our own.

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::rotate):
        * platform/graphics/qt/PathQt.cpp:
        (WebCore::Path::addArc):

2011-01-23  Kenneth Rohde Christiansen <kenneth@webkit.org>

        Reviewed by Andreas Kling.

        Viewport meta: Always adjust device dimensions to the device pixel ratio.

        * dom/ViewportArguments.cpp:
        (WebCore::computeViewportAttributes):

2011-01-23  Andreas Kling  <kling@webkit.org>

        Reviewed by Kenneth Rohde Christiansen.

        Don't scale absolute geometry specified by viewport meta tag.

        * dom/ViewportArguments.cpp:
        (WebCore::computeViewportAttributes):

2011-01-23  Ilya Tikhonovsky  <loislo@chromium.org>

        Unreviewed build fix.

        Web Inspector: looks like efl doesn't regenerate InspectorBackendDispatcher.

        Touch Inspector.idl.

        * inspector/Inspector.idl:

2011-01-22  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: next step in splitting InspectorController.

        Splitting InspectorController is a bit tricky process.

        As a first step I'll do the next things:
        1) rename existing InspectorController to InspectorAgent;
        2) s/nspectorController/nspectorAgent/g everywhere in WebCore/inspector but InspectorInstrumentation;
        3) create a fake InspectorController derived from the InspectorAgent for the rest of WebCore and WebKit;

        The second step is a migration of a small set of functions described in bug 52510 from InspectorAgent to InspectorController.

        As far as the second step will have significant changes in the functions' implementation I'll do it as a separate patch.

        https://bugs.webkit.org/show_bug.cgi?id=52955

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.exp.in:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/JSInjectedScriptHostCustom.cpp:
        (WebCore::JSInjectedScriptHost::nodeForId):
        (WebCore::JSInjectedScriptHost::selectDOMStorage):
        * bindings/v8/custom/V8InjectedScriptHostCustom.cpp:
        (WebCore::V8InjectedScriptHost::nodeForIdCallback):
        * inspector/CodeGeneratorInspector.pm:
        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::InjectedScriptHost):
        (WebCore::InjectedScriptHost::clearConsoleMessages):
        (WebCore::InjectedScriptHost::databaseForId):
        (WebCore::InjectedScriptHost::selectDatabase):
        (WebCore::InjectedScriptHost::selectDOMStorage):
        (WebCore::InjectedScriptHost::injectedScriptForMainFrame):
        (WebCore::InjectedScriptHost::inspectorDOMAgent):
        (WebCore::InjectedScriptHost::frontend):
        (WebCore::InjectedScriptHost::didCreateWorker):
        (WebCore::InjectedScriptHost::didDestroyWorker):
        * inspector/InjectedScriptHost.h:
        (WebCore::InjectedScriptHost::create):
        (WebCore::InjectedScriptHost::inspectorAgent):
        (WebCore::InjectedScriptHost::disconnectController):
        * inspector/InspectorAgent.cpp: Copied from Source/WebCore/inspector/InspectorController.cpp.
        (WebCore::InspectorAgent::InspectorAgent):
        (WebCore::InspectorAgent::~InspectorAgent):
        (WebCore::InspectorAgent::inspectedPageDestroyed):
        (WebCore::InspectorAgent::enabled):
        (WebCore::InspectorAgent::inspectorStartsAttached):
        (WebCore::InspectorAgent::setInspectorStartsAttached):
        (WebCore::InspectorAgent::setInspectorAttachedHeight):
        (WebCore::InspectorAgent::inspectorAttachedHeight):
        (WebCore::InspectorAgent::searchingForNodeInPage):
        (WebCore::InspectorAgent::restoreInspectorStateFromCookie):
        (WebCore::InspectorAgent::inspect):
        (WebCore::InspectorAgent::focusNode):
        (WebCore::InspectorAgent::highlight):
        (WebCore::InspectorAgent::highlightDOMNode):
        (WebCore::InspectorAgent::highlightFrame):
        (WebCore::InspectorAgent::hideHighlight):
        (WebCore::InspectorAgent::mouseDidMoveOverElement):
        (WebCore::InspectorAgent::handleMousePress):
        (WebCore::InspectorAgent::setInspectorFrontendClient):
        (WebCore::InspectorAgent::didClearWindowObjectInWorld):
        (WebCore::InspectorAgent::setSearchingForNode):
        (WebCore::InspectorAgent::connectFrontend):
        (WebCore::InspectorAgent::show):
        (WebCore::InspectorAgent::showPanel):
        (WebCore::InspectorAgent::close):
        (WebCore::InspectorAgent::disconnectFrontend):
        (WebCore::InspectorAgent::resourceAgent):
        (WebCore::InspectorAgent::releaseFrontendLifetimeAgents):
        (WebCore::InspectorAgent::populateScriptObjects):
        (WebCore::InspectorAgent::pushDataCollectedOffline):
        (WebCore::InspectorAgent::restoreDebugger):
        (WebCore::InspectorAgent::restoreProfiler):
        (WebCore::InspectorAgent::unbindAllResources):
        (WebCore::InspectorAgent::didCommitLoad):
        (WebCore::InspectorAgent::mainResourceFiredDOMContentEvent):
        (WebCore::InspectorAgent::mainResourceFiredLoadEvent):
        (WebCore::InspectorAgent::isMainResourceLoader):
        (WebCore::InspectorAgent::willSendRequest):
        (WebCore::InspectorAgent::ensureSettingsLoaded):
        (WebCore::InspectorAgent::startTimelineProfiler):
        (WebCore::InspectorAgent::stopTimelineProfiler):
        (WebCore::PostWorkerNotificationToFrontendTask::create):
        (WebCore::PostWorkerNotificationToFrontendTask::PostWorkerNotificationToFrontendTask):
        (WebCore::PostWorkerNotificationToFrontendTask::performTask):
        (WebCore::InspectorAgent::postWorkerNotificationToFrontend):
        (WebCore::InspectorAgent::didCreateWorker):
        (WebCore::InspectorAgent::didDestroyWorker):
        (WebCore::InspectorAgent::didOpenDatabase):
        (WebCore::InspectorAgent::getCookies):
        (WebCore::InspectorAgent::buildArrayForCookies):
        (WebCore::InspectorAgent::buildObjectForCookie):
        (WebCore::InspectorAgent::deleteCookie):
        (WebCore::InspectorAgent::didUseDOMStorage):
        (WebCore::InspectorAgent::didCreateWebSocket):
        (WebCore::InspectorAgent::willSendWebSocketHandshakeRequest):
        (WebCore::InspectorAgent::didReceiveWebSocketHandshakeResponse):
        (WebCore::InspectorAgent::didCloseWebSocket):
        (WebCore::InspectorAgent::isRecordingUserInitiatedProfile):
        (WebCore::InspectorAgent::startUserInitiatedProfiling):
        (WebCore::InspectorAgent::stopUserInitiatedProfiling):
        (WebCore::InspectorAgent::profilerEnabled):
        (WebCore::InspectorAgent::enableProfiler):
        (WebCore::InspectorAgent::disableProfiler):
        (WebCore::InspectorAgent::showAndEnableDebugger):
        (WebCore::InspectorAgent::enableDebugger):
        (WebCore::InspectorAgent::disableDebugger):
        (WebCore::InspectorAgent::resume):
        (WebCore::InspectorAgent::setAllBrowserBreakpoints):
        (WebCore::InspectorAgent::evaluateForTestInFrontend):
        (WebCore::InspectorAgent::didEvaluateForTestInFrontend):
        (WebCore::quadToPath):
        (WebCore::drawOutlinedQuad):
        (WebCore::drawOutlinedQuadWithClip):
        (WebCore::drawHighlightForBox):
        (WebCore::drawHighlightForLineBoxesOrSVGRenderer):
        (WebCore::convertFromFrameToMainFrame):
        (WebCore::frameToMainFrameOffset):
        (WebCore::InspectorAgent::drawNodeHighlight):
        (WebCore::InspectorAgent::drawElementTitle):
        (WebCore::InspectorAgent::openInInspectedWindow):
        (WebCore::InspectorAgent::addScriptToEvaluateOnLoad):
        (WebCore::InspectorAgent::removeAllScriptsToEvaluateOnLoad):
        (WebCore::InspectorAgent::setInspectorExtensionAPI):
        (WebCore::InspectorAgent::inspectedURL):
        (WebCore::InspectorAgent::reloadPage):
        (WebCore::InspectorAgent::setExtraHeaders):
        * inspector/InspectorAgent.h: Copied from Source/WebCore/inspector/InspectorController.h.
        (WebCore::InspectorAgent::inspectorBackendDispatcher):
        (WebCore::InspectorAgent::inspectorClient):
        (WebCore::InspectorAgent::injectedScriptHost):
        (WebCore::InspectorAgent::inspectedPage):
        (WebCore::InspectorAgent::hideDOMNodeHighlight):
        (WebCore::InspectorAgent::hideFrameHighlight):
        (WebCore::InspectorAgent::frontend):
        (WebCore::InspectorAgent::inspectorController):
        (WebCore::InspectorAgent::inspectorAgent):
        (WebCore::InspectorAgent::consoleAgent):
        (WebCore::InspectorAgent::cssAgent):
        (WebCore::InspectorAgent::domAgent):
        (WebCore::InspectorAgent::injectedScriptAgent):
        (WebCore::InspectorAgent::runtimeAgent):
        (WebCore::InspectorAgent::timelineAgent):
        (WebCore::InspectorAgent::databaseAgent):
        (WebCore::InspectorAgent::domStorageAgent):
        (WebCore::InspectorAgent::fileSystemAgent):
        (WebCore::InspectorAgent::browserDebuggerAgent):
        (WebCore::InspectorAgent::debuggerAgent):
        (WebCore::InspectorAgent::profilerAgent):
        (WebCore::InspectorAgent::applicationCacheAgent):
        (WebCore::InspectorAgent::hasInspectorFrontendClient):
        (WebCore::InspectorAgent::hasFrontend):
        (WebCore::InspectorAgent::startProfiling):
        (WebCore::InspectorAgent::stopProfiling):
        (WebCore::InspectorAgent::debuggerEnabled):
        (WebCore::InspectorAgent::state):
        (WebCore::InspectorAgent::settings):
        * inspector/InspectorApplicationCacheAgent.cpp:
        (WebCore::InspectorApplicationCacheAgent::InspectorApplicationCacheAgent):
        (WebCore::InspectorApplicationCacheAgent::getApplicationCaches):
        * inspector/InspectorApplicationCacheAgent.h:
        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::inspectedURLChanged):
        (WebCore::InspectorBrowserDebuggerAgent::restoreStickyBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willModifyDOMAttr):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):
        * inspector/InspectorBrowserDebuggerAgent.h:
        (WebCore::InspectorBrowserDebuggerAgent::create):
        * inspector/InspectorConsoleAgent.cpp:
        (WebCore::InspectorConsoleAgent::InspectorConsoleAgent):
        (WebCore::InspectorConsoleAgent::~InspectorConsoleAgent):
        (WebCore::InspectorConsoleAgent::clearConsoleMessages):
        (WebCore::InspectorConsoleAgent::addMessageToConsole):
        (WebCore::InspectorConsoleAgent::resourceRetrievedByXMLHttpRequest):
        (WebCore::InspectorConsoleAgent::didReceiveResponse):
        (WebCore::InspectorConsoleAgent::didFailLoading):
        (WebCore::InspectorConsoleAgent::setMonitoringXHREnabled):
        (WebCore::InspectorConsoleAgent::setConsoleMessagesEnabled):
        (WebCore::InspectorConsoleAgent::addConsoleMessage):
        * inspector/InspectorConsoleAgent.h:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        * inspector/InspectorController.h:
        * inspector/InspectorDatabaseAgent.cpp:
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::create):
        (WebCore::InspectorDebuggerAgent::InspectorDebuggerAgent):
        (WebCore::InspectorDebuggerAgent::~InspectorDebuggerAgent):
        (WebCore::InspectorDebuggerAgent::evaluateOnCallFrame):
        (WebCore::InspectorDebuggerAgent::getCompletionsOnCallFrame):
        (WebCore::InspectorDebuggerAgent::currentCallFrames):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/InspectorFileSystemAgent.cpp:
        (WebCore::InspectorFileSystemAgentCallbacks::didOpenFileSystem):
        (WebCore::InspectorFileSystemAgent::InspectorFileSystemAgent):
        (WebCore::InspectorFileSystemAgent::stop):
        (WebCore::InspectorFileSystemAgent::getFileSystemPathAsync):
        (WebCore::InspectorFileSystemAgent::didGetFileSystemPath):
        (WebCore::InspectorFileSystemAgent::didGetFileSystemError):
        * inspector/InspectorFileSystemAgent.h:
        (WebCore::InspectorFileSystemAgent::create):
        * inspector/InspectorFrontendHost.cpp:
        (WebCore::InspectorFrontendHost::setExtensionAPI):
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::create):
        (WebCore::InspectorProfilerAgent::InspectorProfilerAgent):
        (WebCore::InspectorProfilerAgent::addProfileFinishedMessageToConsole):
        (WebCore::InspectorProfilerAgent::addStartProfilingMessageToConsole):
        (WebCore::InspectorProfilerAgent::startUserInitiatedProfiling):
        (WebCore::InspectorProfilerAgent::stopUserInitiatedProfiling):
        * inspector/InspectorProfilerAgent.h:

2011-01-22  Chris Rogers  <crogers@google.com>

        Rubber-stamped by Anders Carlsson.

        Fix FFTFrameStub to compile properly
        https://bugs.webkit.org/show_bug.cgi?id=52969

        No new tests since this is a build fix.

        * platform/audio/FFTFrameStub.cpp:
        (WebCore::FFTFrame::FFTFrame):

2011-01-22  Andrei Popescu  <andreip@google.com>

        Reviewed by Jeremy Orlow.

        IndexedDB corrupts data on disk
        https://bugs.webkit.org/show_bug.cgi?id=52890

        We need to store the SerializedScriptValues on disk in a BLOB column rather than TEXT.
        Test: storage/indexeddb/data-corruption.html

        * platform/sql/SQLiteStatement.cpp:
        (WebCore::SQLiteStatement::bindBlob):
        (WebCore::SQLiteStatement::getColumnBlobAsString):
        (WebCore::SQLiteStatement::getColumnBlobAsVector):
        * platform/sql/SQLiteStatement.h:
        * storage/IDBCursorBackendImpl.cpp:
        (WebCore::IDBCursorBackendImpl::loadCurrentRow):
        * storage/IDBFactoryBackendImpl.cpp:
        (WebCore::runCommands):
        (WebCore::createTables):
        (WebCore::createMetaDataTable):
        (WebCore::migrateDatabase):
        * storage/IDBObjectStoreBackendImpl.cpp:
        (WebCore::IDBObjectStoreBackendImpl::getInternal):
        (WebCore::putObjectStoreData):

2011-01-22  Nikolas Zimmermann  <nzimmermann@rim.com>

        Not reviewed. Fix WinCE build.

        * platform/graphics/wince/GraphicsContextWinCE.cpp:
        (WebCore::GraphicsContext::drawText):
        * rendering/RenderThemeWinCE.cpp:
        (WebCore::RenderThemeWinCE::adjustMenuListButtonStyle):

2011-01-22  Nikolas Zimmermann  <nzimmermann@rim.com>

        Reviewed by Dirk Schulze.

        REGRESSION: Vertical line metrics incorrect
        https://bugs.webkit.org/show_bug.cgi?id=52960

        SimpleFontDataMac.mm contains a hack to modifiy lineGap/descent for the 'Hiragino' font.
        That didn't influence the lineSpacing so far, but does now, causing regressions.

        Restore old line spacing behaviour to fix the regression.
        Covered by existing fast/blockflow, fast/repaint and fast/text/international test cases.

        * platform/graphics/FontMetrics.h:
        (WebCore::FontMetrics::FontMetrics):
        (WebCore::FontMetrics::floatLineSpacing):
        (WebCore::FontMetrics::setLineSpacing):
        (WebCore::FontMetrics::lineSpacing):
        (WebCore::FontMetrics::reset):
        * platform/graphics/SimpleFontData.cpp:
        (WebCore::SimpleFontData::SimpleFontData):
        * platform/graphics/chromium/SimpleFontDataChromiumWin.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/chromium/SimpleFontDataLinux.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/freetype/SimpleFontDataFreeType.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/haiku/SimpleFontDataHaiku.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/mac/SimpleFontDataMac.mm:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/pango/SimpleFontDataPango.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/qt/SimpleFontDataQt.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/win/SimpleFontDataCGWin.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/win/SimpleFontDataCairoWin.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/win/SimpleFontDataWin.cpp:
        (WebCore::SimpleFontData::initGDIFont):
        * platform/graphics/wince/SimpleFontDataWinCE.cpp:
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/wx/SimpleFontDataWx.cpp:
        (WebCore::SimpleFontData::platformInit):

2011-01-22  Andreas Kling  <kling@webkit.org>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] fast/backgrounds/svg-as-mask.html fails
        https://bugs.webkit.org/show_bug.cgi?id=52906

        Transparency layers should start out with in SourceOver mode with
        alpha 1.0 (modeled after CGContextBeginTransparencyLayer.)

        * platform/graphics/qt/TransparencyLayer.h:
        (WebCore::TransparencyLayer::TransparencyLayer):

2011-01-22  Nikolas Zimmermann  <nzimmermann@rim.com>

        Not reviewed.

        Introduce FontMetrics abstraction
        https://bugs.webkit.org/show_bug.cgi?id=51456

        Fix Chromium/Win build.

        * platform/graphics/chromium/UniscribeHelperTextRun.cpp: s/->/./
        (WebCore::UniscribeHelperTextRun::UniscribeHelperTextRun):

2011-01-21  Nikolas Zimmermann  <nzimmermann@rim.com>

        Reviewed by Dirk Schulze.

        Introduce FontMetrics abstraction
        https://bugs.webkit.org/show_bug.cgi?id=51456

        Encapsulate ascent/descent/lineHeight/lineGap methods in a single FontMetrics class, instead of
        having to define them in both Font & SimpleFontData. Changed to store floating point values
        as default, in order to get accurate information for small sized fonts. All these methods
        now have floating-point and integer versions. Whenever an integer variant of these functions
        is called, lroundf() is used to round the value.

        This makes it possible to support small font-sizes for SVG in a follow-up patch, as well
        as fixing rounding issues when using SVG Fonts.
        
        Shouldn't affect existing tests.

        * GNUmakefile.am: Add FontMetrics.h to build. 
        * WebCore.gypi: Ditto.
        * WebCore.pro: Ditto.
        * WebCore.vcproj/WebCore.vcproj: Ditto.
        * WebCore.xcodeproj/project.pbxproj: Ditto.
        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
        (baselinePositionForAccessibilityRenderObject):
        * css/CSSPrimitiveValue.cpp:         
        (WebCore::CSSPrimitiveValue::computeLengthDouble):
        * html/canvas/CanvasRenderingContext2D.cpp: Ditto.
        (WebCore::CanvasRenderingContext2D::drawTextInternal):
        * inspector/InspectorController.cpp: Ditto.
        (WebCore::InspectorController::drawElementTitle):
        * platform/chromium/PopupMenuChromium.cpp: Ditto.
        (WebCore::PopupListBox::paintRow):
        (WebCore::PopupListBox::getRowHeight):
        * platform/graphics/Font.h: Remove ascent/descent/height/lineGap/lineSpacing/xHeight/unitsPerEm accessor...
        (WebCore::Font::fontMetrics): ... and only expose a single FontMetrics object here.
        * platform/graphics/FontFastPath.cpp: Use fontMetrics() to query metrics information.
        (WebCore::Font::emphasisMarkAscent):
        (WebCore::Font::emphasisMarkDescent):
        (WebCore::Font::emphasisMarkHeight):
        (WebCore::Font::floatWidthForSimpleText):
        * platform/graphics/FontMetrics.h: Added.
        (WebCore::FontMetrics::FontMetrics): Creates a FontMetrics object, stored in SimpleFontData.
        (WebCore::FontMetrics::unitsPerEm): Returns an unsigned describing the unitsPerEm.
        (WebCore::FontMetrics::setUnitsPerEm): Sets the unitsPerEm value.
        (WebCore::FontMetrics::floatAscent): Returns the stored m_ascent float.
        (WebCore::FontMetrics::setAscent): Sets the stored m_ascent float.
        (WebCore::FontMetrics::floatDescent): Returns the stored m_descent float.
        (WebCore::FontMetrics::setDescent): Sets the stored m_descent float.
        (WebCore::FontMetrics::floatHeight): Returns floatAscent() + floatDescent().
        (WebCore::FontMetrics::floatLineGap): Returns the stored m_lineGap float.
        (WebCore::FontMetrics::setLineGap): Sets the stored m_lineGap float.
        (WebCore::FontMetrics::floatLineSpacing): Returns the stored m_lineSpacing float.
        (WebCore::FontMetrics::setLineSpacing): Sets the stored m_lineSpacing float.
        (WebCore::FontMetrics::xHeight): Returns the stored m_xHeight float (no integer version available, hence no 'float' prefix).
        (WebCore::FontMetrics::setXHeight): Sets the stored m_xHeight float.
        (WebCore::FontMetrics::ascent): Returns a rounded version of ascent().
        (WebCore::FontMetrics::descent): Ditto (for descent).
        (WebCore::FontMetrics::height): Returns ascent() + descent().
        (WebCore::FontMetrics::lineGap): Returns a rounded version of lineGap().
        (WebCore::FontMetrics::lineSpacing): Ditto (for lineSpacing).
        (WebCore::FontMetrics::reset): Nulls all members, used only by the platform variants of SimpleFontData.
        * platform/graphics/SimpleFontData.cpp: Adapt SVG Fonts code, to initialize the FontMetrics object, as the m_ascent/etc.. members are gone.
        (WebCore::SimpleFontData::SimpleFontData):
        (WebCore::SimpleFontData::initCharWidths):
        * platform/graphics/SimpleFontData.h: Remove ascent/descent/height/lineSpacing/lineGap/xHeight/unitsPerEm accessors, and members, just store a FontMetrics object and expose it.
        (WebCore::SimpleFontData::fontMetrics):
        (WebCore::SimpleFontData::avgCharWidth):
        * platform/graphics/chromium/FontChromiumWin.cpp: Use fontMetrics() to query font metrics.
        (WebCore::TransparencyAwareFontPainter::TransparencyAwareGlyphPainter::estimateTextBounds):
        (WebCore::TransparencyAwareFontPainter::TransparencyAwareGlyphPainter::drawGlyphs):
        (WebCore::TransparencyAwareFontPainter::TransparencyAwareUniscribePainter::estimateTextBounds):
        (WebCore::Font::drawComplexText):
        * platform/graphics/chromium/SimpleFontDataChromiumWin.cpp: Adapt platform code, to initialize the FontMetrics object.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/chromium/SimpleFontDataLinux.cpp: Ditto.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/chromium/UniscribeHelperTextRun.cpp: Use fontMetrics() to query font metrics.
        (WebCore::UniscribeHelperTextRun::UniscribeHelperTextRun):
        (WebCore::UniscribeHelperTextRun::nextWinFontData):
        * platform/graphics/freetype/SimpleFontDataFreeType.cpp: Adapt platform code, to initialize the FontMetrics object.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/haiku/SimpleFontDataHaiku.cpp: Ditto.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/mac/FontComplexTextMac.cpp: Use fontMetrics() to query font metrics.
        (WebCore::Font::floatWidthForComplexText):
        * platform/graphics/mac/FontMac.mm: Ditto.
        (WebCore::showGlyphsWithAdvances):
        * platform/graphics/mac/SimpleFontDataMac.mm: Adapt platform code, to initialize the FontMetrics object.
        (WebCore::SimpleFontData::platformInit):
        (WebCore::SimpleFontData::platformCharWidthInit):
        * platform/graphics/pango/SimpleFontDataPango.cpp: Ditto.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/qt/SimpleFontDataQt.cpp: Ditto. (+ Switch to QFontMetricsF to get floating-point accurancy.)
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/win/FontCGWin.cpp: Use fontMetrics() to query font metrics.
        (WebCore::drawGDIGlyphs):
        * platform/graphics/win/FontWin.cpp: Ditto.
        (WebCore::Font::floatWidthForComplexText):
        * platform/graphics/win/SimpleFontDataCGWin.cpp: Adapt platform code, to initialize the FontMetrics object.
        (WebCore::SimpleFontData::platformInit):
        (WebCore::SimpleFontData::platformBoundsForGlyph):
        * platform/graphics/win/SimpleFontDataCairoWin.cpp: Ditto.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/win/SimpleFontDataWin.cpp: Ditto.
        (WebCore::SimpleFontData::initGDIFont):
        * platform/graphics/wince/GraphicsContextWinCE.cpp: Use fontMetrics() to query font metrics.
        (WebCore::GraphicsContext::drawText):
        * platform/graphics/wince/SimpleFontDataWinCE.cpp: Adapt platform code, to initialize the FontMetrics object.
        (WebCore::SimpleFontData::platformInit):
        * platform/graphics/wx/SimpleFontDataWx.cpp: Ditto.
        (WebCore::SimpleFontData::platformInit):
        * platform/win/PopupMenuWin.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
        (WebCore::PopupMenuWin::calculatePositionAndSize): 
        (WebCore::PopupMenuWin::paint):
        * rendering/EllipsisBox.cpp: Ditto.
        (WebCore::EllipsisBox::paint):
        (WebCore::EllipsisBox::nodeAtPoint):
        * rendering/InlineBox.cpp: Ditto.
        (WebCore::InlineBox::logicalHeight):
        * rendering/InlineFlowBox.cpp: Ditto.
        (WebCore::verticalPositionForBox):
        (WebCore::InlineFlowBox::computeLogicalBoxHeights):
        (WebCore::InlineFlowBox::placeBoxesInBlockDirection):
        * rendering/InlineTextBox.cpp: Ditto.
        (WebCore::InlineTextBox::paint):
        (WebCore::InlineTextBox::paintDecoration):
        (WebCore::InlineTextBox::paintSpellingOrGrammarMarker):
        (WebCore::InlineTextBox::paintCompositionUnderline):
        * rendering/RenderBlock.cpp: Ditto.
        (WebCore::RenderBlock::baselinePosition):
        (WebCore::RenderBlock::firstLineBoxBaseline):
        (WebCore::RenderBlock::lastLineBoxBaseline):
        * rendering/RenderBox.cpp: Ditto.
        (WebCore::RenderBox::localCaretRect):
        * rendering/RenderEmbeddedObject.cpp: Ditto.
        (WebCore::RenderEmbeddedObject::paintReplaced):
        * rendering/RenderImage.cpp: Ditto.
        (WebCore::RenderImage::setImageSizeForAltText):
        (WebCore::RenderImage::paintReplaced):
        * rendering/RenderInline.cpp: Ditto.
        (WebCore::RenderInline::baselinePosition):
        * rendering/RenderListBox.cpp: Ditto.
        (WebCore::RenderListBox::paintItemForeground):
        (WebCore::RenderListBox::itemHeight):
        * rendering/RenderListMarker.cpp: Ditto.
        (WebCore::RenderListMarker::paint):
        (WebCore::RenderListMarker::layout):
        (WebCore::RenderListMarker::computePreferredLogicalWidths):
        (WebCore::RenderListMarker::updateMargins):
        (WebCore::RenderListMarker::getRelativeMarkerRect):
        * rendering/RenderTextControl.cpp: Ditto.
        (WebCore::RenderTextControl::paintPlaceholder):
        * rendering/RenderTextControlSingleLine.cpp: Ditto.
        (WebCore::RenderTextControlSingleLine::createInnerTextStyle):
        * rendering/RenderThemeWin.cpp: Ditto.
        (WebCore::RenderThemeWin::adjustMenuListButtonStyle):
        * rendering/mathml/RenderMathMLFraction.cpp: Ditto.
        (WebCore::RenderMathMLFraction::baselinePosition):
        * rendering/style/RenderStyle.h: Add "const FontMetrics& fontMetrics() const" accessor.
        (WebCore::InheritedFlags::fontMetrics):
        (WebCore::InheritedFlags::computedLineHeight):
        * rendering/svg/RenderSVGInlineText.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
        (WebCore::RenderSVGInlineText::positionForPoint):
        * rendering/svg/SVGInlineTextBox.cpp: Ditto.
        (WebCore::SVGInlineTextBox::selectionRectForTextFragment):
        (WebCore::positionOffsetForDecoration):
        (WebCore::SVGInlineTextBox::paintDecorationWithStyle):
        (WebCore::SVGInlineTextBox::paintTextWithShadows):
        (WebCore::SVGInlineTextBox::calculateBoundaries):
        * rendering/svg/SVGTextLayoutEngineBaseline.cpp: Ditto.
        (WebCore::SVGTextLayoutEngineBaseline::calculateBaselineShift):
        (WebCore::SVGTextLayoutEngineBaseline::calculateAlignmentBaselineShift):
        (WebCore::SVGTextLayoutEngineBaseline::calculateGlyphAdvanceAndOrientation):
        * rendering/svg/SVGTextLayoutEngineSpacing.cpp: Ditto.
        (WebCore::SVGTextLayoutEngineSpacing::calculateSVGKerning):
        * rendering/svg/SVGTextMetrics.cpp: Ditto.
        (WebCore::SVGTextMetrics::SVGTextMetrics):
        * rendering/svg/SVGTextQuery.cpp: Ditto.
        (WebCore::calculateGlyphBoundaries):
        * svg/SVGFontFaceElement.cpp: 
        (WebCore::SVGFontFaceElement::unitsPerEm): Rename defaultUnitsPerEm global to gDefaultUnitsPerEm.
        * svg/SVGLength.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
        (WebCore::SVGLength::convertValueFromUserUnitsToEXS):
        (WebCore::SVGLength::convertValueFromEXSToUserUnits):

2011-01-22  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        Stop instantiating legacy editing positions in VisibleSelection, visible_units.cpp, Frame, and RenderBlock
        https://bugs.webkit.org/show_bug.cgi?id=52759

        Stopped instantiating legacy editing positions in the following files.

        * editing/VisibleSelection.cpp:
        (WebCore::VisibleSelection::adjustSelectionToAvoidCrossingEditingBoundaries):
        * editing/visible_units.cpp:
        (WebCore::previousBoundary):
        (WebCore::previousLinePosition):
        (WebCore::nextLinePosition):
        (WebCore::startOfBlock):
        * page/Frame.cpp:
        (WebCore::Frame::visiblePositionForPoint):
        * rendering/RenderBlock.cpp: Removed RenderBlock::positionForRenderer because it was not called anywhere.
        * rendering/RenderBlock.h: Ditto.

2011-01-22  Adrienne Walker  <enne@google.com>

        Reviewed by James Robinson.

        [chromium] Fix compositor repaints for offscreen fixed elements
        https://bugs.webkit.org/show_bug.cgi?id=52681

        The fast path scrolling was clipping offscreen invalidations.
        Additionally, the compositor was ignoring all invalidations that were
        entirely out of the content rect.

        Test: compositing/ to verify this caused no regressions.
        Tested fix manually in browser as I could not generate a LayoutTest that reproduced the bug in run-webkit-tests.

        * page/FrameView.cpp:
        (WebCore::FrameView::scrollContentsFastPath):
        * platform/graphics/chromium/LayerRendererChromium.cpp:
        (WebCore::LayerRendererChromium::invalidateRootLayerRect):

2011-01-22  Alexey Proskuryakov  <ap@apple.com>

        Reviewed by Dan Bernstein.

        https://bugs.webkit.org/show_bug.cgi?id=52951
        WebKit2 generates a bad PDF for cross process messaging

        * page/PrintContext.cpp: (WebCore::PrintContext::spoolRect): Use a correct offset to actually
        draw inside the requested rectangle.

2011-01-21  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Adam Barth.

        Regression: new window.onerror() implementation leaks cross-origin Javascript errors
        https://bugs.webkit.org/show_bug.cgi?id=52903

        In case of an exception in a script from different domain only generic message
        will be passed to window.onerror hander.

        Tests: http/tests/security/cross-origin-script-window-onerror-redirected.html
               http/tests/security/cross-origin-script-window-onerror.html

        * bindings/js/CachedScriptSourceProvider.h: use URL from the resource response to make sure we do all
        cross origin checks agains real script URL, not the original URL which may have resulted in a sequence
        of redirects to different domains.
        (WebCore::CachedScriptSourceProvider::CachedScriptSourceProvider):
        * bindings/v8/ScriptSourceCode.h: same for v8.
        (WebCore::ScriptSourceCode::url):
        * dom/ScriptExecutionContext.cpp:
        (WebCore::ScriptExecutionContext::dispatchErrorEvent): in case the error occurred in a script we cannot
        access provide concise "Script error." message without any information about the error source. This is
        what Firefox does in this case.

2011-01-21  Andreas Kling  <kling@webkit.org>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Always set composition mode through GraphicsContext
        https://bugs.webkit.org/show_bug.cgi?id=52940

        GraphicsContext tracks the current composition mode so we should
        never call through to the QPainter directly.

        * platform/graphics/GraphicsContext.h:
        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::toQtCompositionMode): Changed this method to a static inline
        since it's only used by GraphicsContextQt.cpp now.

        * platform/graphics/qt/ImageQt.cpp:
        (WebCore::Image::drawPattern):
        (WebCore::BitmapImage::draw):

2011-01-21  Dan Bernstein  <mitz@apple.com>

        Reviewed by Adele Peterson.

        Inconsistent handling of no-break space in justification logic
        https://bugs.webkit.org/show_bug.cgi?id=52938

        Test: fast/text/justify-nbsp.html

        * rendering/RenderBlockLineLayout.cpp:
        (WebCore::RenderBlock::computeInlineDirectionPositionsForLine): Count no-break space as a
        space when computing the distribution of space between text boxes on the line.

2011-01-21  Charlie Reis  <creis@chromium.org>

        Reviewed by Darin Fisher.

        Crash in WebCore::HistoryController::itemsAreClones
        https://bugs.webkit.org/show_bug.cgi?id=52819

        Adds sanity checks to help diagnose the crash.

        * loader/HistoryController.cpp:

2011-01-21  Andreas Kling  <kling@webkit.org>

        Reviewed by Ariya Hidayat.

        [Qt] Let QPainter decide whether a composition mode is supported or not

        Lacking Porter-Duff support in the paint engine shouldn't exclude the
        Source and Source-Over modes (and has nothing to do with the blend
        and raster-op modes.)

        Delegate this decision to QPainter instead (this will cause warnings
        if an unsupported mode is used, but that's a good thing.)

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::clearRect):
        (WebCore::GraphicsContext::setPlatformCompositeOperation):
        * platform/graphics/qt/TransparencyLayer.h:
        (WebCore::TransparencyLayer::TransparencyLayer):

2011-01-21  Chris Rogers  <crogers@google.com>

        Reviewed by Kenneth Russell.

        fix audio build: header file should be "Noncopyable.h" and not "NonCopyable.h"
        https://bugs.webkit.org/show_bug.cgi?id=52933

        No new tests since this just fixes the build

        * webaudio/RealtimeAnalyser.h:

2011-01-21  Chris Rogers  <crogers@google.com>

        Reviewed by Kenneth Russell.

        Fix audio build: change ChromiumBridge to PlatformBridge
        https://bugs.webkit.org/show_bug.cgi?id=52928

        No new tests since audio API is not yet implemented.

        * platform/audio/chromium/AudioBusChromium.cpp:
        (WebCore::AudioBus::loadPlatformResource):

2011-01-21  Chris Rogers  <crogers@google.com>

        Reviewed by Kenneth Russell.

        Add FFTFrameStub to avoid link errors during bringup on platforms without an FFT implementation
        https://bugs.webkit.org/show_bug.cgi?id=52922

        No new tests since audio API is not yet implemented.

        * WebCore.gypi:
        * platform/audio/FFTFrameStub.cpp: Added.
        (WebCore::FFTFrame::FFTFrame):
        (WebCore::FFTFrame::~FFTFrame):
        (WebCore::FFTFrame::multiply):
        (WebCore::FFTFrame::doFFT):
        (WebCore::FFTFrame::doInverseFFT):
        (WebCore::FFTFrame::cleanup):
        (WebCore::FFTFrame::realData):
        (WebCore::FFTFrame::imagData):

2011-01-21  Tony Chang  <tony@chromium.org>

        Reviewed by Sam Weinig.

        reduce number of FrameLoaderClient::didChangeScrollOffset calls
        https://bugs.webkit.org/show_bug.cgi?id=52915

        Only notify of changes in scroll offset when there actually is a change.
        This regressed in r76291.

        Covered by Chromium browser_tests.

        * platform/ScrollAnimator.cpp:
        (WebCore::ScrollAnimator::scrollToOffsetWithoutAnimation):

2011-01-21  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: ~InspectorResourceAgent crashes on closing inspected page.
        https://bugs.webkit.org/show_bug.cgi?id=52900

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::~InspectorController):
        (WebCore::InspectorController::inspectedPageDestroyed):

2011-01-21  Chris Rogers  <crogers@google.com>

        Reviewed by Darin Fisher.

        Add run-time enable support for the web audio API
        https://bugs.webkit.org/show_bug.cgi?id=52741

        No new tests since audio API is not yet implemented.

        * WebCore.exp.in:
        * bindings/generic/RuntimeEnabledFeatures.cpp:
        * bindings/generic/RuntimeEnabledFeatures.h:
        (WebCore::RuntimeEnabledFeatures::setWebkitAudioContextEnabled):
        (WebCore::RuntimeEnabledFeatures::webkitAudioContextEnabled):
        * page/DOMWindow.idl:
        * page/Settings.cpp:
        (WebCore::Settings::Settings):
        (WebCore::Settings::setWebAudioEnabled):
        * page/Settings.h:
        (WebCore::Settings::webAudioEnabled):

2011-01-21  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Menulist text often collides with separator
        https://bugs.webkit.org/show_bug.cgi?id=51155

        Move menulist rendering to RenderThemeGtk and correct padding code
        for separators in menulists.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::RenderThemeGtk): Initialize new widget members.
        (WebCore::RenderThemeGtk::getComboBoxSeparatorWidth): Added.
        (WebCore::RenderThemeGtk::comboBoxArrowSize): Added.
        (WebCore::getButtonInnerBorder): Added.
        (WebCore::RenderThemeGtk::getComboBoxPadding): Do this manually instead of using
        Mozilla code.
        (WebCore::RenderThemeGtk::paintMenuList): Ditto.
        (WebCore::setupWidget): Abstracted this part of the setupWidgetAndAddToContainer
        out to handle child widgets of comboboxes.
        (WebCore::RenderThemeGtk::setupWidgetAndAddToContainer): Abstracted out setupWidget.
        (WebCore::RenderThemeGtk::gtkContainer): Added.
        (WebCore::getGtkComboBoxButton): Added.
        (WebCore::getGtkComboBoxPieces): Added.
        (WebCore::RenderThemeGtk::gtkComboBox): Call setupWidget here.
        (WebCore::RenderThemeGtk::refreshComboBoxChildren): Added.
        (WebCore::RenderThemeGtk::gtkComboBoxButton): Added.
        (WebCore::RenderThemeGtk::gtkComboBoxArrow): Added.
        (WebCore::RenderThemeGtk::gtkComboBoxSeparator): Added.
        * platform/gtk/RenderThemeGtk.h: Added new members and methods.
        * platform/gtk/WidgetRenderingContext.h: Added new members and methods.
        * platform/gtk/WidgetRenderingContextGtk2.cpp:
        (WebCore::WidgetRenderingContext::gtkPaintArrow):
        (WebCore::WidgetRenderingContext::gtkPaintVLine):
        * platform/gtk/WidgetRenderingContextGtk3.cpp:
        (WebCore::WidgetRenderingContext::gtkPaintArrow):
        (WebCore::WidgetRenderingContext::gtkPaintVLine):
        * platform/gtk/gtk2drawing.c: Removed code for drawing menulists and buttons.
        (moz_gtk_init):
        (moz_gtk_get_widget_border):
        (moz_gtk_widget_paint):
        * platform/gtk/gtk3drawing.c:
        (moz_gtk_init):
        (moz_gtk_get_widget_border):
        (moz_gtk_widget_paint):
        * platform/gtk/gtkdrawing.h:

2011-01-21  Sam Weinig  <sam@webkit.org>

        Fix chromium mac build.

        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::scrollbarStateToThemeState):
        (WebCore::ScrollbarThemeChromiumMac::paint):

2011-01-21  Sam Weinig  <sam@webkit.org>

        Fix the windows build.

        * platform/ScrollbarThemeComposite.cpp:
        (WebCore::ScrollbarThemeComposite::paint):

2011-01-21  Chris Rogers  <crogers@google.com>

        Reviewed by Kenneth Russell.

        Add chromium bundled audio spatialization resources to WebAudio.grd
        https://bugs.webkit.org/show_bug.cgi?id=52651

        No new tests since audio API is not yet implemented.

        * WebCore.gyp/WebCore.gyp:
        * platform/audio/chromium/AudioBusChromium.cpp:
        (WebCore::AudioBus::loadPlatformResource):

2011-01-21  Xiyuan Xia  <xiyuan@chromium.org>

        Reviewed by Tony Chang.

        Use WebThemeEngine for relevant RenderTheme parts for chromium/linux.
        https://bugs.webkit.org/show_bug.cgi?id=52826

        * platform/chromium/ChromiumBridge.h:
        * rendering/RenderThemeChromiumLinux.cpp:
        (WebCore::getWebThemeState):
        (WebCore::RenderThemeChromiumLinux::adjustSliderThumbSize):
        (WebCore::RenderThemeChromiumLinux::paintCheckbox):
        (WebCore::RenderThemeChromiumLinux::setCheckboxSize):
        (WebCore::RenderThemeChromiumLinux::paintRadio):
        (WebCore::RenderThemeChromiumLinux::setRadioSize):
        (WebCore::RenderThemeChromiumLinux::paintButton):
        (WebCore::RenderThemeChromiumLinux::paintTextField):
        (WebCore::RenderThemeChromiumLinux::paintMenuList):
        (WebCore::RenderThemeChromiumLinux::paintSliderTrack):
        (WebCore::RenderThemeChromiumLinux::paintSliderThumb):
        (WebCore::RenderThemeChromiumLinux::adjustInnerSpinButtonStyle):
        (WebCore::RenderThemeChromiumLinux::paintInnerSpinButton):
        (WebCore::RenderThemeChromiumLinux::paintProgressBar):
        * rendering/RenderThemeChromiumLinux.h:
        * rendering/RenderThemeChromiumSkia.cpp:
        (WebCore::RenderThemeChromiumSkia::setCheckboxSize):
        (WebCore::RenderThemeChromiumSkia::setSizeIfAuto):
        (WebCore::RenderThemeChromiumSkia::indeterminateProgressValueRectFor):
        * rendering/RenderThemeChromiumSkia.h:

2011-01-21  Sam Weinig  <sam@webkit.org>

        Reviewed by Anders Carlsson.

        Part 2 of "Cleanup Scrollbar/ScrollbarClient relationship"
        https://bugs.webkit.org/show_bug.cgi?id=52779

        Rename ScrollbarClient -> ScrollableArea.

        - Also replaces Scrollbar::setClient with Scrollbar::disconnectFromScrollableArea
          since that was its only use case.

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * accessibility/AccessibilityScrollbar.cpp:
        (WebCore::AccessibilityScrollbar::setValue):
        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::SelectorChecker::checkScrollbarPseudoClass):
        * page/FrameView.h:
        * platform/PopupMenuClient.h:
        * platform/ScrollAnimator.cpp:
        (WebCore::ScrollAnimator::create):
        (WebCore::ScrollAnimator::ScrollAnimator):
        (WebCore::ScrollAnimator::scroll):
        (WebCore::ScrollAnimator::notityPositionChanged):
        * platform/ScrollAnimator.h:
        * platform/ScrollAnimatorWin.cpp:
        (WebCore::ScrollAnimator::create):
        (WebCore::ScrollAnimatorWin::ScrollAnimatorWin):
        (WebCore::ScrollAnimatorWin::scroll):
        * platform/ScrollAnimatorWin.h:
        * platform/ScrollView.cpp:
        (WebCore::ScrollView::scroll):
        (WebCore::ScrollView::updateScrollbars):
        (WebCore::ScrollView::wheelEvent):
        * platform/ScrollView.h:
        * platform/ScrollableArea.cpp: Copied from WebCore/platform/ScrollbarClient.cpp.
        (WebCore::ScrollableArea::ScrollableArea):
        (WebCore::ScrollableArea::~ScrollableArea):
        (WebCore::ScrollableArea::scroll):
        (WebCore::ScrollableArea::scrollToOffsetWithoutAnimation):
        (WebCore::ScrollableArea::scrollToXOffsetWithoutAnimation):
        (WebCore::ScrollableArea::scrollToYOffsetWithoutAnimation):
        (WebCore::ScrollableArea::setScrollOffsetFromAnimation):
        * platform/ScrollableArea.h: Copied from WebCore/platform/ScrollbarClient.h.
        * platform/Scrollbar.cpp:
        (WebCore::Scrollbar::createNativeScrollbar):
        (WebCore::Scrollbar::Scrollbar):
        (WebCore::Scrollbar::offsetDidChange):
        (WebCore::Scrollbar::autoscrollPressedPart):
        (WebCore::Scrollbar::moveThumb):
        (WebCore::Scrollbar::mouseMoved):
        (WebCore::Scrollbar::isWindowActive):
        (WebCore::Scrollbar::invalidateRect):
        (WebCore::Scrollbar::convertToContainingView):
        (WebCore::Scrollbar::convertFromContainingView):
        * platform/Scrollbar.h:
        (WebCore::Scrollbar::disconnectFromScrollableArea):
        (WebCore::Scrollbar::scrollableArea):
        * platform/ScrollbarClient.cpp: Removed.
        * platform/ScrollbarClient.h: Removed.
        * platform/ScrollbarThemeComposite.cpp:
        * platform/chromium/FramelessScrollView.h:
        * platform/chromium/ScrollbarThemeChromium.cpp:
        (WebCore::ScrollbarThemeChromium::paintTickmarks):
        * platform/efl/ScrollbarEfl.cpp:
        (Scrollbar::createNativeScrollbar):
        (ScrollbarEfl::ScrollbarEfl):
        (scrollbarEflEdjeMessage):
        * platform/efl/ScrollbarEfl.h:
        * platform/gtk/MainFrameScrollbarGtk.cpp:
        (MainFrameScrollbarGtk::create):
        (MainFrameScrollbarGtk::MainFrameScrollbarGtk):
        (MainFrameScrollbarGtk::gtkValueChanged):
        * platform/gtk/MainFrameScrollbarGtk.h:
        * platform/mac/ScrollAnimatorMac.h:
        * platform/mac/ScrollAnimatorMac.mm:
        (WebCore::ScrollAnimator::create):
        (WebCore::ScrollAnimatorMac::ScrollAnimatorMac):
        (WebCore::ScrollAnimatorMac::scroll):
        * platform/mac/ScrollbarThemeMac.mm:
        (WebCore::ScrollbarThemeMac::paint):
        * platform/qt/ScrollbarQt.cpp:
        (WebCore::Scrollbar::contextMenu):
        * platform/win/PopupMenuWin.cpp:
        (WebCore::PopupMenuWin::scrollToRevealSelection):
        (WebCore::PopupMenuWin::wndProc):
        * platform/win/PopupMenuWin.h:
        * platform/win/ScrollbarThemeSafari.cpp:
        (WebCore::ScrollbarThemeSafari::paintTrackBackground):
        (WebCore::ScrollbarThemeSafari::paintButton):
        (WebCore::ScrollbarThemeSafari::paintThumb):
        * platform/wx/ScrollbarThemeWx.cpp:
        (WebCore::ScrollbarThemeWx::paint):
        * rendering/RenderDataGrid.h:
        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::scrollToOffset):
        (WebCore::RenderLayer::destroyScrollbar):
        (WebCore::RenderLayer::scroll):
        * rendering/RenderLayer.h:
        * rendering/RenderListBox.cpp:
        (WebCore::RenderListBox::scrollToRevealElementAtListIndex):
        (WebCore::RenderListBox::scroll):
        (WebCore::RenderListBox::logicalScroll):
        (WebCore::RenderListBox::setScrollTop):
        (WebCore::RenderListBox::destroyScrollbar):
        * rendering/RenderListBox.h:
        * rendering/RenderMenuList.cpp:
        (WebCore::RenderMenuList::createScrollbar):
        * rendering/RenderMenuList.h:
        * rendering/RenderScrollbar.cpp:
        (WebCore::RenderScrollbar::createCustomScrollbar):
        (WebCore::RenderScrollbar::RenderScrollbar):
        * rendering/RenderScrollbar.h:
        * rendering/RenderTextControlSingleLine.cpp:
        (WebCore::RenderTextControlSingleLine::createScrollbar):
        * rendering/RenderTextControlSingleLine.h:

2011-01-21  Darin Adler  <darin@apple.com>

        Fix Leopard build.

        * rendering/mathml/RenderMathMLFraction.cpp:
        (WebCore::RenderMathMLFraction::layout): Use ceilf instead of ceil.

2011-01-21  Anton Muhin  <antonm@chromium.org>

        Reviewed by Nate Chapin.

        [v8] Properly deal with the case when conversion to string throws an exception for HTMLCollection accessors
        https://bugs.webkit.org/show_bug.cgi?id=52901

        Test: fast/dom/htmlcollection-conversion-throws-exception.html

        * bindings/v8/custom/V8HTMLCollectionCustom.cpp:
        (WebCore::getItem):

2011-01-21  Adam Roben  <aroben@apple.com>

        Separate flushing layer changes from rendering in CACFLayerTreeHost

        Old model:
          1) A change is made to a GraphicsLayer.
          2) CACFLayerTreeHost::flushPendingGraphicsLayerChangesSoon is called, which schedules the
             render timer.
          3) The timer fires, which calls through to CACFLayerTreeHost::render, which performs the
             flush and then renders.

        New model:
          1) A change is made to a GraphicsLayer.
          2) CACFLayerTreeHost::flushPendingGraphicsLayerChangesSoon is called, which tells the new
             LayerChangesFlusher singleton that this host has changes that need to be flushed.
          3) LayerChangesFlusher sets up a Windows hook that will get called on the next iteration
             of the message loop.
          4) LayerChangesFlusher's hook is called, which calls through to
             CACFLayerTreeHost::flushPendingLayerChangesNow.
          5) CACFLayerTreeHost::flushPendingLayerChangesNow schedules the render timer so the changes
             that were just flushed to the context will be rendered.

        When a change is made to a PlatformCALayer that doesn't have a corresponding GraphicsLayer
        (e.g., for rendering <video>), CACFLayerTreeHost::layerTreeDidChange takes care of
        scheduling the flush.

        This change has three advantages:
          1) Whenever we flush layer changes, we first update layout. This can cause the page to
             leave compositing mode, which in turn can cause all references to the CACFLayerTreeHost
             to be dropped. By separating flushing (and thus updating layout) from rendering, we no
             longer have to worry about this happen during rendering.
          2) The new model is much more similar to how things work on the Mac, so will hopefully
             reduce the number of platform-specific bugs.
          3) CACFLayerTreeHost::shouldRender, which was used to make sure we didn't render while a
             layout was pending, is no longer needed. It actually hasn't been needed since at least
             r75987, but removing it before now would have resulted in a crash whenever a page came
             out of compositing mode due to (1).

        Fixes <http://webkit.org/b/52852> Flushing layer changes and rendering are intertwined in
        CACFLayerTreeHost, but shouldn't be

        Reviewed by Simon Fraser.

        * WebCore.vcproj/WebCore.vcproj: Added LayerChangesFlusher.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp: Added new #include, sorted existing
        #includes.
        (WebCore::CACFLayerTreeHost::CACFLayerTreeHost): Initialize new member.
        (WebCore::CACFLayerTreeHost::layerTreeDidChange): If we aren't already flushing changes,
        schedule a flush. Removed the call to renderSoon(), which now happens when the flush is
        finished.
        (WebCore::CACFLayerTreeHost::destroyRenderer): Cancel any pending flush we had scheduled. Also
        fixed a bug where we'd fail to clear the context's layer.
        (WebCore::CACFLayerTreeHost::render): Removed code to ask the client if we should render, which
        is no longer needed. Moved code to flush layer changes from here to
        flushPendingLayerChangesNow, which is called via the above-described mechanism.
        (WebCore::CACFLayerTreeHost::flushPendingGraphicsLayerChangesSoon): Schedule a flush. Removed
        code to schedule a render, which now happens after we've flushed.
        (WebCore::CACFLayerTreeHost::flushPendingLayerChangesNow): Added. Some of this code came from
        render(). First we flush GraphicsLayer changes from GraphicsLayers to their underlying
        PlatformCALayers, then we flush changes from PlatformCALayers to the context, then we
        schedule a render so that the changes will be rendered to the screen.

        * platform/graphics/ca/win/CACFLayerTreeHost.h: Removed
        CACFLayerTreeHostClient::shouldRender. Added flushPendingLayerChangesNow and
        m_isFlushingLayerChanges.

        * platform/graphics/ca/win/LayerChangesFlusher.cpp: Added.
        (WebCore::LayerChangesFlusher::shared):
        (WebCore::LayerChangesFlusher::LayerChangesFlusher):
        (WebCore::LayerChangesFlusher::flushPendingLayerChangesSoon):
        (WebCore::LayerChangesFlusher::cancelPendingFlush):
        (WebCore::LayerChangesFlusher::hookCallback):
        (WebCore::LayerChangesFlusher::hookFired):
        (WebCore::LayerChangesFlusher::setHook):
        (WebCore::LayerChangesFlusher::removeHook):

        * platform/graphics/ca/win/LayerChangesFlusher.cpp: Added.
        (WebCore::LayerChangesFlusher::shared): Returns the singleton.
        (WebCore::LayerChangesFlusher::LayerChangesFlusher): Initialize our members.
        (WebCore::LayerChangesFlusher::flushPendingLayerChangesSoon): Add the host to the set of
        hosts with changes that need to be flushed, and set up our hook if we haven't already.
        (WebCore::LayerChangesFlusher::cancelPendingFlush): Remove the host from the set of hosts
        with changes that need to be flushed. If we have no more such hosts, remove our hook, unless
        we're currently in the process of calling out to our hosts, in which case we'll take care of
        the hook once we're done calling out.
        (WebCore::LayerChangesFlusher::hookCallback): This is the function that Windows calls when
        our hook fires. Just calls through to hookFired on the singleton.
        (WebCore::LayerChangesFlusher::hookFired): Tell all the hosts with changes that needed to be
        flushed that it's time to flush. If no hosts re-added themselves to our set during this
        process, remove our hook.
        (WebCore::LayerChangesFlusher::setHook): Calls through to ::SetWindowsHookExW.
        (WebCore::LayerChangesFlusher::removeHook): Calls through to ::UnhookWindowsHookEx.

        * platform/graphics/ca/win/LayerChangesFlusher.h: Added.

2011-01-21  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Sam Weinig.

        GraphicsLayer should be non-copyable
        https://bugs.webkit.org/show_bug.cgi?id=52909

        Use WTF_MAKE_NONCOPYABLE on GraphicsLayer, and WTF_MAKE_FAST_ALLOCATED
        on that and KeyframeValueList.
        
        * platform/graphics/GraphicsLayer.h:

2011-01-21  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Sam Weinig.

        Report the sized used by canvases and types arrays
        https://bugs.webkit.org/show_bug.cgi?id=52856

        Report the memory cost associated with canvas elements,
        and typed arrays to JavaScript as extraCost, so that it
        can figure this into its GC behavior.

        * bindings/js/JSArrayBufferViewHelper.h:
        (WebCore::toJSArrayBufferView): New templatized function, similar
        to getDOMObjectWrapper() but calls reportExtraMemoryCost() with
        the byteLength of the array.
        
        * bindings/js/JSFloat32ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.
        * bindings/js/JSInt16ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.
        * bindings/js/JSInt32ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.
        * bindings/js/JSInt8ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.
        * bindings/js/JSUint16ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.
        * bindings/js/JSUint32ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.
        * bindings/js/JSUint8ArrayCustom.cpp:
        (WebCore::toJS): Use toJSArrayBufferView.

        * html/HTMLCanvasElement.cpp:
        (WebCore::HTMLCanvasElement::createImageBuffer): Call heap.reportExtraMemoryCost()
        with the size of the canvas backing store.
        
        * html/canvas/TypedArrayBase.h:
        (WebCore::TypedArrayBase::byteLength): byteLength needs to
        be public.
        
        * platform/graphics/ImageBuffer.h: Add dataSize() method.
        
        * platform/graphics/cairo/ImageBufferCairo.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().
        * platform/graphics/cg/ImageBufferCG.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().
        * platform/graphics/haiku/ImageBufferHaiku.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().
        * platform/graphics/qt/ImageBufferQt.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().
        * platform/graphics/skia/ImageBufferSkia.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().
        * platform/graphics/wince/ImageBufferWinCE.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().
        * platform/graphics/wx/ImageBufferWx.cpp:
        (WebCore::ImageBuffer::dataSize): Implement dataSize().

2011-01-21  Adam Roben  <aroben@apple.com>

        Rename WKCACFLayerRenderer[Client] to CACFLayerTreeHost[Client]

        Also renamed a few functions and data members to match.

        Fixes <http://webkit.org/b/52898> WKCACFLayerRenderer sounds like a render object, but isn't

        Reviewed by Simon Fraser.

        * WebCore.vcproj/WebCore.vcproj: Updated files' names and paths.

        * WebCore.vcproj/WebCoreQuartzCore.vsprops: Added platform/graphics/ca/win to the include
        path.

        * WebCore.vcproj/copyForwardingHeaders.cmd: Copy headers from platform/graphics/ca/win, too.

        * platform/graphics/ca/win/CACFLayerTreeHost.cpp: Renamed from Source/WebCore/platform/graphics/win/WKCACFLayerRenderer.cpp.
        * platform/graphics/ca/win/CACFLayerTreeHost.h: Renamed from Source/WebCore/platform/graphics/win/WKCACFLayerRenderer.h.

        * platform/graphics/ca/win/PlatformCALayerWin.cpp:
        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h:
        Updated for renames.

2011-01-21  Patrick Gansterer  <paroga@paroga.com>

        Original patch from François Sausset  <sausset@gmail.com>

        Reviewed by Darin Adler.

        Code cleaning in rendering/mathml/RenderMathMLFraction.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52201

        Replace unneeded doubles by floats and remove unneeded casts.

        * rendering/mathml/RenderMathMLFraction.cpp:
        (WebCore::RenderMathMLFraction::paint):
        * rendering/mathml/RenderMathMLFraction.h:

2011-01-21  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Darin Adler.

        REGRESSION(r73618): Clicking on a search input causes a crash.
        https://bugs.webkit.org/show_bug.cgi?id=52905

        The problem is caused by TextControlInnerElement being used both as
        shadow root and an element in a shadow subtree. The code assumed it is
        only used as a shadow root.

        Since this code is all just workaround for in-progress conversion to
        new shadow DOM, I am just adding a check. This code will disappear
        completely once bug 52788 is fixed.

        Test: fast/dom/search-shadow-host-crash.html

        * dom/Node.cpp:
        (WebCore::Node::setShadowHost): Added an ASSERT for early detection
            of attempting to stomp on the parentNode.
        * rendering/TextControlInnerElements.cpp:
        (WebCore::TextControlInnerElement::detach): Added a check to only
            clear shadow host if we have one.

2011-01-21  Adam Roben  <aroben@apple.com>

        Replace some "sync compositing state" terminology with "flush pending GraphicsLayer changes"

        This seems to be the direction in which our code is moving. I chose "GraphicsLayer" as
        opposed to just "layer" because there are cases where we flush changes to CACFLayers that
        don't have a corresponding GraphicsLayer.

        Fixes <http://webkit.org/b/52894> "Sync compositing state" terminology in
        WKCACFLayerRenderer and friends is confusing

        Reviewed by Simon Fraser.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::WKCACFLayerRenderer):
        (WebCore::WKCACFLayerRenderer::render):
        Updated for renames.

        (WebCore::WKCACFLayerRenderer::flushPendingGraphicsLayerChangesSoon): Renamed from
        syncCompositingStateSoon, and updated for other renames.

        * platform/graphics/win/WKCACFLayerRenderer.h: Renamed m_syncLayerChanges to
        * m_shouldFlushPendingGraphicsLayerChanges.
        (WebCore::WKCACFLayerRendererClient::flushPendingGraphicsLayerChanges): Renamed from
        syncCompositingState.

2011-01-21  Adam Roben  <aroben@apple.com>

        Clean up PlatformCAAnimationWin

        Fixes <http://webkit.org/b/52904> PlatformCAAnimationWin is leaky and inefficient

        Reviewed by Simon Fraser.

        * platform/graphics/ca/win/PlatformCAAnimationWin.cpp:
        (toCACFFillModeType):
        (fromCACFFillModeType):
        (toCACFValueFunctionType):
        (fromCACFValueFunctionType):
        Changed to take and return CFStringRefs. There's no need to convert to WebCore::String just
        so we can later convert back to CFStringRef.

        (toCACFTimingFunction): Fixed leaks by changing this to return a RetainPtr and adopting the
        results of CACFTimingFunctionCreate.
        (PlatformCAAnimation::PlatformCAAnimation): Changed not to needlessly roundtrip through
        WebCore::String. Also changed an ASSERT(0) to ASSERT_NOT_REACHED().

        (PlatformCAAnimation::setFillMode):
        (PlatformCAAnimation::setTimingFunction):
        (PlatformCAAnimation::setValueFunction):
        (PlatformCAAnimation::setTimingFunctions):
        Updated for changes to the above conversion functions.

2011-01-21  Charlie Reis  <creis@chromium.org>

        Reviewed by Darin Fisher.

        FrameLoader::checkLoadCompleteForThisFrame uses wrong history item
        https://bugs.webkit.org/show_bug.cgi?id=48812

        Most calls to stopAllLoaders now clear the history's provisional item(s).
        We can now avoid resetting the back/forward state if a new navigation
        is in progress.

        Test: http/tests/navigation/back-twice-without-commit.html
        Test: http/tests/navigation/forward-and-cancel.html

        * loader/FrameLoader.cpp:
        * loader/FrameLoader.h:
        * loader/FrameLoaderTypes.h:
        * WebCore.exp.in: Update stopAllLoaders signature.

2011-01-21  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Show caps lock indicator in password fields
        https://bugs.webkit.org/show_bug.cgi?id=52878

        Test: manual-tests/password-caps-lock.html

        * platform/gtk/KeyEventGtk.cpp:
        (WebCore::PlatformKeyboardEvent::currentCapsLockState): Implement
        currentCapsLockState() using GDK API.
        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::paintCapsLockIndicator): Paint an icon
        in the password field when the caps lock modifier is locked.
        * platform/gtk/RenderThemeGtk.h:

2011-01-21  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: move sticky breakpoints management from InspectorController to InspectorBrowserDebuggerAgent.
        https://bugs.webkit.org/show_bug.cgi?id=52874

        This is the first step of debugger api refactoring (see bug 52879).
        JavaScript breakpoints are still in the same list as native breakpoints and are restored by InspectorBrowserDebuggerAgent.
        The second step will be to move sticky JavaScript breakpoints to InspectorDebuggerAgent.

        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::setAllBrowserBreakpoints):
        (WebCore::InspectorBrowserDebuggerAgent::inspectedURLChanged):
        (WebCore::InspectorBrowserDebuggerAgent::restoreStickyBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::discardBindings):
        (WebCore::InspectorBrowserDebuggerAgent::didInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::didRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::hasBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::updateSubtreeBreakpoints):
        * inspector/InspectorBrowserDebuggerAgent.h:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreInspectorStateFromCookie):
        (WebCore::InspectorController::connectFrontend):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::enableDebugger):
        (WebCore::InspectorController::resume):
        (WebCore::InspectorController::inspectedURL):
        * inspector/InspectorController.h:
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/BreakpointManager.js:
        (WebInspector.BreakpointManager):
        (WebInspector.BreakpointManager.prototype._saveBreakpoints):

2011-01-21  John Knottenbelt  <jknotten@chromium.org>

        Reviewed by Jeremy Orlow.

        Turn off uninitialized errors for ARM linux build.
        https://bugs.webkit.org/show_bug.cgi?id=52893

        Fix ARM compiler breakage.

        * WebCore.gyp/WebCore.gyp:

2011-01-21  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [Chromium] REGRESSION: Using the "Back" button
        while profiling causes renderer crash.

        https://bugs.webkit.org/show_bug.cgi?id=52808

        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::addProfileFinishedMessageToConsole):
        (WebCore::InspectorProfilerAgent::addStartProfilingMessageToConsole):

2011-01-20  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: switch page/Console implementation from InspectorController to InspectorInstrumentation.

        There are some places in WebCore where we still using direct InspectorController calls.
        The idea is to pass all the Inspector related calls via InspectorInstrumentaion which is the
        Inspector facade for WebCore.

        https://bugs.webkit.org/show_bug.cgi?id=52869

        * inspector/InspectorController.cpp:
        * inspector/InspectorController.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::addProfileImpl):
        (WebCore::InspectorInstrumentation::profilerEnabledImpl):
        (WebCore::InspectorInstrumentation::getCurrentUserInitiatedProfileNameImpl):
        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::addProfile):
        (WebCore::InspectorInstrumentation::profilerEnabled):
        (WebCore::InspectorInstrumentation::getCurrentUserInitiatedProfileName):
        * page/Console.cpp:
        (WebCore::Console::profile):
        (WebCore::Console::profileEnd):

2011-01-12  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: breakpoints are restored incorrectly when reverting live edit.
        https://bugs.webkit.org/show_bug.cgi?id=52300

        Fix breakpoints restoring when reverting to old revision by using text diff.
        Move live edit logic from ScriptsPanel to DebuggerModel.
        Eliminate unnecessary editLine delegate in TextViewer.

        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel):
        (WebInspector.DebuggerModel.prototype.reset):
        (WebInspector.DebuggerModel.prototype.editScriptSource):
        (WebInspector.DebuggerModel.prototype._updateScriptSource):
        (WebInspector.DebuggerModel.prototype.get callFrames):
        (WebInspector.DebuggerModel.prototype.pausedScript):
        (WebInspector.DebuggerModel.prototype.resumedScript):
        * inspector/front-end/Script.js:
        (WebInspector.Script.prototype.get source):
        * inspector/front-end/ScriptView.js:
        (WebInspector.ScriptView):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel):
        (WebInspector.ScriptsPanel.prototype._scriptSourceChanged):
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame):
        (WebInspector.SourceFrame.prototype._createViewerIfNeeded):
        (WebInspector.SourceFrame.prototype._doubleClick.didEditLine):
        (WebInspector.SourceFrame.prototype._doubleClick):
        * inspector/front-end/SourceView.js:
        (WebInspector.SourceView):
        * inspector/front-end/TextViewer.js:
        (WebInspector.TextViewer):
        (WebInspector.TextViewer.prototype._handleKeyDown):
        (WebInspector.TextViewer.prototype.editLine.finishEditing):
        (WebInspector.TextViewer.prototype.editLine):
        (WebInspector.TextChunk.prototype._createRow):

2011-01-21  Adam Klein  <adamk@chromium.org>

        Reviewed by Eric Seidel.

        [chromium] Rename ChromiumBridge to PlatformBridge
        https://bugs.webkit.org/show_bug.cgi?id=52471

        No tests added as this is a rename; no change in behavior.

        * WebCore.gypi:
        * bindings/v8/V8DOMWindowShell.cpp:
        (WebCore::reportFatalErrorInV8):
        * page/PageGroup.cpp:
        (WebCore::PageGroup::isLinkVisited):
        * platform/android/PlatformBridge.h:
        * platform/audio/chromium/AudioBusChromium.cpp:
        (WebCore::createBusFromInMemoryAudioFile):
        * platform/chromium/ChromiumBridge.h: Removed.
        * platform/chromium/ChromiumDataObjectLegacy.cpp:
        (WebCore::ChromiumDataObjectLegacy::getData):
        * platform/chromium/DragDataChromium.cpp:
        (WebCore::DragData::asURL):
        * platform/chromium/FileSystemChromium.cpp:
        (WebCore::deleteFile):
        (WebCore::deleteEmptyDirectory):
        (WebCore::getFileSize):
        (WebCore::getFileModificationTime):
        (WebCore::revealFolderInOS):
        (WebCore::directoryName):
        (WebCore::pathByAppendingComponent):
        (WebCore::makeAllDirectories):
        (WebCore::fileExists):
        (WebCore::openFile):
        (WebCore::closeFile):
        (WebCore::seekFile):
        (WebCore::truncateFile):
        (WebCore::readFromFile):
        (WebCore::writeToFile):
        * platform/chromium/LanguageChromium.cpp:
        (WebCore::platformDefaultLanguage):
        * platform/chromium/LinkHashChromium.cpp:
        (WebCore::visitedLinkHash):
        * platform/chromium/MIMETypeRegistryChromium.cpp:
        (WebCore::MIMETypeRegistry::getMIMETypeForExtension):
        (WebCore::MIMETypeRegistry::getPreferredExtensionForMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedImageMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedJavaScriptMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedNonImageMIMEType):
        * platform/chromium/PasteboardChromium.cpp:
        (WebCore::Pasteboard::writeSelection):
        (WebCore::Pasteboard::writePlainText):
        (WebCore::Pasteboard::writeURL):
        (WebCore::Pasteboard::writeImage):
        (WebCore::Pasteboard::canSmartReplace):
        (WebCore::Pasteboard::plainText):
        (WebCore::Pasteboard::documentFragment):
        * platform/chromium/PlatformBridge.h:
        * platform/chromium/PlatformScreenChromium.cpp:
        (WebCore::screenDepth):
        (WebCore::screenDepthPerComponent):
        (WebCore::screenIsMonochrome):
        (WebCore::screenRect):
        (WebCore::screenAvailableRect):
        * platform/chromium/ReadableDataObject.cpp:
        (WebCore::ReadableDataObject::getData):
        (WebCore::ReadableDataObject::urlTitle):
        (WebCore::ReadableDataObject::htmlBaseUrl):
        (WebCore::ReadableDataObject::filenames):
        (WebCore::ReadableDataObject::ensureTypeCacheInitialized):
        * platform/chromium/SSLKeyGeneratorChromium.cpp:
        (WebCore::signedPublicKeyAndChallengeString):
        * platform/chromium/ScrollbarThemeChromium.cpp:
        * platform/chromium/ScrollbarThemeChromiumLinux.cpp:
        (WebCore::ScrollbarThemeChromiumLinux::scrollbarThickness):
        (WebCore::ScrollbarThemeChromiumLinux::paintTrackPiece):
        (WebCore::ScrollbarThemeChromiumLinux::paintButton):
        (WebCore::ScrollbarThemeChromiumLinux::paintThumb):
        (WebCore::ScrollbarThemeChromiumLinux::buttonSize):
        (WebCore::ScrollbarThemeChromiumLinux::minimumThumbLength):
        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::scrollbarStateToThemeState):
        (WebCore::ScrollbarThemeChromiumMac::paint):
        * platform/chromium/ScrollbarThemeChromiumWin.cpp:
        (WebCore::ScrollbarThemeChromiumWin::scrollbarThickness):
        (WebCore::ScrollbarThemeChromiumWin::paintTrackPiece):
        (WebCore::ScrollbarThemeChromiumWin::paintButton):
        (WebCore::ScrollbarThemeChromiumWin::paintThumb):
        (WebCore::ScrollbarThemeChromiumWin::buttonSize):
        * platform/chromium/SharedTimerChromium.cpp:
        (WebCore::setSharedTimerFiredFunction):
        (WebCore::setSharedTimerFireTime):
        (WebCore::stopSharedTimer):
        * platform/chromium/SuddenTerminationChromium.cpp:
        (WebCore::disableSuddenTermination):
        (WebCore::enableSuddenTermination):
        * platform/chromium/SystemTimeChromium.cpp:
        (WebCore::currentTime):
        * platform/chromium/WritableDataObject.cpp:
        (WebCore::WritableDataObject::setData):
        * platform/graphics/chromium/CrossProcessFontLoading.mm:
        * platform/graphics/chromium/FontCacheChromiumWin.cpp:
        (WebCore::fontContainsCharacter):
        (WebCore::FillLogFont):
        * platform/graphics/chromium/FontCacheLinux.cpp:
        (WebCore::FontCache::getFontDataForCharacters):
        * platform/graphics/chromium/FontChromiumWin.cpp:
        (WebCore::Font::drawGlyphs):
        * platform/graphics/chromium/FontPlatformDataChromiumWin.cpp:
        (WebCore::FontPlatformData::scriptFontProperties):
        * platform/graphics/chromium/FontPlatformDataLinux.cpp:
        (WebCore::FontPlatformData::querySystemForRenderStyle):
        * platform/graphics/chromium/GlyphPageTreeNodeChromiumWin.cpp:
        (WebCore::fillBMPGlyphs):
        * platform/graphics/chromium/ImageChromium.cpp:
        (WebCore::Image::loadPlatformResource):
        * platform/graphics/chromium/ImageChromiumMac.mm:
        (WebCore::Image::loadPlatformResource):
        * platform/graphics/chromium/SimpleFontDataChromiumWin.cpp:
        (WebCore::SimpleFontData::platformInit):
        (WebCore::SimpleFontData::determinePitch):
        (WebCore::SimpleFontData::platformWidthForGlyph):
        * platform/graphics/chromium/UniscribeHelperTextRun.cpp:
        (WebCore::UniscribeHelperTextRun::tryToPreloadFont):
        * platform/graphics/skia/FontCustomPlatformData.cpp:
        (WebCore::FontCustomPlatformData::fontPlatformData):
        * platform/network/chromium/CookieJarChromium.cpp:
        (WebCore::setCookies):
        (WebCore::cookies):
        (WebCore::cookieRequestHeaderFieldValue):
        (WebCore::cookiesEnabled):
        (WebCore::getRawCookies):
        (WebCore::deleteCookie):
        * platform/network/chromium/DNSChromium.cpp:
        (WebCore::prefetchDNS):
        * platform/qt/PlatformBridge.h:
        * platform/sql/chromium/SQLiteFileSystemChromium.cpp:
        (WebCore::SQLiteFileSystem::deleteDatabaseFile):
        (WebCore::SQLiteFileSystem::getDatabaseFileSize):
        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
        (chromiumOpen):
        (chromiumDelete):
        (chromiumAccess):
        * platform/sql/chromium/SQLiteFileSystemChromiumWin.cpp:
        * plugins/chromium/PluginDataChromium.cpp:
        (WebCore::PluginCache::plugins):
        * rendering/RenderThemeChromiumMac.mm:
        (WebCore::RenderThemeChromiumMac::usesTestModeFocusRingColor):
        * rendering/RenderThemeChromiumSkia.cpp:
        (WebCore::RenderThemeChromiumSkia::caretBlinkInterval):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::platformActiveSelectionBackgroundColor):
        (WebCore::RenderThemeChromiumWin::platformInactiveSelectionBackgroundColor):
        (WebCore::RenderThemeChromiumWin::platformActiveSelectionForegroundColor):
        (WebCore::RenderThemeChromiumWin::systemColor):
        (WebCore::RenderThemeChromiumWin::paintButton):
        (WebCore::RenderThemeChromiumWin::paintSliderTrack):
        (WebCore::menuListButtonWidth):
        (WebCore::RenderThemeChromiumWin::paintMenuList):
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        (WebCore::RenderThemeChromiumWin::paintInnerSpinButton):
        (WebCore::RenderThemeChromiumWin::paintProgressBar):
        * storage/chromium/IDBFactoryBackendInterface.cpp:
        (WebCore::IDBFactoryBackendInterface::create):
        (WebCore::IDBFactoryBackendInterface::~IDBFactoryBackendInterface):
        * storage/chromium/IDBKeyPathBackendImpl.cpp:
        (WebCore::IDBKeyPathBackendImpl::createIDBKeysFromSerializedValuesAndKeyPath):

2011-01-21  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76335.
        http://trac.webkit.org/changeset/76335
        https://bugs.webkit.org/show_bug.cgi?id=52875

        profiler tests were broken (Requested by loislo on #webkit).

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::addProfile):
        (WebCore::InspectorController::getCurrentUserInitiatedProfileName):
        * inspector/InspectorController.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsoleImpl):
        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsole):
        (WebCore::InspectorInstrumentation::inspectorControllerWithFrontendForPage):
        * page/Console.cpp:
        (WebCore::Console::profile):
        (WebCore::Console::profileEnd):

2011-01-21  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: switch page/Console implementation from InspectorController to InspectorInstrumentation.

        There are some places in WebCore where we still using direct InspectorController calls.
        The idea is to pass all the Inspector related calls via InspectorInstrumentaion which is the
        Inspector facade for WebCore.

        https://bugs.webkit.org/show_bug.cgi?id=52869

        * inspector/InspectorController.cpp:
        * inspector/InspectorController.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::addProfileImpl):
        (WebCore::InspectorInstrumentation::profilerEnabledImpl):
        (WebCore::InspectorInstrumentation::getCurrentUserInitiatedProfileNameImpl):
        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::addProfile):
        (WebCore::InspectorInstrumentation::profilerEnabled):
        (WebCore::InspectorInstrumentation::getCurrentUserInitiatedProfileName):
        * page/Console.cpp:
        (WebCore::Console::profile):
        (WebCore::Console::profileEnd):

2011-01-20  Sam Weinig  <sam@webkit.org>

        Reviewed by Gavin Barraclough.

        Fix failing tests from r76291.

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::scrollPosition):
        (WebCore::ScrollView::updateScrollbars):
        Take the scroll origin into account in more places.

2011-01-20  Kent Tamura  <tkent@chromium.org>

        Unreviewed, sorting an Xcode project file.

        * WebCore.xcodeproj/project.pbxproj:

2011-01-20  Ben Vanik  <ben.vanik@gmail.com>

        Reviewed by Kenneth Russell.

        Implementation of the OES_standard_derivatives WebGL extension.
        https://bugs.webkit.org/show_bug.cgi?id=51678

        Changes are modeled off of the existing OESTextureFloat extension. New files,
        extension retrieval, etc all match the existing code.

        Changed ANGLEWebKitBridge to allow for multiple sets of the ANGLE shader compiler
        options. This supports the enabling of the standard derivatives flag when the
        extension is enabled. Refactored the cleanup code to make the destruction of the
        compilers (if they had been created) cleaner.

        Tested with the WebGL conformance test:
        https://cvs.khronos.org/svn/repos/registry/trunk/public/webgl/sdk/tests/conformance/oes-standard-derivatives.html
        Passes on WebKit/OSX, Chromium/OSX, and Chromium/Windows.

        * CMakeLists.txt:
        * DerivedSources.make:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pri:
        * WebCore.pro:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/JSWebGLRenderingContextCustom.cpp:
        (WebCore::toJS):
        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
        (WebCore::toV8Object):
        * html/canvas/OESStandardDerivatives.cpp: Added.
        (WebCore::OESStandardDerivatives::OESStandardDerivatives):
        (WebCore::OESStandardDerivatives::~OESStandardDerivatives):
        (WebCore::OESStandardDerivatives::getName):
        (WebCore::OESStandardDerivatives::create):
        * html/canvas/OESStandardDerivatives.h: Added.
        * html/canvas/OESStandardDerivatives.idl: Added.
        * html/canvas/WebGLExtension.h:
        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::getExtension): Enable and return the new extension.
        (WebCore::WebGLRenderingContext::getParameter): Support extension enum when enabled.
        (WebCore::WebGLRenderingContext::getSupportedExtensions): 
        (WebCore::WebGLRenderingContext::hint): Validate extension enum when enabled.
        (WebCore::WebGLRenderingContext::getNumberOfExtensions):
        (WebCore::WebGLRenderingContext::getExtensionNumber):
        * html/canvas/WebGLRenderingContext.h:
        * platform/graphics/ANGLEWebKitBridge.cpp:
        (WebCore::ANGLEWebKitBridge::~ANGLEWebKitBridge): Cleaned up compiler cleanup.
        (WebCore::ANGLEWebKitBridge::cleanupCompilers): Destruct compilers.
        (WebCore::ANGLEWebKitBridge::setResources): Cleanup existing compilers when changing
        ANGLE settings.
        (WebCore::ANGLEWebKitBridge::validateShaderSource): Cleaned up compiler cleanup on error.
        * platform/graphics/ANGLEWebKitBridge.h:
        (WebCore::ANGLEWebKitBridge::getResources):
        * platform/graphics/Extensions3D.h: Added enumeration for the extension.
        * platform/graphics/GraphicsContext3D.h: lumbing for GraphicsContext3D.
        * platform/graphics/opengl/Extensions3DOpenGL.cpp:
        (WebCore::Extensions3DOpenGL::Extensions3DOpenGL): Plumbed through a pointer to the
        GraphicsContext3D to handle resetting the shader compilers.
        (WebCore::Extensions3DOpenGL::supports): Desktop GL always supports this extension,
        so always return true.
        (WebCore::Extensions3DOpenGL::ensureEnabled): Reset shader compilers as required.
        * platform/graphics/opengl/Extensions3DOpenGL.h: Plumbing for GraphicsContext3D.
        * platform/graphics/opengl/GraphicsContext3DOpenGL.cpp:
        (WebCore::GraphicsContext3D::getExtensions): Plumbing for GraphicsContext3D to
        Extensions3DOpenGL.

2011-01-20  Xiaomei Ji  <xji@chromium.org>

        Reviewed by Dan Bernstein.

        Fix regression(r71566): PDF in RTL block might messes up text directionality.
        https://bugs.webkit.org/show_bug.cgi?id=52776

        Test: fast/dom/52776.html

        * platform/text/BidiResolver.h:
        (WebCore::::checkDirectionInLowerRaiseEmbeddingLevel):
        (WebCore::::lowerExplicitEmbeddingLevel):
        (WebCore::::raiseExplicitEmbeddingLevel):
        (WebCore::::createBidiRunsForLine):

2011-01-20  Beth Dakin  <bdakin@apple.com>

        Reviewed by Anders Carlsson.

        Follow-on for <rdar://problem/8890255>

        This fixes a painting error with ScrollbarPainter scrollers
        and the new drawing area code path.
        * platform/mac/ScrollbarThemeMac.mm:
        (WebCore::updateArrowPlacement):

2011-01-20  Levi Weintraub  <leviw@chromium.org>

        Unreviewed.

        Fixing build breakage.

        * editing/SelectionController.cpp:
        (WebCore::SelectionController::willBeModified):

2011-01-20  Levi Weintraub  <leviw@chromium.org>

        Reviewed by Ryosuke Niwa.

        RTL: Caret goes to the opposite direction when pressing an arrow key after selection is made
        https://bugs.webkit.org/show_bug.cgi?id=49511

        Test: editing/selection/rtl-move-selection-right-left.html

        * editing/SelectionController.cpp:
        (WebCore::SelectionController::willBeModified):
        Respecting the direction of the containing block when switching selection base and extent in
        RTL content.

        (WebCore::SelectionController::modifyMovingRight):
        (WebCore::SelectionController::modifyMovingLeft):
        Using directionOfEnclosingBlock when deciding to use the selection start or end to do the
        correct thing for RTL.

2011-01-20  Nate Chapin  <japhet@chromium.org>

        Reviewed by Adam Barth.

        Null-check m_frame in DOMWindow::setLocation(), since it's
        possible to reach this point without it having been checked
        already.
        https://bugs.webkit.org/show_bug.cgi?id=52769

        Test: fast/dom/Window/Location/set-location-after-close.html

        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::setLocation):

2011-01-20  Chang Shu  <chang.shu@nokia.com>

        Reviewed by Darin Adler.

        setContentEditable with invalid string should throw exception.
        https://bugs.webkit.org/show_bug.cgi?id=52057

        Implemented exception throwing for setContentEditable according to the following spec:
        http://www.whatwg.org/specs/web-apps/current-work/multipage/editing.html#attr-contenteditable
        Related quotas: "On setting, if the new value is an ASCII case-insensitive match for the 
        string 'inherit' then the content attribute must be removed, if the new value is an ASCII 
        case-insensitive match for the string 'true' then the content attribute must be set to the 
        string 'true', if the new value is an ASCII case-insensitive match for the string 'false' 
        then the content attribute must be set to the string 'false', and otherwise the attribute 
        setter must raise a SYNTAX_ERR exception."

        * html/HTMLElement.cpp:
        (WebCore::HTMLElement::setContentEditable): Throw exception on invalid input strings; Make setting values case-insensitive and also convert them to lower cases according to the spec.
        * html/HTMLElement.h: Add additional parameter ExceptionCode& for function setContentEditable.
        * html/HTMLElement.idl: Add exception throwing support for contentEditable setter.

2011-01-19  Adrienne Walker  <enne@google.com>

        Reviewed by James Robinson.

        [chromium] Composited render surfaces should allow writes to alpha channel.
        https://bugs.webkit.org/show_bug.cgi?id=52766

        Test: LayoutTests/platform/chromium/compositing

        * platform/graphics/chromium/LayerRendererChromium.cpp:
        (WebCore::LayerRendererChromium::drawLayers):

2011-01-14  Jer Noble  <jer.noble@apple.com>

        Reviewed by Eric Carlson.

        REGRESSION (r71842): Compass video is not playing in Safari welcome page
        https://bugs.webkit.org/show_bug.cgi?id=52506

        New test: LayoutTests/media/video-currentTime-delay.html

        Call invalidateCachedTime() every time one of the cached property dependencies changes,
        i.e. m_paused and m_playbackRate.

        * html/HTMLMediaElement.cpp:
        (WebCore::HTMLMediaElement::prepareForLoad):
        (WebCore::HTMLMediaElement::setReadyState):
        (WebCore::HTMLMediaElement::setPlaybackRate):
        (WebCore::HTMLMediaElement::mediaPlayerRateChanged):

2011-01-20  Beth Dakin  <bdakin@apple.com>

        Reviewed by Geoffrey Garen.

        Fix for <rdar://problem/8890255>

        Allow WebKitSystemInterface to draw scrollbars 
        when appropriate.
        * WebCore.exp.in:
        * platform/mac/ScrollbarThemeMac.mm:
        (WebCore::scrollbarMap):
        (+[ScrollbarPrefsObserver appearancePrefsChanged:]):
        (WebCore::ScrollbarThemeMac::registerScrollbar):
        (WebCore::ScrollbarThemeMac::unregisterScrollbar):
        (WebCore::ScrollbarThemeMac::paint):
        * platform/mac/WebCoreSystemInterface.h:
        * platform/mac/WebCoreSystemInterface.mm:

2011-01-20  Sam Weinig  <sam@webkit.org>

        Reviewed by Dave Hyatt.

        Cleanup Scrollbar/ScrollbarClient relationship
        https://bugs.webkit.org/show_bug.cgi?id=52779

        Pipe all scrolling through the ScrollbarClient/ScrollAnimator
        rather than through the Scrollbar. The Scrollbar now is just
        a "view" on the scroll position of the scrollable area it is
        attached to.

        There are now two ways to scroll a scrollable area:
        - ScrollbarClient::scroll()
        - ScrollbarClient::scrollToOffsetWithoutAnimation()

        Both of these go through the ScrollAnimator (updating its state
        or starting an animation). The ScrollAnimator, in turn, now calls
        ScrollbarClient::setScrollOffsetFromAnimation, which tells the
        Scrollbars to pull a new offset (via Scrollbar::offsetDidChange)
        and tells the class that derives from ScrollbarClient to scroll
        its contents (via ScrollbarClient::setScrollOffset).

        * WebCore.xcodeproj/project.pbxproj:
        Move Scrollbar.cpp to the right place.

        * accessibility/AccessibilityScrollbar.cpp:
        (WebCore::AccessibilityScrollbar::setValue):
        Initiate the scroll through the scrollbar client, rather than the
        scrollbar itself.

        * page/FrameView.cpp:
        (WebCore::FrameView::scrollTo):
        * page/FrameView.h:
        Condense the two valueChanged overrides to a single override of the
        scrollTo function.

        * platform/ScrollAnimator.cpp:
        (WebCore::ScrollAnimator::scroll):
        (WebCore::ScrollAnimator::scrollToOffsetWithoutAnimation):
        (WebCore::ScrollAnimator::currentPosition):
        (WebCore::ScrollAnimator::notityPositionChanged):
        * platform/ScrollAnimator.h:
        * platform/ScrollAnimatorWin.cpp:
        (WebCore::ScrollAnimatorWin::scrollToOffsetWithoutAnimation):
        (WebCore::ScrollAnimatorWin::animateScroll):
        * platform/ScrollAnimatorWin.h:
        * platform/mac/ScrollAnimatorMac.h:
        * platform/mac/ScrollAnimatorMac.mm:
        (WebCore::ScrollAnimatorMac::scrollToOffsetWithoutAnimation):
        (WebCore::ScrollAnimatorMac::immediateScrollToPoint):
        Change setScrollPositionAndStopAnimation to scrollToOffsetWithoutAnimation
        and bottleneck all client notification of changed position through a new
        notityPositionChanged() function.

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::setScrollOffset):
        (WebCore::ScrollView::scrollTo):
        (WebCore::ScrollView::scrollPosition):
        (WebCore::ScrollView::scroll):
        (WebCore::ScrollView::updateScrollbars):
        (WebCore::ScrollView::wheelEvent):
        * platform/ScrollView.h:
        (WebCore::ScrollView::horizontalScrollbar):
        (WebCore::ScrollView::verticalScrollbar):
        Update to scroll via the ScrollbarClient rather than the Scrollbar.

        * platform/Scrollbar.cpp:
        (WebCore::Scrollbar::offsetDidChange):
        (WebCore::Scrollbar::autoscrollPressedPart):
        (WebCore::Scrollbar::moveThumb):
        (WebCore::Scrollbar::mouseMoved):
        * platform/Scrollbar.h:
        (WebCore::Scrollbar::setPressedPos):
        Change the scrollbar to only updates its offset in response to
        an offsetDidChange call.

        * platform/ScrollbarClient.cpp:
        (WebCore::ScrollbarClient::scroll):
        (WebCore::ScrollbarClient::scrollToOffsetWithoutAnimation):
        (WebCore::ScrollbarClient::scrollToXOffsetWithoutAnimation):
        (WebCore::ScrollbarClient::scrollToYOffsetWithoutAnimation):
        (WebCore::ScrollbarClient::setScrollOffsetFromAnimation):
        * platform/ScrollbarClient.h:
        (WebCore::ScrollbarClient::horizontalScrollbar):
        (WebCore::ScrollbarClient::verticalScrollbar):
        Make the increasingly misnamed ScrollbarClient responsible for
        scrolling.

        * platform/efl/ScrollbarEfl.cpp:
        (scrollbarEflEdjeMessage):
        * platform/gtk/MainFrameScrollbarGtk.cpp:
        (MainFrameScrollbarGtk::gtkValueChanged):
        * platform/qt/ScrollbarQt.cpp:
        (WebCore::Scrollbar::contextMenu):
        Update to move scrolling through the client.

        * platform/win/PopupMenuWin.cpp:
        (WebCore::PopupMenuWin::scrollToRevealSelection):
        (WebCore::PopupMenuWin::scrollPosition):
        (WebCore::PopupMenuWin::setScrollOffset):
        (WebCore::PopupMenuWin::scrollTo):
        (WebCore::PopupMenuWin::wndProc):
        * platform/win/PopupMenuWin.h:
        (WebCore::PopupMenuWin::verticalScrollbar):
        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::scrollToOffset):
        (WebCore::RenderLayer::scrollTo):
        (WebCore::RenderLayer::setScrollOffset):
        (WebCore::RenderLayer::scrollPosition):
        (WebCore::RenderLayer::updateScrollInfoAfterLayout):
        (WebCore::RenderLayer::scroll):
        * rendering/RenderLayer.h:
        * rendering/RenderListBox.cpp:
        (WebCore::RenderListBox::scrollToRevealElementAtListIndex):
        (WebCore::RenderListBox::scroll):
        (WebCore::RenderListBox::logicalScroll):
        (WebCore::RenderListBox::scrollPosition):
        (WebCore::RenderListBox::setScrollOffset):
        (WebCore::RenderListBox::scrollTo):
        (WebCore::RenderListBox::setScrollTop):
        * rendering/RenderListBox.h:
        (WebCore::RenderListBox::verticalScrollbar):
        Update to scroll via the ScrollbarClient rather than the Scrollbar.

        * rendering/RenderMarquee.cpp:
        (WebCore::RenderMarquee::start):
        Simplify initial paint to just do an immediate scroll to the position.

2011-01-20  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r76170.

        * platform/graphics/wince/FontWinCE.cpp: Added a missing include.
        * platform/graphics/wince/ImageBufferData.h: Added a missing include and fixed style.

2011-01-20  James Robinson  <jamesr@chromium.org>

        Reviewed by Darin Fisher.

        Implement mozilla's requestAnimationFrame API
        https://bugs.webkit.org/show_bug.cgi?id=51218

        This implements mozilla's proposed requestAnimationFrame API.  The idea with this API is that
        an author driving an animation from script could use window.requestAnimationFrame(callback)
        instead of window.setTimeout(callback, 0) to schedule their update logic and let the browser
        decide when to update the animations.  This avoids doing unnecessary work when the page content
        is offscreen or is being displayed at a different framerate than what the page author expects.

        Mozilla's proposal is here: https://developer.mozilla.org/en/DOM/window.mozRequestAnimationFrame
        This implements window.mozRequestAnimationFrame as window.webkitRequestAnimationFrame with the
        following changes:
        *) Only the callback syntax is supported, there is no before paint event
        *) webkitRequestAnimationFrame supports a second parameter Element to let the author indicate
            what content they intend to animate.  That way if the page is being displayed but the element
            in question is offscreen, we can avoid invoking the callback.
        *) No timestamp is provided to the caller and there is no window.animationStartTime property
            (see https://bugs.webkit.org/show_bug.cgi?id=51952 for discussion of this property)
        *) window.webkitRequestAnimationFrame returns a numerical id that can be used to cancel the callback
            using window.cancelWebkitRequestAnimationFrame, to parallel window.setTimeout()/window.clearTime().

        The implementation depends on the embedder scheduling the callbacks since the callback invocation
        depends on the page's visibility and the embedder's paint scheduling, neither of which are exposed
        to WebCore.  The expectation for the embedder is that at some point Chrome::scheduleAnimation() is
        called FrameView::serviceScriptedAnimations() should be called for the associated Page's main frame.
        Ideally serviceScriptedAnimations() would be called prior to rendering - although in practice the
        embedder has to rate limit callbacks and may not be able to tie the callback directly to the
        rendering loop.

        Tests: fast/animation/request-animation-frame-cancel.html
               fast/animation/request-animation-frame-cancel2.html
               fast/animation/request-animation-frame-display.html
               fast/animation/request-animation-frame-within-callback.html
               fast/animation/request-animation-frame.html

        * WebCore.gypi:
        * dom/Document.cpp:
        (WebCore::Document::Document):
        (WebCore::Document::webkitRequestAnimationFrame):
        (WebCore::Document::webkitCancelRequestAnimationFrame):
        (WebCore::Document::serviceScriptedAnimations):
        * dom/Document.h:
        * dom/RequestAnimationFrameCallback.h: Added.
        (WebCore::RequestAnimationFrameCallback::~RequestAnimationFrameCallback):
        * dom/RequestAnimationFrameCallback.idl: Added.
        * loader/EmptyClients.h:
        (WebCore::EmptyChromeClient::scheduleAnimation):
        * page/Chrome.cpp:
        (WebCore::Chrome::scheduleAnimation):
        * page/Chrome.h:
        * page/ChromeClient.h:
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::webkitRequestAnimationFrame):
        (WebCore::DOMWindow::webkitCancelRequestAnimationFrame):
        * page/DOMWindow.h:
        * page/DOMWindow.idl:
        * page/FrameView.cpp:
        (WebCore::FrameView::scheduleAnimation):
        (WebCore::FrameView::serviceScriptedAnimations):
        * page/FrameView.h:
        * platform/HostWindow.h:

2011-01-20  James Robinson  <jamesr@chromium.org>

        Reviewed by Nate Chapin.

        [v8] CodeGeneratorV8 generates incorrect code for callbacks with no parameters
        https://bugs.webkit.org/show_bug.cgi?id=52837

        When generating code to invoke a callback with no parameters CodeGeneratorV8.pm was generating the following:
        v8::Handle<v8::Value> argv[] = {}; which does not compile in visual studio.  Instead, if the argument count
        is 0, we can just pass a NULL pointer for the argv parameter.

        Test added to bindings/scripts/test/TestCallback.idl and covered by run-bindings-tests.  This
        patch also includes some spurious changes to the bindings tests golden files (mostly GObject)
        because the old golden files were out of date.

        * bindings/scripts/CodeGeneratorV8.pm:
        * bindings/scripts/test/CPP/WebDOMTestCallback.cpp:
        (WebDOMTestCallback::callbackWithNoParam):
        * bindings/scripts/test/CPP/WebDOMTestCallback.h:
        * bindings/scripts/test/GObject/WebKitDOMTestCallback.cpp:
        (webkit_dom_test_callback_callback_with_no_param):
        * bindings/scripts/test/GObject/WebKitDOMTestCallback.h:
        * bindings/scripts/test/GObject/WebKitDOMTestInterface.cpp:
        * bindings/scripts/test/GObject/WebKitDOMTestMediaQueryListListener.cpp:
        * bindings/scripts/test/GObject/WebKitDOMTestObj.cpp:
        * bindings/scripts/test/JS/JSTestCallback.cpp:
        (WebCore::JSTestCallback::callbackWithNoParam):
        * bindings/scripts/test/JS/JSTestCallback.h:
        * bindings/scripts/test/JS/JSTestInterface.cpp:
        * bindings/scripts/test/JS/JSTestMediaQueryListListener.cpp:
        * bindings/scripts/test/JS/JSTestObj.cpp:
        * bindings/scripts/test/ObjC/DOMTestCallback.h:
        * bindings/scripts/test/ObjC/DOMTestCallback.mm:
        (-[DOMTestCallback callbackWithNoParam]):
        * bindings/scripts/test/TestCallback.idl:
        * bindings/scripts/test/V8/V8TestCallback.cpp:
        (WebCore::V8TestCallback::callbackWithNoParam):
        * bindings/scripts/test/V8/V8TestCallback.h:
        * bindings/scripts/test/V8/V8TestObj.cpp:
        (WebCore::TestObjInternal::reflectedUnsignedIntegralAttrAttrGetter):

2011-01-20  James Robinson  <jamesr@chromium.org>

        Reviewed by Eric "Baller" Seidel.

        RenderTableSection's setNeedsCellRecalc needs to null check table()
        https://bugs.webkit.org/show_bug.cgi?id=52770

        Null checks table() before deferencing it in RenderTableSection::setNeedsCellRecalc.
        This can be null during detach().  Test constructed by Eric Seidel.

        Test: fast/css-generated-content/table-with-scrollbar-corner.html

        * rendering/RenderTableSection.cpp:
        (WebCore::RenderTableSection::setNeedsCellRecalc):
        * rendering/RenderTableSection.h:

2011-01-20  Dirk Schulze  <krit@webkit.org>

        Reviewed by Rob Buis.

        SVG Pattern doesn't take preserveAspectRatio of references Pattern
        https://bugs.webkit.org/show_bug.cgi?id=52802

        SVGPattern didn't take preserveAspectRatio of a referenced SVGPattern into account. Store preserveAspectRatio
        in PatternAttributes as well, if the attribute was set on the referenced SVGPattern element.

        Test: svg/custom/pattern-referencing-preserve-aspect-ratio.svg

        * rendering/svg/RenderSVGResourcePattern.cpp:
        (WebCore::RenderSVGResourcePattern::buildTileImageTransform):
        * svg/PatternAttributes.h:
        (WebCore::PatternAttributes::PatternAttributes):
        (WebCore::PatternAttributes::preserveAspectRatio):
        (WebCore::PatternAttributes::setPreserveAspectRatio):
        (WebCore::PatternAttributes::hasPreserveAspectRatio):
        * svg/SVGPatternElement.cpp:
        (WebCore::SVGPatternElement::collectPatternAttributes):

2011-01-20  Dan Bernstein  <mitz@apple.com>

        Reviewed by Adele Peterson.

        <rdar://problem/8765498> REGRESSION (r72141): Cannot order prints with Aperture 3.1

        <rdar://problem/8884648> REGRESSION (r72141): Safari hangs when visiting a page on www.bfmtv.com
        https://bugs.webkit.org/show_bug.cgi?id=52765

        <rdar://problem/8890909> REGRESSION (r72141): Very Slow Rendering With Certain Markup
        https://bugs.webkit.org/show_bug.cgi?id=52265

        Test: fast/block/line-layout/negative-max-height.html

        Integer overflow detection led to a block having a huge height. This manifested as broken layout
        in the first bug and as extreme slowness in the latter bugs because of
        https://bugs.webkit.org/show_bug.cgi?id=52832

        * rendering/RootInlineBox.cpp:
        (WebCore::RootInlineBox::alignBoxesInBlockDirection): Clamp maxHeight to 0 so the next line
        cannot start above this line. The negative maxHeight also caused the integer overflow detection
        logic to give the block a huge height.

2011-01-20  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Eric Carlson.

        Clean up the Media Controls CSS for Qt
        https://bugs.webkit.org/show_bug.cgi?id=52822

        Split the audio::-webkit-media-xxx and video::-webkit-media-xxx rules 
        in mediaControlsQt.css, and remove the duplicate audio::-webkit-media-xxx
        rules from mediaControlsQtFullscreen.css.

        * css/mediaControlsQt.css:
        (audio::-webkit-media-controls-panel):
        (video::-webkit-media-controls-panel):
        (audio::-webkit-media-controls-mute-button):
        (video::-webkit-media-controls-mute-button):
        (audio::-webkit-media-controls-play-button):
        (video::-webkit-media-controls-play-button):
        (audio::-webkit-media-controls-timeline-container):
        (video::-webkit-media-controls-timeline-container):
        (audio::-webkit-media-controls-current-time-display):
        (video::-webkit-media-controls-current-time-display):
        (audio::-webkit-media-controls-time-remaining-display):
        (video::-webkit-media-controls-time-remaining-display):
        (audio::-webkit-media-controls-timeline):
        (video::-webkit-media-controls-timeline):
        (audio::-webkit-media-controls-volume-slider-container):
        (video::-webkit-media-controls-volume-slider-container):
        (audio::-webkit-media-controls-volume-slider):
        (video::-webkit-media-controls-volume-slider):
        (audio::-webkit-media-controls-seek-back-button):
        (video::-webkit-media-controls-seek-back-button):
        (audio::-webkit-media-controls-seek-forward-button):
        (video::-webkit-media-controls-seek-forward-button):
        (audio::-webkit-media-controls-fullscreen-button):
        (video::-webkit-media-controls-fullscreen-button):
        (audio::-webkit-media-controls-rewind-button):
        (video::-webkit-media-controls-rewind-button):
        (audio::-webkit-media-controls-return-to-realtime-button):
        (video::-webkit-media-controls-return-to-realtime-button):
        (audio::-webkit-media-controls-toggle-closed-captions-button):
        (video::-webkit-media-controls-toggle-closed-captions-button):
        * css/mediaControlsQtFullscreen.css:
        (video::-webkit-media-controls-time-remaining-display):
        (video::-webkit-media-controls-seek-back-button):
        (video::-webkit-media-controls-seek-forward-button):
        (video::-webkit-media-controls-rewind-button):
        (video::-webkit-media-controls-return-to-realtime-button):
        (video::-webkit-media-controls-toggle-closed-captions-button):

2011-01-20  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [REGRESSION] Canceling of CSS numeric values increment/decrement is broken
        https://bugs.webkit.org/show_bug.cgi?id=52816

        * inspector/front-end/StylesSidebarPane.js:
        (WebInspector.StylePropertyTreeElement.prototype):

2011-01-20  Dawit Alemayehu  <adawit@kde.org>

        Reviewed by Andreas Kling.

        [Qt] Fix Layering violation in MediaPlayerPrivateQt.
        https://bugs.webkit.org/show_bug.cgi?id=52733

        No new tests. no behavioral change.

       * platform/graphics/qt/MediaPlayerPrivateQt.cpp:
        (WebCore::MediaPlayerPrivateQt::commitLoad):

2011-01-20  Nate Chapin  <japhet@chromium.org>

        Reviewed by Darin Fisher.

        [V8] Call malloc and memcpy directly instead of
        of strdup in convertV8ObjectToNPVariant() when
        converting strings. If there is a null character
        in the string, our use of strdup causes us to allocate
        too little memory, leading to out of bounds reads.

        https://bugs.webkit.org/show_bug.cgi?id=52631

        * bindings/v8/V8NPUtils.cpp:
        (WebCore::convertV8ObjectToNPVariant):

2011-01-20  Andreas Kling  <kling@webkit.org>

        Reviewed by Ariya Hidayat.

        [Qt] Fill shadow scratch buffer with proper transparent pixels

        QImage::fill() has no Qt::GlobalColor overload in Qt 4.7 (coming in 4.8)
        so doing QImage::fill(Qt::transparent) will actually fill all pixels with
        the RGBA value 0x00000013.

        * platform/graphics/qt/ContextShadowQt.cpp:
        (WebCore::ShadowBuffer::scratchImage):

2011-01-19  Adam Roben  <aroben@apple.com>

        Remove WKCACFContextFlusher

        It wasn't doing anything.

        Fixes <http://webkit.org/b/52752> WKCACFContextFlusher is unused

        Reviewed by Simon Fraser.

        * WebCore.vcproj/WebCore.vcproj: Removed WKCACFContextFlusher. Also let VS have its way with
        the file.

        * platform/graphics/win/WKCACFContextFlusher.cpp: Removed.
        * platform/graphics/win/WKCACFContextFlusher.h: Removed.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::~WKCACFLayerRenderer):
        (WebCore::WKCACFLayerRenderer::layerTreeDidChange):
        Stop telling WKCACFContextFlusher about our context, since it never did anything with it.

2011-01-19  Adam Roben  <aroben@apple.com>

        Only flush our own context when we get resized

        Fixes <http://webkit.org/b/52751> All WKCACFContexts with uncommitted
        changes get flushed whenever any composited page is resized

        Reviewed by Simon Fraser.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::resize): Just flush our own context, not all contexts
        WKCACFContextFlusher knows about. After all, ours is the only one that just got resized!

2011-01-19  Adam Roben  <aroben@apple.com>

        Make WKCACFLayerRenderer ref-counted

        This will be needed to handle cases where the client might release its reference to us while
        we're calling out to it.

        WKCACFLayerRenderer now has a setClient function, which is used rather than passing the
        client to create(). This allows clients to null out the client pointer when they're done
        with the renderer.

        Fixes <http://webkit.org/b/52749> WKCACFLayerRenderer should be
        ref-counted

        Reviewed by Simon Fraser.

        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
        (WebCore::MediaPlayerPrivateFullscreenWindow::MediaPlayerPrivateFullscreenWindow):
        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h:
        Updated for WKCACFLayerRenderer changes.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::acceleratedCompositingAvailable): Updated for changes to
        create().
        (WebCore::WKCACFLayerRenderer::create): No longer takes a WKCACFLayerRendererClient. Now
        returns a PassOwnPtr.
        (WebCore::WKCACFLayerRenderer::WKCACFLayerRenderer): No longer takes a
        WKCACFLayerRendererClient.

        * platform/graphics/win/WKCACFLayerRenderer.h: Made WKCACFLayerRenderer inherit from
        RefCounted.
        (WebCore::WKCACFLayerRenderer::setClient): Added this simple setter.

2011-01-20  Csaba Osztrogonác  <ossy@webkit.org>

        [Qt][V8] Unreviewed buildfix after r76248.

        * bindings/v8/ScriptCachedFrameData.h: Add missing include.

2011-01-20  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: enable resource agent upon request.
        https://bugs.webkit.org/show_bug.cgi?id=52815

        We should not send network-related notifications unless front-end
        is interested.

        * inspector/Inspector.idl:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreInspectorStateFromCookie):
        (WebCore::InspectorController::connectFrontend):
        (WebCore::InspectorController::resourceAgent):
        * inspector/InspectorController.h:
        (WebCore::InspectorController::consoleAgent):
        (WebCore::InspectorController::cssAgent):
        (WebCore::InspectorController::domAgent):
        (WebCore::InspectorController::injectedScriptAgent):
        (WebCore::InspectorController::runtimeAgent):
        (WebCore::InspectorController::databaseAgent):
        (WebCore::InspectorController::domStorageAgent):
        (WebCore::InspectorController::fileSystemAgent):
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::retrieveResourceAgent):
        * inspector/InspectorResourceAgent.cpp:
        (WebCore::InspectorResourceAgent::restore):
        (WebCore::InspectorResourceAgent::~InspectorResourceAgent):
        (WebCore::InspectorResourceAgent::InspectorResourceAgent):
        * inspector/InspectorResourceAgent.h:
        (WebCore::InspectorResourceAgent::create):
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:

2011-01-20  Zoltan Horvath  <zoltan@webkit.org>

        Reviewed by Csaba Osztrogonác.

        Refactoring of the custom allocation framework
        https://bugs.webkit.org/show_bug.cgi?id=49897

        Inheriting from FastAllocBase can result in objects getting larger (bug #33896, #46589).
        The modification replaces Noncopyable and FastAllocBase classes and these inherits with their
        equivalent macro implementation at the necessary places.

2011-01-20  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Chromium] CPU Profiles are cleared when navigating back and forth.

        Profiles are now not cleared unless renderer instance was changed.

        https://bugs.webkit.org/show_bug.cgi?id=52807

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreProfiler):
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::resetState):
        (WebCore::InspectorProfilerAgent::resetFrontendProfiles):
        * inspector/InspectorProfilerAgent.h:

2011-01-20  Alexander Pavlov  <apavlov@chromium.org>

        Unreviewed, add new JS file refs missing from r76116.

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * inspector/front-end/WebKit.qrc:

2011-01-20  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: Crash when adding a rule for an ImageDocument
        https://bugs.webkit.org/show_bug.cgi?id=52811

        * inspector/InspectorCSSAgent.cpp:
        (WebCore::InspectorCSSAgent::addRule2):
        (WebCore::InspectorCSSAgent::viaInspectorStyleSheet):

2011-01-20  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: cleanup InspectorController's friends list.
        We have a plan to extract InspectorAgent from InspectorController.
        InspectorAgent will be accessible only from InspectorController.
        As result we can simply made some methods public and remove long
        friends list.

        https://bugs.webkit.org/show_bug.cgi?id=52806

        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::databaseForId):
        (WebCore::InjectedScriptHost::selectDatabase):
        (WebCore::InjectedScriptHost::selectDOMStorage):
        (WebCore::InjectedScriptHost::inspectorDOMAgent):
        (WebCore::InjectedScriptHost::frontend):
        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willModifyDOMAttr):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):
        * inspector/InspectorController.h:
        (WebCore::InspectorController::frontend):
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::willInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::didModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::characterDataModifiedImpl):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::didReceiveResourceResponseImpl):
        (WebCore::InspectorInstrumentation::didFailLoadingImpl):
        (WebCore::InspectorInstrumentation::resourceRetrievedByXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsoleImpl):
        (WebCore::InspectorInstrumentation::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorInstrumentation::cancelPauseOnNativeEvent):
        (WebCore::InspectorInstrumentation::retrieveTimelineAgent):
        (WebCore::InspectorInstrumentation::retrieveResourceAgent):

2011-01-19  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: implement JavaScriptBreakpointsSidebarPane based on events from debugger model.
        https://bugs.webkit.org/show_bug.cgi?id=52723

        Extract all breakpoints-related presentation code from debugger model to JavaScriptBreakpointSidebarPane.

        * inspector/front-end/Breakpoint.js:
        (WebInspector.Breakpoint):
        (WebInspector.Breakpoint.prototype.get data):
        (WebInspector.Breakpoint.prototype.remove):
        * inspector/front-end/BreakpointsSidebarPane.js:
        (WebInspector.JavaScriptBreakpointsSidebarPane):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._breakpointAdded):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._breakpointRemoved):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._breakpointEnableChanged):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._breakpointItemCheckboxClicked):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._contextMenuEventFired):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._debuggerPaused):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._debuggerResumed):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._addListElement):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._removeListElement):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._projectChanged):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._compare):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._compareBreakpoints):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._setupBreakpointElement.didGetSourceLine):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._setupBreakpointElement):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._breakpointIdForDebuggerPausedEvent):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._setBreakpointEnabled):
        (WebInspector.JavaScriptBreakpointsSidebarPane.prototype._removeBreakpoint):
        (WebInspector.NativeBreakpointsSidebarPane):
        (WebInspector.XHRBreakpointsSidebarPane.prototype.addBreakpointItem):
        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel.prototype.removeBreakpoint):
        (WebInspector.DebuggerModel.prototype.breakpointForId):
        (WebInspector.DebuggerModel.prototype._pausedScript):
        (WebInspector.DebuggerModel.prototype._resumedScript):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel):
        * inspector/front-end/inspector.js:

2011-01-20  Dirk Schulze  <krit@webkit.org>

        Reviewed by Andreas Kling.

        SVG Pattern doesn't take the viewBox of a referenced Pattern
        https://bugs.webkit.org/show_bug.cgi?id=52804
        
        SVGPattern element didn't use the viewBox of another SVGPattern element, referenced
        by xlink:href. Modified PatternAttributes, to take the value of the viewBox of the
        SVGPattern element as well, if the attribute was set.
        This gets checked by a W3C SVG test case.        

        Test: svg/W3C-SVG-1.1-SE/pservers-pattern-04-f.svg

        * rendering/svg/RenderSVGResourcePattern.cpp:
        (WebCore::RenderSVGResourcePattern::buildTileImageTransform):
        * svg/PatternAttributes.h:
        (WebCore::PatternAttributes::PatternAttributes):
        (WebCore::PatternAttributes::viewBox):
        (WebCore::PatternAttributes::setViewBox):
        (WebCore::PatternAttributes::hasViewBox):
        * svg/SVGPatternElement.cpp:
        (WebCore::SVGPatternElement::collectPatternAttributes):

2011-01-19  Stephen White  <senorblanco@chromium.org>

        [Re-land of r76159 with a compile fix for the Chromium linux shlib
        build.]

        Reviewed by James Robinson.

        Implement accelerated path drawing and clipping for the Canvas2D GPU
        path.
        https://bugs.webkit.org/show_bug.cgi?id=52627
        
        This is done with a simple curve interpolator and the GLU tesselator,
        which is good enough for a 3-5X speedup on
        http://ie.microsoft.com/testdrive/Performance/Galactic/Default.html.

        Covered by canvas/philip/2d.path.clip.basic.html, and many, many more.
        All tests canvas/philip and fast/canvas paths pass with no
        regressions, although two have minor pixel differences which require
        rebaselining.

        * WebCore.gyp/WebCore.gyp:
        Add internal_glu include path to chromium build.
        * WebCore.gypi:
        Add internal_glu files to chromium build.
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::reset):
        (WebCore::CanvasRenderingContext2D::platformLayer):
        Make CanvasRenderingContext2D more robust against failure to create
        a DrawingBuffer.
        * platform/graphics/chromium/DrawingBufferChromium.cpp:
        (WebCore::DrawingBuffer::DrawingBuffer):
        As in DrawingBufferMac.cpp, call reset() from the constructor.
        Also initialize size to (-1, -1), so reset() doesn't early-out.
        Add initializers for depthBuffer and stencilBuffer, and remove
        multisampleDepthStencilBuffer.
        * platform/graphics/chromium/GLES2Canvas.cpp:
        Remove some unused #includes.
        (WebCore::GLES2Canvas::State::State):
        Add clipping state, and implement save/restore via the copy constructor.
        (WebCore::operator*):
        (WebCore::Quadratic::Quadratic):
        (WebCore::Quadratic::fromBezier):
        (WebCore::Quadratic::evaluate):
        Quadratic Bezier curve class.
        (WebCore::Cubic::Cubic):
        (WebCore::Cubic::fromBezier):
        (WebCore::Cubic::evaluate):
        Cubic Bezier curve class.
        (WebCore::GLES2Canvas::clearRect):
        Add clipping support to clearRect().
        (WebCore::GLES2Canvas::fillPath):
        Implement fillPath().
        (WebCore::GLES2Canvas::fillRect):
        Add clipping support to fillRect().
        (WebCore::GLES2Canvas::clipPath):
        Implement clipPath().
        (WebCore::GLES2Canvas::clipOut):
        Stub out clipOut() (not called by Canvas 2D).
        (WebCore::GLES2Canvas::restore):
        When restoring, draw any remaining clipping paths to the stencil buffer.
        (WebCore::GLES2Canvas::drawTexturedRect):
        Add clipping support.
        (WebCore::interpolateQuadratic):
        (WebCore::interpolateCubic):
        Simple curve interpolation, using the Cubic and Quadratic classes.
        (WebCore::PolygonData::PolygonData):
        A struct to hold the tesselation data for callbacks.
        (WebCore::beginData):
        (WebCore::edgeFlagData):
        (WebCore::vertexData):
        (WebCore::endData):
        (WebCore::combineData):
        internal_glu tesselation callbacks.
        (WebCore::GLES2Canvas::createVertexBufferFromPath):
        Build an interpolated, tesselated vertex buffer and element array buffer from a given path, suitable for filling.
        (WebCore::GLES2Canvas::beginStencilDraw):
        Enable stencilling, and disable draws to the color buffer.
        (WebCore::GLES2Canvas::applyClipping):
        If clipping is enabled, set the appropriate GL state.
        * platform/graphics/chromium/GLES2Canvas.h:
        Document the flavours of drawTexturedRect() a bit, so I don't get confused.
        * platform/graphics/gpu/DrawingBuffer.cpp:
        (WebCore::DrawingBuffer::clear):
        (WebCore::DrawingBuffer::createSecondaryBuffers):
        (WebCore::DrawingBuffer::resizeDepthStencil):
        (WebCore::DrawingBuffer::reset):
        * platform/graphics/gpu/DrawingBuffer.h:
        Unify m_multisampleDepthStencilBuffer with m_depthStencilBuffer. 
        Implement separate depth and stencil buffers for when
        OES_packed_depth_stencil is not available.  Refactor creation of
        multisampled and non-multisampled depth and stencil buffers into
        resizeDepthStencil().
        * platform/graphics/gpu/SharedGraphicsContext3D.cpp:
        (WebCore::SharedGraphicsContext3D::create):
        Turn on stencil, turn off depth, turn off antialiasing (for now).
        (WebCore::SharedGraphicsContext3D::enableStencil):
        * platform/graphics/gpu/SharedGraphicsContext3D.h:
        Implement stencil enable/disable.
        * platform/graphics/gpu/mac/DrawingBufferMac.mm:
        (WebCore::DrawingBuffer::DrawingBuffer):
        Remove m_multisampleDepthStencilBuffer.  Set the size to (-1, -1)
        on creation, so reset() doesn't early-out.  Initialize m_depthBuffer
        and m_stencilBuffer.
        * platform/graphics/skia/GraphicsContextSkia.cpp:
        (WebCore::GraphicsContext::canvasClip):
        (WebCore::GraphicsContext::clipOut):
        (WebCore::GraphicsContext::clipPath):
        (WebCore::GraphicsContext::fillPath):
        Put in GPU hooks for path clipping, and path drawing.
        * platform/graphics/skia/PlatformContextSkia.cpp:
        (WebCore::PlatformContextSkia::canAccelerate):
        Don't check for clipping paths in canAccelerate() (since we can
        now accelerate them).
        (WebCore::PlatformContextSkia::uploadSoftwareToHardware):
        Don't do clipping when uploading software draws to hardware.
        * thirdparty/glu/README.webkit:
        * thirdparty/glu/gluos.h:
        #undef MIN and MAX, to fix warnings-as-errors in Chrome/Mac build.
        * thirdparty/glu/libtess/geom.c:
        * thirdparty/glu/libtess/priorityq.c:
        * thirdparty/glu/libtess/render.c:
        Use do{}while(0) instead of if(1)else construct in macro.
        * thirdparty/glu/libtess/sweep.c:
        (IsWindingInside):
        (DoneEdgeDict):
        Fix some warnings treated as errors for the Linux Release build.


2011-01-20  Pavel Feldman  <pfeldman@chromium.org>

        Web Inspector: move releaseObjectGroup to the new Runtime agent.
        https://bugs.webkit.org/show_bug.cgi?id=52803
        (accedentally landed as r76231)

        * inspector/InspectorContorller.h:
        * inspector/InspectorContorller.cpp:
        * inspector/InspectorRuntimeAgent.h:
        * inspector/InspectorRuntimeAgent.cpp:

2011-01-20  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: build fix.

        * inspector/InspectorState.h:
        (WebCore::InspectorState::setBoolean):
        (WebCore::InspectorState::setString):
        (WebCore::InspectorState::setLong):

2011-01-20  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: further simplify InspectorState.
        https://bugs.webkit.org/show_bug.cgi?id=52731

        This change moves XHR logging flag into console agent,
        removes InspectorState pushing to the front-end.

        * inspector/Inspector.idl:
        * inspector/InspectorConsoleAgent.cpp:
        (WebCore::InspectorConsoleAgent::InspectorConsoleAgent):
        (WebCore::InspectorConsoleAgent::resourceRetrievedByXMLHttpRequest):
        (WebCore::InspectorConsoleAgent::setMonitoringXHREnabled):
        (WebCore::InspectorConsoleAgent::setConsoleMessagesEnabled):
        (WebCore::InspectorConsoleAgent::addConsoleMessage):
        * inspector/InspectorConsoleAgent.h:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        * inspector/InspectorController.h:
        (WebCore::InspectorController::state):
        (WebCore::InspectorController::settings):
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        (WebCore::InspectorState::registerBoolean):
        (WebCore::InspectorState::registerString):
        (WebCore::InspectorState::registerLong):
        (WebCore::InspectorState::registerObject):
        (WebCore::InspectorState::Property::create):
        * inspector/InspectorState.h:
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher.dispatcher.consoleMessagesCleared):
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher.dispatcher.monitoringXHRStateChanged):
        (WebInspector.ConsoleView.prototype._registerConsoleDomainDispatcher):
        (WebInspector.ConsoleView.prototype._handleContextMenuEvent):
        * inspector/front-end/inspector.js:

2011-01-20  Csaba Osztrogonác  <ossy@webkit.org>

        Unreviewed buildfix.

        [Qt][V8] Remove unnecessary files after r76224.

        * WebCore.pro:

2011-01-20  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: prepare for extracting InspectorAgent from InspectorController.
        https://bugs.webkit.org/show_bug.cgi?id=52797

        * inspector/CodeGeneratorInspector.pm:
        * inspector/InspectorController.h:
        (WebCore::InspectorController::inspectorAgent):
        (WebCore::InspectorController::cssAgent):
        (WebCore::InspectorController::injectedScriptAgent):
        (WebCore::InspectorController::resourceAgent):
        (WebCore::InspectorController::runtimeAgent):
        (WebCore::InspectorController::timelineAgent):
        (WebCore::InspectorController::databaseAgent):
        (WebCore::InspectorController::domStorageAgent):
        (WebCore::InspectorController::fileSystemAgent):
        (WebCore::InspectorController::browserDebuggerAgent):
        (WebCore::InspectorController::debuggerAgent):
        (WebCore::InspectorController::profilerAgent):
        (WebCore::InspectorController::applicationCacheAgent):

2011-01-20  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76215.
        http://trac.webkit.org/changeset/76215
        https://bugs.webkit.org/show_bug.cgi?id=52799

        Caused regressions in Chromium; morrita is going to look at it
        tomrorow (Requested by jorlow on #webkit).

        * dom/TextEvent.h:
        * dom/TextEventInputType.h:
        * editing/CompositeEditCommand.cpp:
        (WebCore::CompositeEditCommand::rebalanceWhitespaceAt):
        * editing/CompositeEditCommand.h:
        * editing/Editor.cpp:
        (WebCore::Editor::insertTextWithoutSendingTextEvent):
        (WebCore::Editor::confirmComposition):
        (WebCore::Editor::setComposition):
        * editing/Editor.h:
        * editing/InsertTextCommand.cpp:
        (WebCore::InsertTextCommand::input):
        * editing/InsertTextCommand.h:
        * editing/TypingCommand.cpp:
        (WebCore::TypingCommand::TypingCommand):
        (WebCore::TypingCommand::insertText):
        (WebCore::TypingCommand::insertTextRunWithoutNewlines):
        * editing/TypingCommand.h:
        (WebCore::TypingCommand::create):

2010-12-14  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Adam Barth.

        [V8] Get rid of delayed exception reporting in V8ConsoleMessage.cpp
        https://bugs.webkit.org/show_bug.cgi?id=51044

        * WebCore.gypi:
        * bindings/v8/V8ConsoleMessage.cpp: Removed.
        * bindings/v8/V8ConsoleMessage.h: Removed.
        * bindings/v8/V8DOMWindowShell.cpp:
        (WebCore::v8UncaughtExceptionHandler):
        (WebCore::reportUnsafeJavaScriptAccess):
        (WebCore::V8DOMWindowShell::initContextIfNeeded):
        * bindings/v8/V8Proxy.cpp:
        (WebCore::addMessageToConsole):
        (WebCore::logInfo):
        (WebCore::V8Proxy::reportUnsafeAccessTo):
        (WebCore::V8Proxy::runScript):
        (WebCore::V8Proxy::callFunction):
        (WebCore::V8Proxy::newInstance):
        * bindings/v8/V8Proxy.h:
        * bindings/v8/WorkerContextExecutionProxy.cpp:
        * bindings/v8/specialization/V8BindingState.cpp:
        (WebCore::::immediatelyReportUnsafeAccessTo):

2011-01-19  MORITA Hajime  <morrita@google.com>

        Reviewed by Eric Seidel.

        ShadowElement::m_shadowParent should be removed
        https://bugs.webkit.org/show_bug.cgi?id=52558

        No new tests. No behavioral change.

        * rendering/ShadowElement.h:
        (WebCore::ShadowElement::ShadowElement):

2011-01-20  Hans Wennborg  <hans@chromium.org>

        Reviewed by Jeremy Orlow.

        IndexedDB: IDBObjectStore.get should fire onsuccess rather than onerror
        https://bugs.webkit.org/show_bug.cgi?id=52725

        Let IDBObjectStore.get() fire the onsuccess handler with the value
        'undefined' for when an object does not exist in the store.

        Update SerializedScriptValue to provide such an undefined value.

        * bindings/v8/SerializedScriptValue.cpp:
        (WebCore::SerializedScriptValue::nullValue):
        (WebCore::SerializedScriptValue::undefinedValue):
        * bindings/v8/SerializedScriptValue.h:
        * storage/IDBObjectStoreBackendImpl.cpp:
        (WebCore::IDBObjectStoreBackendImpl::getInternal):

2010-12-27  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        WebCore doesn't fire window.onerror event when uncaught JavaScript exceptions are thrown
        https://bugs.webkit.org/show_bug.cgi?id=8519

        Uncaught exceptions are propagated to window.onerror hander if one is present.
        The handler is expected to be a function accepting three arguments: error message,
        resource url and line number where the exception occured.

        It was decided to dispatch ErrorEvent to all listeners/handlers no matter if they
        were created in the same isolated world where the exception occured or not.

        Tests: fast/events/window-onerror1.html
               fast/events/window-onerror10.html
               fast/events/window-onerror11.html
               fast/events/window-onerror12.html
               fast/events/window-onerror2.html
               fast/events/window-onerror3.html
               fast/events/window-onerror4.html
               fast/events/window-onerror5.html
               fast/events/window-onerror6.html
               fast/events/window-onerror7.html
               fast/events/window-onerror8.html
               fast/events/window-onerror9.html
               http/tests/security/window-onerror-exception-in-iframe.html
               userscripts/window-onerror-for-isolated-world-1.html
               userscripts/window-onerror-for-isolated-world-2.html

        * Android.jscbindings.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.order:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/JSBindingsAllInOne.cpp:
        * bindings/js/JSDOMBinding.cpp:
        (WebCore::reportException):
        * bindings/js/JSErrorHandler.cpp: Renamed from WebCore/bindings/js/JSWorkerContextErrorHandler.cpp.
        (WebCore::JSErrorHandler::JSErrorHandler):
        (WebCore::JSErrorHandler::~JSErrorHandler):
        (WebCore::JSErrorHandler::handleEvent):
        * bindings/js/JSErrorHandler.h: Copied from WebCore/bindings/js/JSWorkerContextErrorHandler.h.
        (WebCore::JSErrorHandler::create):
        (WebCore::createJSErrorHandler):
        * bindings/js/JSEventListener.h:
        * bindings/scripts/CodeGeneratorJS.pm:
        * bindings/scripts/CodeGeneratorV8.pm:
        * bindings/v8/V8ConsoleMessage.cpp:
        (WebCore::V8ConsoleMessage::dispatchNow):
        (WebCore::V8ConsoleMessage::handler): the method was changed to use generic WebCore exception
        reporting mechanism which is also used by JSC bindings.
        * bindings/v8/V8ConsoleMessage.h:
        * bindings/v8/V8EventListener.h:
        * bindings/v8/V8WindowErrorHandler.cpp: Renamed from WebCore/bindings/js/JSWorkerContextErrorHandler.h.
        (WebCore::V8WindowErrorHandler::V8WindowErrorHandler):
        (WebCore::V8WindowErrorHandler::callListenerFunction):
        * bindings/v8/V8WindowErrorHandler.h: Copied from WebCore/dom/ErrorEvent.cpp.
        (WebCore::V8WindowErrorHandler::create):
        * bindings/v8/WorkerContextExecutionProxy.cpp:
        (WebCore::v8MessageHandler):
        * bindings/v8/WorkerScriptController.cpp:
        (WebCore::WorkerScriptController::evaluate):
        * dom/Document.cpp:
        (WebCore::Document::errorEventTarget):
        (WebCore::Document::logExceptionToConsole):
        (WebCore::Document::addMessage):
        * dom/Document.h:
        * dom/ErrorEvent.cpp:
        * dom/ErrorEvent.h:
        * dom/Event.cpp:
        (WebCore::Event::isErrorEvent):
        * dom/Event.h:
        * dom/ScriptExecutionContext.cpp:
        (WebCore::ScriptExecutionContext::PendingException::PendingException):
        (WebCore::ScriptExecutionContext::ScriptExecutionContext):
        (WebCore::ScriptExecutionContext::reportException): this method is not virtual anymore to
        ensure that error event dispatching algorithm is the same in WorkerContext and in Document.
        (WebCore::ScriptExecutionContext::dispatchErrorEvent):
        * dom/ScriptExecutionContext.h:
        * websockets/WebSocket.cpp:
        (WebCore::WebSocket::connect):
        * websockets/WebSocketChannel.cpp:
        (WebCore::WebSocketChannel::didOpen):
        (WebCore::WebSocketChannel::didFail):
        (WebCore::WebSocketChannel::appendToBuffer):
        * websockets/WebSocketHandshake.cpp:
        (WebCore::WebSocketHandshake::readServerHandshake):
        (WebCore::WebSocketHandshake::readStatusLine):
        (WebCore::WebSocketHandshake::readHTTPHeaders):
        (WebCore::WebSocketHandshake::checkResponseHeaders):
        * workers/DefaultSharedWorkerRepository.cpp:
        (WebCore::postExceptionTask):
        (WebCore::postConsoleMessageTask):
        * workers/WorkerContext.cpp:
        (WebCore::WorkerContext::WorkerContext):
        (WebCore::WorkerContext::errorEventTarget):
        (WebCore::WorkerContext::logExceptionToConsole):
        (WebCore::WorkerContext::addMessage):
        * workers/WorkerContext.h:
        * workers/WorkerMessagingProxy.cpp:
        (WebCore::WorkerExceptionTask::performTask):
        (WebCore::postConsoleMessageTask):
        * xml/XMLHttpRequest.cpp:
        (WebCore::reportUnsafeUsage):

2011-01-19  MORITA Hajime  <morrita@google.com>

        Reviewed by Ryosuke Niwa.

        Space and tab characters "sent" by an input method give totally different results than typing them directly
        https://bugs.webkit.org/show_bug.cgi?id=5241
        
        * Introduced TextEvent::InputTypeComposition and TypingCommand::TextCompositionType to 
          distinguish text input which is originated by composition.
        * Generalized rebalanceWhitespaceAt() to rebalanceWhitespaceOnTextSubstring() to rebalancing 
          range of string on text node, instead of surrounding part of that.

        Test: editing/inserting/insert-composition-whitespace.html

        * dom/TextEvent.h:
        (WebCore::TextEvent::isComposition):
        * dom/TextEventInputType.h: Added TextEventInputComposition as a member of TextEvent::InputType
        * editing/CompositeEditCommand.cpp:
        (WebCore::containsOnlyWhitespace):
        (WebCore::CompositeEditCommand::shouldRebalanceLeadingWhitespaceFor):
        (WebCore::CompositeEditCommand::canRebalance):
        (WebCore::CompositeEditCommand::rebalanceWhitespaceAt):
        (WebCore::CompositeEditCommand::rebalanceWhitespaceOnTextSubstring): Added: A generalized version of rebalanceWhitespaceAt(), which takes a range inside Text string.
        * editing/CompositeEditCommand.h:
        * editing/Editor.cpp:
        (WebCore::Editor::insertTextForConfirmedComposition): Added.
        (WebCore::Editor::insertTextWithoutSendingTextEvent):
        (WebCore::Editor::confirmComposition): Now uses insertTextForConfirmedComposition().
        (WebCore::Editor::setComposition):
        * editing/Editor.h:
        * editing/InsertTextCommand.cpp:
        (WebCore::InsertTextCommand::input):
        * editing/InsertTextCommand.h:
        * editing/TypingCommand.cpp:
        (WebCore::TypingCommand::TypingCommand):
        (WebCore::TypingCommand::insertText):
        (WebCore::TypingCommand::insertTextRunWithoutNewlines):
        * editing/TypingCommand.h: Added TypingCommand::m_compositionType and TypingCommand::TextCompositionType
        (WebCore::TypingCommand::setCompositionType): Added.
        (WebCore::TypingCommand::create):

2011-01-19  Dominic Cooney  <dominicc@google.com>

        Reviewed by Kent Tamura.

        Make <keygen> no longer appear to be a <select> element to script.
        https://bugs.webkit.org/show_bug.cgi?id=52557

        The intent is to put <keygen> options into shadow DOM. This change
        takes the first step by hiding the <select> element from
        JavaScript.

        Test: fast/dom/HTMLKeygenElement/keygen.html

        * CMakeLists.txt: Adds new IDL-derived wrapper.
        * DerivedSources.cpp:
        * DerivedSources.make:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pri:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/gobject/GNUmakefile.am:
        * bindings/gobject/WebKitHTMLElementWrapperFactory.cpp:
        (WebKit::createKeygenWrapper):
        (WebKit::createHTMLElementWrapper):
        * bindings/objc/DOM.mm:
        (WebCore::createElementClassMap): Keygen no longer DOMHTMLSelectElement
        * html/HTMLKeygenElement.h:
        (WebCore::HTMLKeygenElement::willValidate): Now public.
        * html/HTMLKeygenElement.idl: Added.
        * html/HTMLTagNames.in: Keygen's wrapper is HTMLKeygenElement.
        * page/DOMWindow.idl: Add HTMLKeygenElement constructor.

2011-01-19  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76203.
        http://trac.webkit.org/changeset/76203
        https://bugs.webkit.org/show_bug.cgi?id=52784

        Broke Win compile on Chromium bots (Requested by dimich on
        #webkit).

        * WebCore.gypi:
        * bindings/v8/V8DOMWindowShell.cpp:
        (WebCore::reportFatalErrorInV8):
        * page/PageGroup.cpp:
        (WebCore::PageGroup::isLinkVisited):
        * platform/android/PlatformBridge.h:
        * platform/audio/chromium/AudioBusChromium.cpp:
        (WebCore::createBusFromInMemoryAudioFile):
        * platform/chromium/ChromiumBridge.h: Added.
        * platform/chromium/ChromiumDataObjectLegacy.cpp:
        (WebCore::ChromiumDataObjectLegacy::getData):
        * platform/chromium/DragDataChromium.cpp:
        (WebCore::DragData::asURL):
        * platform/chromium/FileSystemChromium.cpp:
        (WebCore::deleteFile):
        (WebCore::deleteEmptyDirectory):
        (WebCore::getFileSize):
        (WebCore::getFileModificationTime):
        (WebCore::revealFolderInOS):
        (WebCore::directoryName):
        (WebCore::pathByAppendingComponent):
        (WebCore::makeAllDirectories):
        (WebCore::fileExists):
        (WebCore::openFile):
        (WebCore::closeFile):
        (WebCore::seekFile):
        (WebCore::truncateFile):
        (WebCore::readFromFile):
        (WebCore::writeToFile):
        * platform/chromium/LanguageChromium.cpp:
        (WebCore::platformDefaultLanguage):
        * platform/chromium/LinkHashChromium.cpp:
        (WebCore::visitedLinkHash):
        * platform/chromium/MIMETypeRegistryChromium.cpp:
        (WebCore::MIMETypeRegistry::getMIMETypeForExtension):
        (WebCore::MIMETypeRegistry::getPreferredExtensionForMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedImageMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedJavaScriptMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedNonImageMIMEType):
        * platform/chromium/PasteboardChromium.cpp:
        (WebCore::Pasteboard::writeSelection):
        (WebCore::Pasteboard::writePlainText):
        (WebCore::Pasteboard::writeURL):
        (WebCore::Pasteboard::writeImage):
        (WebCore::Pasteboard::canSmartReplace):
        (WebCore::Pasteboard::plainText):
        (WebCore::Pasteboard::documentFragment):
        * platform/chromium/PlatformBridge.h:
        * platform/chromium/PlatformScreenChromium.cpp:
        (WebCore::screenDepth):
        (WebCore::screenDepthPerComponent):
        (WebCore::screenIsMonochrome):
        (WebCore::screenRect):
        (WebCore::screenAvailableRect):
        * platform/chromium/ReadableDataObject.cpp:
        (WebCore::ReadableDataObject::getData):
        (WebCore::ReadableDataObject::urlTitle):
        (WebCore::ReadableDataObject::htmlBaseUrl):
        (WebCore::ReadableDataObject::filenames):
        (WebCore::ReadableDataObject::ensureTypeCacheInitialized):
        * platform/chromium/SSLKeyGeneratorChromium.cpp:
        (WebCore::signedPublicKeyAndChallengeString):
        * platform/chromium/ScrollbarThemeChromium.cpp:
        * platform/chromium/ScrollbarThemeChromiumLinux.cpp:
        (WebCore::ScrollbarThemeChromiumLinux::scrollbarThickness):
        (WebCore::ScrollbarThemeChromiumLinux::paintTrackPiece):
        (WebCore::ScrollbarThemeChromiumLinux::paintButton):
        (WebCore::ScrollbarThemeChromiumLinux::paintThumb):
        (WebCore::ScrollbarThemeChromiumLinux::buttonSize):
        (WebCore::ScrollbarThemeChromiumLinux::minimumThumbLength):
        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::scrollbarStateToThemeState):
        (WebCore::ScrollbarThemeChromiumMac::paint):
        * platform/chromium/ScrollbarThemeChromiumWin.cpp:
        (WebCore::ScrollbarThemeChromiumWin::scrollbarThickness):
        (WebCore::ScrollbarThemeChromiumWin::paintTrackPiece):
        (WebCore::ScrollbarThemeChromiumWin::paintButton):
        (WebCore::ScrollbarThemeChromiumWin::paintThumb):
        (WebCore::ScrollbarThemeChromiumWin::buttonSize):
        * platform/chromium/SharedTimerChromium.cpp:
        (WebCore::setSharedTimerFiredFunction):
        (WebCore::setSharedTimerFireTime):
        (WebCore::stopSharedTimer):
        * platform/chromium/SuddenTerminationChromium.cpp:
        (WebCore::disableSuddenTermination):
        (WebCore::enableSuddenTermination):
        * platform/chromium/SystemTimeChromium.cpp:
        (WebCore::currentTime):
        * platform/chromium/WritableDataObject.cpp:
        (WebCore::WritableDataObject::setData):
        * platform/graphics/chromium/CrossProcessFontLoading.mm:
        * platform/graphics/chromium/FontCacheChromiumWin.cpp:
        (WebCore::fontContainsCharacter):
        (WebCore::FillLogFont):
        * platform/graphics/chromium/FontCacheLinux.cpp:
        (WebCore::FontCache::getFontDataForCharacters):
        * platform/graphics/chromium/FontChromiumWin.cpp:
        (WebCore::Font::drawGlyphs):
        * platform/graphics/chromium/FontPlatformDataChromiumWin.cpp:
        (WebCore::FontPlatformData::scriptFontProperties):
        * platform/graphics/chromium/FontPlatformDataLinux.cpp:
        (WebCore::FontPlatformData::querySystemForRenderStyle):
        * platform/graphics/chromium/GlyphPageTreeNodeChromiumWin.cpp:
        (WebCore::fillBMPGlyphs):
        * platform/graphics/chromium/ImageChromium.cpp:
        (WebCore::Image::loadPlatformResource):
        * platform/graphics/chromium/ImageChromiumMac.mm:
        (WebCore::Image::loadPlatformResource):
        * platform/graphics/chromium/SimpleFontDataChromiumWin.cpp:
        (WebCore::SimpleFontData::platformInit):
        (WebCore::SimpleFontData::determinePitch):
        (WebCore::SimpleFontData::platformWidthForGlyph):
        * platform/graphics/chromium/UniscribeHelperTextRun.cpp:
        (WebCore::UniscribeHelperTextRun::tryToPreloadFont):
        * platform/graphics/skia/FontCustomPlatformData.cpp:
        (WebCore::FontCustomPlatformData::fontPlatformData):
        * platform/network/chromium/CookieJarChromium.cpp:
        (WebCore::setCookies):
        (WebCore::cookies):
        (WebCore::cookieRequestHeaderFieldValue):
        (WebCore::cookiesEnabled):
        (WebCore::getRawCookies):
        (WebCore::deleteCookie):
        * platform/network/chromium/DNSChromium.cpp:
        (WebCore::prefetchDNS):
        * platform/qt/PlatformBridge.h:
        * platform/sql/chromium/SQLiteFileSystemChromium.cpp:
        (WebCore::SQLiteFileSystem::deleteDatabaseFile):
        (WebCore::SQLiteFileSystem::getDatabaseFileSize):
        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
        (chromiumOpen):
        (chromiumDelete):
        (chromiumAccess):
        * platform/sql/chromium/SQLiteFileSystemChromiumWin.cpp:
        * plugins/chromium/PluginDataChromium.cpp:
        (WebCore::PluginCache::plugins):
        * rendering/RenderThemeChromiumMac.mm:
        (WebCore::RenderThemeChromiumMac::usesTestModeFocusRingColor):
        * rendering/RenderThemeChromiumSkia.cpp:
        (WebCore::RenderThemeChromiumSkia::caretBlinkInterval):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::platformActiveSelectionBackgroundColor):
        (WebCore::RenderThemeChromiumWin::platformInactiveSelectionBackgroundColor):
        (WebCore::RenderThemeChromiumWin::platformActiveSelectionForegroundColor):
        (WebCore::RenderThemeChromiumWin::systemColor):
        (WebCore::RenderThemeChromiumWin::paintButton):
        (WebCore::RenderThemeChromiumWin::paintSliderTrack):
        (WebCore::menuListButtonWidth):
        (WebCore::RenderThemeChromiumWin::paintMenuList):
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        (WebCore::RenderThemeChromiumWin::paintInnerSpinButton):
        (WebCore::RenderThemeChromiumWin::paintProgressBar):
        * storage/chromium/IDBFactoryBackendInterface.cpp:
        (WebCore::IDBFactoryBackendInterface::create):
        (WebCore::IDBFactoryBackendInterface::~IDBFactoryBackendInterface):
        * storage/chromium/IDBKeyPathBackendImpl.cpp:
        (WebCore::IDBKeyPathBackendImpl::createIDBKeysFromSerializedValuesAndKeyPath):

2011-01-19  Helder Correia  <helder@sencha.com>

        Reviewed by Andreas Kling.

        [Qt] GraphicsContext::strokePath() paints solid shadows with incorrect alpha
        https://bugs.webkit.org/show_bug.cgi?id=52705

        This is related to bug 52611. The shadow color alpha must be multiplied
        by the context pen alpha. Fixing this results in correct behavior for
        Canvas path stroke() and strokeRect() [which relies on stroke()].

        Tests: fast/canvas/canvas-strokePath-alpha-shadow.html
               fast/canvas/canvas-strokeRect-alpha-shadow.html

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::strokePath):

2011-01-19  Darin Fisher  <darin@chromium.org>

        Reviewed by Mihai Parparita.

        Re-initialize the HistoryItem fully when navigating to a HistoryItem,
        or replacing a HistoryItem, results in a different URL.

        https://bugs.webkit.org/show_bug.cgi?id=49654

        This patch also forces all HistoryItems to record the post-redirect
        URL.  Previously, frames would remember the pre-redirect URL.  This is
        problematic since other members of the HistoryItem correspond to the
        post-redirect URL.

        Tests: fast/history/history-replace-updates-current-item.html
               http/tests/navigation/redirect-on-back-updates-history-item.html
               http/tests/navigation/redirect-on-reload-updates-history-item.html

        * history/HistoryItem.cpp:
        (WebCore::HistoryItem::HistoryItem):
        (WebCore::HistoryItem::reset):
        * history/HistoryItem.h:
        * loader/HistoryController.cpp:
        (WebCore::HistoryController::updateForBackForwardNavigation):
        (WebCore::HistoryController::updateForReload):
        (WebCore::HistoryController::updateForStandardLoad):
        (WebCore::HistoryController::updateForRedirectWithLockedBackForwardList):
        (WebCore::HistoryController::initializeItem):
        (WebCore::HistoryController::createItem):
        (WebCore::HistoryController::createItemTree):
        (WebCore::HistoryController::updateCurrentItem):
        * loader/HistoryController.h:

2011-01-19  Adam Klein  <adamk@chromium.org>

        Reviewed by Darin Fisher.

        [chromium] Rename ChromiumBridge to PlatformBridge
        https://bugs.webkit.org/show_bug.cgi?id=52471

        No tests added as this is a rename; no change in behavior.

        * WebCore.gypi:
        * bindings/v8/V8DOMWindowShell.cpp:
        (WebCore::reportFatalErrorInV8):
        * page/PageGroup.cpp:
        (WebCore::PageGroup::isLinkVisited):
        * platform/android/PlatformBridge.h:
        * platform/audio/chromium/AudioBusChromium.cpp:
        (WebCore::createBusFromInMemoryAudioFile):
        * platform/chromium/ChromiumBridge.h: Removed.
        * platform/chromium/ChromiumDataObjectLegacy.cpp:
        (WebCore::ChromiumDataObjectLegacy::getData):
        * platform/chromium/DragDataChromium.cpp:
        (WebCore::DragData::asURL):
        * platform/chromium/FileSystemChromium.cpp:
        (WebCore::deleteFile):
        (WebCore::deleteEmptyDirectory):
        (WebCore::getFileSize):
        (WebCore::getFileModificationTime):
        (WebCore::revealFolderInOS):
        (WebCore::directoryName):
        (WebCore::pathByAppendingComponent):
        (WebCore::makeAllDirectories):
        (WebCore::fileExists):
        (WebCore::openFile):
        (WebCore::closeFile):
        (WebCore::seekFile):
        (WebCore::truncateFile):
        (WebCore::readFromFile):
        (WebCore::writeToFile):
        * platform/chromium/LanguageChromium.cpp:
        (WebCore::platformDefaultLanguage):
        * platform/chromium/LinkHashChromium.cpp:
        (WebCore::visitedLinkHash):
        * platform/chromium/MIMETypeRegistryChromium.cpp:
        (WebCore::MIMETypeRegistry::getMIMETypeForExtension):
        (WebCore::MIMETypeRegistry::getPreferredExtensionForMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedImageMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedJavaScriptMIMEType):
        (WebCore::MIMETypeRegistry::isSupportedNonImageMIMEType):
        * platform/chromium/PasteboardChromium.cpp:
        (WebCore::Pasteboard::writeSelection):
        (WebCore::Pasteboard::writePlainText):
        (WebCore::Pasteboard::writeURL):
        (WebCore::Pasteboard::writeImage):
        (WebCore::Pasteboard::canSmartReplace):
        (WebCore::Pasteboard::plainText):
        (WebCore::Pasteboard::documentFragment):
        * platform/chromium/PlatformBridge.h:
        * platform/chromium/PlatformScreenChromium.cpp:
        (WebCore::screenDepth):
        (WebCore::screenDepthPerComponent):
        (WebCore::screenIsMonochrome):
        (WebCore::screenRect):
        (WebCore::screenAvailableRect):
        * platform/chromium/ReadableDataObject.cpp:
        (WebCore::ReadableDataObject::getData):
        (WebCore::ReadableDataObject::urlTitle):
        (WebCore::ReadableDataObject::htmlBaseUrl):
        (WebCore::ReadableDataObject::filenames):
        (WebCore::ReadableDataObject::ensureTypeCacheInitialized):
        * platform/chromium/SSLKeyGeneratorChromium.cpp:
        (WebCore::signedPublicKeyAndChallengeString):
        * platform/chromium/ScrollbarThemeChromium.cpp:
        * platform/chromium/ScrollbarThemeChromiumLinux.cpp:
        (WebCore::ScrollbarThemeChromiumLinux::scrollbarThickness):
        (WebCore::ScrollbarThemeChromiumLinux::paintTrackPiece):
        (WebCore::ScrollbarThemeChromiumLinux::paintButton):
        (WebCore::ScrollbarThemeChromiumLinux::paintThumb):
        (WebCore::ScrollbarThemeChromiumLinux::buttonSize):
        (WebCore::ScrollbarThemeChromiumLinux::minimumThumbLength):
        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::scrollbarStateToThemeState):
        (WebCore::ScrollbarThemeChromiumMac::paint):
        * platform/chromium/ScrollbarThemeChromiumWin.cpp:
        (WebCore::ScrollbarThemeChromiumWin::scrollbarThickness):
        (WebCore::ScrollbarThemeChromiumWin::paintTrackPiece):
        (WebCore::ScrollbarThemeChromiumWin::paintButton):
        (WebCore::ScrollbarThemeChromiumWin::paintThumb):
        (WebCore::ScrollbarThemeChromiumWin::buttonSize):
        * platform/chromium/SharedTimerChromium.cpp:
        (WebCore::setSharedTimerFiredFunction):
        (WebCore::setSharedTimerFireTime):
        (WebCore::stopSharedTimer):
        * platform/chromium/SuddenTerminationChromium.cpp:
        (WebCore::disableSuddenTermination):
        (WebCore::enableSuddenTermination):
        * platform/chromium/SystemTimeChromium.cpp:
        (WebCore::currentTime):
        * platform/chromium/WritableDataObject.cpp:
        (WebCore::WritableDataObject::setData):
        * platform/graphics/chromium/CrossProcessFontLoading.mm:
        * platform/graphics/chromium/FontCacheChromiumWin.cpp:
        (WebCore::fontContainsCharacter):
        (WebCore::FillLogFont):
        * platform/graphics/chromium/FontCacheLinux.cpp:
        (WebCore::FontCache::getFontDataForCharacters):
        * platform/graphics/chromium/FontChromiumWin.cpp:
        (WebCore::Font::drawGlyphs):
        * platform/graphics/chromium/FontPlatformDataChromiumWin.cpp:
        (WebCore::FontPlatformData::scriptFontProperties):
        * platform/graphics/chromium/FontPlatformDataLinux.cpp:
        (WebCore::FontPlatformData::querySystemForRenderStyle):
        * platform/graphics/chromium/GlyphPageTreeNodeChromiumWin.cpp:
        (WebCore::fillBMPGlyphs):
        * platform/graphics/chromium/ImageChromium.cpp:
        (WebCore::Image::loadPlatformResource):
        * platform/graphics/chromium/ImageChromiumMac.mm:
        (WebCore::Image::loadPlatformResource):
        * platform/graphics/chromium/SimpleFontDataChromiumWin.cpp:
        (WebCore::SimpleFontData::platformInit):
        (WebCore::SimpleFontData::determinePitch):
        (WebCore::SimpleFontData::platformWidthForGlyph):
        * platform/graphics/chromium/UniscribeHelperTextRun.cpp:
        (WebCore::UniscribeHelperTextRun::tryToPreloadFont):
        * platform/graphics/skia/FontCustomPlatformData.cpp:
        (WebCore::FontCustomPlatformData::fontPlatformData):
        * platform/network/chromium/CookieJarChromium.cpp:
        (WebCore::setCookies):
        (WebCore::cookies):
        (WebCore::cookieRequestHeaderFieldValue):
        (WebCore::cookiesEnabled):
        (WebCore::getRawCookies):
        (WebCore::deleteCookie):
        * platform/network/chromium/DNSChromium.cpp:
        (WebCore::prefetchDNS):
        * platform/qt/PlatformBridge.h:
        * platform/sql/chromium/SQLiteFileSystemChromium.cpp:
        (WebCore::SQLiteFileSystem::deleteDatabaseFile):
        (WebCore::SQLiteFileSystem::getDatabaseFileSize):
        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
        (chromiumOpen):
        (chromiumDelete):
        (chromiumAccess):
        * platform/sql/chromium/SQLiteFileSystemChromiumWin.cpp:
        * plugins/chromium/PluginDataChromium.cpp:
        (WebCore::PluginCache::plugins):
        * rendering/RenderThemeChromiumMac.mm:
        (WebCore::RenderThemeChromiumMac::usesTestModeFocusRingColor):
        * rendering/RenderThemeChromiumSkia.cpp:
        (WebCore::RenderThemeChromiumSkia::caretBlinkInterval):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::platformActiveSelectionBackgroundColor):
        (WebCore::RenderThemeChromiumWin::platformInactiveSelectionBackgroundColor):
        (WebCore::RenderThemeChromiumWin::platformActiveSelectionForegroundColor):
        (WebCore::RenderThemeChromiumWin::systemColor):
        (WebCore::RenderThemeChromiumWin::paintButton):
        (WebCore::RenderThemeChromiumWin::paintSliderTrack):
        (WebCore::menuListButtonWidth):
        (WebCore::RenderThemeChromiumWin::paintMenuList):
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        (WebCore::RenderThemeChromiumWin::paintInnerSpinButton):
        (WebCore::RenderThemeChromiumWin::paintProgressBar):
        * storage/chromium/IDBFactoryBackendInterface.cpp:
        (WebCore::IDBFactoryBackendInterface::create):
        (WebCore::IDBFactoryBackendInterface::~IDBFactoryBackendInterface):
        * storage/chromium/IDBKeyPathBackendImpl.cpp:
        (WebCore::IDBKeyPathBackendImpl::createIDBKeysFromSerializedValuesAndKeyPath):

2011-01-19  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76187.
        http://trac.webkit.org/changeset/76187
        https://bugs.webkit.org/show_bug.cgi?id=52778

        Broke caret-showing tests on SnowLeopard and Chromium
        (Requested by dimich on #webkit).

        * rendering/RenderText.cpp:
        (WebCore::RenderText::localCaretRect):

2011-01-19  Yuzo Fujishima  <yuzo@google.com>

        Reviewed by Kent Tamura.

        Fix for Bug 52279 - WebCore::RenderBlock::updateFirstLetter crashes for anonymous blocks
        https://bugs.webkit.org/show_bug.cgi?id=52279

        In constructing text fragments to handle first-letter rule, first add
        the text for the non-first letters and then remove the original text,
        rather than the other way around. Otherwise, the text can be added to
        an anoymous block that is different from the original one. This breaks
        the assumption that a first letter render object has a non-null sibling
        for the non-first letters and causes a crash.

        Test: fast/css/first-letter-anonymous-block-crash.html

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::updateFirstLetter):

2011-01-19  James Robinson  <jamesr@chromium.org>

        Unreviewed, rolling out r76194.
        http://trac.webkit.org/changeset/76194
        https://bugs.webkit.org/show_bug.cgi?id=51218

        Caused mysterious compile failure on the chromium win
        build.webkit.org bots

        * WebCore.gypi:
        * dom/Document.cpp:
        (WebCore::Document::Document):
        * dom/Document.h:
        * dom/RequestAnimationFrameCallback.h: Removed.
        * dom/RequestAnimationFrameCallback.idl: Removed.
        * loader/EmptyClients.h:
        * page/Chrome.cpp:
        * page/Chrome.h:
        * page/ChromeClient.h:
        * page/DOMWindow.cpp:
        * page/DOMWindow.h:
        * page/DOMWindow.idl:
        * page/FrameView.cpp:
        * page/FrameView.h:
        * platform/HostWindow.h:

2011-01-19  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Sam Weinig.

        GraphicsLayers in subframes can get sync'd multiple times
        https://bugs.webkit.org/show_bug.cgi?id=52489

        Some cleanup that will work towards fixing this bug.
        
        Tested by existing iframe compositing tests.

        * WebCore.exp.in: syncCompositingStateRecursive()
        was renamed to syncCompositingStateIncludingSubframes().

        * page/FrameView.h:
        * page/FrameView.cpp:
        (WebCore::FrameView::syncCompositingStateForThisFrame): Some
        code cleanup: do all the word we need to do for this frame,
        including the needsLayout() check.
        (WebCore::FrameView::syncCompositingStateIncludingSubframes):
        This is no longer recursive; instead, it iterates over descendant
        frames via the frame tree, calling syncCompositingStateForThisFrame()
        on each Frame's view.

        * rendering/RenderLayerCompositor.h:
        (WebCore::RenderLayerCompositor::isFlushingLayers): Getter for the flag.
        * rendering/RenderLayerCompositor.cpp: 
        (WebCore::RenderLayerCompositor::RenderLayerCompositor):
        (WebCore::RenderLayerCompositor::flushPendingLayerChanges): Maintain
        a flag to say if we're flushing, which allows us to assert on re-entrant flushes.
        (WebCore::RenderLayerCompositor::enclosingCompositorFlushingLayers):
        Add the ability to get the rootmost compositor that is in the middle
        of a flush.

2011-01-19  James Robinson  <jamesr@chromium.org>

        Reviewed by Darin Fisher.

        Implement mozilla's requestAnimationFrame API
        https://bugs.webkit.org/show_bug.cgi?id=51218

        This implements mozilla's proposed requestAnimationFrame API.  The idea with this API is that
        an author driving an animation from script could use window.requestAnimationFrame(callback)
        instead of window.setTimeout(callback, 0) to schedule their update logic and let the browser
        decide when to update the animations.  This avoids doing unnecessary work when the page content
        is offscreen or is being displayed at a different framerate than what the page author expects.

        Mozilla's proposal is here: https://developer.mozilla.org/en/DOM/window.mozRequestAnimationFrame
        This implements window.mozRequestAnimationFrame as window.webkitRequestAnimationFrame with the
        following changes:
        *) Only the callback syntax is supported, there is no before paint event
        *) webkitRequestAnimationFrame supports a second parameter Element to let the author indicate
            what content they intend to animate.  That way if the page is being displayed but the element
            in question is offscreen, we can avoid invoking the callback.
        *) No timestamp is provided to the caller and there is no window.animationStartTime property
            (see https://bugs.webkit.org/show_bug.cgi?id=51952 for discussion of this property)
        *) window.webkitRequestAnimationFrame returns a numerical id that can be used to cancel the callback
            using window.cancelWebkitRequestAnimationFrame, to parallel window.setTimeout()/window.clearTime().

        The implementation depends on the embedder scheduling the callbacks since the callback invocation
        depends on the page's visibility and the embedder's paint scheduling, neither of which are exposed
        to WebCore.  The expectation for the embedder is that at some point Chrome::scheduleAnimation() is
        called FrameView::serviceScriptedAnimations() should be called for the associated Page's main frame.
        Ideally serviceScriptedAnimations() would be called prior to rendering - although in practice the
        embedder has to rate limit callbacks and may not be able to tie the callback directly to the
        rendering loop.

        Tests: fast/animation/request-animation-frame-cancel.html
               fast/animation/request-animation-frame-cancel2.html
               fast/animation/request-animation-frame-display.html
               fast/animation/request-animation-frame-within-callback.html
               fast/animation/request-animation-frame.html

        * WebCore.gypi:
        * dom/Document.cpp:
        (WebCore::Document::Document):
        (WebCore::Document::webkitRequestAnimationFrame):
        (WebCore::Document::webkitCancelRequestAnimationFrame):
        (WebCore::Document::serviceScriptedAnimations):
        * dom/Document.h:
        * dom/RequestAnimationFrameCallback.h: Added.
        (WebCore::RequestAnimationFrameCallback::~RequestAnimationFrameCallback):
        * dom/RequestAnimationFrameCallback.idl: Added.
        * loader/EmptyClients.h:
        (WebCore::EmptyChromeClient::scheduleAnimation):
        * page/Chrome.cpp:
        (WebCore::Chrome::scheduleAnimation):
        * page/Chrome.h:
        * page/ChromeClient.h:
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::webkitRequestAnimationFrame):
        (WebCore::DOMWindow::webkitCancelRequestAnimationFrame):
        * page/DOMWindow.h:
        * page/DOMWindow.idl:
        * page/FrameView.cpp:
        (WebCore::FrameView::scheduleAnimation):
        (WebCore::FrameView::serviceScriptedAnimations):
        * page/FrameView.h:
        * platform/HostWindow.h:

2011-01-13  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Daniel Bates.

        [GTK] Move progress bar painting out of gtk2drawing.c
        https://bugs.webkit.org/show_bug.cgi?id=52385

        Move progress bar painting to RenderThemeGtk2 and share some animation
        logic between the GTK+ 2.x and GTK+ 3.x port.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::animationRepeatIntervalForProgressBar): Moved from RenderThemeGtk3.
        (WebCore::RenderThemeGtk::animationDurationForProgressBar): Ditto.
        (WebCore::RenderThemeGtk::calculateProgressRect): Calculate the proper rectangle for the
        progress indicator given the rect for the maximum size of the indicator.
        * platform/gtk/RenderThemeGtk.h: Added calculateProgressRect declaration and
        a new widget member for GTK+ 2.x
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::platformInit): Added initialization for the new widget member.
        (WebCore::RenderThemeGtk::paintProgressBar): Paint the progress bar manually instead of
        calling the old Mozilla code.
        (WebCore::RenderThemeGtk::gtkProgressBar): Added.
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::paintProgressBar): Call calculateProgressRect now to get
        the area of the progress indicator.
        * platform/gtk/gtk2drawing.c: Remove unused code.
        (moz_gtk_get_widget_border):
        (moz_gtk_widget_paint):
        * platform/gtk/gtkdrawing.h: Ditto.

2011-01-19  Dmitry Titov  <dimich@chromium.org>

        [Chromium] Not reviewed, reverts the following changes:
        http://trac.webkit.org/changeset/76164 (build fix)
        http://trac.webkit.org/changeset/76159 (main change)

        The change broke Chromium Linux-shlib build.

        Original issue:
        Accelerated canvas2D has bad clipping performance.
        https://bugs.webkit.org/show_bug.cgi?id=52627

        * WebCore.gyp/WebCore.gyp:
        * WebCore.gypi:
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::reset):
        (WebCore::CanvasRenderingContext2D::platformLayer):
        * platform/graphics/chromium/DrawingBufferChromium.cpp:
        (WebCore::DrawingBuffer::DrawingBuffer):
        * platform/graphics/chromium/GLES2Canvas.cpp:
        (WebCore::GLES2Canvas::State::State):
        (WebCore::GLES2Canvas::clearRect):
        (WebCore::GLES2Canvas::fillRect):
        (WebCore::GLES2Canvas::restore):
        (WebCore::GLES2Canvas::drawTexturedRect):
        * platform/graphics/chromium/GLES2Canvas.h:
        * platform/graphics/gpu/DrawingBuffer.cpp:
        (WebCore::DrawingBuffer::clear):
        (WebCore::DrawingBuffer::createSecondaryBuffers):
        (WebCore::DrawingBuffer::reset):
        * platform/graphics/gpu/DrawingBuffer.h:
        * platform/graphics/gpu/SharedGraphicsContext3D.cpp:
        (WebCore::SharedGraphicsContext3D::create):
        * platform/graphics/gpu/SharedGraphicsContext3D.h:
        * platform/graphics/gpu/mac/DrawingBufferMac.mm:
        (WebCore::DrawingBuffer::DrawingBuffer):
        * platform/graphics/skia/GraphicsContextSkia.cpp:
        (WebCore::GraphicsContext::canvasClip):
        (WebCore::GraphicsContext::clipOut):
        (WebCore::GraphicsContext::clipPath):
        (WebCore::GraphicsContext::fillPath):
        * platform/graphics/skia/PlatformContextSkia.cpp:
        (WebCore::PlatformContextSkia::canAccelerate):
        (WebCore::PlatformContextSkia::uploadSoftwareToHardware):
        * thirdparty/glu/README.webkit:
        * thirdparty/glu/gluos.h:
        * thirdparty/glu/libtess/geom.c:
        * thirdparty/glu/libtess/priorityq.c:
        * thirdparty/glu/libtess/render.c:
        * thirdparty/glu/libtess/sweep.c:
        (IsWindingInside):
        (DoneEdgeDict):

2011-01-19  Levi Weintraub  <leviw@google.com>

        Reviewed by Darin Adler.

        Re-committing this with the proper expected results.

        Changing RenderText::localCaretRect to clip to its containing block's logicalLeft and
        logicalRightLayoutOverflow instead of simply using logicalLeft and logicalRight, as this
        resulted in the caret being placed incorrectly in overflowing editable IFrame content.

        Long lines in non-white-space-pre editable documents show cursor in wrong place
        https://bugs.webkit.org/show_bug.cgi?id=48132

        Test: editing/selection/caret-painting-in-overflowing-autowrap-content.html

        * rendering/RenderText.cpp:
        (WebCore::RenderText::localCaretRect):

2011-01-18 MORITA Hajime <morrita@google.com>

        Reviewed by David Levin.

        ElementRareData::m_shadowRoot should not be RefPtr.
        https://bugs.webkit.org/show_bug.cgi?id=51914

        Makes ElementRareData::m_shadowRoot a raw pointer because
        ElementRareData::m_shadowRoot should be like a
        ContaineNode::m_firstChild, which is also a raw pointer.
        pointer. Which also means that both the shadow root and the shadow
        host reference each other as a parent-and-child relationship, via
        a raw pointer.
        
        Note that it is safe not to manipulate the ref-count of
        m_shadowRoot because Node::m_parent of the shadow root points its
        shadow host, and the object isn't deleted even if the refcount is
        zero, as long as the node has non-null m_parent. (See TreeShared.)
        
        The shadow root node is finally destroyed inside
        removeShadowRoot(), where we store the root node into a local
        RefPtr, then make the node's m_parent null, which results the
        destroy the node, at the end of the function, by RefPtr::~RefPtr.
        
        No new tests. No behavioral change.

        * dom/Element.cpp:
        (WebCore::Element::~Element):
        (WebCore::Element::shadowRoot):
        (WebCore::Element::setShadowRoot):
        (WebCore::Element::removeShadowRoot):
        * dom/ElementRareData.h:
        (WebCore::ElementRareData::ElementRareData):
        (WebCore::ElementRareData::~ElementRareData):

2011-01-12  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Gustavo Noronha Silva.

        [GTK] Move text field painting out of gtk2drawing.c
        https://bugs.webkit.org/show_bug.cgi?id=52327

        No new tests. This should not change behavior.

        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::paintButton): Use the setWidgetHasFocus helper.
        (WebCore::RenderThemeGtk::paintTextField): Do this manually now instead
        of calling into the Mozilla code.
        * platform/gtk/WidgetRenderingContext.cpp: Added a couple more wrappers
        for GTK+ theme functions.
        (WebCore::WidgetRenderingContext::gtkPaintFlatBox):
        (WebCore::WidgetRenderingContext::gtkPaintShadow):
        * platform/gtk/WidgetRenderingContext.h: Added new method declarations.
        * platform/gtk/gtk2drawing.c: Remove unused code.
        (moz_gtk_get_widget_border):
        (moz_gtk_widget_paint):
        * platform/gtk/gtkdrawing.h:

2011-01-19  Antti Koivisto  <antti@apple.com>

        Reviewed by Oliver Hunt.

        Cache function offsets to speed up javascript parsing
        https://bugs.webkit.org/show_bug.cgi?id=52622
        
        Use cache to save function offsets and some other info.
        This avoids quite a bit of work when reparsing the source.

        * bindings/js/CachedScriptSourceProvider.h:
        (WebCore::CachedScriptSourceProvider::cache):
        (WebCore::CachedScriptSourceProvider::cacheSizeChanged):
        (WebCore::CachedScriptSourceProvider::CachedScriptSourceProvider):
        * bindings/js/ScriptSourceProvider.h:
        (WebCore::ScriptSourceProvider::ScriptSourceProvider):
        * loader/cache/CachedScript.cpp:
        (WebCore::CachedScript::destroyDecodedData):
        (WebCore::CachedScript::sourceProviderCache):
        (WebCore::CachedScript::sourceProviderCacheSizeChanged):
        * loader/cache/CachedScript.h:

2011-01-11  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Gustavo Noronha Silva.

        [GTK] Move toggle button rendering out of gtk2drawing.c
        https://bugs.webkit.org/show_bug.cgi?id=52258

        * platform/gtk/RenderThemeGtk.h:
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::platformInit): Initialize new button members.
        (WebCore::adjustRectForFocus): Added this function which inflates a rect based
        on a widget's exterior focus.
        (WebCore::RenderThemeGtk::adjustRepaintRect): Account for exterior focus.
        (WebCore::setToggleSize): Only listen to indicator-size to properly size
        checkboxes and radio buttons.
        (WebCore::RenderThemeGtk::setCheckboxSize): Call new setToggleSize properly.
        (WebCore::paintToggle): Added.
        (WebCore::RenderThemeGtk::paintCheckbox): Call paintToggle.
        (WebCore::RenderThemeGtk::setRadioSize): Call new setToggleSize properly.
        (WebCore::RenderThemeGtk::paintRadio): Call paintToggle.
        (WebCore::RenderThemeGtk::gtkRadioButton): Added.
        (WebCore::RenderThemeGtk::gtkCheckButton): Added.
        * platform/gtk/WidgetRenderingContext.cpp:
        (WebCore::WidgetRenderingContext::WidgetRenderingContext): Use a static extra space
        variable. This is good enough for all themes that I've tested and prevents having to
        pass information from RenderThemeGtk about every single type of widget.
        (WebCore::WidgetRenderingContext::gtkPaintFocus): Use the paintRect
        to draw instead of m_paintRect. This is important when we're painting
        something that isn't the size of the total rect.
        (WebCore::WidgetRenderingContext::gtkPaintCheck): Added.
        (WebCore::WidgetRenderingContext::gtkPaintOption): Added.
        * platform/gtk/WidgetRenderingContext.h: Updated to reflect new methods.
        * platform/gtk/gtkdrawing.h: Remove newly unused code.
        * platform/gtk/gtk2drawing.c: Ditto.

2011-01-19  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Build fix for r76170
        https://bugs.webkit.org/show_bug.cgi?id=52758

        * platform/graphics/chromium/UniscribeHelperTextRun.cpp:

2011-01-19  David D. Kilzer  <ddkilzer@apple.com>

        <http://webkit.org/b/52687> Clean up FrameLoader methods for PLUGIN_PROXY_FOR_VIDEO

        Reviewed by Eric Carlson.

        * loader/FrameLoader.cpp: Declare the methods here.
        (WebCore::FrameLoader::hideMediaPlayerProxyPlugin):
        (WebCore::FrameLoader::showMediaPlayerProxyPlugin):
        * loader/FrameLoader.cpp: Moved methods to here...
        (WebCore::FrameLoader::hideMediaPlayerProxyPlugin):
        (WebCore::FrameLoader::showMediaPlayerProxyPlugin):
        * loader/SubframeLoader.cpp: ...from here.
        (WebCore::FrameLoader::hideMediaPlayerProxyPlugin):
        (WebCore::FrameLoader::showMediaPlayerProxyPlugin):

2011-01-19  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Mihai Parparita.

        Perform some forward declaration
        https://bugs.webkit.org/show_bug.cgi?id=52522

        No new tests because no new functionality.

        * accessibility/AccessibilityObject.h:
        * css/WebKitCSSMatrix.cpp:
        * html/HTMLAreaElement.cpp:
        * html/canvas/CanvasRenderingContext2D.cpp:
        * inspector/InspectorController.cpp:
        * platform/graphics/FloatPoint.cpp:
        * platform/graphics/Font.cpp:
        * platform/graphics/Font.h:
        * platform/graphics/FontFastPath.cpp:
        * platform/graphics/GraphicsContext.cpp:
        * platform/graphics/ImageBuffer.h:
        * platform/graphics/StringTruncator.cpp:
        * platform/graphics/WidthIterator.cpp:
        * platform/graphics/mac/ComplexTextController.cpp:
        * platform/graphics/mac/ComplexTextControllerCoreText.cpp:
        * platform/graphics/mac/FontComplexTextMac.cpp:
        * platform/graphics/transforms/TransformationMatrix.cpp:
        * platform/graphics/transforms/TransformationMatrix.h:
        * rendering/EllipsisBox.cpp:
        * rendering/InlineTextBox.cpp:
        * rendering/RenderBlock.cpp:
        * rendering/RenderBlockLineLayout.cpp:
        * rendering/RenderEmbeddedObject.cpp:
        * rendering/RenderFileUploadControl.cpp:
        * rendering/RenderFlexibleBox.cpp:
        * rendering/RenderImage.cpp:
        * rendering/RenderListBox.cpp:
        * rendering/RenderListMarker.cpp:
        * rendering/RenderMenuList.cpp:
        * rendering/RenderObject.h:
        * rendering/RenderText.cpp:
        * rendering/RenderTextControl.cpp:
        * rendering/svg/SVGInlineTextBox.cpp:
        * rendering/svg/SVGMarkerLayoutInfo.h:
        * rendering/svg/SVGTextMetrics.cpp:
        * svg/SVGFont.cpp:

2011-01-19  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        [chromium] Tiled compositor should use texture manager
        https://bugs.webkit.org/show_bug.cgi?id=52418

        Test: compositing/

        * platform/graphics/chromium/LayerRendererChromium.cpp:
        (WebCore::LayerRendererChromium::~LayerRendererChromium):
        (WebCore::LayerRendererChromium::cleanupSharedObjects):
        * platform/graphics/chromium/LayerTilerChromium.cpp:
        (WebCore::LayerTilerChromium::LayerTilerChromium):
        (WebCore::LayerTilerChromium::reset):
        (WebCore::LayerTilerChromium::createTile):
        (WebCore::LayerTilerChromium::update):
        (WebCore::LayerTilerChromium::draw):
        * platform/graphics/chromium/LayerTilerChromium.h:
        (WebCore::LayerTilerChromium::Tile::Tile):
        (WebCore::LayerTilerChromium::Tile::texture):

2011-01-19  Stephen White  <senorblanco@chromium.org>

        Unreviewed; build fix for chromium.

        * platform/graphics/chromium/GLES2Canvas.cpp:
        (WebCore::GLES2Canvas::fillPath):

2011-01-18  Stephen White  <senorblanco@chromium.org>

        Reviewed by James Robinson.

        Implement accelerated path drawing and clipping for the Canvas2D GPU
        path.
        https://bugs.webkit.org/show_bug.cgi?id=52627
        
        This is done with a simple curve interpolator and the GLU tesselator,
        which is good enough for a 3-5X speedup on
        http://ie.microsoft.com/testdrive/Performance/Galactic/Default.html.

        Covered by canvas/philip/2d.path.clip.basic.html, and many, many more.
        All tests canvas/philip and fast/canvas paths pass with no
        regressions, although two have minor pixel differences which require
        rebaselining.

        * WebCore.gyp/WebCore.gyp:
        Add internal_glu include path to chromium build.
        * WebCore.gypi:
        Add internal_glu files to chromium build.
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::reset):
        (WebCore::CanvasRenderingContext2D::platformLayer):
        Make CanvasRenderingContext2D more robust against failure to create
        a DrawingBuffer.
        * platform/graphics/chromium/DrawingBufferChromium.cpp:
        (WebCore::DrawingBuffer::DrawingBuffer):
        As in DrawingBufferMac.cpp, call reset() from the constructor.
        Also initialize size to (-1, -1), so reset() doesn't early-out.
        Add initializers for depthBuffer and stencilBuffer, and remove
        multisampleDepthStencilBuffer.
        * platform/graphics/chromium/GLES2Canvas.cpp:
        Remove some unused #includes.
        (WebCore::GLES2Canvas::State::State):
        Add clipping state, and implement save/restore via the copy constructor.
        (WebCore::operator*):
        (WebCore::Quadratic::Quadratic):
        (WebCore::Quadratic::fromBezier):
        (WebCore::Quadratic::evaluate):
        Quadratic Bezier curve class.
        (WebCore::Cubic::Cubic):
        (WebCore::Cubic::fromBezier):
        (WebCore::Cubic::evaluate):
        Cubic Bezier curve class.
        (WebCore::GLES2Canvas::clearRect):
        Add clipping support to clearRect().
        (WebCore::GLES2Canvas::fillPath):
        Implement fillPath().
        (WebCore::GLES2Canvas::fillRect):
        Add clipping support to fillRect().
        (WebCore::GLES2Canvas::clipPath):
        Implement clipPath().
        (WebCore::GLES2Canvas::clipOut):
        Stub out clipOut() (not called by Canvas 2D).
        (WebCore::GLES2Canvas::restore):
        When restoring, draw any remaining clipping paths to the stencil buffer.
        (WebCore::GLES2Canvas::drawTexturedRect):
        Add clipping support.
        (WebCore::interpolateQuadratic):
        (WebCore::interpolateCubic):
        Simple curve interpolation, using the Cubic and Quadratic classes.
        (WebCore::PolygonData::PolygonData):
        A struct to hold the tesselation data for callbacks.
        (WebCore::beginData):
        (WebCore::edgeFlagData):
        (WebCore::vertexData):
        (WebCore::endData):
        (WebCore::combineData):
        internal_glu tesselation callbacks.
        (WebCore::GLES2Canvas::createVertexBufferFromPath):
        Build an interpolated, tesselated vertex buffer and element array buffer from a given path, suitable for filling.
        (WebCore::GLES2Canvas::beginStencilDraw):
        Enable stencilling, and disable draws to the color buffer.
        (WebCore::GLES2Canvas::applyClipping):
        If clipping is enabled, set the appropriate GL state.
        * platform/graphics/chromium/GLES2Canvas.h:
        Document the flavours of drawTexturedRect() a bit, so I don't get confused.
        * platform/graphics/gpu/DrawingBuffer.cpp:
        (WebCore::DrawingBuffer::clear):
        (WebCore::DrawingBuffer::createSecondaryBuffers):
        (WebCore::DrawingBuffer::resizeDepthStencil):
        (WebCore::DrawingBuffer::reset):
        * platform/graphics/gpu/DrawingBuffer.h:
        Unify m_multisampleDepthStencilBuffer with m_depthStencilBuffer. 
        Implement separate depth and stencil buffers for when
        OES_packed_depth_stencil is not available.  Refactor creation of
        multisampled and non-multisampled depth and stencil buffers into
        resizeDepthStencil().
        * platform/graphics/gpu/SharedGraphicsContext3D.cpp:
        (WebCore::SharedGraphicsContext3D::create):
        Turn on stencil, turn off depth, turn off antialiasing (for now).
        (WebCore::SharedGraphicsContext3D::enableStencil):
        * platform/graphics/gpu/SharedGraphicsContext3D.h:
        Implement stencil enable/disable.
        * platform/graphics/gpu/mac/DrawingBufferMac.mm:
        (WebCore::DrawingBuffer::DrawingBuffer):
        Remove m_multisampleDepthStencilBuffer.  Set the size to (-1, -1)
        on creation, so reset() doesn't early-out.  Initialize m_depthBuffer
        and m_stencilBuffer.
        * platform/graphics/skia/GraphicsContextSkia.cpp:
        (WebCore::GraphicsContext::canvasClip):
        (WebCore::GraphicsContext::clipOut):
        (WebCore::GraphicsContext::clipPath):
        (WebCore::GraphicsContext::fillPath):
        Put in GPU hooks for path clipping, and path drawing.
        * platform/graphics/skia/PlatformContextSkia.cpp:
        (WebCore::PlatformContextSkia::canAccelerate):
        Don't check for clipping paths in canAccelerate() (since we can
        now accelerate them).
        (WebCore::PlatformContextSkia::uploadSoftwareToHardware):
        Don't do clipping when uploading software draws to hardware.
        * thirdparty/glu/README.webkit:
        * thirdparty/glu/gluos.h:
        #undef MIN and MAX, to fix warnings-as-errors in Chrome/Mac build.
        * thirdparty/glu/libtess/geom.c:
        * thirdparty/glu/libtess/priorityq.c:
        * thirdparty/glu/libtess/render.c:
        Use do{}while(0) instead of if(1)else construct in macro.
        * thirdparty/glu/libtess/sweep.c:
        (IsWindingInside):
        (DoneEdgeDict):
        Fix some warnings treated as errors for the Linux Release build.

2011-01-19  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r76144.
        http://trac.webkit.org/changeset/76144
        https://bugs.webkit.org/show_bug.cgi?id=52737

        Broke tests on multiple bots, mostly Chromium Canaries
        (Requested by dimich on #webkit).

        * rendering/RenderText.cpp:
        (WebCore::RenderText::localCaretRect):

2011-01-19  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Adam Roben.

        [CSS Gradients] Crash due to out-of-memory with repeating-linear-gradient and latter stop positioned before former
        https://bugs.webkit.org/show_bug.cgi?id=52732
        
        When repeating gradient stops, make sure that the first and last stops are not at the same
        place, otherwise we'll add stops indefinitely and run out of memory.

        Test: fast/gradients/zero-range-repeating-gradient-hang.html

        * css/CSSGradientValue.cpp:
        (WebCore::CSSGradientValue::addStops):

2011-01-14  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Darin Adler.

        Remove event forwarding logic from input[type=range], simplify event flow and thumb positioning logic.
        https://bugs.webkit.org/show_bug.cgi?id=52464

        This change has two parts:

        1) Utilize shadow DOM event retargeting to get rid of forwarding events
           via render tree;
        2) Move thumb positioning logic from RenderSlider to SliderThumbElement.

        These two are highly co-dependent. It looked ugly when I tried to
        separate them.

        No change in behavior, covered by existing tests.

        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::defaultEventHandler): Added invocation of
            InputType::handleMouseDownEvent.
        * html/InputType.cpp:
        (WebCore::InputType::handleMouseDownEvent): Added empty decl.
        * html/InputType.h: Added def.
        * html/RangeInputType.cpp:
        (WebCore::RangeInputType::handleMouseDownEvent): Added to handle the case
            when the user clicks on the track of the slider. Also removed the
            forwardEvent method.
        * html/RangeInputType.h: Added/removed defs.
        * html/shadow/SliderThumbElement.cpp:
        (WebCore::SliderThumbElement::dragFrom): Added a helper method to start
            dragging from any position.
        (WebCore::SliderThumbElement::dragTo): Added a helper method to drag to
            specified position.
        (WebCore::SliderThumbElement::setPosition): Collapsed most of the positioning
            logic in RenderSlider into this method, which is now a simple calculation
            and adjusting of thumb position based on supplied coordinates.
        (WebCore::SliderThumbElement::startDragging): Added.
        (WebCore::SliderThumbElement::stopDragging): Added.
        (WebCore::SliderThumbElement::defaultEventHandler): Removed most of the
            old position-sniffing logic and replaced with simple calls to start,
            stop, and drag the thumb.
        * html/shadow/SliderThumbElement.h: Added defs.
        * rendering/RenderSlider.cpp: Removed a bunch of code that is no longer
            necessary.
        * rendering/RenderSlider.h: Removed defs, removed now-unnecessary friendliness.

2011-01-19  Shane Stephens  <shanestephens@google.com>

        Reviewed by Chris Marrin.

        Make AffineTransform and TransformationMatrix do matrix multiplication in the correct order (Column Major)
        https://bugs.webkit.org/show_bug.cgi?id=48031

        Fixed reversal, renamed matrix methods to be clearer, found all examples of operator* and
        operator*= usage and switched operand order.

        No new tests as this refactor doesn't add functionality.

        * html/HTMLCanvasElement.cpp:
        (WebCore::HTMLCanvasElement::baseTransform):
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::transform):
        (WebCore::CanvasRenderingContext2D::setTransform):
        * platform/graphics/cg/PatternCG.cpp:
        (WebCore::Pattern::createPlatformPattern):
        * platform/graphics/chromium/GLES2Canvas.cpp:
        (WebCore::GLES2Canvas::fillRect):
        (WebCore::GLES2Canvas::concatCTM):
        (WebCore::GLES2Canvas::drawQuad):
        * platform/graphics/chromium/TransparencyWin.cpp:
        (WebCore::TransparencyWin::setupLayerForOpaqueCompositeLayer):
        (WebCore::TransparencyWin::setupTransformForKeepTransform):
        * platform/graphics/transforms/AffineTransform.cpp:
        (WebCore::AffineTransform::multiply):
        (WebCore::AffineTransform::rotate):
        * platform/graphics/transforms/AffineTransform.h:
        (WebCore::AffineTransform::operator*=):
        (WebCore::AffineTransform::operator*):
        * platform/graphics/wince/GraphicsContextWinCE.cpp:
        (WebCore::GraphicsContextPlatformPrivate::concatCTM):
        * platform/graphics/wince/SharedBitmap.cpp:
        (WebCore::SharedBitmap::drawPattern):
        * rendering/svg/RenderSVGResourceContainer.cpp:
        (WebCore::RenderSVGResourceContainer::transformOnNonScalingStroke):
        * rendering/svg/RenderSVGResourceGradient.cpp:
        (WebCore::clipToTextMask):
        (WebCore::RenderSVGResourceGradient::applyResource):
        * rendering/svg/RenderSVGResourcePattern.cpp:
        (WebCore::RenderSVGResourcePattern::applyResource):
        * rendering/svg/RenderSVGRoot.cpp:
        (WebCore::RenderSVGRoot::localToBorderBoxTransform):
        * rendering/svg/SVGImageBufferTools.cpp:
        (WebCore::SVGImageBufferTools::calculateTransformationToOutermostSVGCoordinateSystem):
        (WebCore::SVGImageBufferTools::renderSubtreeToImageBuffer):
        * rendering/svg/SVGTextLayoutEngine.cpp:
        (WebCore::SVGTextLayoutEngine::finalizeTransformMatrices):
        * svg/SVGLocatable.cpp:
        (WebCore::SVGLocatable::computeCTM):
        (WebCore::SVGLocatable::getTransformToElement):
        * svg/SVGMatrix.h:
        (WebCore::SVGMatrix::multiply):
        * svg/SVGSVGElement.cpp:
        (WebCore::SVGSVGElement::localCoordinateSpaceTransform):
        (WebCore::SVGSVGElement::viewBoxToViewTransform):
        * svg/SVGStyledTransformableElement.cpp:
        (WebCore::SVGStyledTransformableElement::animatedLocalTransform):
        * svg/SVGTextElement.cpp:
        (WebCore::SVGTextElement::animatedLocalTransform):
        * svg/SVGTransformList.cpp:
        (WebCore::SVGTransformList::concatenate):

2011-01-19  Chang Shu  <chang.shu@nokia.com>

        Reviewed by Darin Adler.

        The return value of contentEditable() function should depend on the DOM attribute
        instead of render style userModify. The code change fixed test cases in the bug
        and partially fixed test cases in other contentEditable bugs;

        https://bugs.webkit.org/show_bug.cgi?id=52056

        * html/HTMLElement.cpp:
        (WebCore::HTMLElement::contentEditable):

2011-01-19  Levi Weintraub  <leviw@chromium.org>

        Reviewed by Darin Adler.

        Changing RenderText::localCaretRect to clip to its containing block's logicalLeft and
        logicalRightLayoutOverflow instead of simply using logicalLeft and logicalRight, as this
        resulted in the caret being placed incorrectly in overflowing editable IFrame content.

        Long lines in non-white-space-pre editable documents show cursor in wrong place
        https://bugs.webkit.org/show_bug.cgi?id=48132

        Test: editing/selection/caret-painting-in-overflowing-autowrap-content.html

        * rendering/RenderText.cpp:
        (WebCore::RenderText::localCaretRect):

2011-01-19  Chris Marrin  <cmarrin@apple.com>

        Reviewed by Simon Fraser.

        WK2 - Multiple crashes in PlatformCALayer::replaceSublayer
        https://bugs.webkit.org/show_bug.cgi?id=52695

        Added ASSERTs to the places we assume a non-null superlayer.

        * platform/graphics/ca/GraphicsLayerCA.cpp:
        (WebCore::GraphicsLayerCA::ensureStructuralLayer):
        (WebCore::GraphicsLayerCA::swapFromOrToTiledLayer):

2011-01-18  Beth Dakin  <bdakin@apple.com>

        Reviewed by Maciej Stachowiak.

        Fix for <rdar://problem/8882916> Overlay scrollers require 
        content to layout underneath the scrollbar area

        The render tree should not include scrollbar size for
        overlay scrollers. This patch will allow scrollers on
        the WebView to behave like overflow:overlay.

        Treat overlay scrollers the same way as the !includeScrollbars
        case.
        * platform/ScrollView.cpp:
        (WebCore::ScrollView::visibleContentRect):

        No corner rect for overlay scrollers.
        (WebCore::ScrollView::scrollCornerRect):

        usesOverlayScrollbars() currently always returns no.
        * platform/ScrollbarTheme.h:
        (WebCore::ScrollbarTheme::usesOverlayScrollbars):
        * platform/mac/ScrollbarThemeMac.h:
        * platform/mac/ScrollbarThemeMac.mm:
        (WebCore::ScrollbarThemeMac::usesOverlayScrollbars):

        includeVerticalScrollbarSize() and includeHorizontalScrollbarSize()
        should return false for overlay scrollers. They already return
        false for overflow:overlay.
        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::includeVerticalScrollbarSize):
        (WebCore::RenderBox::includeHorizontalScrollbarSize):
        * rendering/RenderBox.h:

        In the render tree, always treat overlay scrollers like
        they have a width and height of 0.
        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::verticalScrollbarWidth):
        (WebCore::RenderLayer::horizontalScrollbarHeight):
        * rendering/RenderListBox.cpp:
        (WebCore::RenderListBox::verticalScrollbarWidth):

2011-01-18  Evan Martin  <evan@chromium.org>

        Reviewed by Tony Chang.

        [chromium] simplify complex text code, fixing a handful of layout tests
        https://bugs.webkit.org/show_bug.cgi?id=52661

        Change ComplexTextControllerLinux to lay out RTL text to the left from
        the starting point.  (Previously it always went to the right.)  This allows
        us to map pixel offsets more directly into offsets within the text runs,
        simplifying a few of the text-fiddling functions (they no longer need to
        track the current position, as ComplexTextController now does it).

        * platform/graphics/chromium/ComplexTextControllerLinux.cpp:
        (WebCore::ComplexTextController::ComplexTextController):
        (WebCore::ComplexTextController::reset):
        (WebCore::ComplexTextController::setGlyphXPositions):
        * platform/graphics/chromium/ComplexTextControllerLinux.h:
        (WebCore::ComplexTextController::offsetX):
        * platform/graphics/chromium/FontLinux.cpp:
        (WebCore::Font::drawComplexText):
        (WebCore::Font::floatWidthForComplexText):
        (WebCore::glyphIndexForXPositionInScriptRun):
        (WebCore::Font::offsetForPositionForComplexText):
        (WebCore::Font::selectionRectForComplexText):

2011-01-19  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: move methods from InjectedScript domain into DOM,
        Runtime and Debugger domains. Introduce InspectorRuntimeAgent.
        https://bugs.webkit.org/show_bug.cgi?id=52717

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/InjectedScript.cpp:
        (WebCore::InjectedScript::evaluateOnCallFrame):
        (WebCore::InjectedScript::getCompletions):
        (WebCore::InjectedScript::getCompletionsOnCallFrame):
        * inspector/InjectedScript.h:
        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::injectedScriptForMainWorld):
        * inspector/InjectedScriptHost.h:
        * inspector/InjectedScriptSource.js:
        (.):
        ():
        * inspector/Inspector.idl:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::connectFrontend):
        (WebCore::InspectorController::releaseFrontendLifetimeAgents):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::InspectorDOMAgent):
        (WebCore::InspectorDOMAgent::resolveNode):
        (WebCore::InspectorDOMAgent::getNodeProperties):
        (WebCore::InspectorDOMAgent::getNodePrototypes):
        (WebCore::InspectorDOMAgent::injectedScriptForNodeId):
        * inspector/InspectorDOMAgent.h:
        (WebCore::EventListenerInfo::EventListenerInfo):
        (WebCore::InspectorDOMAgent::DOMListener::~DOMListener):
        (WebCore::InspectorDOMAgent::create):
        (WebCore::InspectorDOMAgent::cast):
        (WebCore::InspectorDOMAgent::documents):
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::evaluateOnCallFrame):
        (WebCore::InspectorDebuggerAgent::getCompletionsOnCallFrame):
        (WebCore::InspectorDebuggerAgent::injectedScriptForCallFrameId):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/InspectorRuntimeAgent.cpp: Added.
        (WebCore::InspectorRuntimeAgent::InspectorRuntimeAgent):
        (WebCore::InspectorRuntimeAgent::~InspectorRuntimeAgent):
        (WebCore::InspectorRuntimeAgent::evaluate):
        (WebCore::InspectorRuntimeAgent::getCompletions):
        (WebCore::InspectorRuntimeAgent::getProperties):
        (WebCore::InspectorRuntimeAgent::setPropertyValue):
        (WebCore::InspectorRuntimeAgent::pushNodeToFrontend):
        (WebCore::InspectorRuntimeAgent::injectedScriptForObjectId):
        * inspector/InspectorRuntimeAgent.h: Copied from Source/WebCore/inspector/InjectedScript.h.
        (WebCore::InspectorRuntimeAgent::create):
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype.completions):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.doEvalInCallFrame):

2011-01-18  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: add UglifyJS parser and formatter files
        https://bugs.webkit.org/show_bug.cgi?id=51702

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * inspector/front-end/ScriptFormatter.js:
        (WebInspector.ScriptFormatter.positionToLocation):
        (WebInspector.ScriptFormatter.prototype.format.messageHandler):
        (WebInspector.ScriptFormatter.prototype.format):
        (WebInspector.ScriptFormatter.prototype._buildMapping):
        (WebInspector.ScriptFormatter.prototype._convertPosition):
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype.formatSource.didFormat):
        (WebInspector.SourceFrame.prototype.formatSource):
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/parse-js.js: Added. UglifyJS parser.
        * inspector/front-end/process.js: Added. UglifyJS formatter.
        * inspector/front-end/scriptFormatterWorker.js: Added. Worker script that wraps UglifyJS code.
        (onmessage):
        (beautify):
        (loadModule):
        (require):
        * inspector/front-end/utilities.js:
        ():

2011-01-19  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [JSC] scripts have incorrect starting line (always 1).
        https://bugs.webkit.org/show_bug.cgi?id=52721

        Test: inspector/debugger-scripts.html

        * bindings/js/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::dispatchDidParseSource):
        (WebCore::ScriptDebugServer::dispatchFailedToParseSource):
        (WebCore::ScriptDebugServer::sourceParsed):
        * bindings/js/ScriptDebugServer.h:
        * bindings/js/ScriptSourceCode.h:
        (WebCore::ScriptSourceCode::ScriptSourceCode):
        * bindings/js/StringSourceProvider.h:
        (WebCore::StringSourceProvider::create):
        (WebCore::StringSourceProvider::startPosition):
        (WebCore::StringSourceProvider::StringSourceProvider):

2011-01-19  Satish Sampath  <satish@chromium.org>

        Reviewed by Jeremy Orlow.

        Send origin/url as part of speech input requests to the embedder.
        https://bugs.webkit.org/show_bug.cgi?id=52718

        * page/SpeechInput.cpp:
        (WebCore::SpeechInput::startRecognition): Pass up additional origin parameter.
        * page/SpeechInput.h:
        * page/SpeechInputClient.h:
        * platform/mock/SpeechInputClientMock.cpp:
        (WebCore::SpeechInputClientMock::startRecognition): Updated prototype.
        * platform/mock/SpeechInputClientMock.h:
        * rendering/TextControlInnerElements.cpp:
        (WebCore::InputFieldSpeechButtonElement::defaultEventHandler): Pass the frame origin to speech input request.

2011-01-19  Hans Wennborg  <hans@chromium.org>

        Reviewed by Jeremy Orlow.

        IndexedDB: Support auto-increment keys
        https://bugs.webkit.org/show_bug.cgi?id=52576

        Add support for auto-increment keys.

        Test: storage/indexeddb/objectstore-autoincrement.html

        * storage/IDBDatabase.cpp:
        (WebCore::IDBDatabase::createObjectStore):
        * storage/IDBObjectStoreBackendImpl.cpp:
        (WebCore::genAutoIncrementKey):
        (WebCore::IDBObjectStoreBackendImpl::putInternal):

2011-01-19  Csaba Osztrogonác  <ossy@webkit.org>

        Reviewed by Laszlo Gombos and Tor Arne Vestbø.

        [Qt] Remove unnecessary "../Source" from paths
        after moving source files into Source is finished.

        * WebCore.pri:
        * WebCore.pro:

2011-01-19  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: Employ TextPrompt for CSS property name/value autocompletion
        https://bugs.webkit.org/show_bug.cgi?id=52212

        WebInspector.CSSKeywordCompletions contains a hand-written list of accepted CSS property value keywords
        for each property. WebInspector.TextPrompt is used to suggest both the name and value keywords while
        editing styles, in place of the old custom suggestion code.

        * inspector/front-end/CSSCompletions.js:
        (WebInspector.CSSCompletions.prototype.startsWith): Fix array-out-of-bounds error.
        * inspector/front-end/CSSKeywordCompletions.js: Added.
        (WebInspector.CSSKeywordCompletions.forProperty):
        * inspector/front-end/StylesSidebarPane.js:
        (WebInspector.StylePropertyTreeElement.prototype.updateTitle):
        (WebInspector.StylePropertyTreeElement.prototype):
        ():
        * inspector/front-end/TextPrompt.js:
        (WebInspector.TextPrompt):
        (WebInspector.TextPrompt.prototype.removeFromElement):
        (WebInspector.TextPrompt.prototype._onKeyDown):
        (WebInspector.TextPrompt.prototype.tabKeyPressed):
        (WebInspector.TextPrompt.prototype.upKeyPressed):
        (WebInspector.TextPrompt.prototype.downKeyPressed):
        (WebInspector.TextPrompt.prototype._moveBackInHistory):
        (WebInspector.TextPrompt.prototype._moveForwardInHistory):
        * inspector/front-end/inspector.css:
        (.auto-complete-text, .editing .auto-complete-text):
        * inspector/front-end/inspector.html:

2011-01-19  Dai Mikurube  <dmikurube@google.com>

        Reviewed by Kent Tamura.

        Implement onformchange and onforminput event handlers
        https://bugs.webkit.org/show_bug.cgi?id=26141

        Tests: fast/forms/formchange-event.html
               fast/forms/forminput-event.html

        * bindings/scripts/CodeGeneratorGObject.pm: Added event names.
        * dom/Document.h: Added event definitions.
        * dom/Document.idl: Added event definitions.
        * dom/Element.h: Added event definitions.
        * dom/Element.idl: Added event definitions.
        * dom/Event.cpp:
        (WebCore::Event::fromUserGesture): Added a condition for a formchange event in handling user gestures.
        * dom/EventNames.h: Added event definitions.
        * dom/InputElement.cpp:
        (WebCore::InputElement::setValueFromRenderer): Replaced a direct dispatchEvent() call into dispatchInputEvents(), a virtual function which broadcasts forminput events for HTML elements.
        * dom/Node.cpp:
        (WebCore::Node::dispatchInputEvents): Defined basic dispatchInputEvents() described above.
        (WebCore::Node::dispatchChangeEvents): Defined basic dispatchChangeEvents() described above.
        (WebCore::Node::defaultEventHandler): Replaced a direct dispatchEvent() call into dispatchInputEvents().
        * dom/Node.h:
        * html/FormAssociatedElement.h: Added isResettable() to check the element is resettable or not.
        * html/HTMLAttributeNames.in: Added event names.
        * html/HTMLElement.cpp:
        (WebCore::HTMLElement::parseMappedAttribute): Added event handling.
        (WebCore::HTMLElement::shadowAncestorOwnerForm): Added to get an ancestor <form> element from a shadow element.
        (WebCore::HTMLElement::dispatchChangeEvents): Defined dispatchChangeEvents() for HTML elements described above.
        (WebCore::HTMLElement::dispatchInputEvents): Defined dispatchInputEvents() for HTML elements described above.
        * html/HTMLElement.h:
        * html/HTMLFormControlElement.cpp:
        (WebCore::HTMLFormControlElement::dispatchFormControlChangeEvent): Added calling dispatchFormChange() to broadcast formchange events.
        (WebCore::HTMLFormControlElement::dispatchFormControlInputEvent): Defined newly to dispatch an input event with broadcasting forminput events.
        * html/HTMLFormControlElement.h: Added isResettable().
        * html/HTMLFormElement.cpp:
        (WebCore::HTMLFormElement::broadcastFormEvent): Added to broadcast forminput or formchange events.
        (WebCore::HTMLFormElement::dispatchFormInput): Defined newly to broadcast forminput events.
        (WebCore::HTMLFormElement::dispatchFormChange): Defined newly to broadcast formchange events.
        * html/HTMLFormElement.h:
        * html/HTMLFormElement.idl: Added dispatchFormInput() and dispatchFormChange() DOM API definitions.
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::stepUpFromRenderer): Replaced a direct dispatchEvent() call into dispatchInputEvents().
        * html/HTMLInputElement.h: Added isResettable().
        * html/HTMLKeygenElement.h: Added isResettable().
        * html/HTMLObjectElement.h: Added isResettable().
        * html/HTMLOutputElement.h: Added isResettable().
        * html/HTMLSelectElement.h: Added isResettable().
        * html/HTMLTextAreaElement.h: Added isResettable().
        * page/DOMWindow.h: Added event definitions.
        * page/DOMWindow.idl: Added event definitions.
        * rendering/TextControlInnerElements.cpp:
        (WebCore::SearchFieldCancelButtonElement::defaultEventHandler): Replaced a direct dispatchEvent() call into dispatchInputEvents().

2011-01-19  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Extensions API] delete pending callback from callback map before invoking it
        https://bugs.webkit.org/show_bug.cgi?id=52707

        * inspector/front-end/ExtensionAPI.js:
        (WebInspector.injectedExtensionAPI.ExtensionServerClient.prototype._onCallback):

2011-01-19  Levi Weintraub  <leviw@google.com>

        Reviewed by Ryosuke Niwa.

        Replaced rangeCompliantEquivalent with Position::parentAnchoredEquivalent
        and simplified the logic a bit. Unfortunately, Tables and some legacy
        editing positions still need to be handled specifically.

        remove rangeCompliantEquivalent and replace it with Position methods
        https://bugs.webkit.org/show_bug.cgi?id=25057

        No new tests as this is a refactor that doesn't change behavior.

        * WebCore.exp.in:
        * dom/Document.cpp:
        (WebCore::Document::caretRangeFromPoint):
        * dom/Position.cpp:
        (WebCore::Position::parentAnchoredEquivalent):
        * dom/Position.h:
        * editing/ApplyStyleCommand.cpp:
        (WebCore::ApplyStyleCommand::applyBlockStyle):
        * editing/CompositeEditCommand.cpp:
        (WebCore::CompositeEditCommand::insertNodeAt):
        (WebCore::CompositeEditCommand::moveParagraphs):
        * editing/DeleteSelectionCommand.cpp:
        (WebCore::DeleteSelectionCommand::initializePositionData):
        (WebCore::DeleteSelectionCommand::mergeParagraphs):
        * editing/Editor.cpp:
        (WebCore::Editor::textDirectionForSelection):
        (WebCore::Editor::advanceToNextMisspelling):
        * editing/InsertLineBreakCommand.cpp:
        (WebCore::InsertLineBreakCommand::shouldUseBreakElement):
        * editing/InsertParagraphSeparatorCommand.cpp:
        (WebCore::InsertParagraphSeparatorCommand::doApply):
        * editing/ReplaceSelectionCommand.cpp:
        (WebCore::handleStyleSpansBeforeInsertion):
        * editing/VisiblePosition.cpp:
        (WebCore::makeRange):
        (WebCore::setStart):
        (WebCore::setEnd):
        * editing/VisibleSelection.cpp:
        (WebCore::VisibleSelection::firstRange):
        (WebCore::VisibleSelection::toNormalizedRange):
        (WebCore::makeSearchRange):
        * editing/htmlediting.cpp:
        (WebCore::indexForVisiblePosition):
        * editing/htmlediting.h:
        * editing/visible_units.cpp:
        (WebCore::previousBoundary):
        (WebCore::nextBoundary):
        * page/DOMSelection.cpp:
        (WebCore::anchorPosition):
        (WebCore::focusPosition):
        (WebCore::basePosition):
        (WebCore::extentPosition):

2011-01-19  Peter Rybin  <peter.rybin@gmail.com>

        Reviewed by Yury Semikhatsky.

        Web Inspector: script column offset is incorrect
        https://bugs.webkit.org/show_bug.cgi?id=52580

        Column is updated in 3 places, 2 less probable places contained error.
        Fixed now.

        * platform/text/SegmentedString.cpp:
        (WebCore::SegmentedString::advanceSlowCase):
        * platform/text/SegmentedString.h:
        (WebCore::SegmentedString::advancePastNewline):

2011-01-18  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: make InjectedScriptAccess API a part of Web Inspector protocol.
        https://bugs.webkit.org/show_bug.cgi?id=52652

        Calls served by the InjectedScript should be first class protocol
        citizens, not dispatched via single protocol message.

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/InjectedScript.cpp:
        (WebCore::InjectedScript::evaluate):
        (WebCore::InjectedScript::evaluateInCallFrame):
        (WebCore::InjectedScript::evaluateOnSelf):
        (WebCore::InjectedScript::getCompletions):
        (WebCore::InjectedScript::getProperties):
        (WebCore::InjectedScript::pushNodeToFrontend):
        (WebCore::InjectedScript::resolveNode):
        (WebCore::InjectedScript::getNodeProperties):
        (WebCore::InjectedScript::getNodePrototypes):
        (WebCore::InjectedScript::setPropertyValue):
        (WebCore::InjectedScript::makeCall):
        * inspector/InjectedScript.h:
        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::evaluate):
        (WebCore::InjectedScriptHost::evaluateInCallFrame):
        (WebCore::InjectedScriptHost::evaluateOnSelf):
        (WebCore::InjectedScriptHost::getCompletions):
        (WebCore::InjectedScriptHost::getProperties):
        (WebCore::InjectedScriptHost::pushNodeToFrontend):
        (WebCore::InjectedScriptHost::resolveNode):
        (WebCore::InjectedScriptHost::getNodeProperties):
        (WebCore::InjectedScriptHost::getNodePrototypes):
        (WebCore::InjectedScriptHost::setPropertyValue):
        (WebCore::InjectedScriptHost::injectedScriptForObjectId):
        (WebCore::InjectedScriptHost::injectedScriptForNodeId):
        (WebCore::InjectedScriptHost::injectedScriptForMainWorld):
        * inspector/InjectedScriptHost.h:
        * inspector/InjectedScriptSource.js:
        (.):
        * inspector/Inspector.idl:
        * inspector/InspectorController.cpp:
        * inspector/InspectorController.h:
        * inspector/InspectorValues.cpp:
        (WebCore::InspectorObject::getNumber):
        * inspector/InspectorValues.h:
        * inspector/front-end/AuditRules.js:
        (WebInspector.AuditRules.evaluateInTargetWindow):
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype.completions):
        (WebInspector.ConsoleView.prototype.doEvalInWindow):
        * inspector/front-end/ElementsTreeOutline.js:
        (WebInspector.ElementsTreeElement.prototype._createTooltipForNode):
        * inspector/front-end/ExtensionPanel.js:
        (WebInspector.ExtensionWatchSidebarPane.prototype.setExpression):
        * inspector/front-end/ExtensionServer.js:
        (WebInspector.ExtensionServer.prototype._onEvaluateOnInspectedPage):
        * inspector/front-end/InjectedScriptAccess.js: Removed.
        * inspector/front-end/PropertiesSidebarPane.js:
        (WebInspector.PropertiesSidebarPane.prototype.update.callback):
        (WebInspector.PropertiesSidebarPane.prototype.update):
        * inspector/front-end/RemoteObject.js:
        (WebInspector.RemoteObject.resolveNode):
        (WebInspector.RemoteObject.prototype.getProperties):
        (WebInspector.RemoteObject.prototype.setPropertyValue):
        (WebInspector.RemoteObject.prototype.pushNodeToFrontend):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.doEvalInCallFrame):
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/inspector.html:

2011-01-18  Anton Muhin  <antonm@chromium.org>

        Reviewed by Adam Barth.

        [v8] Minor cleanup: make 2nd argument of removeIfPresnt accept only a value type stored in the DOM map
        https://bugs.webkit.org/show_bug.cgi?id=51683

        Covered by the existing tests.

        * bindings/v8/DOMDataStore.cpp:
        (WebCore::DOMDataStore::weakNodeCallback):
        (WebCore::DOMDataStore::IntrusiveDOMWrapperMap::removeIfPresent):
        * bindings/v8/DOMDataStore.h:
        * bindings/v8/V8DOMMap.h:
        (WebCore::WeakReferenceMap::removeIfPresent):

2011-01-18 MORITA Hajime  <morrita@google.com>

        Reviewed by Ryosuke Niwa.
        
        Refactoring: EventHandler::handleTextInputEvent should accept an enum instead of bools.
        https://bugs.webkit.org/show_bug.cgi?id=52608

        No new tests. no behavioral change.

        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * dom/TextEvent.cpp:
        (WebCore::TextEvent::create):
        (WebCore::TextEvent::createForDrop):
        (WebCore::TextEvent::TextEvent):
        * dom/TextEvent.h:
        (WebCore::TextEvent::isLineBreak):
        (WebCore::TextEvent::isBackTab):
        (WebCore::TextEvent::isPaste):
        (WebCore::TextEvent::isDrop):
        * dom/TextEventInputType.h: Added. Extracted from TextEvent::TextInputType.
        * editing/EditorCommand.cpp:
        (WebCore::executeInsertBacktab):
        (WebCore::executeInsertLineBreak):
        (WebCore::executeInsertNewline):
        (WebCore::executeInsertTab):
        * page/EventHandler.cpp:
        (WebCore::EventHandler::handleTextInputEvent):
        * page/EventHandler.h:

2011-01-18  Ben Vanik  <ben.vanik@gmail.com>

        Reviewed by Kenneth Russell.

        Updating ANGLE in WebKit to r533.
        https://bugs.webkit.org/show_bug.cgi?id=47194

        * platform/graphics/ANGLEWebKitBridge.cpp:
        (WebCore::ANGLEWebKitBridge::ANGLEWebKitBridge):
        (WebCore::ANGLEWebKitBridge::~ANGLEWebKitBridge):
        (WebCore::ANGLEWebKitBridge::validateShaderSource):
        Update to new ANGLE API for shader validation.
        * platform/graphics/ANGLEWebKitBridge.h:
        (WebCore::ANGLEWebKitBridge::setResources): 
        Renaming types to new names.
        * platform/graphics/mac/GraphicsContext3DMac.mm:
        (WebCore::GraphicsContext3D::GraphicsContext3D):
        Initialize ANGLEResources with ANGLE init call to prevent uninitialized variables.

2011-01-18  MORITA Hajime  <morrita@google.com>

        Reviewed by Simon Fraser.

        Refactoring: Extract RoundedIntRect class
        https://bugs.webkit.org/show_bug.cgi?id=51664

        RoundedIntRect is a pair of rect and four IntSize objects which represent
        corner radii of the rectangle. IntSize is grouped into RoundedIntRect::Radii.
        Now RenderStyle::getRoundedBorderFor() and RenderStyle::getRoundedInnerBorderWithBorderWidths()
        return RoundedIntRect and GraphicsContext::addRoundedRectClip(), GraphicsContext::fillRoundedRect()
        and other functions accept RoundedIntRect as an argument.

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * platform/graphics/GraphicsContext.cpp:
        (WebCore::GraphicsContext::addRoundedRectClip):
        (WebCore::GraphicsContext::clipOutRoundedRect):
        (WebCore::GraphicsContext::fillRoundedRect):
        * platform/graphics/GraphicsContext.h:
        * platform/graphics/RoundedIntRect.cpp: Added.
        (WebCore::RoundedIntRect::Radii::isZero):
        (WebCore::RoundedIntRect::Radii::scale):
        (WebCore::RoundedIntRect::Radii::expand):
        (WebCore::RoundedIntRect::Radii::includeLogicalEdges):
        (WebCore::RoundedIntRect::Radii::excludeLogicalEdges):
        (WebCore::RoundedIntRect::RoundedIntRect):
        (WebCore::RoundedIntRect::includeLogicalEdges):
        (WebCore::RoundedIntRect::excludeLogicalEdges):
        * platform/graphics/RoundedIntRect.h: Added.
        (WebCore::RoundedIntRect::Radii::Radii):
        (WebCore::RoundedIntRect::Radii::setTopLeft):
        (WebCore::RoundedIntRect::Radii::setTopRight):
        (WebCore::RoundedIntRect::Radii::setBottomLeft):
        (WebCore::RoundedIntRect::Radii::setBottomRight):
        (WebCore::RoundedIntRect::Radii::topLeft):
        (WebCore::RoundedIntRect::Radii::topRight):
        (WebCore::RoundedIntRect::Radii::bottomLeft):
        (WebCore::RoundedIntRect::Radii::bottomRight):
        (WebCore::RoundedIntRect::Radii::expand):
        (WebCore::RoundedIntRect::Radii::shrink):
        (WebCore::RoundedIntRect::rect):
        (WebCore::RoundedIntRect::radii):
        (WebCore::RoundedIntRect::isRounded):
        (WebCore::RoundedIntRect::isEmpty):
        (WebCore::RoundedIntRect::setRect):
        (WebCore::RoundedIntRect::setRadii):
        (WebCore::RoundedIntRect::move):
        (WebCore::RoundedIntRect::inflate):
        (WebCore::RoundedIntRect::inflateWithRadii):
        (WebCore::RoundedIntRect::expandRadii):
        (WebCore::RoundedIntRect::shrinkRadii):
        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::pushContentsClip):
        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
        (WebCore::RenderBoxModelObject::paintBorder):
        (WebCore::RenderBoxModelObject::clipBorderSidePolygon):
        (WebCore::RenderBoxModelObject::paintBoxShadow):
        * rendering/RenderBoxModelObject.h:
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::drawBoxSideFromPath):
        * rendering/RenderReplaced.cpp:
        (WebCore::RenderReplaced::paint):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        * rendering/RenderThemeMac.mm:
        (WebCore::RenderThemeMac::paintMenuListButtonGradients):
        (WebCore::RenderThemeMac::paintSliderTrack):
        * rendering/RenderThemeSafari.cpp:
        (WebCore::RenderThemeSafari::paintMenuListButtonGradients):
        (WebCore::RenderThemeSafari::paintSliderTrack):
        * rendering/RenderThemeWinCE.cpp:
        (WebCore::RenderThemeWinCE::paintSearchFieldCancelButton):
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::paint):
        * rendering/style/BorderData.h:
        * rendering/style/RenderStyle.cpp:
        (WebCore::calcRadiiFor):
        (WebCore::calcConstraintScaleFor):
        (WebCore::RenderStyle::getRoundedBorderFor):
        (WebCore::RenderStyle::getRoundedInnerBorderWithBorderWidths):
        * rendering/style/RenderStyle.h:
        (WebCore::InheritedFlags::setBorderRadius):

2011-01-18  MORITA Hajime  <morrita@google.com>

        Reviewed by Simon Fraser.

        Refactoring: Extract RoundedIntRect class
        https://bugs.webkit.org/show_bug.cgi?id=51664

        RoundedIntRect is a pair of rect and four IntSize objects which represent
        corner radii of the rectangle. IntSize is grouped into RoundedIntRect::Radii.
        Now RenderStyle::getRoundedBorderFor() and RenderStyle::getRoundedInnerBorderWithBorderWidths()
        return RoundedIntRect and GraphicsContext::addRoundedRectClip(), GraphicsContext::fillRoundedRect()
        and other functions accept RoundedIntRect as an argument.

        No new tests. No behavioral change.

        * Android.mk:
        * CMakeLists.txt:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.xcodeproj/project.pbxproj:
        * platform/graphics/GraphicsContext.cpp:
        (WebCore::GraphicsContext::addRoundedRectClip):
        (WebCore::GraphicsContext::clipOutRoundedRect):
        (WebCore::GraphicsContext::fillRoundedRect):
        * platform/graphics/GraphicsContext.h:
        * platform/graphics/RoundedIntRect.cpp: Added.
        (WebCore::RoundedIntRect::Radii::isZero):
        (WebCore::RoundedIntRect::Radii::scale):
        (WebCore::RoundedIntRect::Radii::expand):
        (WebCore::RoundedIntRect::Radii::includeLogicalEdges):
        (WebCore::RoundedIntRect::Radii::excludeLogicalEdges):
        (WebCore::RoundedIntRect::RoundedIntRect):
        (WebCore::RoundedIntRect::includeLogicalEdges):
        (WebCore::RoundedIntRect::excludeLogicalEdges):
        * platform/graphics/RoundedIntRect.h: Added.
        (WebCore::RoundedIntRect::Radii::Radii):
        (WebCore::RoundedIntRect::Radii::setTopLeft):
        (WebCore::RoundedIntRect::Radii::setTopRight):
        (WebCore::RoundedIntRect::Radii::setBottomLeft):
        (WebCore::RoundedIntRect::Radii::setBottomRight):
        (WebCore::RoundedIntRect::Radii::topLeft):
        (WebCore::RoundedIntRect::Radii::topRight):
        (WebCore::RoundedIntRect::Radii::bottomLeft):
        (WebCore::RoundedIntRect::Radii::bottomRight):
        (WebCore::RoundedIntRect::Radii::expand):
        (WebCore::RoundedIntRect::Radii::shrink):
        (WebCore::RoundedIntRect::rect):
        (WebCore::RoundedIntRect::radii):
        (WebCore::RoundedIntRect::isRounded):
        (WebCore::RoundedIntRect::isEmpty):
        (WebCore::RoundedIntRect::setRect):
        (WebCore::RoundedIntRect::setRadii):
        (WebCore::RoundedIntRect::move):
        (WebCore::RoundedIntRect::inflate):
        (WebCore::RoundedIntRect::inflateWithRadii):
        (WebCore::RoundedIntRect::expandRadii):
        (WebCore::RoundedIntRect::shrinkRadii):
        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::pushContentsClip):
        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
        (WebCore::RenderBoxModelObject::paintBorder):
        (WebCore::RenderBoxModelObject::clipBorderSidePolygon):
        (WebCore::RenderBoxModelObject::paintBoxShadow):
        * rendering/RenderBoxModelObject.h:
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::drawBoxSideFromPath):
        * rendering/RenderReplaced.cpp:
        (WebCore::RenderReplaced::paint):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        * rendering/RenderThemeMac.mm:
        (WebCore::RenderThemeMac::paintMenuListButtonGradients):
        (WebCore::RenderThemeMac::paintSliderTrack):
        * rendering/RenderThemeSafari.cpp:
        (WebCore::RenderThemeSafari::paintMenuListButtonGradients):
        (WebCore::RenderThemeSafari::paintSliderTrack):
        * rendering/RenderThemeWinCE.cpp:
        (WebCore::RenderThemeWinCE::paintSearchFieldCancelButton):
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::paint):
        * rendering/style/BorderData.h:
        * rendering/style/RenderStyle.cpp:
        (WebCore::calcRadiiFor):
        (WebCore::calcConstraintScaleFor):
        (WebCore::RenderStyle::getRoundedBorderFor):
        (WebCore::RenderStyle::getRoundedInnerBorderWithBorderWidths):
        * rendering/style/RenderStyle.h:
        (WebCore::InheritedFlags::setBorderRadius):

2011-01-18  Victoria Kirst  <vrk@chromium.org>

        Reviewed by Kenneth Russell.

        [chromium] Adding support for YV16 video frame formats.
        https://bugs.webkit.org/show_bug.cgi?id=52345

        * platform/graphics/chromium/VideoLayerChromium.cpp:
        (WebCore::VideoLayerChromium::determineTextureFormat):
        (WebCore::VideoLayerChromium::draw):

2011-01-18  David Hyatt  <hyatt@apple.com>

        Reviewed by Dan Bernstein.

        <rdar://problem/8479998> REGRESSION (r67660): broken button layout at devforums.apple.com
        
        Exclude floating objects from shrinking to avoid floats.  They should never do this.  Timing-related bugs could
        occur as a result of this mistake, and the change to rewrite pagination to defer layout of floats until they
        got encountered on the correct line exposed this issue.

        Added /fast/block/float/float-overflow-hidden-containing-block-width.html.

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::shrinkToAvoidFloats):

2011-01-18  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Make CheckedInt<long> and CheckedInt<unsigned long> work
        https://bugs.webkit.org/show_bug.cgi?id=52401

        * html/canvas/CheckedInt.h:
        (WebCore::CheckedInt::CheckedInt): Merge with the patch provided by Benoit Jacob.
        * html/canvas/WebGLBuffer.cpp:
        (WebCore::WebGLBuffer::associateBufferDataImpl): Use CheckedInt<long> instead of CheckedInt<int>.
        (WebCore::WebGLBuffer::associateBufferSubDataImpl): Ditto.

2011-01-18  Kenneth Russell  <kbr@google.com>

        Reviewed by David Levin.

        Must strip comments from WebGL shaders before enforcing character set
        https://bugs.webkit.org/show_bug.cgi?id=52390

        Strip comments from incoming shaders, preserving line numbers,
        before validating that they conform to the ESSL character set.
        Revert changes from http://trac.webkit.org/changeset/75735 which
        allowed invalid characters to be passed to certain APIs.

        Tested with WebGL layout tests, conformance test suite and several
        WebGL demos in both Safari and Chromium.

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::StripComments::StripComments::process):
        (WebCore::WebGLRenderingContext::shaderSource):

2011-01-18  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        Stop instantiating legacy editing positions in DeleteSelectionCommand, IndentOudentCommand,
        InsertLineBreakCommand, InsertListCOmmand.cpp, InsertParagraphSeparatorCommand, and htmlediting.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52644

        This is a cleanup to stop instantiating legacy editing positions in the following tests.
        firstDeepEditingPositionForNode and lastDeepEditingPositionForNode in htmlediting.h are not updated
        because doing so requires significant code changes. They are tracked on the bug 52642.

        * editing/DeleteSelectionCommand.cpp:
        (WebCore::DeleteSelectionCommand::initializeStartEnd):
        (WebCore::updatePositionForNodeRemoval):
        (WebCore::DeleteSelectionCommand::removeNode):
        (WebCore::updatePositionForTextRemoval):
        (WebCore::DeleteSelectionCommand::handleGeneralDelete):
        * editing/IndentOutdentCommand.cpp:
        (WebCore::IndentOutdentCommand::outdentParagraph):
        * editing/InsertLineBreakCommand.cpp:
        (WebCore::InsertLineBreakCommand::doApply):
        * editing/InsertListCommand.cpp:
        (WebCore::InsertListCommand::doApplyForSingleParagraph):
        (WebCore::InsertListCommand::unlistifyParagraph):
        (WebCore::InsertListCommand::listifyParagraph):
        * editing/InsertParagraphSeparatorCommand.cpp:
        (WebCore::InsertParagraphSeparatorCommand::doApply):
        * editing/htmlediting.cpp:
        (WebCore::enclosingBlock):
        (WebCore::enclosingList):
        (WebCore::enclosingListChild):
        (WebCore::indexForVisiblePosition):
        (WebCore::isNodeVisiblyContainedWithin):
        (WebCore::avoidIntersectionWithNode):

2011-01-18  Benjamin Kalman  <kalman@chromium.org>

        Reviewed by Ryosuke Niwa.

        Tweak style in visible_units.cpp and TextIterator.cpp in preparation for another patch
        https://bugs.webkit.org/show_bug.cgi?id=52610

        This is a purely aesthetic change.

        * editing/TextIterator.cpp:
        (WebCore::SimplifiedBackwardsTextIterator::advance):
        * editing/visible_units.cpp:
        (WebCore::previousBoundary):

2011-01-18  Adam Klein  <adamk@chromium.org>

        Reviewed by Darin Fisher.

        [Chromium] Replace ChromiumBridge::widgetSetCursor with ChromeClient::setCursor
        https://bugs.webkit.org/show_bug.cgi?id=42236

        * platform/chromium/ChromiumBridge.h:
        * platform/chromium/WidgetChromium.cpp:
        (WebCore::Widget::setCursor):

2011-01-18  Chris Fleizach  <cfleizach@apple.com>

        Reviewed by Darin Adler.

        REGRESSION: A problem with Voiceover and finding links
        https://bugs.webkit.org/show_bug.cgi?id=52324

        Fallout from recent change to make WebCore return its own scroll view.
           1) There were two scroll views in the hierarchy, one which no needed to be ignored.
           2) Hit tests for sub frames needed to be offset.
           3) The check for whether an attachment is ignored must happen earlier than using
              the helpText to determine if an element should be ignored.

        Test: platform/mac/accessibility/iframe-with-title-correct-hierarchy.html

        * accessibility/AccessibilityObject.cpp:
        (WebCore::AccessibilityObject::elementAccessibilityHitTest):
        * accessibility/AccessibilityRenderObject.cpp:
        (WebCore::AccessibilityRenderObject::accessibilityIsIgnored):
        * accessibility/mac/AccessibilityObjectWrapper.mm:
        (-[AccessibilityObjectWrapper scrollViewParent]):

2011-01-18  Adam Roben  <aroben@apple.com>

        Call alternate CFHTTPCookie functions if available

        Fixes <http://webkit.org/b/52637> <rdar://problem/8878984>.

        Reviewed by Darin Adler.

        * platform/network/cf/CookieJarCFNet.cpp: Added soft-linking macros to
        pull in the alternate CFHTTPCookie functions.

        (WebCore::cookieDomain):
        (WebCore::cookieExpirationTime):
        (WebCore::cookieName):
        (WebCore::cookiePath):
        (WebCore::cookieValue):
        Added these wrappers around the CFHTTPCookie functions. We call the
        alternate functions if they exist, otherwise fall back to the current
        functions.

        (WebCore::filterCookies):
        (WebCore::getRawCookies):
        (WebCore::deleteCookie):
        Changed to use the wrapper functions.

2011-01-18  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Eric Seidel.

        [GTK] Filenames are converted to URLs during edit drags
        https://bugs.webkit.org/show_bug.cgi?id=52096

        * platform/gtk/DragDataGtk.cpp: Only advertise and deliver filenames as URLs if the
        conversion policy allows it.
        (WebCore::DragData::containsURL): Ditto.
        (WebCore::DragData::asURL): Ditto.

2011-01-18  Helder Correia  <helder@sencha.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Incorrect shadow alpha with semi-transparent solid fillStyle
        https://bugs.webkit.org/show_bug.cgi?id=52611

        This is related to bug 52559. The shadow color alpha must be multiplied
        by the context brush alpha.

        Test: fast/canvas/canvas-fillPath-alpha-shadow.html

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::fillPath):

2011-01-18  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: fail resource.requestContent() immediately for WebSocket resources
        https://bugs.webkit.org/show_bug.cgi?id=52628

        * English.lproj/localizedStrings.js: Rename WebSocket -> WebSockets in resource catetegories (rest are in plural, too)
        * inspector/front-end/ExtensionServer.js: Do not expose webInspector.resources.Types in extensions API (obsolete)
        (WebInspector.ExtensionServer.prototype._buildExtensionAPIInjectedScript):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource.Type.toUIString): Remove ResourceType.Media as it's not used.
        (WebInspector.Resource.Type.toString): ditto.
        (WebInspector.Resource.prototype.requestContent): Fail immediately for WebSocket resources.
        * inspector/front-end/inspector.js: Rename WebSocket -> WebSockets in resource catetegories (rest are in plural, too)

2011-01-18  Helder Correia  <helder@sencha.com>

        Reviewed by Dirk Schulze.

        REGRESSION(75139): SVG gradients are not applied to texts
        https://bugs.webkit.org/show_bug.cgi?id=52531

        r75139 caused a problem with filling and stroking text with a gradient
        fill in SVG. The order of CGContextConcatCTM and CGContextClipToRect
        was mixed up.

        Test: svg/css/text-gradient-shadow.svg

        * platform/graphics/cg/GraphicsContextCG.cpp:
        (WebCore::GraphicsContext::fillRect):

2011-01-18  Leo Yang  <leo.yang@torchmobile.com.cn>

        Reviewed by Nikolas Zimmermann.

        Unable to indirectly animate visibility of SVGUseElement
        https://bugs.webkit.org/show_bug.cgi?id=50240

        SVGUseElement::recalcStyle should take care of its shadow
        tree's style recalculation when it is called with change >= Inherit
        or when childNeedsStyleRecalc() is true because in these two
        cases needStyleRecalc() may not be true.

        Test: svg/custom/use-inherit-style.svg

        * svg/SVGUseElement.cpp:
        (WebCore::SVGUseElement::recalcStyle):

2011-01-18  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: provide script length to frontend.
        https://bugs.webkit.org/show_bug.cgi?id=52620

        * inspector/Inspector.idl:
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::didParseSource):
        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel.prototype._parsedScriptSource):
        (WebInspector.DebuggerDispatcher.prototype.parsedScriptSource):
        * inspector/front-end/Script.js:
        (WebInspector.Script):

2011-01-18  Zoltan Herczeg  <zherczeg@webkit.org>

        Rubber-stamped by Csaba Osztrogonác

        Fixing ChangeLog

        Removing a line introduced by
        http://trac.webkit.org/changeset/75743/trunk/Source/WebCore/ChangeLog
        Removing an unnecessary space before a time stamp.

2011-01-17  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [refactoring] use events to notify NetworkManager clients
        https://bugs.webkit.org/show_bug.cgi?id=52588

        * inspector/front-end/AuditLauncherView.js:
        (WebInspector.AuditLauncherView): Do not expose public interface to resource count. Do not reset resource count upon reset().
        (WebInspector.AuditLauncherView.prototype._resetResourceCount):
        (WebInspector.AuditLauncherView.prototype._onResourceStarted):
        (WebInspector.AuditLauncherView.prototype._onResourceFinished):
        * inspector/front-end/AuditsPanel.js: Do not expose public interface to resource start/finish events.
        * inspector/front-end/ExtensionServer.js:
        (WebInspector.ExtensionServer):
        (WebInspector.ExtensionServer.prototype._notifyResourceFinished):
        (WebInspector.ExtensionServer.prototype.initExtensions):
        * inspector/front-end/NetworkManager.js: Dispatch events rather than directly call clients.
        (WebInspector.NetworkManager):
        (WebInspector.NetworkManager.prototype.willSendRequest):
        (WebInspector.NetworkManager.prototype.markResourceAsCached):
        (WebInspector.NetworkManager.prototype.didReceiveResponse):
        (WebInspector.NetworkManager.prototype.didReceiveContentLength):
        (WebInspector.NetworkManager.prototype.setInitialContent):
        (WebInspector.NetworkManager.prototype.didCommitLoadForFrame):
        (WebInspector.NetworkManager.prototype.willSendWebSocketHandshakeRequest):
        (WebInspector.NetworkManager.prototype.didReceiveWebSocketHandshakeResponse):
        (WebInspector.NetworkManager.prototype._startResource):
        (WebInspector.NetworkManager.prototype._finishResource):
        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkPanel):
        (WebInspector.NetworkPanel.prototype._onResourceStarted):
        (WebInspector.NetworkPanel.prototype._appendResource):
        (WebInspector.NetworkPanel.prototype._onResourceUpdated):
        (WebInspector.NetworkPanel.prototype._refreshResource):
        (WebInspector.NetworkPanel.prototype._onMainResourceChanged):
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel):
        (WebInspector.ResourcesPanel.prototype._refreshResource):

2011-01-18  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: preserve pause on exception state in settings.
        https://bugs.webkit.org/show_bug.cgi?id=52619

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::getInspectorState):
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::setPauseOnExceptionsState):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel):
        (WebInspector.ScriptsPanel.prototype.debuggerWasEnabled):
        (WebInspector.ScriptsPanel.prototype._updatePauseOnExceptionsState):
        (WebInspector.ScriptsPanel.prototype._togglePauseOnExceptions):
        (WebInspector.ScriptsPanel.prototype._setPauseOnExceptions):
        * inspector/front-end/Settings.js:
        (WebInspector.Settings):
        * inspector/front-end/inspector.js:
        (WebInspector.doLoadedDone.populateInspectorState):

2011-01-18  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [REGRESSION] JavaScript exceptions aren't shown in source frame.
        https://bugs.webkit.org/show_bug.cgi?id=52623

        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleMessage):
        (WebInspector.ConsoleMessage.prototype._formatMessage):

2011-01-18  Pavel Feldman  <pfeldman@chromium.org>

        Revert r76017. No need to guard InspectorInstrumentation:: in WebCore.

        * page/Page.cpp:
        (WebCore::networkStateChanged):

2011-01-18  Konstantin Tokarev  <annulen@yandex.ru>

        Reviewed by Kent Tamura.

        Fixed compilation when Inspector is disabled
        https://bugs.webkit.org/show_bug.cgi?id=52564

        * page/Page.cpp:
        (WebCore::networkStateChanged): Added ENABLE(INSPECTOR) guard

2011-01-18  MORITA Hajime  <morrita@google.com>

        Unreviewed, rolling out r76004, r76005, r76007, and r76011.
        http://trac.webkit.org/changeset/76004
        http://trac.webkit.org/changeset/76005
        http://trac.webkit.org/changeset/76007
        http://trac.webkit.org/changeset/76011
        https://bugs.webkit.org/show_bug.cgi?id=51664

        The r76004 broke pixel tests.
        (The failure was missed due to the tolerance.)

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * platform/graphics/GraphicsContext.cpp:
        (WebCore::GraphicsContext::addRoundedRectClip):
        (WebCore::GraphicsContext::clipOutRoundedRect):
        * platform/graphics/GraphicsContext.h:
        * platform/graphics/RoundedIntRect.cpp: Removed.
        * platform/graphics/RoundedIntRect.h: Removed.
        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::pushContentsClip):
        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
        (WebCore::RenderBoxModelObject::paintBorder):
        (WebCore::RenderBoxModelObject::clipBorderSidePolygon):
        (WebCore::uniformlyExpandBorderRadii):
        (WebCore::RenderBoxModelObject::paintBoxShadow):
        * rendering/RenderBoxModelObject.h:
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::drawBoxSideFromPath):
        * rendering/RenderReplaced.cpp:
        (WebCore::RenderReplaced::paint):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        * rendering/RenderThemeMac.mm:
        (WebCore::RenderThemeMac::paintMenuListButtonGradients):
        (WebCore::RenderThemeMac::paintSliderTrack):
        * rendering/RenderThemeSafari.cpp:
        (WebCore::RenderThemeSafari::paintMenuListButtonGradients):
        (WebCore::RenderThemeSafari::paintSliderTrack):
        * rendering/RenderThemeWinCE.cpp:
        (WebCore::RenderThemeWinCE::paintSearchFieldCancelButton):
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::paint):
        * rendering/style/BorderData.h:
        * rendering/style/RenderStyle.cpp:
        (WebCore::constrainCornerRadiiForRect):
        (WebCore::RenderStyle::getBorderRadiiForRect):
        (WebCore::RenderStyle::getInnerBorderRadiiForRectWithBorderWidths):
        * rendering/style/RenderStyle.h:

2011-01-17  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: add source column field to debugger call frames.
        https://bugs.webkit.org/show_bug.cgi?id=52443

        * bindings/js/JavaScriptCallFrame.cpp:
        (WebCore::JavaScriptCallFrame::JavaScriptCallFrame):
        * bindings/js/JavaScriptCallFrame.h:
        (WebCore::JavaScriptCallFrame::create):
        (WebCore::JavaScriptCallFrame::line):
        (WebCore::JavaScriptCallFrame::column):
        (WebCore::JavaScriptCallFrame::update):
        * bindings/js/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::createCallFrameAndPauseIfNeeded):
        (WebCore::ScriptDebugServer::updateCallFrameAndPauseIfNeeded):
        (WebCore::ScriptDebugServer::callEvent):
        (WebCore::ScriptDebugServer::atStatement):
        (WebCore::ScriptDebugServer::returnEvent):
        (WebCore::ScriptDebugServer::exception):
        (WebCore::ScriptDebugServer::willExecuteProgram):
        (WebCore::ScriptDebugServer::didExecuteProgram):
        (WebCore::ScriptDebugServer::didReachBreakpoint):
        * bindings/js/ScriptDebugServer.h:
        * bindings/v8/DebuggerScript.js:
        ():
        * bindings/v8/JavaScriptCallFrame.cpp:
        (WebCore::JavaScriptCallFrame::column):
        * bindings/v8/JavaScriptCallFrame.h:
        * inspector/InjectedScriptSource.js:
        ():
        * inspector/JavaScriptCallFrame.idl:

2011-01-18  Antti Koivisto  <antti@apple.com>

        Reviewed by Dave Hyatt.

        https://bugs.webkit.org/show_bug.cgi?id=52370
        <rdar://problem/8856808>
        Style sharing optimization no longer works on major web sites
        
        The code in CSSStyleSelector::locateSharedStyle() that tries to share style information between element has been defeated 
        by widespread use of certain CSS selectors (:first-child pseudo class and similar). The current implementation disables
        the sharing optimization for the whole page if one of these constructs is seen in any style sheet used by the page.  
        
        This patch gets the style sharing back to 25-40% range on most web sites.

        * css/CSSMutableStyleDeclaration.h:
        (WebCore::CSSMutableStyleDeclaration::propertiesEqual):
            
            Needed to improve equality checking in NamedNodeMap::mappedMapsEquivalent.
        
        * css/CSSSelector.h:
        (WebCore::CSSSelector::isSiblingSelector):
        
            Test for selectors that are affected by the sibling elements.
        
        * css/CSSStyleSelector.cpp:
        (WebCore::elementCanUseSimpleDefaultStyle):
        (WebCore::collectSiblingRulesInDefaultStyle):
        (WebCore::assertNoSiblingRulesInDefaultStyle):
            
            Extract sibling rules from the MathML default stylesheet. 
            Assert that no other default stylesheet has them.
            
        (WebCore::CSSStyleSelector::CSSStyleSelector):
        (WebCore::CSSStyleSelector::locateCousinList):
        (WebCore::CSSStyleSelector::matchesSiblingRules):
        (WebCore::CSSStyleSelector::canShareStyleWithElement):
        (WebCore::CSSStyleSelector::locateSharedStyle):
        (WebCore::CSSStyleSelector::styleForElement):
        (WebCore::collectIdsAndSiblingRulesFromList):
        (WebCore::CSSRuleSet::collectIdsAndSiblingRules):

            Track sibling rules and ids used in the stylesheets to allow much more fine-grained rejection of cases
            where style sharing can't be used.

        * css/CSSStyleSelector.h:
        * dom/NamedNodeMap.cpp:
        (WebCore::NamedNodeMap::mappedMapsEquivalent):
            
            Check also for CSSValue mutation from DOM. 
            
        * mathml/MathMLMathElement.cpp:
        (WebCore::MathMLMathElement::insertedIntoDocument):
        * mathml/MathMLMathElement.h:
        
            MathML default style sheet has sibling rules which don't get noticed by the normal document
            stylesheet parsing.
        
        * rendering/style/RenderStyle.h:
        (WebCore::InheritedFlags::setFirstChildState):
        (WebCore::InheritedFlags::setLastChildState):
        (WebCore::InheritedFlags::setChildIndex):
        
            These all make style non-shareable (unique).

2011-01-18  MORITA Hajime  <morrita@google.com>

        Unreviewed crash fix on release builds.

        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintFillLayerExtended):

2011-01-18  Pavel Podivilov  <podivilov@chromium.org>

        Unreviewed, update localizedStrings.js.

        * English.lproj/localizedStrings.js:

2011-01-11  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: implement script beautifier prototype.
        https://bugs.webkit.org/show_bug.cgi?id=51588

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * inspector/front-end/ScriptFormatter.js: Added.
        (WebInspector.ScriptFormatter): Implements JavaScript source beautification and conversion between original and
        formatted line numbers
        (WebInspector.ScriptFormatter.findLineEndings):
        (WebInspector.ScriptFormatter.locationToPosition):
        (WebInspector.ScriptFormatter.positionToLocation):
        (WebInspector.ScriptFormatter.upperBound):
        (WebInspector.ScriptFormatter.prototype.format):
        (WebInspector.ScriptFormatter.prototype.originalLineNumberToFormattedLineNumber):
        (WebInspector.ScriptFormatter.prototype.formattedLineNumberToOriginalLineNumber):
        (WebInspector.ScriptFormatter.prototype.originalPositionToFormattedLineNumber):
        (WebInspector.ScriptFormatter.prototype.formattedLineNumberToOriginalPosition):
        (WebInspector.ScriptFormatter.prototype._convertPosition):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel):
        (WebInspector.ScriptsPanel.prototype._clearCurrentExecutionLine):
        (WebInspector.ScriptsPanel.prototype._callFrameSelected):
        (WebInspector.ScriptsPanel.prototype._formatScript):
        * inspector/front-end/SourceFrame.js: Convert original line numbers to UI line numbers and vice versa
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/inspector.html:

2011-01-18  Philippe Normand  <pnormand@igalia.com>

        Unreviewed, GTK build fix as follow-up of r76004.

        * GNUmakefile.am: Include RoundedIntRect files in the build

2011-01-18  Philippe Normand  <pnormand@igalia.com>

        Unreviewed, rolling out r76002.
        http://trac.webkit.org/changeset/76002
        https://bugs.webkit.org/show_bug.cgi?id=49790

        breaks a bunch of fast/forms tests on mac and GTK

        * html/HTMLOptionElement.cpp:
        (WebCore::HTMLOptionElement::setRenderStyle):

2011-01-18 MORITA Hajime <morrita@google.com>

        Unreviewed windows build fix.

        * WebCore.vcproj/WebCore.vcproj:

2011-01-17  MORITA Hajime  <morrita@google.com>

        Reviewed by Simon Fraser.

        Refactoring: Extract RoundedIntRect class
        https://bugs.webkit.org/show_bug.cgi?id=51664

        RoundedIntRect is a pair of rect and four IntSize objects which represent
        corner radii of the rectangle. IntSize is grouped into RoundedIntRect::Radii.
        Now RenderStyle::getRoundedBorderFor() and RenderStyle::getRoundedInnerBorderWithBorderWidths()
        return RoundedIntRect and GraphicsContext::addRoundedRectClip(), GraphicsContext::fillRoundedRect()
        and other functions accept RoundedIntRect as an argument.

        No new tests. No behavioral change.

        * Android.mk:
        * CMakeLists.txt:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.xcodeproj/project.pbxproj:
        * platform/graphics/GraphicsContext.cpp:
        (WebCore::GraphicsContext::addRoundedRectClip):
        (WebCore::GraphicsContext::clipOutRoundedRect):
        (WebCore::GraphicsContext::fillRoundedRect):
        * platform/graphics/GraphicsContext.h:
        * platform/graphics/RoundedIntRect.cpp: Added.
        (WebCore::RoundedIntRect::Radii::isZero):
        (WebCore::RoundedIntRect::Radii::scale):
        (WebCore::RoundedIntRect::Radii::expand):
        (WebCore::RoundedIntRect::Radii::includeLogicalEdges):
        (WebCore::RoundedIntRect::Radii::excludeLogicalEdges):
        (WebCore::RoundedIntRect::RoundedIntRect):
        (WebCore::RoundedIntRect::includeLogicalEdges):
        (WebCore::RoundedIntRect::excludeLogicalEdges):
        * platform/graphics/RoundedIntRect.h: Added.
        (WebCore::RoundedIntRect::Radii::Radii):
        (WebCore::RoundedIntRect::Radii::setTopLeft):
        (WebCore::RoundedIntRect::Radii::setTopRight):
        (WebCore::RoundedIntRect::Radii::setBottomLeft):
        (WebCore::RoundedIntRect::Radii::setBottomRight):
        (WebCore::RoundedIntRect::Radii::topLeft):
        (WebCore::RoundedIntRect::Radii::topRight):
        (WebCore::RoundedIntRect::Radii::bottomLeft):
        (WebCore::RoundedIntRect::Radii::bottomRight):
        (WebCore::RoundedIntRect::Radii::expand):
        (WebCore::RoundedIntRect::Radii::shrink):
        (WebCore::RoundedIntRect::location):
        (WebCore::RoundedIntRect::size):
        (WebCore::RoundedIntRect::x):
        (WebCore::RoundedIntRect::y):
        (WebCore::RoundedIntRect::width):
        (WebCore::RoundedIntRect::height):
        (WebCore::RoundedIntRect::right):
        (WebCore::RoundedIntRect::bottom):
        (WebCore::RoundedIntRect::rect):
        (WebCore::RoundedIntRect::radii):
        (WebCore::RoundedIntRect::isRounded):
        (WebCore::RoundedIntRect::isEmpty):
        (WebCore::RoundedIntRect::setRect):
        (WebCore::RoundedIntRect::setRadii):
        (WebCore::RoundedIntRect::move):
        (WebCore::RoundedIntRect::inflate):
        (WebCore::RoundedIntRect::inflateWithRadii):
        (WebCore::RoundedIntRect::expandRadii):
        (WebCore::RoundedIntRect::shrinkRadii):
        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::pushContentsClip):
        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
        (WebCore::RenderBoxModelObject::paintBorder):
        (WebCore::RenderBoxModelObject::clipBorderSidePolygon):
        (WebCore::RenderBoxModelObject::paintBoxShadow):
        * rendering/RenderBoxModelObject.h:
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::drawBoxSideFromPath):
        * rendering/RenderReplaced.cpp:
        (WebCore::RenderReplaced::paint):
        * rendering/RenderThemeChromiumWin.cpp:
        (WebCore::RenderThemeChromiumWin::paintTextFieldInternal):
        * rendering/RenderThemeMac.mm:
        (WebCore::RenderThemeMac::paintMenuListButtonGradients):
        (WebCore::RenderThemeMac::paintSliderTrack):
        * rendering/RenderThemeSafari.cpp:
        (WebCore::RenderThemeSafari::paintMenuListButtonGradients):
        (WebCore::RenderThemeSafari::paintSliderTrack):
        * rendering/RenderThemeWinCE.cpp:
        (WebCore::RenderThemeWinCE::paintSearchFieldCancelButton):
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::paint):
        * rendering/style/BorderData.h:
        * rendering/style/RenderStyle.cpp:
        (WebCore::calcRadiiFor):
        (WebCore::calcConstraintScaleFor):
        (WebCore::RenderStyle::getRoundedBorderFor):
        (WebCore::RenderStyle::getRoundedInnerBorderWithBorderWidths):
        * rendering/style/RenderStyle.h:
        (WebCore::InheritedFlags::setBorderRadius):

2011-01-17  Rob Buis  <rwlbuis@gmail.com>

        Reviewed by Kent Tamura.

        Color changes to option elements in a select multiple aren't drawn immediately
        https://bugs.webkit.org/show_bug.cgi?id=49790

        Redirect style changes on <option> element to the owner <select> element.

        Tests: fast/forms/select-option-background-color-change.html
               fast/forms/select-option-color-change.html
               fast/forms/select-option-visibility-change.html

        * html/HTMLOptionElement.cpp:
        (WebCore::HTMLOptionElement::setRenderStyle):

2011-01-17  MORITA Hajime  <morrita@google.com>

        Unreviewed, rolling out r75995.
        http://trac.webkit.org/changeset/75995
        https://bugs.webkit.org/show_bug.cgi?id=51914

        Causes assertion failures.

        * dom/Element.cpp:
        (WebCore::Element::shadowRoot):
        (WebCore::Element::setShadowRoot):
        (WebCore::Element::removeShadowRoot):
        * dom/ElementRareData.h:
        (WebCore::ElementRareData::ElementRareData):

2011-01-17  MORITA Hajime  <morrita@google.com>

        Unreviewed, rolling out r75999.
        http://trac.webkit.org/changeset/75999

        * dom/Element.cpp:
        (WebCore::Element::removeShadowRoot):

2011-01-17 MORITA Hajime  <morrita@google.com>

        Unreviewed crash fix, which introduced at r75995

        * dom/Element.cpp:
        (WebCore::Element::removeShadowRoot):

2011-01-17  MORITA Hajime  <morrita@google.com>

        Reviewed by Dimitri Glazkov.

        ElementRareData::m_shadowRoot should not be RefPtr.
        https://bugs.webkit.org/show_bug.cgi?id=51914

        This change makes m_shadowRoot a raw pointer, as Node::m_parent is.
        This change is safe because shadow host pointer is stored as TreeShared::m_parent
        which prevents deletion unless set to null.
        
        No test, no behavioral change.

        * dom/Element.cpp:
        (WebCore::Element::shadowRoot):
        (WebCore::Element::setShadowRoot):
        (WebCore::Element::removeShadowRoot):
        * dom/ElementRareData.h:
        (WebCore::ElementRareData::ElementRareData):

2011-01-17  Maciej Stachowiak  <mjs@apple.com>

        Reviewed by Dan Bernstein.

        Some WebKit2 layout tests crash due to focus being on a frame in the page cache
        https://bugs.webkit.org/show_bug.cgi?id=52607

        No new tests. Existing tests crash in WebKit2 without this fix.
        
        I suspect there are other consequences besides the WebKit2 crash, but I
        was unable to identify any for certain.

        * history/CachedFrame.cpp:
        (WebCore::CachedFrame::CachedFrame): If a frame still has focus when its page
        goes in the page cache, reset focus to the main frame.

2011-01-17  Adam Roben  <aroben@apple.com>

        Simplify WKCACFLayerRenderer's API

        createRenderer/destroyRenderer are now hidden behind setHostWindow.
        WKCACFLayerRendererClient::animationsStarted has been removed, as it
        was never called. (The work it was supposed to do was already being
        accomplished by WKCACFLayerRenderer::render telling each layer that
        animations are starting.)

        Fixes <http://webkit.org/b/52587> WKCACFLayerRenderer is hard to use

        Reviewed by Chris Marrin.

        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
        (WebCore::MediaPlayerPrivateFullscreenWindow::createWindow): Moved the
        call to setHostWindow here from the WM_CREATE handler. The WM_CREATE
        handler was causing the Direct3D device to be created, but MSDN says
        you shouldn't create a device while handling WM_CREATE. Removed
        no-longer-needed call to createRenderer (setHostWindow does this now)
        and the never-needed call to setNeedsDisplay (we never draw into the
        root layer; this was just creating an unnecessary backing store the
        size of the screen!).
        (WebCore::MediaPlayerPrivateFullscreenWindow::wndProc): Moved WM_CREATE
        code, as described above. Removed call to destroyRenderer when handling
        WM_DESTROY; setHostWindow does this now. Fixed up our WM_PAINT handler
        to do a synchronous paint and to clear our dirty region, while I was in
        here.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::~WKCACFLayerRenderer): Changed to call
        setHostWindow instead of destroyRenderer; the former calls the latter
        if needed.
        (WebCore::WKCACFLayerRenderer::setHostWindow): Moved here from the
        header file. Destroys our old renderer (i.e., IDirect3DDevice9) if
        we're losing our window, or creates a renderer if we're gaining a
        window.
        (WebCore::WKCACFLayerRenderer::createRenderer): Updated for WKSI function rename.
        (WebCore::WKCACFLayerRenderer::destroyRenderer): Changed to clear the
        D3D device from our context before releasing the device.

        * platform/graphics/win/WKCACFLayerRenderer.h: Removed
        WKCACFLayerRendererClient::animationsStarted. Removed setNeedsDisplay.
        Make createRenderer, destroyRenderer, and renderSoon private.

2011-01-17  Adam Roben  <aroben@apple.com>

        Remove special-cased support for providing content for the root layer

        Clients will just have to provide content through the normal
        GraphicsLayer channels now!

        Support for <http://webkit.org/b/52582> WebView should paint directly
        into a GraphicsLayer when in accelerated compositing mode

        Reviewed by Simon Fraser and Chris Marrin.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::WKCACFLayerRenderer): Removed
        initialization of m_backingStoreDirty, which has itself been removed.
        (WebCore::WKCACFLayerRenderer::setNeedsDisplay): Moved code to schedule
        a sync from here to syncCompositingStateSoon. We only need to call
        renderSoon if we don't call syncCompositingStateSoon; the latter
        function calls the former.
        (WebCore::WKCACFLayerRenderer::paint): Removed code to handle
        m_backingStoreDirty. We don't want to know anything about clients'
        backing stores.
        (WebCore::WKCACFLayerRenderer::syncCompositingStateSoon): Added. Code
        came from setNeedsDisplay.

        * platform/graphics/win/WKCACFLayerRenderer.h:
        Removed setRootContents[AndDisplay], setBackingStoreDirty, and
        m_backingStoreDirty. Made paint() public so that clients can force a
        synchronous render (e.g., when handling WM_PAINT).

2011-01-17  Adam Roben  <aroben@apple.com>

        Remove contexts from WKCACFContextFlusher before destroying them

        We aren't really using WKCACFContextFlusher for anything useful at the
        moment, but that will probably change in the near future.

        I couldn't come up with a way to test this because it isn't possible to
        resize a window in DumpRenderTree.

        Fixes <http://webkit.org/b/52573> REGRESSION (r75262): Crash beneath
        WKCACFContextFlusher::flushAllContexts when resizing window on page
        that uses accelerated compositing

        Reviewed by Simon Fraser.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::~WKCACFLayerRenderer): Remove our
        context from WKCACFContextFlusher. (This code was erroneously removed
        from WKCACFLayerRenderer::destroyRenderer in r75262. This is a more
        sensible place for it.)

2011-01-17  Adam Roben  <aroben@apple.com>

        Don't access the CACFLayerRef's sublayers directly from PlatformCALayer

        There might be a secret extra sublayer (the tile parent layer) that
        PlatformCALayer doesn't know about. When PlatformCALayer would
        encounter this, it would try to use the tile parent layer's
        PlatformCALayer wrapper, which was null, and then would crash. We now
        ask PlatformCALayerWinInternal for the sublayer list, since that class
        knows about the tile parent layer and can exclude it from the sublayer
        list.

        Covered by compositing/tiling/huge-layer-resize.html.

        Fixes <http://webkit.org/b/52597> Crash beneath
        PlatformCALayer::adoptSublayers when switching out of tiling mode
        (null-dereference of a PlatformCALayer)

        Reviewed by Darin Adler and Chris Marrin.

        * platform/graphics/ca/win/PlatformCALayerWin.cpp:
        (PlatformCALayer::adoptSublayers):
        (printLayer):
        Changed to use PlatformCALayerWinInternal::getSublayers.

        * platform/graphics/ca/win/PlatformCALayerWinInternal.cpp:
        (PlatformCALayerWinInternal::getSublayers): Added. Retrieves the list
        of PlatformCALayers that represent our sublayers. Significantly, this
        code knows about the tile parent layer and can thus exclude it.

        * platform/graphics/ca/win/PlatformCALayerWinInternal.h: Added
        getSublayers.

2011-01-17  Naoki Takano  <takano.naoki@gmail.com>

        Reviewed by Kent Tamura.

        [Chromium] Fix popup menu re-positioning when the menu is opened upward, above the corresponding form field.
        https://bugs.webkit.org/show_bug.cgi?id=51382
        http://crbug.com/60427

        Calculate correct location of popup window whenever the items in the window change.

        No new tests, because this fix is for Chromium project and hard to test only in WebKit project

        * platform/chromium/PopupMenuChromium.cpp:
        (WebCore::PopupContainer::layoutAndCalculateWidgetRect): New Function to layout and calculate popup widget rect.
        (WebCore::PopupContainer::showPopup): Move widgetRect calculation logic to calculateWidgetRect().
        (WebCore::PopupContainer::refresh): Add parameter focusRect to take the location and the size of focus text input field to calculate correct popup window location.
        * platform/chromium/PopupMenuChromium.h: Append new input parameter for refresh().

2011-01-17  Mark Rowe  <mrowe@apple.com>

        Fix the 32-bit build.

        * WebCore.exp.in:

2011-01-17  Dan Bernstein  <mitz@apple.com>

        Reviewed by Darin Adler.

        Use of invalid hash map key in CSSFontFaceSource::getFontData() with 0-sized remote font
        https://bugs.webkit.org/show_bug.cgi?id=52598

        Test: fast/css/font-face-zero-hash-key.html

        * css/CSSFontFaceSource.cpp:
        (WebCore::CSSFontFaceSource::getFontData): Add 1 to the font size to avoid a 0 hash key.
        * css/CSSSegmentedFontFace.cpp:
        (WebCore::CSSSegmentedFontFace::getFontData): Ditto.

2011-01-17  David Kilzer  <ddkilzer@apple.com>

        <http://webkit.org/b/52596> Add missing DOMDocument/DOMDocumentFragment headers to Xcode project

        Reviewed by Dan Bernstein.

        This fixes two issues:

        Add missing DOMDocumentFragmentPrivate.h and
        DOMDocumentPrivate.h files to the project.  These files were
        never added to the the project although their *Internal.h
        counterparts were added in r16548 and r17390.

        Add missing DOMDocumentFragmentInternal.h to the Headers
        section.  It was moved from Headers to "Copy Generated Headers"
        in r31045, but it should have an entry in both sections.

        * WebCore.xcodeproj/project.pbxproj:

2011-01-17  Helder Correia  <helder@sencha.com>

        Reviewed by Andreas Kling.

        [Qt] Incorrect shadow alpha with pattern fillStyle
        https://bugs.webkit.org/show_bug.cgi?id=52559

        The shadow color opacity needs to be set on the shadow painter.
        This is related to bug 52556.

        Test: fast/canvas/canvas-fillPath-pattern-shadow.html

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::fillPath):

2011-01-17  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Andreas Kling.

        [GTK] Port a crash fix from libsoup upstream to the libsoup cache code
        https://bugs.webkit.org/show_bug.cgi?id=52586

        No new tests. This is just a merge from upstream.

        * platform/network/soup/cache/soup-http-input-stream.c:
        (webkit_soup_http_input_stream_got_chunk): Properly handle unsigned numbers.

2011-01-17  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Alexey Proskuryakov.

        Fix some headers with missing or misspelled #ifndef guards
        https://bugs.webkit.org/show_bug.cgi?id=52545

        No new tests because no new functionality.

        * ForwardingHeaders/runtime/InitializeThreading.h:
        * editing/SmartReplace.h:
        * loader/CrossOriginAccessControl.h:
        * loader/NetscapePlugInStreamLoader.h:
        * platform/chromium/ClipboardUtilitiesChromium.h:
        * platform/graphics/cairo/DrawErrorUnderline.h:
        * platform/graphics/cairo/GraphicsContextPlatformPrivateCairo.h:
        * platform/graphics/cg/GraphicsContextPlatformPrivateCG.h:
        * platform/graphics/cg/PDFDocumentImage.h:
        * platform/win/WebCoreTextRenderer.h:

2011-01-17  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: follow-up fix for r52574: do not reuse clear() for navigation.

        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkPanel.prototype.clear):
        (WebInspector.NetworkPanel.prototype.mainResourceChanged):

2011-01-17  Sergio Villar Senin  <svillar@igalia.com>

        Reviewed by Martin Robinson.

        [Gtk] No need to content sniff 304 Not Modified responses
        https://bugs.webkit.org/show_bug.cgi?id=52570

        Makes no sense to wait for the outcome of content sniffing when WebCore
        is validating resources. If we get a 304 Not Modified it means that we can
        safely use the cached version of the resource we're asking for.

        No new tests because it does not change functionality, it just
        calls didReceiveResponse sooner for 304 Not Modified responses.

        * platform/network/soup/ResourceHandleSoup.cpp:
        (WebCore::gotHeadersCallback):

2011-01-17  Jessie Berlin  <jberlin@apple.com>

        Reviewed by Anders Carlsson.

        REGRESSION: Assertion failure in FrameLoader::continueLoadAfterWillSubmitForm() when
        navigating back to an unreachable URL
        https://bugs.webkit.org/show_bug.cgi?id=52388

        Test: http/tests/navigation/go-back-to-error-page.html

        * history/PageCache.cpp:
        (WebCore::PageCache::canCachePageContainingThisFrame):
        Do not cache any error pages (which we can recognize as having substitute data and/or an
        unreachableURL).

2011-01-17  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: fixing typo in r75952.

        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkDataGridNode.prototype._refreshNameCell):

2011-01-17  Enrica Casucci  <enrica@apple.com>

        Reviewed by Alexey Proskuryakov.

        Drag and drop support: refactoring of image from link and image from selection
        https://bugs.webkit.org/show_bug.cgi?id=52496

        This work cleans up the Mac code and makes it more similar to the Windows implementation,
        avoiding the use of an NSView when the FrameView can be used.
        The refactoring is a necessary step towards the complete support of drag and drop
        in WebKit2.
        
        * page/mac/FrameMac.mm:
        (WebCore::Frame::imageFromRect): Modified to use FrameView instead of NSView
        to generate the image for drag.

2011-01-17  Dan Bernstein  <mitz@apple.com>

        Rubber-stamped by Mark Rowe.

        Update xcodeproj svn:ignore to include xcuserdata.

        * WebCore.xcodeproj: Modified property svn:ignore.
        * manual-tests/NPN_Invoke/NPN_Invoke.xcodeproj: Modified property svn:ignore.

2011-01-17  Alexey Proskuryakov  <ap@apple.com>

        Leopard build fix.

        * page/PrintContext.cpp: GCC complained about shortening a double value to float.

2011-01-17  Alexey Proskuryakov  <ap@apple.com>

        Reviewed by Dan Bernstein.

        https://bugs.webkit.org/show_bug.cgi?id=52495

        No change in behavior, so no tests.

        * WebCore.exp.in: Export additional methods, as I'm going to use more code from PrintContext.

        * page/PrintContext.cpp:
        (WebCore::PrintContext::~PrintContext): No need to clear m_pageRects, the object is being
        destroyed already.
        (WebCore::PrintContext::pageCount): Changed page count from int to size_t.
        (WebCore::PrintContext::pageRect): Ditto.
        (WebCore::PrintContext::computePageRects): Pass allowHorizontalTiling as an argument.
        PrintContext already has code to calculate scale factor, so it makes sense to make methods
        that contain it universal (allowHorizontalTiling is always true for Safari).
        Round page height to an integer, because Mac code does that, and because page height is
        treated as integer almost everywhere else in code.
        (WebCore::PrintContext::begin): Allow calling this function multiple times. There is no need
        to return to screen mode if e.g. "print backgounds" option changes.
        (WebCore::PrintContext::computeAutomaticScaleFactor): Expose scale factor computation, so
        that clients don't have to copy it.
        (WebCore::PrintContext::spoolRect): Add a way to spool a precomputed rect - handy if a request
        comes from code that doesn't have page number.
        (WebCore::PrintContext::pageNumberForElement): Page number int -> size_t.

        * page/PrintContext.h: Added comments and FIXMEs. PrintContext needs cleanup, but that
        depends on deciding how it really needs to work (e.g. whether computePageRects() should
        cause relayout).

2011-01-17  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: unify image data source assignment, add image url
        to the image view properties list.
        https://bugs.webkit.org/show_bug.cgi?id=52584

        * English.lproj/localizedStrings.js:
        * inspector/front-end/ImageView.js:
        (WebInspector.ImageView.prototype._createContentIfNeeded.onImageLoad):
        (WebInspector.ImageView.prototype._createContentIfNeeded):
        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkDataGridNode.prototype._refreshNameCell):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource.prototype.populateImageSource):
        (WebInspector.Resource.prototype._contentURL):
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.FrameResourceTreeElement.prototype.onattach):

2011-01-17  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Extensions API] webInspector.resources.onFinished is not fired for redirected resources
        Make resource start/finish hanlding more consistent.
        https://bugs.webkit.org/show_bug.cgi?id=52452

        * inspector/front-end/AuditLauncherView.js: Ignore WebSocket resources when displaying progress indicator
        (WebInspector.AuditLauncherView.prototype._resetResourceCount):
        (WebInspector.AuditLauncherView.prototype.resourceStarted):
        (WebInspector.AuditLauncherView.prototype.resourceFinished):
        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager): Factor out resource start/finish logic to _startResource()/_finishResource()
        (WebInspector.NetworkManager.prototype.identifierForInitialRequest):
        (WebInspector.NetworkManager.prototype.willSendRequest):
        (WebInspector.NetworkManager.prototype.markResourceAsCached):
        (WebInspector.NetworkManager.prototype.didReceiveResponse):
        (WebInspector.NetworkManager.prototype.didReceiveContentLength):
        (WebInspector.NetworkManager.prototype.didFinishLoading):
        (WebInspector.NetworkManager.prototype.didFailLoading):
        (WebInspector.NetworkManager.prototype.didLoadResourceFromMemoryCache):
        (WebInspector.NetworkManager.prototype.didCreateWebSocket):
        (WebInspector.NetworkManager.prototype.willSendWebSocketHandshakeRequest):
        (WebInspector.NetworkManager.prototype.didReceiveWebSocketHandshakeResponse):
        (WebInspector.NetworkManager.prototype.didCloseWebSocket):
        (WebInspector.NetworkManager.prototype._appendRedirect):
        (WebInspector.NetworkManager.prototype._startResource):
        (WebInspector.NetworkManager.prototype._finishResource):

2011-01-17  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: restore dom and network state upon frontend reuse.
        https://bugs.webkit.org/show_bug.cgi?id=52574

        * inspector/Inspector.idl:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreInspectorStateFromCookie):
        (WebCore::InspectorController::populateScriptObjects):
        (WebCore::InspectorController::pushDataCollectedOffline):
        (WebCore::InspectorController::didCommitLoad):
        * inspector/InspectorController.h:
        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager.prototype.reset):
        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkPanel.prototype.clear):
        (WebInspector.NetworkPanel.prototype.mainResourceChanged):
        * inspector/front-end/ResourceTreeModel.js:
        (WebInspector.ResourceTreeModel):
        (WebInspector.ResourceTreeModel.prototype.reloadCachedResources):
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel.prototype.clear):
        * inspector/front-end/inspector.js:
        (WebInspector.frontendReused):

2011-01-17  Csaba Osztrogonác  <ossy@webkit.org>

        Unreviewed buildfix after r75944.

        * WebCore.pro:

2011-01-17  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Andreas Kling.

        [Qt] Extend the Platform Plugin to support full screen video handler
        https://bugs.webkit.org/show_bug.cgi?id=51249

        Make MediaPlayerPrivateQt support a fullscreen player.

        No new tests because LayoutTests/media/media-fullscreen-inline.html already exists.
        However, this test failed for Qt (QtMediaPlayer) due to durationchange event getting fired twice.
        So, still skip it for Qt.

        * WebCore.pro:
        * features.pri:
        * platform/graphics/qt/MediaPlayerPrivateQt.cpp:
        (WebCore::MediaPlayerPrivateQt::MediaPlayerPrivateQt):
        (WebCore::MediaPlayerPrivateQt::removeVideoItem):
        (WebCore::MediaPlayerPrivateQt::restoreVideoItem):
        * platform/graphics/qt/MediaPlayerPrivateQt.h:
        (WebCore::MediaPlayerPrivateQt::supportsFullscreen):
        (WebCore::MediaPlayerPrivateQt::mediaPlayer):

2011-01-17  Anthony Ricaud  <rik@webkit.org>

        Reviewed by Kent Tamura.

        [HTML5] Revert display:none on datalist
        https://bugs.webkit.org/show_bug.cgi?id=52214

        * css/html.css:

2011-01-17  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: simplify debugger enabling routine.
        https://bugs.webkit.org/show_bug.cgi?id=52472

        * inspector/Inspector.idl:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreDebugger):
        (WebCore::InspectorController::showAndEnableDebugger):
        (WebCore::InspectorController::enableDebugger):
        * inspector/InspectorController.h:
        * inspector/front-end/DebuggerModel.js:
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.show):
        (WebInspector.ScriptsPanel.prototype._toggleDebugging):

2011-01-17  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: refactoring: encapsulate lazy initialization of SourceFrame.
        https://bugs.webkit.org/show_bug.cgi?id=51738

        Extract content loading logic from SourceView and ScriptView to ContentProvider implementations.
        Pass ContentProvider in SourceFrame constructor to allow SourceFrame manage it's lazy initialization.

        * inspector/front-end/ScriptView.js:
        (WebInspector.ScriptView):
        (WebInspector.SourceFrameContentProviderForScript):
        (WebInspector.SourceFrameContentProviderForScript.prototype.requestContent.didRequestSource):
        (WebInspector.SourceFrameContentProviderForScript.prototype.requestContent):
        (WebInspector.SourceFrameContentProviderForScript.prototype.scripts):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._addScript):
        (WebInspector.ScriptsPanel.prototype.sourceFrameForScript):
        (WebInspector.ScriptsPanel.prototype._sourceFrameForResource):
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame):
        (WebInspector.SourceFrame.prototype.set visible):
        (WebInspector.SourceFrame.prototype._createTextViewer):
        (WebInspector.SourceFrame.prototype._breakpointAdded):
        (WebInspector.SourceFrame.prototype._breakpoints):
        (WebInspector.SourceFrame.prototype._sourceIDForLine):
        (WebInspector.SourceFrame.prototype._sourceIDSet):
        (WebInspector.SourceFrameContentProvider):
        (WebInspector.SourceFrameContentProvider.prototype.requestContent):
        (WebInspector.SourceFrameContentProvider.prototype.scripts):
        * inspector/front-end/SourceView.js:
        (WebInspector.SourceView):
        (WebInspector.SourceView.prototype.show):
        (WebInspector.SourceView.prototype.resize):
        (WebInspector.SourceView.prototype.performSearch.didFindSearchMatches):
        (WebInspector.SourceView.prototype.performSearch):
        (WebInspector.SourceView.prototype.revealLine):
        (WebInspector.SourceView.prototype.highlightLine):
        (WebInspector.SourceView.prototype._jumpToSearchResult):
        (WebInspector.SourceFrameContentProviderForResource):
        (WebInspector.SourceFrameContentProviderForResource.prototype.requestContent):
        (WebInspector.SourceFrameContentProviderForResource.prototype.scripts):

2011-01-17  John Knottenbelt  <jknotten@chromium.org>

        Reviewed by Jeremy Orlow.

        GeolocationController should call stopUpdating on destruction
        https://bugs.webkit.org/show_bug.cgi?id=52216

        Test: fast/dom/Geolocation/window-close-crash.html

        * page/GeolocationController.cpp:
        (WebCore::GeolocationController::~GeolocationController):

2011-01-17  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: Qt build fix.

        * inspector/InspectorInstrumentation.h:

2011-01-16  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: make WebCore use InspectorInstrumentation
        for instrumentation calls.
        https://bugs.webkit.org/show_bug.cgi?id=52532

        This change makes WebCore classes issue instrumentation signals
        by means of InspectorInstrumentation interface. It covered migration
        for Document, FrameLoader, Database, DOMStorage, etc. It fixed
        instrumentation handling for Console as well. This all is a part
        of story described in the bug 52510.

        * dom/Document.cpp:
        (WebCore::Document::finishedParsing):
        * dom/Document.h:
        * dom/ScriptExecutionContext.h:
        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willModifyDOMAttr):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):
        * inspector/InspectorBrowserDebuggerAgent.h:
        (WebCore::InspectorBrowserDebuggerAgent::create):
        * inspector/InspectorConsoleAgent.cpp:
        (WebCore::InspectorConsoleAgent::stopTiming):
        (WebCore::InspectorConsoleAgent::count):
        * inspector/InspectorConsoleAgent.h:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::~InspectorController):
        (WebCore::InspectorController::handleMousePress):
        (WebCore::InspectorController::didClearWindowObjectInWorld):
        (WebCore::PostWorkerNotificationToFrontendTask::performTask):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorDOMStorageAgent.h:
        * inspector/InspectorDatabaseAgent.cpp:
        * inspector/InspectorDatabaseAgent.h:
        * inspector/InspectorFrontendHost.cpp:
        * inspector/InspectorFrontendHost.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::didClearWindowObjectInWorldImpl):
        (WebCore::InspectorInstrumentation::inspectedPageDestroyedImpl):
        (WebCore::InspectorInstrumentation::mouseDidMoveOverElementImpl):
        (WebCore::InspectorInstrumentation::handleMousePressImpl):
        (WebCore::InspectorInstrumentation::mainResourceFiredLoadEventImpl):
        (WebCore::InspectorInstrumentation::mainResourceFiredDOMContentEventImpl):
        (WebCore::InspectorInstrumentation::frameDetachedFromParentImpl):
        (WebCore::InspectorInstrumentation::didCommitLoadImpl):
        (WebCore::InspectorInstrumentation::addMessageToConsoleImpl):
        (WebCore::InspectorInstrumentation::consoleCountImpl):
        (WebCore::InspectorInstrumentation::startConsoleTimingImpl):
        (WebCore::InspectorInstrumentation::stopConsoleTimingImpl):
        (WebCore::InspectorInstrumentation::consoleMarkTimelineImpl):
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsoleImpl):
        (WebCore::InspectorInstrumentation::didOpenDatabaseImpl):
        (WebCore::InspectorInstrumentation::didUseDOMStorageImpl):
        (WebCore::InspectorInstrumentation::didCreateWorkerImpl):
        (WebCore::InspectorInstrumentation::didDestroyWorkerImpl):
        (WebCore::InspectorInstrumentation::didCreateWebSocketImpl):
        (WebCore::InspectorInstrumentation::willSendWebSocketHandshakeRequestImpl):
        (WebCore::InspectorInstrumentation::didReceiveWebSocketHandshakeResponseImpl):
        (WebCore::InspectorInstrumentation::didCloseWebSocketImpl):
        (WebCore::InspectorInstrumentation::networkStateChangedImpl):
        (WebCore::InspectorInstrumentation::updateApplicationCacheStatusImpl):
        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::inspectorControllerCreated):
        (WebCore::InspectorInstrumentation::inspectorControllerDeleted):
        (WebCore::InspectorInstrumentation::didClearWindowObjectInWorld):
        (WebCore::InspectorInstrumentation::inspectedPageDestroyed):
        (WebCore::InspectorInstrumentation::willInsertDOMNode):
        (WebCore::InspectorInstrumentation::didInsertDOMNode):
        (WebCore::InspectorInstrumentation::willRemoveDOMNode):
        (WebCore::InspectorInstrumentation::willModifyDOMAttr):
        (WebCore::InspectorInstrumentation::didModifyDOMAttr):
        (WebCore::InspectorInstrumentation::mouseDidMoveOverElement):
        (WebCore::InspectorInstrumentation::handleMousePress):
        (WebCore::InspectorInstrumentation::characterDataModified):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequest):
        (WebCore::InspectorInstrumentation::didScheduleResourceRequest):
        (WebCore::InspectorInstrumentation::didInstallTimer):
        (WebCore::InspectorInstrumentation::didRemoveTimer):
        (WebCore::InspectorInstrumentation::willCallFunction):
        (WebCore::InspectorInstrumentation::willChangeXHRReadyState):
        (WebCore::InspectorInstrumentation::willDispatchEvent):
        (WebCore::InspectorInstrumentation::willDispatchEventOnWindow):
        (WebCore::InspectorInstrumentation::willEvaluateScript):
        (WebCore::InspectorInstrumentation::willFireTimer):
        (WebCore::InspectorInstrumentation::willLayout):
        (WebCore::InspectorInstrumentation::willLoadXHR):
        (WebCore::InspectorInstrumentation::willPaint):
        (WebCore::InspectorInstrumentation::willRecalculateStyle):
        (WebCore::InspectorInstrumentation::identifierForInitialRequest):
        (WebCore::InspectorInstrumentation::willSendRequest):
        (WebCore::InspectorInstrumentation::markResourceAsCached):
        (WebCore::InspectorInstrumentation::didLoadResourceFromMemoryCache):
        (WebCore::InspectorInstrumentation::willReceiveResourceData):
        (WebCore::InspectorInstrumentation::willReceiveResourceResponse):
        (WebCore::InspectorInstrumentation::didReceiveContentLength):
        (WebCore::InspectorInstrumentation::didFinishLoading):
        (WebCore::InspectorInstrumentation::didFailLoading):
        (WebCore::InspectorInstrumentation::resourceRetrievedByXMLHttpRequest):
        (WebCore::InspectorInstrumentation::scriptImported):
        (WebCore::InspectorInstrumentation::mainResourceFiredLoadEvent):
        (WebCore::InspectorInstrumentation::mainResourceFiredDOMContentEvent):
        (WebCore::InspectorInstrumentation::frameDetachedFromParent):
        (WebCore::InspectorInstrumentation::didCommitLoad):
        (WebCore::InspectorInstrumentation::willWriteHTML):
        (WebCore::InspectorInstrumentation::didOpenDatabase):
        (WebCore::InspectorInstrumentation::didUseDOMStorage):
        (WebCore::InspectorInstrumentation::didCreateWorker):
        (WebCore::InspectorInstrumentation::didDestroyWorker):
        (WebCore::InspectorInstrumentation::didCreateWebSocket):
        (WebCore::InspectorInstrumentation::willSendWebSocketHandshakeRequest):
        (WebCore::InspectorInstrumentation::didReceiveWebSocketHandshakeResponse):
        (WebCore::InspectorInstrumentation::didCloseWebSocket):
        (WebCore::InspectorInstrumentation::networkStateChanged):
        (WebCore::InspectorInstrumentation::updateApplicationCacheStatus):
        (WebCore::InspectorInstrumentation::addMessageToConsole):
        (WebCore::InspectorInstrumentation::consoleCount):
        (WebCore::InspectorInstrumentation::startConsoleTiming):
        (WebCore::InspectorInstrumentation::stopConsoleTiming):
        (WebCore::InspectorInstrumentation::consoleMarkTimeline):
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsole):
        (WebCore::InspectorInstrumentation::inspectorControllerForContext):
        (WebCore::InspectorInstrumentation::inspectorControllerForFrame):
        (WebCore::InspectorInstrumentation::inspectorControllerForPage):
        (WebCore::InspectorInstrumentation::inspectorControllerWithFrontendForContext):
        (WebCore::InspectorInstrumentation::inspectorControllerWithFrontendForDocument):
        (WebCore::InspectorInstrumentation::inspectorControllerWithFrontendForFrame):
        (WebCore::InspectorInstrumentation::inspectorControllerWithFrontendForPage):
        * inspector/InspectorState.cpp:
        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::detachFromParent):
        (WebCore::FrameLoader::dispatchDidClearWindowObjectInWorld):
        (WebCore::FrameLoader::dispatchDidCommitLoad):
        * page/Chrome.cpp:
        (WebCore::Chrome::mouseDidMoveOverElement):
        * page/Console.cpp:
        (WebCore::Console::addMessage):
        (WebCore::Console::count):
        (WebCore::Console::markTimeline):
        (WebCore::Console::profile):
        (WebCore::Console::time):
        (WebCore::Console::timeEnd):
        (WebCore::Console::group):
        (WebCore::Console::groupCollapsed):
        (WebCore::Console::groupEnd):
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::sessionStorage):
        (WebCore::DOMWindow::localStorage):
        (WebCore::DOMWindow::dispatchLoadEvent):
        * page/EventHandler.cpp:
        (WebCore::EventHandler::handleMousePressEvent):
        * page/Page.cpp:
        (WebCore::Page::~Page):
        * storage/Database.cpp:
        (WebCore::Database::openDatabase):
        * workers/AbstractWorker.cpp:
        (WebCore::AbstractWorker::onDestroyWorker):
        * workers/SharedWorker.cpp:
        (WebCore::SharedWorker::create):
        * workers/Worker.cpp:
        (WebCore::Worker::create):
        * workers/WorkerMessagingProxy.cpp:

2011-01-17  Gyuyoung Kim  <gyuyoung.kim@samsung.com>

        Unreviewed, rolling out r75923.

        GTK guy rolls out the r75914.

        * platform/efl/ScrollViewEfl.cpp:
        (WebCore::ScrollView::platformInit):

2011-01-17  Helder Correia  <helder@sencha.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] fast/canvas/canvas-fillPath-gradient-shadow.html does not pass
        https://bugs.webkit.org/show_bug.cgi?id=52556

        The shadow color opacity needs to be set on the shadow painter.
        Additionally, the gradient brush should be transformed.

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::fillPath):

2011-01-17  No'am Rosenthal  <noam.rosenthal@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Background image rendering is slow
        https://bugs.webkit.org/show_bug.cgi?id=50527

        When tiling a scaled pixmap in Image::drawPattern, scale the tile
        first and only then draw it to the target. Do so only when drawing
        more than one tile.

        Tests in fast/backgrounds/size cover this.

        * platform/graphics/qt/ImageQt.cpp:
        (WebCore::Image::drawPattern):

2011-01-17  Laszlo Gombos  <laszlo.1.gombos@nokia.com>

        Reviewed by Simon Hausmann.

        [Qt] [Symbian] Fix building NPAPI support
        https://bugs.webkit.org/show_bug.cgi?id=51981

        Make sure that npapi.h is always included outside of the extern "C"
        linkage declaration block.

        No new tests as there is no new functionality.

        * bridge/npruntime.h:

2011-01-17  Philippe Normand  <pnormand@igalia.com>

        Unreviewed, rolling out r75914.
        http://trac.webkit.org/changeset/75914
        https://bugs.webkit.org/show_bug.cgi?id=49177

        multiple crashes on GTK

        * platform/ScrollView.cpp:
        (WebCore::ScrollView::removeChild):
        (WebCore::ScrollView::wheelEvent):
        * platform/gtk/MainFrameScrollbarGtk.cpp:
        (MainFrameScrollbarGtk::attachAdjustment):
        (MainFrameScrollbarGtk::gtkValueChanged):
        * platform/gtk/ScrollViewGtk.cpp:
        (WebCore::ScrollView::platformInit):
        (WebCore::ScrollView::platformAddChild):
        (WebCore::ScrollView::platformRemoveChild):

2011-01-17  Gyuyoung Kim  <gyuyoung.kim@samsung.com>

        Unreviewed build fix.

        Bug 49177's patch enabled platformInit() in super class(ScrollView).
        But, it didn't removed the function in ScrollViewEfl.cpp.

        * platform/efl/ScrollViewEfl.cpp:

2011-01-16  Dan Bernstein  <mitz@apple.com>

        Reviewed by Sam Weinig.

        <rdar://problem/8871903> REGRESSION (r75897): Crash with 0-by-0 iframe in scaled WebView

        Avoid use of FloatRect::enclosingBoundingBox(), which can stretch an empty
        quad to a non-empty rect.

        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::setWidget):
        (WebCore::RenderWidget::updateWidgetPosition):

2011-01-16  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] fast/events/scroll-after-click-on-tab-index has been failing on the bots
        https://bugs.webkit.org/show_bug.cgi?id=49177

        * platform/ScrollView.cpp: Move the platform guards around a little. GTK+
        now shares the implementation of platformAddChild and platformRemoveChild,
        but has its own implementation of removeChild, which knows how to inform
        main frame scrollbars that they no longer control the WebCore scrollbar.
        * platform/gtk/MainFrameScrollbarGtk.cpp:
        (MainFrameScrollbarGtk::attachAdjustment): If we are attaching the same adjustment
        that we already have, bail out early. Apply the value changed signal handler
        after configuring the adjustment. We don't want our reset of the adjustment to
        stomp on WebCore values.
        (MainFrameScrollbarGtk::gtkValueChanged): Do not adjust the value if the WebCore
        state already matches ours. This prevents some unnecessary recursion
        * platform/gtk/ScrollViewGtk.cpp:
        (WebCore::ScrollView::removeChild): Added, special cases main frame scrollbars
        which need their adjustments detached.

2011-01-13  Yuzo Fujishima  <yuzo@google.com>

        Reviewed by Antti Koivisto.

        Fix for Bug 52427 - Inconsistent use of m_cache in CachedResourceLoader
        https://bugs.webkit.org/show_bug.cgi?id=52427

        In constructor/destructor of CachedResourceLoader, m_cache has been
        used to call MemoryCache::addCachedResourceLoader/removeCachedResourceLoader
        while cache() is used everywhere else.

        Actually addCachedResourceLoader/removeCachedResourceLoader need not be called at all.
        Remove the call sites and make MemoryCache non-friend of CachedResourceLoader.

        No new tests because the behavior remains the same.

        * loader/cache/CachedResourceLoader.cpp:
        (WebCore::CachedResourceLoader::CachedResourceLoader):
        (WebCore::CachedResourceLoader::~CachedResourceLoader):
        * loader/cache/CachedResourceLoader.h:
        * loader/cache/MemoryCache.cpp:
        * loader/cache/MemoryCache.h:

2011-01-16  Adam Barth  <abarth@webkit.org>

        Rubber-stamped by Eric Seidel.

        Move WebKit into Source
        https://bugs.webkit.org/show_bug.cgi?id=52530

        * WebCore.gyp/WebCore.gyp:
        * WebCore.pri:
        * WebCore.pro:

2011-01-16  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dan Bernstein.

        frame-removed-during-resize.html test crashes (shows up as image-map-2.html crash)
        https://bugs.webkit.org/show_bug.cgi?id=52549

        Fix regression from r75900; m_widget->setFrameRect() can run script that
        clears m_widget, so null-check it before calling setBoundsSize().
        
        Tested by fast/replaced/frame-removed-during-resize.html

        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::setWidgetGeometry):

2011-01-16  Simon Fraser  <simon.fraser@apple.com>

        Keep Leopard build happy.

        * platform/mac/WidgetMac.mm:
        (WebCore::Widget::setBoundsSize):

2011-01-16  Robert Hogan  <robert@webkit.org>

        Reviewed by Andreas Kling.

        [Qt] plugins/keyboard-events.html fails after r72717
        https://bugs.webkit.org/show_bug.cgi?id=50050

        * plugins/qt/PluginViewQt.cpp:
        (WebCore::setXKeyEventSpecificFields): map event text to keycode

2011-01-16  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dan Bernstein.

        Issues with iframes and plugins when the WebView is scaled.
        <rdar://problem/6213380>
        
        When _scaleWebView has been called on a WebView, iframes
        in WebKit1 render and hit-test incorrectly, and plug-ins don't scale up.
        This is caused by AppKit NSViews not playing nicely with the scale
        applied through style.
        
        Work around most of these issues by adjusting the bounds size
        of widgets to allow iframe contents to paint with the correct scale,
        and fix various places in the code where we relied on coordinate
        transforms via NSViews (which ignore CSS transforms).

        * WebCore.exp.in:
        * platform/Widget.cpp:
        (WebCore::Widget::setBoundsSize):
        * platform/Widget.h:
        * platform/mac/WidgetMac.mm:
        (WebCore::Widget::setBoundsSize):
        (WebCore::Widget::paint):
        * rendering/RenderLayerCompositor.cpp:
        (WebCore::RenderLayerCompositor::shouldPropagateCompositingToEnclosingIFrame):
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::setWidgetGeometry):
        (WebCore::RenderWidget::setWidget):
        (WebCore::RenderWidget::updateWidgetPosition):
        * rendering/RenderWidget.h:

2011-01-16  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dan Bernstein.

        RenderView needs to take transforms on its layer into account
        https://bugs.webkit.org/show_bug.cgi?id=52536
        
        The RenderView's coordinate mapping methods failed to
        take into account a transform on the RenderView's layer.

        No tests because it's not possible to get a transform
        on the RenderView's layer through content.

        * rendering/RenderView.cpp:
        (WebCore::RenderView::mapLocalToContainer):
        (WebCore::RenderView::mapAbsoluteToLocalPoint):

2011-01-15  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r75708.
        http://trac.webkit.org/changeset/75708
        https://bugs.webkit.org/show_bug.cgi?id=52521

        Breaks Qt build if mobility is not installed. (Requested by
        benjaminp on #webkit).

        * WebCore.pro:
        * platform/graphics/qt/MediaPlayerPrivateQt.cpp:
        (WebCore::MediaPlayerPrivateQt::MediaPlayerPrivateQt):
        * platform/graphics/qt/MediaPlayerPrivateQt.h:
        (WebCore::MediaPlayerPrivateQt::supportsFullscreen):

2011-01-15  David Kilzer  <ddkilzer@apple.com>

        <http://webkit.org/b/52512> REGRESSION(r73818): range.cloneContents() ignores end offset

        Reviewed by Adele Peterson.

        The fix for Bug 50710 in r73799 introduced an off-by-one error
        when copying nodes to a local NodeVector for processing.  A fix
        was attempted for Bug 50854 in r73818, but instead of stopping
        at the end offset, it iterates through all the sibling nodes
        because the loop variable (i) is never incremented.  To clean
        this up, revert back to the code in r73799 and fix the
        off-by-one error.

        Test: fast/dom/Range/range-clone-contents.html

        * dom/Range.cpp:
        (WebCore::Range::processContents): Fix the loop that copies
        nodes to a local NodeVector by restoring the code from r73799
        and fixing the off-by-one error.

2011-01-15  Adam Barth  <abarth@webkit.org>

        Rubber-stamped by Eric Seidel.

        Move WebKit2 into Source
        https://bugs.webkit.org/show_bug.cgi?id=52438

        * WebCore.pro:

2011-01-15  Joone Hur  <joone.hur@collabora.co.uk>

        Reviewed by Martin Robinson.

        [GTK] Linux build with FileSystem API enabled fails
        https://bugs.webkit.org/show_bug.cgi?id=43878

        This patch allows WebKitGtk+ to build with FileSystem API option.

        No new tests because no new functionality.

        * GNUmakefile.am: Included AsyncFileSystem.h,cpp and Excluded duplicated JSFileException.h,cpp.
        * bindings/js/JSDirectoryEntryCustom.cpp: Included ExceptionCode.h.

2011-01-14  Sam Magnuson  <smagnuso@gmail.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Compile with QT_NO_GRAPHICSVIEW
        https://bugs.webkit.org/show_bug.cgi?id=49750

        * platform/graphics/qt/GraphicsLayerQt.cpp:
        * platform/graphics/qt/GraphicsLayerQt.h:
        * platform/qt/PlatformMouseEventQt.cpp:

2011-01-14  Tony Chang  <tony@chromium.org>

        Reviewed by Alexey Proskuryakov.

        Strip NUL character when copying text on Windows
        https://bugs.webkit.org/show_bug.cgi?id=52236

        Test: editing/pasteboard/copy-null-characters.html

        * editing/Editor.cpp:
        (WebCore::Editor::selectedText):
        * platform/mac/PasteboardMac.mm:
        (WebCore::Pasteboard::writeSelection): Use editor()->selectedText() which matches the other platforms.

2011-01-14  Yuzo Fujishima  <yuzo@google.com>

        Reviewed by Antti Koivisto.

        Rename cache() to memoryCache()
        https://bugs.webkit.org/show_bug.cgi?id=52433

        No new tests because the behavior remains the same.

        * WebCore.exp.in:
        * WebCore.order:
        * history/PageCache.cpp:
        (WebCore::PageCache::releaseAutoreleasedPagesNow):
        * inspector/InspectorResourceAgent.cpp:
        (WebCore::InspectorResourceAgent::cachedResource):
        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::tellClientAboutPastMemoryCacheLoads):
        * loader/archive/cf/LegacyWebArchive.cpp:
        (WebCore::LegacyWebArchive::create):
        * loader/cache/CachedImage.cpp:
        (WebCore::CachedImage::allClientsRemoved):
        (WebCore::CachedImage::data):
        * loader/cache/CachedResource.cpp:
        (WebCore::CachedResource::~CachedResource):
        (WebCore::CachedResource::addClientToSet):
        (WebCore::CachedResource::removeClient):
        (WebCore::CachedResource::setDecodedSize):
        (WebCore::CachedResource::setEncodedSize):
        (WebCore::CachedResource::didAccessDecodedData):
        * loader/cache/CachedResourceLoader.cpp:
        (WebCore::CachedResourceLoader::CachedResourceLoader):
        (WebCore::CachedResourceLoader::requestUserCSSStyleSheet):
        (WebCore::CachedResourceLoader::requestResource):
        (WebCore::CachedResourceLoader::revalidateResource):
        (WebCore::CachedResourceLoader::loadResource):
        (WebCore::CachedResourceLoader::clearPreloads):
        (WebCore::CachedResourceLoader::printPreloadStats):
        * loader/cache/CachedResourceRequest.cpp:
        (WebCore::CachedResourceRequest::load):
        (WebCore::CachedResourceRequest::didFail):
        (WebCore::CachedResourceRequest::didReceiveResponse):
        * loader/cache/MemoryCache.cpp:
        (WebCore::memoryCache):
        * loader/cache/MemoryCache.h:

2011-01-14  Dan Bernstein  <mitz@apple.com>

        Reviewed by Simon Fraser.

        WebCore part of <rdar://problem/8441312> Crash in -[NSView _invalidateGStatesForTree]

        * WebCore.exp.in: Export RenderWidget::suspendWidgetHierarchyUpdates() and
        RenderWidget::resumeWidgetHierarchyUpdates().
        * manual-tests/plug-in-mutates-NSView-hierarchy-during-resize.html: Added.
        * rendering/RenderWidget.cpp:
        (WebCore::RenderWidget::setWidgetGeometry): Removed the assertion that widget hierarchy updates
        are disabled. When this assertion was added, this condition was a subset of the “calling out to
        plug-in code is forbidden” condition, hence the assertion was valid. The WebKit part of this
        change now suspends widget hierarchy updates even at times where plug-in code is expected to be
        called, which invalidates the assertion.

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Fix Qt build after r75837
        https://bugs.webkit.org/show_bug.cgi?id=52494

        * rendering/style/StyleRareInheritedData.cpp:
        * rendering/style/StyleRareNonInheritedData.cpp:

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Fix Qt build after r75837
        https://bugs.webkit.org/show_bug.cgi?id=52494

        * rendering/style/RenderStyle.cpp:

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Fix Qt build after r75837
        https://bugs.webkit.org/show_bug.cgi?id=52494

        * editing/EditorCommand.cpp:

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Fix Qt build after r75837
        https://bugs.webkit.org/show_bug.cgi?id=52494

        * editing/ApplyStyleCommand.cpp:

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Fix Qt build after r75837
        https://bugs.webkit.org/show_bug.cgi?id=52494

        * css/CSSStyleSelector.cpp:

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Fix Qt build after r75837
        https://bugs.webkit.org/show_bug.cgi?id=52494

        * rendering/InlineFlowBox.h:
        * rendering/RenderBoxModelObject.h:

2011-01-14  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by David Levin.

        Do some forward declaration in RenderStyle.h
        https://bugs.webkit.org/show_bug.cgi?id=52453

        No new tests because no new functionality.

        * css/CSSComputedStyleDeclaration.cpp:
        * css/CSSStyleSelector.cpp:
        * editing/Editor.cpp:
        * page/EventHandler.cpp:
        * rendering/EllipsisBox.cpp:
        * rendering/InlineBox.cpp:
        * rendering/InlineTextBox.cpp:
        * rendering/RenderBlock.cpp:
        * rendering/RenderBlock.h:
        * rendering/RenderBox.cpp:
        * rendering/RenderBox.h:
        * rendering/RenderEmbeddedObject.cpp:
        * rendering/RenderFieldset.cpp:
        * rendering/RenderFileUploadControl.cpp:
        * rendering/RenderFrameSet.cpp:
        * rendering/RenderHTMLCanvas.cpp:
        * rendering/RenderImageResource.cpp:
        * rendering/RenderInputSpeech.cpp:
        * rendering/RenderLayer.h:
        * rendering/RenderLineBoxList.cpp:
        * rendering/RenderListBox.cpp:
        * rendering/RenderMediaControlsChromium.cpp:
        * rendering/RenderObject.cpp:
        * rendering/RenderObject.h:
        * rendering/RenderObjectChildList.cpp:
        * rendering/RenderProgress.cpp:
        * rendering/RenderScrollbarPart.cpp:
        * rendering/RenderTable.cpp:
        * rendering/RenderTable.h:
        * rendering/RenderTableCell.cpp:
        * rendering/RenderTableRow.cpp:
        * rendering/RenderTableSection.cpp:
        * rendering/RenderTheme.cpp:
        * rendering/RenderThemeChromiumSkia.cpp:
        * rendering/RenderThemeChromiumWin.cpp:
        * rendering/RootInlineBox.cpp:
        * rendering/style/RenderStyle.cpp:
        * rendering/style/RenderStyle.h:
        * rendering/style/StyleRareInheritedData.cpp:

2011-01-14  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        Stop instantiating legacy editing positions in AccessibilityRenderObject.cpp, Element.cpp,
        BreakBlockquoteCommand.cpp, CompositeEditCommand.cpp, and DeleteButtonController.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52481

        Removed instantiation of legacy editing positions.
        Calls to Position::Position are replaced by calls to Position's convenience functions.
        
        Also fixed firstPositionInOrBeforeNode and lastPositionInOrAfterNode so that
        they instantiate right positions for text nodes.

        * accessibility/AccessibilityRenderObject.cpp:
        (WebCore::AccessibilityRenderObject::setSelectedTextRange):
        * dom/Element.cpp:
        (WebCore::Element::updateFocusAppearance):
        * editing/BreakBlockquoteCommand.cpp:
        (WebCore::BreakBlockquoteCommand::doApply):
        * editing/CompositeEditCommand.cpp:
        (WebCore::CompositeEditCommand::inputText):
        (WebCore::CompositeEditCommand::rebalanceWhitespaceAt):
        (WebCore::CompositeEditCommand::moveParagraphContentsToNewBlockIfNecessary):
        (WebCore::CompositeEditCommand::moveParagraphs):
        (WebCore::CompositeEditCommand::breakOutOfEmptyListItem):
        (WebCore::CompositeEditCommand::breakOutOfEmptyMailBlockquotedParagraph):
        (WebCore::CompositeEditCommand::splitTreeToNode):
        * editing/DeleteButtonController.cpp:
        (WebCore::enclosingDeletableElement):
        * editing/htmlediting.h:
        (WebCore::firstPositionInOrBeforeNode): Instantiates firstPositionInNode instead of
        positionBeforeNode for a text node.
        (WebCore::lastPositionInOrAfterNode): Ditto.

2011-01-14  Helder Correia  <helder@sencha.com>

        Reviewed by Simon Fraser.

        Shadow is not drawn when filling a path with a gradient
        https://bugs.webkit.org/show_bug.cgi?id=51982

        This happens in CG and is related to bug 51869, this time to be fixed
        in GraphicsContext::fillPath(const Path& path). We need to draw the
        gradient clipped to the path on a CGLayer first, and then draw the
        layer on the GraphicsContext.

        Test: fast/canvas/canvas-fillPath-gradient-shadow.html

        * platform/graphics/cg/GraphicsContextCG.cpp:
        (WebCore::GraphicsContext::fillPath):

2011-01-14  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Adam Roben.

        Layer syncing should go through the compositor
        https://bugs.webkit.org/show_bug.cgi?id=52486

        Rather than have FrameView go directly to GraphicsLayer to
        sync pending changes, route the call through RenderLayerCompositor.
        
        Add a FIXME about an existing issue with flushing and subframes.
        
        No behavior change, so no tests.

        * page/FrameView.cpp:
        (WebCore::FrameView::syncCompositingStateForThisFrame):
        * rendering/RenderLayerBacking.cpp:
        (WebCore::RenderLayerBacking::notifySyncRequired):
        * rendering/RenderLayerCompositor.cpp:
        (WebCore::RenderLayerCompositor::scheduleLayerFlush):
        (WebCore::RenderLayerCompositor::flushPendingLayerChanges):
        * rendering/RenderLayerCompositor.h:
        (WebCore::RenderLayerCompositor::notifySyncRequired):

2011-01-14  Abhishek Arya  <inferno@chromium.org>

        Reviewed by David Hyatt.

        Fix parent block calculation when trying to find top most node
        containing "this" float.
        https://bugs.webkit.org/show_bug.cgi?id=51711

        Replace use of containingBlock and traverse the parents directly
        to check for float existence. containingBlock can skip parents and
        jump to the RenderView directly which will cause floats to not get
        cleared from intermediate parents.

        Test: fast/block/float/floats-not-cleared-crash.html

        * rendering/RenderBox.cpp:
        (WebCore::RenderBox::removeFloatingOrPositionedChildFromBlockLists):

2011-01-14  Adam Klein  <adamk@chromium.org>

        Reviewed by Darin Fisher.

        [Chromium] Replace BackForwardListClient with BackForwardControllerClient/BackForwardList
        https://bugs.webkit.org/show_bug.cgi?id=42237

        Remove Chromium-specific implementation from WebCore.

        No tests added; this refactor should be covered by existing history-exercising tests.

        * WebCore.gyp/WebCore.gyp:
        * WebCore.gypi:
        * history/BackForwardListChromium.cpp: Removed.
        * history/BackForwardListImpl.h:

2011-01-12  Satish Sampath  <satish@chromium.org>

        Reviewed by Dimitri Glazkov.

        Fix a crash when accessing speech input from script.
        https://bugs.webkit.org/show_bug.cgi?id=52325

        Test: fast/speech/speech-input-scripting.html

        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::parseMappedAttribute): Recreate renderer when speech input is enabled/disabled.
        * rendering/RenderTextControlSingleLine.cpp: Remove unused code.
        * rendering/RenderTextControlSingleLine.h:
        * rendering/TextControlInnerElements.cpp: Take self references before firing events and check for renderer validity after.
        (WebCore::InputFieldSpeechButtonElement::defaultEventHandler):
        (WebCore::InputFieldSpeechButtonElement::setRecognitionResult):
        (WebCore::InputFieldSpeechButtonElement::detach):

2011-01-14  Abhishek Arya  <inferno@chromium.org>

        Reviewed by David Hyatt.

        Prevent merging of anonymous blocks if one of them is already getting
        destroyed.
        https://bugs.webkit.org/show_bug.cgi?id=52402

        Test: fast/block/merge-anonymous-block-remove-child-crash2.html

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::RenderBlock): initialize m_beingDestroyed to false.
        (WebCore::RenderBlock::destroy): set m_beingDestroyed to true.
        (WebCore::canMergeContiguousAnonymousBlocks): do not merge if any or prev or next is being destroyed.
        (WebCore::RenderBlock::removeChild): remove the hack previously done for preventing oldChild merging with nextBlock's next sibling.
        * rendering/RenderBlock.h:
        (WebCore::RenderBlock::beingDestroyed): public function for m_beingDestroyed.

2011-01-14  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed. Follow up to r75791: fix missing dispatch.
        https://bugs.webkit.org/show_bug.cgi?id=52442

        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerDispatcher.prototype.breakpointResolved):

2011-01-14  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Adam Roben.

        Issues with contentsScale in GraphicsLayerCA
        https://bugs.webkit.org/show_bug.cgi?id=52463

        Fix various issues with the recent contentsScale changes:

        * platform/graphics/ca/GraphicsLayerCA.cpp:
        (WebCore::GraphicsLayerCA::GraphicsLayerCA): Initialize m_contentsScale to 1.
        (WebCore::GraphicsLayerCA::updateContentsScale): Only do a setNeedsDisplay()
        if the layer draws content, otherwise we'll create backing store for empty layers.
        (WebCore::GraphicsLayerCA::swapFromOrToTiledLayer): Be sure to set contentsScale
        on the new (tiled or untiled) layer.
        (WebCore::GraphicsLayerCA::cloneLayer): Clones need contentsScale too.

2011-01-14  Simon Fraser  <simon.fraser@apple.com>

        Let Xcode have it's way with the project file.

        * WebCore.xcodeproj/project.pbxproj:

2011-01-14  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Anders Carlsson.

        Refactor some FrameView::syncCompositingState code
        https://bugs.webkit.org/show_bug.cgi?id=52459

        Refactor some code in FrameView related to synchronizing
        compositing layer state.
        
        * page/FrameView.cpp:
        (WebCore::FrameView::syncCompositingStateForThisFrame):
        (WebCore::FrameView::syncCompositingStateRecursive):
        (WebCore::FrameView::paintContents):
        * page/FrameView.h:

2011-01-14  Viatcheslav Ostapenko  <ostapenko.viatcheslav@nokia.com>

        Reviewed by Eric Seidel.

        [Qt] Fix build problem introduced by http://trac.webkit.org/changeset/75713
        https://bugs.webkit.org/show_bug.cgi?id=30179

        * plugins/symbian/PluginViewSymbian.cpp:

2011-01-14  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Add volume slider to media player
        https://bugs.webkit.org/show_bug.cgi?id=51532

        * css/mediaControlsGtk.css:
        (audio::-webkit-media-controls-panel, video::-webkit-media-controls-panel):
        (audio::-webkit-media-controls-volume-slider-container, video::-webkit-media-controls-volume-slider-container):
        (audio::-webkit-media-controls-volume-slider, video::-webkit-media-controls-volume-slider):
        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::adjustMediaSliderThumbSize):
        (WebCore::RenderThemeGtk::paintMediaVolumeSliderContainer):
        (WebCore::RenderThemeGtk::paintMediaVolumeSliderTrack):
        (WebCore::RenderThemeGtk::paintMediaVolumeSliderThumb):
        * platform/gtk/RenderThemeGtk.h:
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::paintSliderTrack):
        (WebCore::RenderThemeGtk::paintSliderThumb):
        (WebCore::RenderThemeGtk::adjustSliderThumbSize):
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::paintSliderTrack):
        (WebCore::RenderThemeGtk::paintSliderThumb):
        (WebCore::RenderThemeGtk::adjustSliderThumbSize):

2011-01-14  Joone Hur  <joone.hur@collabora.co.uk>

        Reviewed by David Levin.

        [GTK] Convert use of raw pointers to GOwnPtr in FileSystemGtk.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52434

        No new tests. This code will be tested when an implementation 
        of beginDragWithFiles is complete. 

        * platform/gtk/FileSystemGtk.cpp:
        (WebCore::filenameToString): Use GOwnPtr instead of gchar pointer.
        (WebCore::fileSystemRepresentation): Ditto.
        (WebCore::filenameForDisplay): Ditto.
        (WebCore::pathGetFileName): Ditto.

2011-01-14  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: breakpoint text snippet in breakpoints sidebar pane disappears after reload.
        https://bugs.webkit.org/show_bug.cgi?id=52215

        * inspector/front-end/Breakpoint.js:
        (WebInspector.Breakpoint):
        (WebInspector.Breakpoint.prototype.populateLabelElement):
        * inspector/front-end/Script.js:
        (WebInspector.Script.prototype.get linesCount):
        (WebInspector.Script.prototype.sourceLine):
        (WebInspector.Script.prototype.sourceLine.didRequestSource):
        (WebInspector.Script.prototype.set source):
        (WebInspector.Script.prototype.requestSource.didGetScriptSource):
        (WebInspector.Script.prototype.requestSource):
        * inspector/front-end/ScriptView.js:
        (WebInspector.ScriptView.prototype.setupSourceFrameIfNeeded.didRequestSource):
        (WebInspector.ScriptView.prototype.setupSourceFrameIfNeeded):
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype._addBreakpoint):
        * inspector/front-end/utilities.js:
        (String.prototype.findAll):

2011-01-14  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: provide script column offset to frontend.
        https://bugs.webkit.org/show_bug.cgi?id=52377

        * bindings/js/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::dispatchDidParseSource):
        * bindings/js/ScriptSourceCode.h:
        (WebCore::ScriptSourceCode::ScriptSourceCode):
        * bindings/v8/DebuggerScript.js:
        ():
        * bindings/v8/ScriptDebugServer.cpp:
        (WebCore::ScriptDebugServer::dispatchDidParseSource):
        * inspector/Inspector.idl:
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::didParseSource):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/ScriptDebugListener.h:
        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel.prototype.parsedScriptSource):
        * inspector/front-end/Script.js:
        (WebInspector.Script):

2011-01-14  Ilya Tikhonovsky  <loislo@chromium.org>

        Unreviewed one line fix for console-xhr-logging test.

        The problem was introduced at r75788.

        * inspector/InspectorBrowserDebuggerAgent.cpp:
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):

2011-01-13  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: extract console related functionality into InspectorConsoleAgent
        https://bugs.webkit.org/show_bug.cgi?id=52282

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/ConsoleMessage.cpp:
        (WebCore::ConsoleMessage::~ConsoleMessage):
        * inspector/ConsoleMessage.h:
        * inspector/Inspector.idl:
        * inspector/InspectorConsoleAgent.cpp: Added.
        (WebCore::InspectorConsoleAgent::InspectorConsoleAgent):
        (WebCore::InspectorConsoleAgent::~InspectorConsoleAgent):
        (WebCore::InspectorConsoleAgent::setConsoleMessagesEnabled):
        (WebCore::InspectorConsoleAgent::clearConsoleMessages):
        (WebCore::InspectorConsoleAgent::reset):
        (WebCore::InspectorConsoleAgent::setFrontend):
        (WebCore::InspectorConsoleAgent::addMessageToConsole):
        (WebCore::InspectorConsoleAgent::startTiming):
        (WebCore::InspectorConsoleAgent::stopTiming):
        (WebCore::InspectorConsoleAgent::count):
        (WebCore::InspectorConsoleAgent::resourceRetrievedByXMLHttpRequest):
        (WebCore::InspectorConsoleAgent::didReceiveResponse):
        (WebCore::InspectorConsoleAgent::didFailLoading):
        (WebCore::InspectorConsoleAgent::addConsoleMessage):
        * inspector/InspectorConsoleAgent.h: Added.
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::clearConsoleMessages):
        (WebCore::InspectorController::connectFrontend):
        (WebCore::InspectorController::disconnectFrontend):
        (WebCore::InspectorController::didCommitLoad):
        * inspector/InspectorController.h:
        (WebCore::InspectorController::consoleAgent):
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::didReceiveResourceResponseImpl):
        (WebCore::InspectorInstrumentation::didFailLoadingImpl):
        (WebCore::InspectorInstrumentation::resourceRetrievedByXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::addMessageToConsole):
        (WebCore::InspectorInstrumentation::count):
        (WebCore::InspectorInstrumentation::startTiming):
        (WebCore::InspectorInstrumentation::stopTiming):
        (WebCore::InspectorInstrumentation::addStartProfilingMessageToConsole):
        * inspector/InspectorInstrumentation.h:
        * inspector/InspectorProfilerAgent.cpp:
        (WebCore::InspectorProfilerAgent::addProfileFinishedMessageToConsole):
        (WebCore::InspectorProfilerAgent::addStartProfilingMessageToConsole):
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView):
        (WebInspector.ConsoleView.prototype.addConsoleMessage):
        (WebInspector.ConsoleView.prototype.updateConsoleMessageExpiredCount):
        (WebInspector.ConsoleView.prototype.consoleMessagesCleared):
        * inspector/front-end/inspector.js:
        * page/Console.cpp:
        (WebCore::Console::addMessage):
        (WebCore::Console::count):
        (WebCore::Console::profile):
        (WebCore::Console::time):
        (WebCore::Console::timeEnd):
        (WebCore::Console::group):
        (WebCore::Console::groupCollapsed):
        (WebCore::Console::groupEnd):
        * page/Console.h:
        * page/Console.idl:

2011-01-14  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: do not use this as protocol message
        dispatcher in models / agents.
        https://bugs.webkit.org/show_bug.cgi?id=52442

        Models should never for InspectorBackend.registerDomainDispatcher("foo", this).
        There should be a clear way to tell whether method is being called
        from within front-end or by the backend.

        * inspector/front-end/DOMAgent.js:
        (WebInspector.DOMAgent):
        (WebInspector.DOMAgent.prototype.nodeForId):
        (WebInspector.DOMAgent.prototype._bindNodes):
        (WebInspector.DOMAgent.prototype._removeBreakpoints):
        (WebInspector.DOMDispatcher):
        (WebInspector.DOMDispatcher.prototype.setDocument):
        (WebInspector.DOMDispatcher.prototype.attributesUpdated):
        (WebInspector.DOMDispatcher.prototype.characterDataModified):
        (WebInspector.DOMDispatcher.prototype.setChildNodes):
        (WebInspector.DOMDispatcher.prototype.setDetachedRoot):
        (WebInspector.DOMDispatcher.prototype.childNodeCountUpdated):
        (WebInspector.DOMDispatcher.prototype.childNodeInserted):
        (WebInspector.DOMDispatcher.prototype.childNodeRemoved):
        (WebInspector.DOMDispatcher.prototype.didCommitLoad):
        (WebInspector.ApplicationCacheDispatcher):
        (WebInspector.ApplicationCacheDispatcher.prototype.getApplicationCachesAsync):
        (WebInspector.ApplicationCacheDispatcher.prototype.updateApplicationCacheStatus):
        (WebInspector.ApplicationCacheDispatcher.prototype.updateNetworkState):
        * inspector/front-end/DOMStorage.js:
        (WebInspector.DOMStorageDispatcher):
        (WebInspector.DOMStorageDispatcher.prototype.addDOMStorage):
        (WebInspector.DOMStorageDispatcher.prototype.selectDOMStorage):
        (WebInspector.DOMStorageDispatcher.prototype.updateDOMStorage):
        * inspector/front-end/Database.js:
        (WebInspector.Database.prototype.executeSql):
        (WebInspector.DatabaseDispatcher):
        (WebInspector.DatabaseDispatcher.prototype.addDatabase):
        (WebInspector.DatabaseDispatcher.prototype.selectDatabase):
        (WebInspector.DatabaseDispatcher.prototype.sqlTransactionSucceeded):
        (WebInspector.DatabaseDispatcher.prototype.sqlTransactionFailed):
        * inspector/front-end/DebuggerModel.js:
        (WebInspector.DebuggerModel):
        (WebInspector.DebuggerModel.prototype._pausedScript):
        (WebInspector.DebuggerModel.prototype._resumedScript):
        (WebInspector.DebuggerModel.prototype._parsedScriptSource):
        (WebInspector.DebuggerModel.prototype._failedToParseScriptSource):
        (WebInspector.DebuggerDispatcher):
        (WebInspector.DebuggerDispatcher.prototype.pausedScript):
        (WebInspector.DebuggerDispatcher.prototype.resumedScript):
        (WebInspector.DebuggerDispatcher.prototype.parsedScriptSource):
        (WebInspector.DebuggerDispatcher.prototype.failedToParseScriptSource):
        * inspector/front-end/FileSystemView.js:
        (WebInspector.FileSystemDispatcher):
        (WebInspector.FileSystemDispatcher.prototype.getFileSystemPathsAsync):
        (WebInspector.FileSystemDispatcher.prototype.didGetFileSystemPath):
        (WebInspector.FileSystemDispatcher.prototype.didGetFileSystemError):
        (WebInspector.FileSystemDispatcher.prototype.didGetFileSystemDisabled):
        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel):
        (WebInspector.ProfilesPanel.prototype._addProfileHeader):
        (WebInspector.ProfilesPanel.prototype._removeProfileHeader):
        (WebInspector.ProfilesPanel.prototype._addHeapSnapshotChunk):
        (WebInspector.ProfilesPanel.prototype._finishHeapSnapshot):
        (WebInspector.ProfilesPanel.prototype._setRecordingProfile):
        (WebInspector.ProfilerDispatcher):
        (WebInspector.ProfilerDispatcher.prototype.profilerWasEnabled):
        (WebInspector.ProfilerDispatcher.prototype.profilerWasDisabled):
        (WebInspector.ProfilerDispatcher.prototype.resetProfiles):
        (WebInspector.ProfilerDispatcher.prototype.addProfileHeader):
        (WebInspector.ProfilerDispatcher.prototype.addHeapSnapshotChunk):
        (WebInspector.ProfilerDispatcher.prototype.finishHeapSnapshot):
        (WebInspector.ProfilerDispatcher.prototype.setRecordingProfile):
        (WebInspector.ProfileSidebarTreeElement.prototype.ondelete):
        * inspector/front-end/ResourceTreeModel.js:
        (WebInspector.ResourceTreeModel):
        * inspector/front-end/TimelinePanel.js:
        (WebInspector.TimelinePanel):
        (WebInspector.TimelinePanel.prototype._timelineProfilerWasStarted):
        (WebInspector.TimelinePanel.prototype._timelineProfilerWasStopped):
        (WebInspector.TimelinePanel.prototype._addRecordToTimeline):
        (WebInspector.TimelineDispatcher):
        (WebInspector.TimelineDispatcher.prototype.timelineProfilerWasStarted):
        (WebInspector.TimelineDispatcher.prototype.timelineProfilerWasStopped):
        (WebInspector.TimelineDispatcher.prototype.addRecordToTimeline):

2011-01-14  Csaba Osztrogonác  <ossy@webkit.org>

        [Qt][V8] Unreviewed buildfix after r75788.

        * inspector/InspectorBrowserDebuggerAgent.cpp:

2011-01-12  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Extract BrowserDebuggerAgent from InspectorController, InspectorDOMAgent and InspectorDebugger agent.
        We have some methods of Debugger which are related to DOM.
        Lets extract these methods to BrowserDebugger agent.

        http://bugs.webkit.org/show_bug.cgi?id=52294

        * CMakeLists.txt:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp: Added.
        (WebCore::InspectorBrowserDebuggerAgent::InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::~InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::discardBindings):
        (WebCore::InspectorBrowserDebuggerAgent::setEventListenerBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeEventListenerBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::didInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::didRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willModifyDOMAttr):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::hasBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::updateSubtreeBreakpoints):
        (WebCore::InspectorBrowserDebuggerAgent::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorBrowserDebuggerAgent::setXHRBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeXHRBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):
        (WebCore::InspectorBrowserDebuggerAgent::clearForPageNavigation):
        * inspector/InspectorBrowserDebuggerAgent.h: Added.
        (WebCore::InspectorBrowserDebuggerAgent::create):
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::inspectedPageDestroyed):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::enableDebuggerFromFrontend):
        (WebCore::InspectorController::disableDebugger):
        (WebCore::InspectorController::restoreStickyBreakpoints):
        (WebCore::InspectorController::restoreStickyBreakpoint):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::discardBindings):
        (WebCore::InspectorDOMAgent::didInsertDOMNode):
        (WebCore::InspectorDOMAgent::didRemoveDOMNode):
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::willInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::pauseOnNativeEventIfNeeded):

2011-01-14  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: redirected resources not handled properly in Network panel
        https://bugs.webkit.org/show_bug.cgi?id=52292

        * inspector/Inspector.idl: Do not pass isMainResource to identifierForInitialRequest() (it's useless, as we may hit provisional load)
        * inspector/InspectorInstrumentation.cpp: Ditto.
        (WebCore::InspectorInstrumentation::identifierForInitialRequestImpl):
        * inspector/InspectorResourceAgent.cpp: Ditto.
        (WebCore::InspectorResourceAgent::identifierForInitialRequest):
        * inspector/InspectorResourceAgent.h: Ditto.
        * inspector/InspectorInstrumentation.cpp: Ditto.
        (WebCore::InspectorInstrumentation::identifierForInitialRequestImpl): Fix main resource detection.
        * inspector/front-end/AuditsPanel.js: WebInspector.networkResources now returns array, not map.
        * inspector/front-end/ConsoleView.js: User WebInspector.resourceById() to get resource
        (WebInspector.ConsoleMessage.prototype._formatMessage):
        * inspector/front-end/ExtensionServer.js: Ditto.
        (WebInspector.ExtensionServer.prototype._onRevealAndSelectResource):
        (WebInspector.ExtensionServer.prototype._onGetResourceContent):
        * inspector/front-end/HAREntry.js: WebInspector.networkResources now returns array, not map
        (WebInspector.HARLog.prototype.build):
        (WebInspector.HARLog.prototype._convertResource):
        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager): Use appendResource, not refreshResource, when adding a new resource.
        (WebInspector.NetworkManager.prototype.identifierForInitialRequest):
        (WebInspector.NetworkManager.prototype.willSendRequest):
        (WebInspector.NetworkManager.prototype.didLoadResourceFromMemoryCache):
        (WebInspector.NetworkManager.prototype.setInitialContent):
        (WebInspector.NetworkManager.prototype.didCommitLoadForFrame):
        (WebInspector.NetworkManager.prototype.didCreateWebSocket):
        (WebInspector.NetworkManager.prototype._createResource): always register resource URL with ResourceTreeModel
        (WebInspector.NetworkManager.prototype._appendRedirect):
        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkPanel):
        (WebInspector.NetworkPanel.prototype.get resources):
        (WebInspector.NetworkPanel.prototype.resourceById):
        (WebInspector.NetworkPanel.prototype.appendResource): Add resource as new iff appendResource was added.
        (WebInspector.NetworkPanel.prototype.refreshResource): ditto.
        (WebInspector.NetworkPanel.prototype.mainResourceChanged): Clear console upon arrival of new main resource.
        * inspector/front-end/ResourceTreeModel.js: Expose unbindResourceURL, bind resources automatically upon creation.
        (WebInspector.ResourceTreeModel.prototype._clearResources):
        (WebInspector.ResourceTreeModel.prototype.unbindResourceURL):
        (WebInspector.ResourceTreeModel.prototype._addFramesRecursively):
        (WebInspector.ResourceTreeModel.prototype.createResource):
        * inspector/front-end/inspector.js:
        (WebInspector.resourceById):

2011-01-14  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r75783.
        http://trac.webkit.org/changeset/75783
        https://bugs.webkit.org/show_bug.cgi?id=52439

        a bit strange but the same patch have broken mac builds at
        linking stage. (Requested by loislo2 on #webkit).

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp: Removed.
        * inspector/InspectorBrowserDebuggerAgent.h: Removed.
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::inspectedPageDestroyed):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::enableDebuggerFromFrontend):
        (WebCore::InspectorController::disableDebugger):
        (WebCore::InspectorController::restoreStickyBreakpoints):
        (WebCore::InspectorController::restoreStickyBreakpoint):
        (WebCore::InspectorController::setEventListenerBreakpoint):
        (WebCore::InspectorController::removeEventListenerBreakpoint):
        (WebCore::InspectorController::hasEventListenerBreakpoint):
        (WebCore::InspectorController::setXHRBreakpoint):
        (WebCore::InspectorController::removeXHRBreakpoint):
        (WebCore::InspectorController::hasXHRBreakpoint):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::discardBindings):
        (WebCore::InspectorDOMAgent::setDOMBreakpoint):
        (WebCore::InspectorDOMAgent::removeDOMBreakpoint):
        (WebCore::InspectorDOMAgent::shouldBreakOnNodeInsertion):
        (WebCore::InspectorDOMAgent::shouldBreakOnNodeRemoval):
        (WebCore::InspectorDOMAgent::shouldBreakOnAttributeModification):
        (WebCore::InspectorDOMAgent::descriptionForDOMEvent):
        (WebCore::InspectorDOMAgent::didInsertDOMNode):
        (WebCore::InspectorDOMAgent::didRemoveDOMNode):
        (WebCore::InspectorDOMAgent::hasBreakpoint):
        (WebCore::InspectorDOMAgent::updateSubtreeBreakpoints):
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::willInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::pauseOnNativeEventIfNeeded):

2011-01-12  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Extract BrowserDebuggerAgent from InspectorController, InspectorDOMAgent and InspectorDebugger agent.
        We have some methods of Debugger which are related to DOM.
        Lets extract these methods to BrowserDebugger agent.

        http://bugs.webkit.org/show_bug.cgi?id=52294

        * CMakeLists.txt:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp: Added.
        (WebCore::InspectorBrowserDebuggerAgent::InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::~InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::discardBindings):
        (WebCore::InspectorBrowserDebuggerAgent::setEventListenerBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeEventListenerBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::didInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::didRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willModifyDOMAttr):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::hasBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::updateSubtreeBreakpoints):
        (WebCore::InspectorBrowserDebuggerAgent::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorBrowserDebuggerAgent::setXHRBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeXHRBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):
        (WebCore::InspectorBrowserDebuggerAgent::clearForPageNavigation):
        * inspector/InspectorBrowserDebuggerAgent.h: Added.
        (WebCore::InspectorBrowserDebuggerAgent::create):
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::inspectedPageDestroyed):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::enableDebuggerFromFrontend):
        (WebCore::InspectorController::disableDebugger):
        (WebCore::InspectorController::restoreStickyBreakpoints):
        (WebCore::InspectorController::restoreStickyBreakpoint):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::discardBindings):
        (WebCore::InspectorDOMAgent::didInsertDOMNode):
        (WebCore::InspectorDOMAgent::didRemoveDOMNode):
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::willInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::pauseOnNativeEventIfNeeded):

2011-01-14  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: build fix.

        * WebCore.vcproj/WebCore.vcproj:

2011-01-14  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: extract InspectorSettings from InspectorState,
        simplify it.
        https://bugs.webkit.org/show_bug.cgi?id=52429

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/InspectorClient.h:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::inspectorStartsAttached):
        (WebCore::InspectorController::setInspectorStartsAttached):
        (WebCore::InspectorController::setInspectorAttachedHeight):
        (WebCore::InspectorController::inspectorAttachedHeight):
        (WebCore::InspectorController::setMonitoringXHREnabled):
        (WebCore::InspectorController::restoreDebugger):
        (WebCore::InspectorController::restoreProfiler):
        (WebCore::InspectorController::ensureSettingsLoaded):
        (WebCore::InspectorController::enableProfiler):
        (WebCore::InspectorController::disableProfiler):
        (WebCore::InspectorController::enableDebuggerFromFrontend):
        (WebCore::InspectorController::disableDebugger):
        * inspector/InspectorController.h:
        * inspector/InspectorSettings.cpp: Added.
        (WebCore::InspectorSettings::InspectorSettings):
        (WebCore::InspectorSettings::getBoolean):
        (WebCore::InspectorSettings::setBoolean):
        (WebCore::InspectorSettings::getLong):
        (WebCore::InspectorSettings::setLong):
        (WebCore::InspectorSettings::registerBoolean):
        (WebCore::InspectorSettings::registerLong):
        * inspector/InspectorSettings.h: Added.
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        (WebCore::InspectorState::setValue):
        (WebCore::InspectorState::setObject):
        (WebCore::InspectorState::registerBoolean):
        (WebCore::InspectorState::registerString):
        (WebCore::InspectorState::registerLong):
        (WebCore::InspectorState::registerObject):
        (WebCore::InspectorState::Property::create):
        * inspector/InspectorState.h:
        (WebCore::InspectorState::setBoolean):
        (WebCore::InspectorState::setString):
        (WebCore::InspectorState::setLong):

2011-01-14  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r75774.
        http://trac.webkit.org/changeset/75774
        https://bugs.webkit.org/show_bug.cgi?id=52431

        gtk builds were broken (Requested by loislo2 on #webkit).

        * CMakeLists.txt:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp: Removed.
        * inspector/InspectorBrowserDebuggerAgent.h: Removed.
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::inspectedPageDestroyed):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::enableDebuggerFromFrontend):
        (WebCore::InspectorController::disableDebugger):
        (WebCore::InspectorController::restoreStickyBreakpoints):
        (WebCore::InspectorController::restoreStickyBreakpoint):
        (WebCore::InspectorController::setEventListenerBreakpoint):
        (WebCore::InspectorController::removeEventListenerBreakpoint):
        (WebCore::InspectorController::hasEventListenerBreakpoint):
        (WebCore::InspectorController::setXHRBreakpoint):
        (WebCore::InspectorController::removeXHRBreakpoint):
        (WebCore::InspectorController::hasXHRBreakpoint):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::discardBindings):
        (WebCore::InspectorDOMAgent::setDOMBreakpoint):
        (WebCore::InspectorDOMAgent::removeDOMBreakpoint):
        (WebCore::InspectorDOMAgent::shouldBreakOnNodeInsertion):
        (WebCore::InspectorDOMAgent::shouldBreakOnNodeRemoval):
        (WebCore::InspectorDOMAgent::shouldBreakOnAttributeModification):
        (WebCore::InspectorDOMAgent::descriptionForDOMEvent):
        (WebCore::InspectorDOMAgent::didInsertDOMNode):
        (WebCore::InspectorDOMAgent::didRemoveDOMNode):
        (WebCore::InspectorDOMAgent::hasBreakpoint):
        (WebCore::InspectorDOMAgent::updateSubtreeBreakpoints):
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::willInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::pauseOnNativeEventIfNeeded):

2011-01-12  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Extract BrowserDebuggerAgent from InspectorController, InspectorDOMAgent and InspectorDebugger agent.
        We have some methods of Debugger which are related to DOM.
        Lets extract these methods to BrowserDebugger agent.

        http://bugs.webkit.org/show_bug.cgi?id=52294

        * CMakeLists.txt:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/Inspector.idl:
        * inspector/InspectorBrowserDebuggerAgent.cpp: Added.
        (WebCore::InspectorBrowserDebuggerAgent::InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::~InspectorBrowserDebuggerAgent):
        (WebCore::InspectorBrowserDebuggerAgent::discardBindings):
        (WebCore::InspectorBrowserDebuggerAgent::setEventListenerBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeEventListenerBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::didInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::didRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::setDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeDOMBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willInsertDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willRemoveDOMNode):
        (WebCore::InspectorBrowserDebuggerAgent::willModifyDOMAttr):
        (WebCore::InspectorBrowserDebuggerAgent::descriptionForDOMEvent):
        (WebCore::InspectorBrowserDebuggerAgent::hasBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::updateSubtreeBreakpoints):
        (WebCore::InspectorBrowserDebuggerAgent::pauseOnNativeEventIfNeeded):
        (WebCore::InspectorBrowserDebuggerAgent::setXHRBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::removeXHRBreakpoint):
        (WebCore::InspectorBrowserDebuggerAgent::willSendXMLHttpRequest):
        (WebCore::InspectorBrowserDebuggerAgent::clearForPageNavigation):
        * inspector/InspectorBrowserDebuggerAgent.h: Added.
        (WebCore::InspectorBrowserDebuggerAgent::create):
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::inspectedPageDestroyed):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::enableDebuggerFromFrontend):
        (WebCore::InspectorController::disableDebugger):
        (WebCore::InspectorController::restoreStickyBreakpoints):
        (WebCore::InspectorController::restoreStickyBreakpoint):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::discardBindings):
        (WebCore::InspectorDOMAgent::didInsertDOMNode):
        (WebCore::InspectorDOMAgent::didRemoveDOMNode):
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::willInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didInsertDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::didRemoveDOMNodeImpl):
        (WebCore::InspectorInstrumentation::willModifyDOMAttrImpl):
        (WebCore::InspectorInstrumentation::willSendXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::pauseOnNativeEventIfNeeded):

2011-01-13  Kent Tamura  <tkent@chromium.org>

        Reviewed by Dimitri Glazkov.

        Implement form validation message UI
        https://bugs.webkit.org/show_bug.cgi?id=48980

        * Add four internal pseudo selectors:
          - -webkit-validation-bubble
          - -webkit-validation-bubble-message
          - -webkit-validation-bubble-top-outer-arrow
          - -webkit-validation-bubble-top-inner-arrow

        * Implement ValidationMessage functions
          Show the message for <the number of characters> / 20.0 seconds.

        No new tests because the feature is disabled by default for now and the
        new behavior is strongly timing-dependent.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::canShareStyleWithElement):
          Do not share a style with elements with different shadowPseudoId().
        * css/html.css: Define appearance for the internal selectors.
        (::-webkit-validation-bubble):
        (::-webkit-validation-bubble-message):
        (::-webkit-validation-bubble-top-outer-arrow):
        (::-webkit-validation-bubble-top-inner-arrow):
        * dom/Node.cpp:
        (WebCore::Node::createRendererIfNeeded):
          Allow to add shadow renderers even if canHaveChildren() returns false.
        * html/HTMLFormControlElement.cpp:
        (WebCore::HTMLFormControlElement::detach):
          Remove m_validationMessage immediately because we can't use
          hideVisibleValidationMessage(), which calls a ValidationMessage function later.
        (WebCore::HTMLFormControlElement::updateVisibleValidationMessage):
          - Don't create ValidationMessage if the message is empty.
          - Remove the check for message equality.
        (WebCore::HTMLFormControlElement::hideVisibleValidationMessage):
          Don't remove m_validationMessage immediately. We shouldn't make the
          element needsLayout() state in this context.
        * html/ValidationMessage.cpp:
        (WebCore::ValidationMessage::~ValidationMessage):
          hideMessage() -> deleteBubbleTree() renaming.
        (WebCore::ValidationMessage::setMessage): Implemented.
        (WebCore::ValidationMessage::setMessageDOMAndStartTimer):
          Added. This updates the validation message and starts the timer to hide it.
        (WebCore::ElementWithPseudoId):
          Added to help implementations of styled shadow nodes.
        (WebCore::ValidationMessage::buildBubbleTree): Added.
        (WebCore::ValidationMessage::requestToHideMessage): Added.
        (WebCore::ValidationMessage::deleteBubbleTree):
          Renamed from hideMessage(), and implemented.
        * html/ValidationMessage.h: Add declarations.

2011-01-13  Dan Bernstein  <mitz@apple.com>

        Reviewed by Alexey Proskuryakov.

        <rdar://problem/8827065> REGRESSION (r71884): Cross-origin XHR fails if willSendRequest changes the URL
        https://bugs.webkit.org/show_bug.cgi?id=52419

        Test: http/tests/loading/cross-origin-XHR-willLoadRequest.html

        * loader/ResourceLoader.cpp:
        (WebCore::ResourceLoader::init): Complete r74453 by ensuring that m_request is only set after
        willSendRequest(). Otherwise, willSendRequest() ends up calling into
        ThreadableDocumentRequest::willSendRequest(), which cancels the request.

2011-01-13  Dan Bernstein  <mitz@apple.com>

        Reviewed by Mark Rowe.

        Don’t try to compile InjectedScriptSource.js into WebCore.

        * WebCore.xcodeproj/project.pbxproj:

2011-01-13  Mike Thole  <mthole@apple.com>

        Reviewed by Darin Adler and Brady Eidson.

        The pageScaleFactor() should be saved/restored along with the scroll position
        https://bugs.webkit.org/show_bug.cgi?id=52406
        <rdar://problem/8714412>

        * history/HistoryItem.cpp:
        (WebCore::HistoryItem::HistoryItem): Initialize m_pageScaleFactor.
        (WebCore::HistoryItem::pageScaleFactor): Added getter.
        (WebCore::HistoryItem::setPageScaleFactor): Added setter.
        (WebCore::HistoryItem::encodeBackForwardTreeNode): Encode m_pageScaleFactor.
        (WebCore::HistoryItem::decodeBackForwardTree): Decode m_pageScaleFactor.
        * history/HistoryItem.h:
        * loader/HistoryController.cpp:
        (WebCore::HistoryController::saveScrollPositionAndViewStateToItem): Save the page scale factor...
        (WebCore::HistoryController::restoreScrollPositionAndViewState): ...and restore it here.

2011-01-13  Evan Martin  <evan@chromium.org>

        Reviewed by Tony Chang.

        [chromium] drop backwards iteration in Linux complex text code
        https://bugs.webkit.org/show_bug.cgi?id=52403

        ComplexTextController previously supported iterating through the text in
        both directions, but this resulted in duplicate code for each path.
        Instead, by being more careful about flipping signs where appropriate,
        we can refactor the code into one code path.

        No tests, just a refactoring; should be covered by existing tests.

        * platform/graphics/chromium/ComplexTextControllerLinux.cpp:
        (WebCore::ComplexTextController::ComplexTextController):
        (WebCore::ComplexTextController::reset):
        (WebCore::ComplexTextController::nextScriptRun):
        * platform/graphics/chromium/ComplexTextControllerLinux.h:
        * platform/graphics/chromium/FontLinux.cpp:
        (WebCore::glyphIndexForXPositionInScriptRun):
        (WebCore::Font::selectionRectForComplexText):

2011-01-13  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Darin Adler.

        Flip input[type=range] to use the new shadow DOM model.
        https://bugs.webkit.org/show_bug.cgi?id=52317

        This is a straight-up flip, minimal change to the logic, which will be
        refactored in a follow-up patch.

        Covered by existing tests.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::initForStyleResolve): Changed to use either
            host or parent node to find parent.
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::updateType): Added logic for destroying/creating
            shadow DOM subtree.
        * html/InputType.cpp:
        (WebCore::InputType::createShadowSubtree): Added empty decl.
        (WebCore::InputType::destroyShadowSubtree): Added a method to destroy
            shadow subtree.
        * html/InputType.h: Added defs.
        * html/RangeInputType.cpp:
        (WebCore::RangeInputType::createShadowSubtree): Added a virtual method to create
            slider thumb.
        * html/RangeInputType.h: Adde def.
        * html/shadow/SliderThumbElement.cpp: Added temporary RenderSliderThumb class
            to handle cascading appearance.
        (WebCore::RenderSliderThumb::RenderSliderThumb): Added.
        (WebCore::RenderSliderThumb::layout): Moved here the logic from
            RenderSlider::createThumbStyle.
        (WebCore::SliderThumbElement::createRenderer): Added virtual method to
            create RenderSliderThumb instance.
        (WebCore::SliderThumbElement::defaultEventHandler): Changed to use HTMLDivElement
            as base class.
        (WebCore::SliderThumbElement::detach): Ditto.
        * html/shadow/SliderThumbElement.h:
        (WebCore::SliderThumbElement::SliderThumbElement): Ditto.
        (WebCore::SliderThumbElement::create): Ditto.
        (WebCore::toSliderThumbElement): Added a casting helper.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlInputElement::attach): Added handling of shadow DOM,
            since the whole method is hand-rolled.
        (WebCore::MediaControlInputElement::updateStyle): Ditto.
        * rendering/RenderSlider.cpp:
        (WebCore::RenderSlider::~RenderSlider): Removed unneeded code.
        (WebCore::RenderSlider::thumbRect): Changed to use sliderThumbElement helper.
        (WebCore::RenderSlider::layout): Ditto.
        (WebCore::RenderSlider::sliderThumbElement): Added a temporary helper to access
            SliderThumbElement.
        (WebCore::RenderSlider::mouseEventIsInThumb): Changed to use sliderThumbElement helper.
        (WebCore::RenderSlider::mouseEventOffsetToThumb): Ditto.
        (WebCore::RenderSlider::setValueForPosition): Ditto.
        (WebCore::RenderSlider::positionForOffset): Ditto.
        (WebCore::RenderSlider::currentPosition): Ditto.
        (WebCore::RenderSlider::trackSize): Ditto.
        (WebCore::RenderSlider::forwardEvent): Ditto.
        (WebCore::RenderSlider::inDragMode): Ditto.
        * rendering/RenderSlider.h: Added def.

2011-01-13  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        Rename RGBA32Buffer to ImageFrame
        https://bugs.webkit.org/show_bug.cgi?id=52363

        RGBA32Buffer is a terrible misnomer.  ImageFrame is vastly
        more accurate.  More cleanup to come.

        * WebCore.pro:
        * platform/graphics/ImageSource.cpp:
        (WebCore::ImageSource::createFrameAtIndex):
        (WebCore::ImageSource::frameDurationAtIndex):
        (WebCore::ImageSource::frameIsCompleteAtIndex):
        * platform/graphics/qt/ImageDecoderQt.cpp:
        (WebCore::ImageDecoderQt::frameBufferAtIndex):
        (WebCore::ImageDecoderQt::internalReadImage):
        (WebCore::ImageDecoderQt::internalHandleCurrentImage):
        * platform/graphics/qt/ImageDecoderQt.h:
        * platform/graphics/wince/ImageWinCE.cpp:
        (WebCore::ImageFrame::asNewNativeImage):
        * platform/image-decoders/ImageDecoder.cpp:
        (WebCore::ImageFrame::ImageFrame):
        (WebCore::ImageFrame::operator=):
        (WebCore::ImageFrame::clear):
        (WebCore::ImageFrame::zeroFill):
        (WebCore::ImageFrame::copyReferenceToBitmapData):
        (WebCore::ImageFrame::copyBitmapData):
        (WebCore::ImageFrame::setSize):
        (WebCore::ImageFrame::hasAlpha):
        (WebCore::ImageFrame::setHasAlpha):
        (WebCore::ImageFrame::setColorProfile):
        (WebCore::ImageFrame::setStatus):
        (WebCore::ImageFrame::width):
        (WebCore::ImageFrame::height):
        * platform/image-decoders/ImageDecoder.h:
        (WebCore::ImageFrame::ImageFrame):
        * platform/image-decoders/bmp/BMPImageDecoder.cpp:
        (WebCore::BMPImageDecoder::frameBufferAtIndex):
        (WebCore::BMPImageDecoder::decode):
        * platform/image-decoders/bmp/BMPImageDecoder.h:
        * platform/image-decoders/bmp/BMPImageReader.cpp:
        (WebCore::BMPImageReader::decodeBMP):
        * platform/image-decoders/bmp/BMPImageReader.h:
        (WebCore::BMPImageReader::setBuffer):
        * platform/image-decoders/cairo/ImageDecoderCairo.cpp:
        (WebCore::ImageFrame::asNewNativeImage):
        * platform/image-decoders/cg/ImageDecoderCG.cpp:
        (WebCore::getPtrAsPixelData):
        (WebCore::ImageFrame::copyReferenceToBitmapData):
        (WebCore::ImageFrame::copyBitmapData):
        (WebCore::ImageFrame::setSize):
        (WebCore::ImageFrame::asNewNativeImage):
        * platform/image-decoders/gif/GIFImageDecoder.cpp:
        (WebCore::GIFImageDecoder::frameBufferAtIndex):
        (WebCore::GIFImageDecoder::clearFrameBufferCache):
        (WebCore::GIFImageDecoder::haveDecodedRow):
        (WebCore::GIFImageDecoder::frameComplete):
        (WebCore::GIFImageDecoder::initFrameBuffer):
        * platform/image-decoders/gif/GIFImageDecoder.h:
        * platform/image-decoders/gif/GIFImageReader.cpp:
        (GIFImageReader::read):
        * platform/image-decoders/gif/GIFImageReader.h:
        (GIFFrameReader::GIFFrameReader):
        * platform/image-decoders/haiku/ImageDecoderHaiku.cpp:
        (WebCore::ImageFrame::asNewNativeImage):
        * platform/image-decoders/ico/ICOImageDecoder.cpp:
        (WebCore::ICOImageDecoder::frameBufferAtIndex):
        (WebCore::ICOImageDecoder::decode):
        * platform/image-decoders/ico/ICOImageDecoder.h:
        * platform/image-decoders/jpeg/JPEGImageDecoder.cpp:
        (WebCore::JPEGImageDecoder::frameBufferAtIndex):
        (WebCore::JPEGImageDecoder::outputScanlines):
        (WebCore::JPEGImageDecoder::jpegComplete):
        (WebCore::JPEGImageDecoder::decode):
        * platform/image-decoders/jpeg/JPEGImageDecoder.h:
        * platform/image-decoders/openvg/ImageDecoderOpenVG.cpp:
        (WebCore::ImageFrame::asNewNativeImage):
        * platform/image-decoders/png/PNGImageDecoder.cpp:
        (WebCore::PNGImageDecoder::frameBufferAtIndex):
        (WebCore::PNGImageDecoder::rowAvailable):
        (WebCore::PNGImageDecoder::pngComplete):
        * platform/image-decoders/png/PNGImageDecoder.h:
        (WebCore::PNGImageDecoder::isComplete):
        * platform/image-decoders/qt/ImageFrameQt.cpp: Copied from Source/WebCore/platform/image-decoders/qt/RGBA32BufferQt.cpp.
        (WebCore::ImageFrame::ImageFrame):
        (WebCore::ImageFrame::operator=):
        (WebCore::ImageFrame::clear):
        (WebCore::ImageFrame::zeroFill):
        (WebCore::ImageFrame::copyBitmapData):
        (WebCore::ImageFrame::setSize):
        (WebCore::ImageFrame::asNewNativeImage):
        (WebCore::ImageFrame::hasAlpha):
        (WebCore::ImageFrame::setHasAlpha):
        (WebCore::ImageFrame::setColorProfile):
        (WebCore::ImageFrame::setStatus):
        (WebCore::ImageFrame::setPixmap):
        (WebCore::ImageFrame::width):
        (WebCore::ImageFrame::height):
        * platform/image-decoders/qt/RGBA32BufferQt.cpp: Removed.
        * platform/image-decoders/skia/ImageDecoderSkia.cpp:
        (WebCore::ImageFrame::ImageFrame):
        (WebCore::ImageFrame::operator=):
        (WebCore::ImageFrame::clear):
        (WebCore::ImageFrame::zeroFill):
        (WebCore::ImageFrame::copyBitmapData):
        (WebCore::ImageFrame::setSize):
        (WebCore::ImageFrame::asNewNativeImage):
        (WebCore::ImageFrame::hasAlpha):
        (WebCore::ImageFrame::setHasAlpha):
        (WebCore::ImageFrame::setColorProfile):
        (WebCore::ImageFrame::setStatus):
        (WebCore::ImageFrame::width):
        (WebCore::ImageFrame::height):
        * platform/image-decoders/webp/WEBPImageDecoder.cpp:
        (WebCore::WEBPImageDecoder::frameBufferAtIndex):
        (WebCore::WEBPImageDecoder::decode):
        * platform/image-decoders/webp/WEBPImageDecoder.h:
        * platform/image-decoders/wx/ImageDecoderWx.cpp:
        (WebCore::ImageFrame::asNewNativeImage):

2011-01-13  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Darin Adler.

        Transferring nodes between documents should be aware of the shadow DOM.
        https://bugs.webkit.org/show_bug.cgi?id=52399

        No visible change in behavior at the moment.

        Once https://bugs.webkit.org/show_bug.cgi?id=52317 lands, the following
        tests should no longer crash:
        * fast/css/pseudo-in-range-invalid-value.html
        * fast/css/pseudo-in-range.html
        * fast/forms/form-collection-elements.html
        * fast/forms/range-keyoperation.html

        * dom/Document.cpp:
        (WebCore::Document::adoptNode): Changed to use Node::setDocumentRecursively.
        * dom/Node.cpp:
        (WebCore::Node::setDocumentRecursively): Added new method, taking existing
            logic and adding shadow DOM traversal.
        (WebCore::Node::traverseNextNode): Style fix.
        (WebCore::Node::traverseNextSibling): Ditto.
        (WebCore::Node::traversePreviousNode): Ditto.
        (WebCore::Node::traversePreviousNodePostOrder): Ditto.
        (WebCore::Node::checkReplaceChild): Changed to use setDocumentRecursively.
        (WebCore::Node::checkAddChild): Ditto.
        * dom/Node.h: Added def.

2011-01-12  Enrica Casucci  <enrica@apple.com>

        Reviewed by Darin Adler.

        WebKit2: Add support for drag and drop
        https://bugs.webkit.org/show_bug.cgi?id=52343
        <rdar://problem/7660558>
               
        This patch contains the changes required to support dropping content
        in WebKit on the Mac. The DragData class has been extended to provide
        additional context from the application (keyboard state, modal windows, etc.)
        as well as information of the drag pasteboard being used.
        The support for WebKit as drag source will be added with a separate patch.

        * WebCore.exp.in:
        * page/DragController.cpp:
        (WebCore::DragController::dragIsMove): Added DragData parameter.
        (WebCore::DragController::tryDocumentDrag): Modified call to dragIsMove.
        (WebCore::DragController::concludeEditDrag): Same as above.
        * page/DragController.h: Added parameter to isCopyKeyDown.
        * page/mac/DragControllerMac.mm:
        The following methods have been modified to use the information stored
        in the DragData class.
        (WebCore::DragController::isCopyKeyDown):
        (WebCore::DragController::dragOperation):
        * platform/DragData.h:
        (WebCore::DragData::flags):
        * platform/DragData.cpp: Added default flags parameter to the constructor.
        * platform/mac/DragDataMac.mm:
        (WebCore::DragData::DragData): Added constructor that receives the name of the pasteboard to use.
        (WebCore::DragData::canSmartReplace):
        (WebCore::DragData::containsColor):
        (WebCore::DragData::containsFiles):
        (WebCore::DragData::asFilenames):
        (WebCore::DragData::containsPlainText):
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):
        All the following files have been modified to add the DragData
        parameter to isCopyKeyDown. I plan to improve this in the future
        and make isCopyKeyDown not platform specific.
        * page/android/DragControllerAndroid.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/brew/DragControllerBrew.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/chromium/DragControllerChromium.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/efl/DragControllerEfl.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/gtk/DragControllerGtk.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/haiku/DragControllerHaiku.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/mac/DragControllerMac.mm:
        (WebCore::DragController::isCopyKeyDown):
        (WebCore::DragController::dragOperation):
        * page/qt/DragControllerQt.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/win/DragControllerWin.cpp:
        (WebCore::DragController::isCopyKeyDown):
        * page/wx/DragControllerWx.cpp:
        (WebCore::DragController::isCopyKeyDown):

2011-01-13  David Kilzer  <ddkilzer@apple.com>

        Add missing MathMLElementFactory.h and MathMLNames.h to Xcode project

        Not reviewed.

        * WebCore.xcodeproj/project.pbxproj: Add missing headers.  Note
        that the corresponding source files were originally added to the
        project in r48559.

2011-01-12  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Use GC3D types in WebGLRenderingContext and related WebGL classes
        https://bugs.webkit.org/show_bug.cgi?id=51908

        * html/canvas/WebGLActiveInfo.h:
        (WebCore::WebGLActiveInfo::create):
        (WebCore::WebGLActiveInfo::type):
        (WebCore::WebGLActiveInfo::size):
        (WebCore::WebGLActiveInfo::WebGLActiveInfo):
        * html/canvas/WebGLBuffer.cpp:
        (WebCore::WebGLBuffer::associateBufferDataImpl):
        (WebCore::WebGLBuffer::associateBufferData):
        (WebCore::WebGLBuffer::associateBufferSubDataImpl):
        (WebCore::WebGLBuffer::associateBufferSubData):
        (WebCore::WebGLBuffer::byteLength):
        (WebCore::WebGLBuffer::getCachedMaxIndex):
        (WebCore::WebGLBuffer::setCachedMaxIndex):
        (WebCore::WebGLBuffer::setTarget):
        * html/canvas/WebGLBuffer.h:
        (WebCore::WebGLBuffer::getTarget):
        * html/canvas/WebGLFramebuffer.cpp:
        (WebCore::WebGLFramebuffer::setAttachment):
        (WebCore::WebGLFramebuffer::getAttachment):
        (WebCore::WebGLFramebuffer::getWidth):
        (WebCore::WebGLFramebuffer::getHeight):
        (WebCore::WebGLFramebuffer::getColorBufferFormat):
        (WebCore::WebGLFramebuffer::initializeRenderbuffers):
        * html/canvas/WebGLFramebuffer.h:
        * html/canvas/WebGLProgram.cpp:
        (WebCore::WebGLProgram::cacheActiveAttribLocations):
        (WebCore::WebGLProgram::numActiveAttribLocations):
        (WebCore::WebGLProgram::getActiveAttribLocation):
        (WebCore::WebGLProgram::isUsingVertexAttrib0):
        * html/canvas/WebGLProgram.h:
        (WebCore::WebGLProgram::getLinkCount):
        * html/canvas/WebGLRenderbuffer.h:
        (WebCore::WebGLRenderbuffer::setInternalFormat):
        (WebCore::WebGLRenderbuffer::getInternalFormat):
        (WebCore::WebGLRenderbuffer::setSize):
        (WebCore::WebGLRenderbuffer::getWidth):
        (WebCore::WebGLRenderbuffer::getHeight):
        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::initializeNewContext):
        (WebCore::WebGLRenderingContext::sizeInBytes):
        (WebCore::WebGLRenderingContext::activeTexture):
        (WebCore::WebGLRenderingContext::bindAttribLocation):
        (WebCore::WebGLRenderingContext::bindBuffer):
        (WebCore::WebGLRenderingContext::bindFramebuffer):
        (WebCore::WebGLRenderingContext::bindRenderbuffer):
        (WebCore::WebGLRenderingContext::bindTexture):
        (WebCore::WebGLRenderingContext::blendColor):
        (WebCore::WebGLRenderingContext::blendEquation):
        (WebCore::WebGLRenderingContext::blendEquationSeparate):
        (WebCore::WebGLRenderingContext::blendFunc):
        (WebCore::WebGLRenderingContext::blendFuncSeparate):
        (WebCore::WebGLRenderingContext::bufferData):
        (WebCore::WebGLRenderingContext::bufferSubData):
        (WebCore::WebGLRenderingContext::checkFramebufferStatus):
        (WebCore::WebGLRenderingContext::clear):
        (WebCore::WebGLRenderingContext::clearColor):
        (WebCore::WebGLRenderingContext::clearDepth):
        (WebCore::WebGLRenderingContext::clearStencil):
        (WebCore::WebGLRenderingContext::colorMask):
        (WebCore::WebGLRenderingContext::copyTexImage2D):
        (WebCore::WebGLRenderingContext::copyTexSubImage2D):
        (WebCore::WebGLRenderingContext::createShader):
        (WebCore::WebGLRenderingContext::cullFace):
        (WebCore::WebGLRenderingContext::deleteBuffer):
        (WebCore::WebGLRenderingContext::depthFunc):
        (WebCore::WebGLRenderingContext::depthMask):
        (WebCore::WebGLRenderingContext::depthRange):
        (WebCore::WebGLRenderingContext::disable):
        (WebCore::WebGLRenderingContext::disableVertexAttribArray):
        (WebCore::WebGLRenderingContext::validateElementArraySize):
        (WebCore::WebGLRenderingContext::validateIndexArrayConservative):
        (WebCore::WebGLRenderingContext::validateIndexArrayPrecise):
        (WebCore::WebGLRenderingContext::validateRenderingState):
        (WebCore::WebGLRenderingContext::drawArrays):
        (WebCore::WebGLRenderingContext::drawElements):
        (WebCore::WebGLRenderingContext::enable):
        (WebCore::WebGLRenderingContext::enableVertexAttribArray):
        (WebCore::WebGLRenderingContext::framebufferRenderbuffer):
        (WebCore::WebGLRenderingContext::framebufferTexture2D):
        (WebCore::WebGLRenderingContext::frontFace):
        (WebCore::WebGLRenderingContext::generateMipmap):
        (WebCore::WebGLRenderingContext::getActiveAttrib):
        (WebCore::WebGLRenderingContext::getActiveUniform):
        (WebCore::WebGLRenderingContext::getAttachedShaders):
        (WebCore::WebGLRenderingContext::getAttribLocation):
        (WebCore::WebGLRenderingContext::getBufferParameter):
        (WebCore::WebGLRenderingContext::getError):
        (WebCore::WebGLRenderingContext::getFramebufferAttachmentParameter):
        (WebCore::WebGLRenderingContext::getParameter):
        (WebCore::WebGLRenderingContext::getProgramParameter):
        (WebCore::WebGLRenderingContext::getRenderbufferParameter):
        (WebCore::WebGLRenderingContext::getShaderParameter):
        (WebCore::WebGLRenderingContext::getTexParameter):
        (WebCore::WebGLRenderingContext::getUniform):
        (WebCore::WebGLRenderingContext::getUniformLocation):
        (WebCore::WebGLRenderingContext::getVertexAttrib):
        (WebCore::WebGLRenderingContext::getVertexAttribOffset):
        (WebCore::WebGLRenderingContext::hint):
        (WebCore::WebGLRenderingContext::isBuffer):
        (WebCore::WebGLRenderingContext::isEnabled):
        (WebCore::WebGLRenderingContext::isFramebuffer):
        (WebCore::WebGLRenderingContext::isProgram):
        (WebCore::WebGLRenderingContext::isRenderbuffer):
        (WebCore::WebGLRenderingContext::isShader):
        (WebCore::WebGLRenderingContext::isTexture):
        (WebCore::WebGLRenderingContext::lineWidth):
        (WebCore::WebGLRenderingContext::linkProgram):
        (WebCore::WebGLRenderingContext::pixelStorei):
        (WebCore::WebGLRenderingContext::polygonOffset):
        (WebCore::WebGLRenderingContext::readPixels):
        (WebCore::WebGLRenderingContext::renderbufferStorage):
        (WebCore::WebGLRenderingContext::sampleCoverage):
        (WebCore::WebGLRenderingContext::scissor):
        (WebCore::WebGLRenderingContext::stencilFunc):
        (WebCore::WebGLRenderingContext::stencilFuncSeparate):
        (WebCore::WebGLRenderingContext::stencilMask):
        (WebCore::WebGLRenderingContext::stencilMaskSeparate):
        (WebCore::WebGLRenderingContext::stencilOp):
        (WebCore::WebGLRenderingContext::stencilOpSeparate):
        (WebCore::WebGLRenderingContext::texImage2DBase):
        (WebCore::WebGLRenderingContext::texImage2DImpl):
        (WebCore::WebGLRenderingContext::texImage2D):
        (WebCore::WebGLRenderingContext::texParameter):
        (WebCore::WebGLRenderingContext::texParameterf):
        (WebCore::WebGLRenderingContext::texParameteri):
        (WebCore::WebGLRenderingContext::texSubImage2DBase):
        (WebCore::WebGLRenderingContext::texSubImage2DImpl):
        (WebCore::WebGLRenderingContext::texSubImage2D):
        (WebCore::WebGLRenderingContext::uniform1f):
        (WebCore::WebGLRenderingContext::uniform1fv):
        (WebCore::WebGLRenderingContext::uniform1i):
        (WebCore::WebGLRenderingContext::uniform1iv):
        (WebCore::WebGLRenderingContext::uniform2f):
        (WebCore::WebGLRenderingContext::uniform2fv):
        (WebCore::WebGLRenderingContext::uniform2i):
        (WebCore::WebGLRenderingContext::uniform2iv):
        (WebCore::WebGLRenderingContext::uniform3f):
        (WebCore::WebGLRenderingContext::uniform3fv):
        (WebCore::WebGLRenderingContext::uniform3i):
        (WebCore::WebGLRenderingContext::uniform3iv):
        (WebCore::WebGLRenderingContext::uniform4f):
        (WebCore::WebGLRenderingContext::uniform4fv):
        (WebCore::WebGLRenderingContext::uniform4i):
        (WebCore::WebGLRenderingContext::uniform4iv):
        (WebCore::WebGLRenderingContext::uniformMatrix2fv):
        (WebCore::WebGLRenderingContext::uniformMatrix3fv):
        (WebCore::WebGLRenderingContext::uniformMatrix4fv):
        (WebCore::WebGLRenderingContext::vertexAttrib1f):
        (WebCore::WebGLRenderingContext::vertexAttrib1fv):
        (WebCore::WebGLRenderingContext::vertexAttrib2f):
        (WebCore::WebGLRenderingContext::vertexAttrib2fv):
        (WebCore::WebGLRenderingContext::vertexAttrib3f):
        (WebCore::WebGLRenderingContext::vertexAttrib3fv):
        (WebCore::WebGLRenderingContext::vertexAttrib4f):
        (WebCore::WebGLRenderingContext::vertexAttrib4fv):
        (WebCore::WebGLRenderingContext::vertexAttribPointer):
        (WebCore::WebGLRenderingContext::viewport):
        (WebCore::WebGLRenderingContext::getBooleanParameter):
        (WebCore::WebGLRenderingContext::getBooleanArrayParameter):
        (WebCore::WebGLRenderingContext::getFloatParameter):
        (WebCore::WebGLRenderingContext::getIntParameter):
        (WebCore::WebGLRenderingContext::getLongParameter):
        (WebCore::WebGLRenderingContext::getUnsignedLongParameter):
        (WebCore::WebGLRenderingContext::getWebGLFloatArrayParameter):
        (WebCore::WebGLRenderingContext::getWebGLIntArrayParameter):
        (WebCore::WebGLRenderingContext::isTexInternalFormatColorBufferCombinationValid):
        (WebCore::WebGLRenderingContext::getBoundFramebufferColorFormat):
        (WebCore::WebGLRenderingContext::validateTextureBinding):
        (WebCore::WebGLRenderingContext::validateSize):
        (WebCore::WebGLRenderingContext::validateTexFuncFormatAndType):
        (WebCore::WebGLRenderingContext::validateTexFuncLevel):
        (WebCore::WebGLRenderingContext::validateTexFuncParameters):
        (WebCore::WebGLRenderingContext::validateTexFuncData):
        (WebCore::WebGLRenderingContext::validateDrawMode):
        (WebCore::WebGLRenderingContext::validateStencilFunc):
        (WebCore::WebGLRenderingContext::validateFramebufferFuncParameters):
        (WebCore::WebGLRenderingContext::validateBlendEquation):
        (WebCore::WebGLRenderingContext::validateBlendFuncFactors):
        (WebCore::WebGLRenderingContext::validateCapability):
        (WebCore::WebGLRenderingContext::validateUniformParameters):
        (WebCore::WebGLRenderingContext::validateUniformMatrixParameters):
        (WebCore::WebGLRenderingContext::validateBufferDataParameters):
        (WebCore::WebGLRenderingContext::vertexAttribfImpl):
        (WebCore::WebGLRenderingContext::vertexAttribfvImpl):
        (WebCore::WebGLRenderingContext::simulateVertexAttrib0):
        * html/canvas/WebGLRenderingContext.h:
        (WebCore::WebGLRenderingContext::VertexAttribState::VertexAttribState):
        * html/canvas/WebGLShader.cpp:
        (WebCore::WebGLShader::create):
        (WebCore::WebGLShader::WebGLShader):
        * html/canvas/WebGLShader.h:
        (WebCore::WebGLShader::getType):
        * html/canvas/WebGLTexture.cpp:
        (WebCore::WebGLTexture::setTarget):
        (WebCore::WebGLTexture::setParameteri):
        (WebCore::WebGLTexture::setParameterf):
        (WebCore::WebGLTexture::setLevelInfo):
        (WebCore::WebGLTexture::generateMipmapLevelInfo):
        (WebCore::WebGLTexture::getInternalFormat):
        (WebCore::WebGLTexture::getType):
        (WebCore::WebGLTexture::getWidth):
        (WebCore::WebGLTexture::getHeight):
        (WebCore::WebGLTexture::isNPOT):
        (WebCore::WebGLTexture::mapTargetToIndex):
        (WebCore::WebGLTexture::computeLevelCount):
        (WebCore::WebGLTexture::update):
        (WebCore::WebGLTexture::getLevelInfo):
        * html/canvas/WebGLTexture.h:
        (WebCore::WebGLTexture::LevelInfo::setInfo):
        * html/canvas/WebGLUniformLocation.cpp:
        (WebCore::WebGLUniformLocation::create):
        (WebCore::WebGLUniformLocation::WebGLUniformLocation):
        (WebCore::WebGLUniformLocation::location):
        * html/canvas/WebGLUniformLocation.h:
        * platform/graphics/GraphicsContext3D.h: Map GC3Dboolean to bool instead of unsigned char.

2011-01-13  Jian Li  <jianli@chromium.org>

        Reviewed by Darin Fisher.

        Change createObjectURL and revokeObjectURL to put under webkitURL.
        https://bugs.webkit.org/show_bug.cgi?id=52257

        Note that we add "webkit" vendor prefix to URL that is introduced in
        the latest File API spec.

        For the time being, we implement webkitURL as a readonly attribute
        instead of a constructor so that we will not expose prototype property,
        as required by the spec.

        * Android.derived.jscbindings.mk:
        * Android.derived.v8bindings.mk:
        * Android.mk:
        * CMakeLists.txt:
        * DerivedSources.cpp:
        * DerivedSources.make:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pri:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * html/DOMURL.cpp: Added.
        * html/DOMURL.h: Added.
        * html/DOMURL.idl: Added.
        * inspector/front-end/NetworkPanel.js:
        * inspector/front-end/utilities.js:
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::webkitURL):
        * page/DOMWindow.h:
        * page/DOMWindow.idl:
        * workers/WorkerContext.cpp:
        (WebCore::WorkerContext::webkitURL):
        * workers/WorkerContext.h:
        * workers/WorkerContext.idl:

2011-01-13  Emil Eklund  <eae@chromium.org>

        Reviewed by Dimitri Glazkov.

        Setting outerText should convert CR/LF to <br>
        https://bugs.webkit.org/show_bug.cgi?id=52268

        Make set outerText support line breaks (sharing the text to fragment code
        with setInnerText) and handle empty text nodes the same way IE does.

        Test: fast/dom/set-outer-text.html

        * html/HTMLElement.cpp:
        (WebCore::HTMLElement::textToFragment): Shared between setInnerText and setOuterText
        (WebCore::HTMLElement::setInnerText): Split out text parsing code.
        (WebCore::mergeWithNextTextNode): Split out text node merging code.
        (WebCore::HTMLElement::setOuterText): Added support for line breaks.
        * html/HTMLElement.h:

2011-01-13  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Relax the ESSL valid charset a little bit to include " ' `
        https://bugs.webkit.org/show_bug.cgi?id=52396

        * html/canvas/WebGLRenderingContext.cpp:

2011-01-13  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        [chromium] Attempt to fix crash in tiled compositor memcpy
        https://bugs.webkit.org/show_bug.cgi?id=52379

        * platform/graphics/chromium/LayerTilerChromium.cpp:
        (WebCore::LayerTilerChromium::update):

2011-01-13  Dimitri Glazkov  <dglazkov@chromium.org>

        Unreviewed, rolling out r75725.
        http://trac.webkit.org/changeset/75725
        https://bugs.webkit.org/show_bug.cgi?id=52317

        Caused crashes in layout tests.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::initForStyleResolve):
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::updateType):
        * html/InputType.cpp:
        * html/InputType.h:
        * html/RangeInputType.cpp:
        * html/RangeInputType.h:
        * html/shadow/SliderThumbElement.cpp:
        (WebCore::SliderThumbElement::defaultEventHandler):
        (WebCore::SliderThumbElement::detach):
        * html/shadow/SliderThumbElement.h:
        (WebCore::SliderThumbElement::SliderThumbElement):
        (WebCore::SliderThumbElement::create):
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlInputElement::attach):
        (WebCore::MediaControlInputElement::updateStyle):
        * rendering/RenderSlider.cpp:
        (WebCore::RenderSlider::~RenderSlider):
        (WebCore::RenderSlider::styleDidChange):
        (WebCore::RenderSlider::createThumbStyle):
        (WebCore::RenderSlider::thumbRect):
        (WebCore::RenderSlider::layout):
        (WebCore::RenderSlider::updateFromElement):
        (WebCore::RenderSlider::mouseEventIsInThumb):
        (WebCore::RenderSlider::mouseEventOffsetToThumb):
        (WebCore::RenderSlider::setValueForPosition):
        (WebCore::RenderSlider::positionForOffset):
        (WebCore::RenderSlider::currentPosition):
        (WebCore::RenderSlider::trackSize):
        (WebCore::RenderSlider::forwardEvent):
        (WebCore::RenderSlider::inDragMode):
        * rendering/RenderSlider.h:

2011-01-12  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Darin Adler.

        Flip input[type=range] to use the new shadow DOM model.
        https://bugs.webkit.org/show_bug.cgi?id=52317

        This is a straight-up flip, minimal change to the logic, which will be
        refactored in a follow-up patch.

        Covered by existing tests.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::initForStyleResolve): Changed to use either
            host or parent node to find parent.
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::updateType): Added logic for destroying/creating
            shadow DOM subtree.
        * html/InputType.cpp:
        (WebCore::InputType::createShadowSubtree): Added empty decl.
        (WebCore::InputType::destroyShadowSubtree): Added a method to destroy
            shadow subtree.
        * html/InputType.h: Added defs.
        * html/RangeInputType.cpp:
        (WebCore::RangeInputType::createShadowSubtree): Added a virtual method to create
            slider thumb.
        * html/RangeInputType.h: Adde def.
        * html/shadow/SliderThumbElement.cpp: Added temporary RenderSliderThumb class
            to handle cascading appearance.
        (WebCore::RenderSliderThumb::RenderSliderThumb): Added.
        (WebCore::RenderSliderThumb::layout): Moved here the logic from
            RenderSlider::createThumbStyle.
        (WebCore::SliderThumbElement::createRenderer): Added virtual method to
            create RenderSliderThumb instance.
        (WebCore::SliderThumbElement::defaultEventHandler): Changed to use HTMLDivElement
            as base class.
        (WebCore::SliderThumbElement::detach): Ditto.
        * html/shadow/SliderThumbElement.h:
        (WebCore::SliderThumbElement::SliderThumbElement): Ditto.
        (WebCore::SliderThumbElement::create): Ditto.
        (WebCore::toSliderThumbElement): Added a casting helper.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlInputElement::attach): Added handling of shadow DOM,
            since the whole method is hand-rolled.
        (WebCore::MediaControlInputElement::updateStyle): Ditto.
        * rendering/RenderSlider.cpp:
        (WebCore::RenderSlider::~RenderSlider): Removed unneeded code.
        (WebCore::RenderSlider::thumbRect): Changed to use sliderThumbElement helper.
        (WebCore::RenderSlider::layout): Ditto.
        (WebCore::RenderSlider::sliderThumbElement): Added a temporary helper to access
            SliderThumbElement.
        (WebCore::RenderSlider::mouseEventIsInThumb): Changed to use sliderThumbElement helper.
        (WebCore::RenderSlider::mouseEventOffsetToThumb): Ditto.
        (WebCore::RenderSlider::setValueForPosition): Ditto.
        (WebCore::RenderSlider::positionForOffset): Ditto.
        (WebCore::RenderSlider::currentPosition): Ditto.
        (WebCore::RenderSlider::trackSize): Ditto.
        (WebCore::RenderSlider::forwardEvent): Ditto.
        (WebCore::RenderSlider::inDragMode): Ditto.
        * rendering/RenderSlider.h: Added def.

2011-01-13  Dan Bernstein  <mitz@apple.com>

        Reviewed by Simon Fraser.

        <rdar://problem/8098442> Crash in Widget::setFrameRect()
        https://bugs.webkit.org/show_bug.cgi?id=52375

        Test: plugins/destroy-on-setwindow.html

        * platform/mac/WidgetMac.mm:
        (WebCore::Widget::setFrameRect): Protect the Widget from being deleted as a result of calling
        out to the view.
        (WebCore::Widget::getOuterView): Coding style fix.
        (WebCore::Widget::paint): Protect the Widget from being deleted as a result of calling out to
        the views. This is precautionary, since this function does not applear to access member variables
        after such calls.
        * platform/wx/WidgetWx.cpp:
        (WebCore::Widget::setFrameRect): Protect the Widget from being deleted as a result of calling
        out to the platform widget.

2011-01-13  Csaba Osztrogonác  <ossy@webkit.org>

        Unreviewed buildfix after r75715.

        * WebCore.pri:
        * WebCore.pro:

2011-01-13  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: Qt build fix.

        * WebCore.pri:

2011-01-12  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: embed injected script into the backend.
        https://bugs.webkit.org/show_bug.cgi?id=52312

        InjectedScript belongs to the backend of the system and
        should be exposed by means of protocol, not InjectedScriptAccess.
        This patch makes injected script a part of the backend.
        It introduces single manual generation step (xxd -i) that should be
        automated by the build scripts for all the platforms.

        * CMakeLists.txt:
        * DerivedSources.make:
        * GNUmakefile.am:
        * WebCore.gyp/WebCore.gyp:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/JSInjectedScriptHostCustom.cpp:
        (WebCore::InjectedScriptHost::injectedScriptFor):
        * bindings/v8/custom/V8InjectedScriptHostCustom.cpp:
        (WebCore::InjectedScriptHost::injectedScriptFor):
        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::injectedScriptSource):
        * inspector/InjectedScriptHost.h:
        * inspector/Inspector.idl:
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreInspectorStateFromCookie):
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/InjectedScript.js: Removed.
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/inspector.html:
        * inspector/front-end/inspector.js:
        (WebInspector.doLoadedDone.propertyNamesCallback):
        (WebInspector.doLoadedDone):
        * inspector/xxd.pl: Added.

2011-01-13  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Timothy Hatcher.

        Web Inspector: Cleanup after r75613 -- make all UI-facing strings
        to be passed directly to WebInspector.UIString

        https://bugs.webkit.org/show_bug.cgi?id=52365

        * English.lproj/localizedStrings.js:
        * inspector/front-end/ApplicationCacheItemsView.js:
        (WebInspector.ApplicationCacheItemsView.prototype._updateCallback):
        (WebInspector.ApplicationCacheItemsView.prototype._populateDataGrid):
        * inspector/front-end/AuditRules.js:
        (WebInspector.AuditRules.GzipRule.prototype.doRun):
        (WebInspector.AuditRules.CookieSizeRule.prototype.processCookies):
        (WebInspector.AuditRules.StaticCookielessRule.prototype.processCookies):
        * inspector/front-end/BreakpointsSidebarPane.js:
        (WebInspector.EventListenerBreakpointsSidebarPane):
        (WebInspector.EventListenerBreakpointsSidebarPane.prototype._createCategory):
        * inspector/front-end/CookieItemsView.js:
        (WebInspector.CookieItemsView.prototype._updateWithCookies):
        * inspector/front-end/ImageView.js:
        (WebInspector.ImageView.prototype._createContentIfNeeded.onImageLoad):
        (WebInspector.ImageView.prototype._createContentIfNeeded):
        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkTimeCalculator.prototype.formatValue):
        (WebInspector.NetworkTransferTimeCalculator.prototype.formatValue):
        (WebInspector.NetworkTransferDurationCalculator.prototype.formatValue):
        * inspector/front-end/ProfileDataGridTree.js:
        (WebInspector.ProfileDataGridNode.prototype.get data.formatMilliseconds):
        (WebInspector.ProfileDataGridNode.prototype.get data):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource.Type.toUIString):
        (WebInspector.Resource.Type.toString):
        * inspector/front-end/TimelineOverviewPane.js:
        (WebInspector.TimelineOverviewCalculator.prototype.formatValue):
        * inspector/front-end/TimelinePanel.js:
        (WebInspector.TimelinePanel):
        (WebInspector.TimelineCalculator.prototype.formatValue):
        (WebInspector.TimelinePanel.FormattedRecord.prototype._generateAggregatedInfo):
        (WebInspector.TimelinePanel.FormattedRecord.prototype._generatePopupContent):
        (WebInspector.TimelinePanel.FormattedRecord.prototype._getRecordDetails):
        * inspector/front-end/utilities.js:
        ():

2011-01-13  Viatcheslav Ostapenko  <ostapenko.viatcheslav@nokia.com>

        Reviewed by Simon Hausmann.

        [Qt] Need a way to inform the application when a Netscape plugin is created.
        https://bugs.webkit.org/show_bug.cgi?id=30179

        Added "c" style static method for the application to hook up for
        receiving notifications when a plugin is created.

        * plugins/symbian/PluginViewSymbian.cpp:
        (qtwebkit_setPluginCreatedCallback):
        (WebCore::PluginView::platformStart):

2011-01-13  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Eric Seidel.

        [Qt] Use a black background color for the video element on Qt Mobile
        https://bugs.webkit.org/show_bug.cgi?id=52252

        Use black as the background color for the video element on Qt Mobile.

        * css/themeQtMobile.css:
        (video):

2011-01-13  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Eric Seidel.

        [Qt] Use a big central media play control button for video element 
        https://bugs.webkit.org/show_bug.cgi?id=52315

        When ChromeClient::requiresFullscreenForVideoPlayback() returns true,
        all other control buttons for the video element are hidden, except 
        a big centralized play button.

        No new tests because no client implements requiresFullscreenForVideoPlayback yet.

        * WebCore.pri:
        * css/mediaControlsQtFullscreen.css: Added.
        (audio):
        (audio::-webkit-media-controls-panel):
        (video::-webkit-media-controls-panel):
        (video:-webkit-full-page-media::-webkit-media-controls-panel):
        (audio::-webkit-media-controls-mute-button):
        (video::-webkit-media-controls-mute-button):
        (audio::-webkit-media-controls-play-button):
        (video::-webkit-media-controls-play-button):
        (audio::-webkit-media-controls-timeline-container):
        (video::-webkit-media-controls-timeline-container):
        (audio::-webkit-media-controls-current-time-display):
        (video::-webkit-media-controls-current-time-display):
        (audio::-webkit-media-controls-time-remaining-display, video::-webkit-media-controls-time-remaining-display):
        (audio::-webkit-media-controls-timeline):
        (video::-webkit-media-controls-timeline):
        (audio::-webkit-media-controls-volume-slider-container):
        (video::-webkit-media-controls-volume-slider-container):
        (audio::-webkit-media-controls-volume-slider):
        (video::-webkit-media-controls-volume-slider):
        (audio::-webkit-media-controls-seek-back-button, video::-webkit-media-controls-seek-back-button):
        (audio::-webkit-media-controls-seek-forward-button, video::-webkit-media-controls-seek-forward-button):
        (audio::-webkit-media-controls-fullscreen-button):
        (video::-webkit-media-controls-fullscreen-button):
        (audio::-webkit-media-controls-rewind-button, video::-webkit-media-controls-rewind-button):
        (audio::-webkit-media-controls-return-to-realtime-button, video::-webkit-media-controls-return-to-realtime-button):
        (audio::-webkit-media-controls-toggle-closed-captions-button, video::-webkit-media-controls-toggle-closed-captions-button):
        * platform/qt/RenderThemeQt.cpp:
        (WebCore::RenderThemeQt::extraMediaControlsStyleSheet):

2011-01-13  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Paint toggle buttons inconsistent when the object state is indeterminate
        https://bugs.webkit.org/show_bug.cgi?id=52361

        Check whether the object state is indeterminate to set the flag
        GTK_STATE_FLAG_INCONSISTENT before rendering check and radio
        buttons.

        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::paintToggle):

2011-01-13  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Simon Hausmann.

        [Qt] Extend the Platform Plugin to support full screen video handler
        https://bugs.webkit.org/show_bug.cgi?id=51249

        Make MediaPlayerPrivateQt support a fullscreen player.

        No new tests because LayoutTests/media/media-fullscreen-inline.html already exists.
        However, this test failed for Qt (QtMediaPlayer) due to durationchange event getting fired twice.
        So, still skip it for Qt.

        * WebCore.pro:
        * platform/graphics/qt/MediaPlayerPrivateQt.cpp:
        (WebCore::MediaPlayerPrivateQt::MediaPlayerPrivateQt):
        (WebCore::MediaPlayerPrivateQt::removeVideoItem):
        (WebCore::MediaPlayerPrivateQt::restoreVideoItem):
        * platform/graphics/qt/MediaPlayerPrivateQt.h:
        (WebCore::MediaPlayerPrivateQt::supportsFullscreen):
        (WebCore::MediaPlayerPrivateQt::mediaPlayer):

2011-01-13  Dan Bernstein  <mitz@apple.com>

        Reviewed by Dave Hyatt.

        <rdar://problem/8858548> Disable inheritance of text emphasis marks to ruby text
        https://bugs.webkit.org/show_bug.cgi?id=52359

        Test: fast/ruby/text-emphasis.html

        * css/html.css:
        (rt):

2011-01-13  Csaba Osztrogonác  <ossy@webkit.org>

        Rubber-stamped by David Levin.

        Trivial fix after r75682.

        * loader/FrameLoader.cpp: Remove accidentally committed debug code.
        (WebCore::FrameLoader::shouldClose):

2011-01-12  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        REGRESSION(r69831): focus() in onkeypress discards input (affects chaseonline.chase.com)
        https://bugs.webkit.org/show_bug.cgi?id=52241

        The bug was caused by RenderTextControl::selection's creating a Range with m_insertText
        which is a shadow DOM div as both start and end containers. Fixed the bug by traversing
        through the descendents of m_innerText and using the right start and end containers to
        create a Range.

        Test: fast/forms/focus-change-on-keypress.html

        * rendering/RenderTextControl.cpp:
        (WebCore::setContainerAndOffsetForRange): Added; a helper function.
        (WebCore::RenderTextControl::selection): See above.

2011-01-12  Kenichi Ishibashi  <bashi@google.com>

        Reviewed by Kent Tamura.

        M_formElementsWithFormAttribute not cleared when FormAssociatedElement is inserted with a null m_form and then removed.
        https://bugs.webkit.org/show_bug.cgi?id=51905

        Calls unregisterFormElementWithFormAttribute() when 'form' attribute
        is removed.

        Tests: fast/forms/form-associated-element-crash.html
               fast/forms/form-associated-element-crash2.html

        * html/FormAssociatedElement.cpp:
        (WebCore::FormAssociatedElement::formAttributeChanged):

2011-01-12  Kenichi Ishibashi  <bashi@google.com>

        Reviewed by Kent Tamura.

        M_formElementsWithFormAttribute not cleared when Node is moved to another document.
        https://bugs.webkit.org/show_bug.cgi?id=51418

        Calls unregisterFormElementWithFormAttribute() when form associated elements
        are moved to another document.

        Test: fast/forms/change-form-element-document-crash.html

        * html/FormAssociatedElement.cpp:
        (WebCore::FormAssociatedElement::willMoveToNewOwnerDocument): Added.
        * html/FormAssociatedElement.h: Added willMoveToNewOwnerDocument().
        * html/HTMLFormControlElement.cpp:
        (WebCore::HTMLFormControlElement::willMoveToNewOwnerDocument): Added.
        * html/HTMLFormControlElement.h: Added willMoveToNewOwnerDocument().
        * html/HTMLObjectElement.cpp:
        (WebCore::HTMLObjectElement::willMoveToNewOwnerDocument): Added.
        * html/HTMLObjectElement.h: Added willMoveToNewOwnerDocument().
        * html/HTMLPlugInImageElement.h: Moves willMoveToNewOwnerDocument() to protected.

2011-01-12  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        Stop instantiating legacy editing positions in ApplyBlockElementCommand and ApplyStyleCommand
        https://bugs.webkit.org/show_bug.cgi?id=52250

        Removed instantiation of legacy editing positions.
        Calls to Position::Position are replaced by calls to Position's convenience functions.

        Also added firstPositionInOrBeforeNode and lastPositionInOrAfterNode,
        which are functions that return firstPositionInNode and lastPositionInNode respectively
        when the specified node can have children for editing purpose and return positionBeforeNode
        and positionAfterNode respectively otherwise. They can be used to guarantee that we never
        create a bogus position like [img, 0] or [br, 0].

        No tests are added since this is a cleanup.

        * editing/ApplyBlockElementCommand.cpp:
        (WebCore::ApplyBlockElementCommand::formatSelection):
        * editing/ApplyStyleCommand.cpp:
        (WebCore::ApplyStyleCommand::applyBlockStyle):
        (WebCore::ApplyStyleCommand::fixRangeAndApplyInlineStyle):
        (WebCore::ApplyStyleCommand::highestAncestorWithConflictingInlineStyle):
        (WebCore::ApplyStyleCommand::removeInlineStyle):
        (WebCore::ApplyStyleCommand::nodeFullySelected):
        (WebCore::ApplyStyleCommand::nodeFullyUnselected):
        (WebCore::ApplyStyleCommand::splitTextAtStart):
        (WebCore::ApplyStyleCommand::splitTextAtEnd):
        (WebCore::ApplyStyleCommand::splitTextElementAtStart):
        (WebCore::ApplyStyleCommand::splitTextElementAtEnd):
        (WebCore::ApplyStyleCommand::isValidCaretPositionInTextNode):
        (WebCore::ApplyStyleCommand::mergeStartWithPreviousIfIdentical):
        (WebCore::ApplyStyleCommand::mergeEndWithNextIfIdentical):
        (WebCore::ApplyStyleCommand::computedFontSize):
        (WebCore::ApplyStyleCommand::joinChildTextNodes):
        * editing/ApplyStyleCommand.h:
        * editing/htmlediting.h:
        (WebCore::firstPositionInOrBeforeNode): Added.
        (WebCore::lastPositionInOrAfterNode): Added.

2011-01-12  Sam Weinig  <sam@webkit.org>

        Another build fix.

        * platform/mac/WheelEventMac.mm:
        (WebCore::phaseForEvent):

2011-01-12  Sam Weinig  <sam@webkit.org>

        Fix build.

        * platform/mac/WheelEventMac.mm:
        (WebCore::phaseForEvent):

2011-01-12  Adam Barth  <abarth@webkit.org>

        Reviewed by Darin Adler.

        Remove premature optimization from SchemeRegistry
        https://bugs.webkit.org/show_bug.cgi?id=52283

        As far as I can tell, this optimization isn't necessary.  I'm slightly
        unsure which benchmarks to run to demonstrate this numerically, but
        none of the benchmarks Chromium tracks were affected by adding a
        similar check for "display-isolated" schemes.

        * platform/SchemeRegistry.cpp:
        (WebCore::SchemeRegistry::shouldTreatURLSchemeAsLocal):

2011-01-12  Beth Dakin  <bdakin@apple.com>

        Reviewed by Anders Carlsson.

        Add-on for https://bugs.webkit.org/show_bug.cgi?id=52309 
        Expose fixed layout through WebKit SPI
        -and corresponding-
        <rdar://problem/8844464>

        And now with getters!
        * WebCore.exp.in:

2011-01-12  Sam Weinig  <sam@webkit.org>

        Reviewed by Anders Carlsson.

        https://bugs.webkit.org/show_bug.cgi?id=52337
        PlatformWheelEvent should know about the scroll phase on the Mac

        Add a phase parameter on Mac PlatformWheelEvents.

        * platform/PlatformWheelEvent.h:
        (WebCore::PlatformWheelEvent::PlatformWheelEvent):
        (WebCore::PlatformWheelEvent::phase):
        * platform/mac/WheelEventMac.mm:
        (WebCore::phaseForEvent):
        (WebCore::PlatformWheelEvent::PlatformWheelEvent):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        A couple of lines of the patch for https://bugs.webkit.org/show_bug.cgi?id=52321
        were omitted. 

        * platform/graphics/ca/GraphicsLayerCA.cpp:
        (WebCore::GraphicsLayerCA::commitLayerChangesBeforeSublayers):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Getting rid of an assert that was causing build failures that turns out not to be needed.

        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::paintsWithTransform):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Another fix for Gtk

        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::paintsWithTransform):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Fix for Gtk and Windows builds

        * page/Frame.cpp:
        (WebCore::Frame::scalePage):
        * page/Frame.h:
        * platform/graphics/ca/win/PlatformCALayerWin.cpp:
        (PlatformCALayer::contentsScale):
        (PlatformCALayer::setContentsScale):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        UNreviewed.

        Fix for the Windows build

        * platform/graphics/ca/win/PlatformCALayerWin.cpp:
        (contentsScale):
        (setContentsScale):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Another build fix

        * platform/graphics/ca/GraphicsLayerCA.cpp:
        (WebCore::GraphicsLayerCA::clampedContentsScaleForScale):
        * platform/graphics/ca/mac/PlatformCALayerMac.mm:
        (PlatformCALayer::setContentsScale):

2011-01-11  Matthew Delaney  <mdelaney@apple.com>

        Reviewed by Simon Fraser.

        Max area bound needed in creation of IOSurface in ImageBufferCG.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52172

        Tests: fast/canvas/canvas-large-dimensions.html

        * platform/graphics/cg/ImageBufferCG.cpp:
        (WebCore::ImageBuffer::ImageBuffer):

2011-01-12  Daniel Bates  <dbates@rim.com>
            And Benjamin C Meyer  <bmeyer@rim.com>

        Build fix when building with Inspector disabled
        https://bugs.webkit.org/show_bug.cgi?id=52313

        After changeset 75604 <http://trac.webkit.org/changeset/75604> it's not
        possible to build when the Inspector is disabled.

        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::updateApplicationCacheStatus): Fix build breakage when building
        with Inspector disabled and Offline Web Applications enabled by moving macro guard condition
        ENABLE(INSPECTOR) && ENABLE(OFFLINE_WEB_APPLICATIONS) into function body. This makes us also
        consistent with the form we use for InspectorInstrumentation::networkStateChanged() and other
        InspectorInstrumentation functions.
        * loader/appcache/ApplicationCacheGroup.cpp:
        (WebCore::ApplicationCacheGroup::didReceiveData): Fix build breakage when building with Inspector
        disabled by adding ENABLE(INSPECTOR) guard around code that references the instance variable
        ApplicationCacheGroup::m_currentResourceIdentifier as this variable only exists when building
        with the Inspector.
        (WebCore::ApplicationCacheGroup::didFinishLoading): Ditto.
        (WebCore::ApplicationCacheGroup::didFail): Ditto.

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Fix a build issue from http://trac.webkit.org/changeset/75639.

        * platform/graphics/GraphicsLayer.h:
        (WebCore::GraphicsLayer::contentsScale):
        (WebCore::GraphicsLayer::setContentsScale):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Reviewed by Kevin Decker.

        Pages with accelerated layers lose subpixel-AA and become blurry when a scale factor is applied
        rdar://problem/8824974

        This prevents the rootLayer (with the WebKit rendered content) from going becoming
        a tiled layer when zoomed, and when there is other layered content on the page.
        This speeds up zooming a lot and avoids some buggy behavior in CA with a very large
        number of layers.
        
        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::paintsWithTransform):
        * rendering/RenderLayer.h:
        * rendering/RenderLayerBacking.cpp:
        (WebCore::RenderLayerBacking::paintingGoesToWindow):

2011-01-12  Chris Marrin  <cmarrin@apple.com>

        Reviewed by Simon Fraser.
        
        Pages with accelerated layers lose subpixel-AA and become blurry when a scale factor is applied
        rdar://problem/8824974

        When scaled, WebKit renders the page content at the scaled up size, so there are no
        scaling artifacts. But content drawn into a layer's backing store does not scale up.
        This is made worse by the fact that the root page contents become layered when there
        are other accelerated compositing layers present (video, plugins, etc.).
        
        Plumb scaling factor from Frame::scalePage() down into all layers with content. It
        eventually calls CALayer::setContentsScale which renders to a backing store whose dimensions
        are scaled, causing them to render larger and appear pixel perfect at the scaled
        page size.
 
         * page/Frame.cpp:
         (WebCore::Frame::updateContentsScale):
         (WebCore::Frame::scalePage):
         * page/Frame.h:
         * platform/graphics/GraphicsLayer.h:
         * platform/graphics/ca/GraphicsLayerCA.cpp:
         (WebCore::GraphicsLayerCA::setContentsScale):
         (WebCore::GraphicsLayerCA::clampedContentsScaleForScale):
         * platform/graphics/ca/GraphicsLayerCA.h:
         (WebCore::GraphicsLayerCA::contentsScale):
         * platform/graphics/ca/PlatformCALayer.h:
         * platform/graphics/ca/mac/PlatformCALayerMac.mm:
         (PlatformCALayer::contentsScale):
         (PlatformCALayer::setContentsScale):
         * rendering/RenderLayer.cpp:
         (WebCore::RenderLayer::updateContentsScale):
         * rendering/RenderLayer.h:
         * rendering/RenderLayerBacking.cpp:
         (WebCore::RenderLayerBacking::createGraphicsLayer):
         (WebCore::RenderLayerBacking::updateForegroundLayer):
         (WebCore::RenderLayerBacking::updateMaskLayer):
         (WebCore::RenderLayerBacking::updateContentsScale):
         * rendering/RenderLayerBacking.h:
         * rendering/RenderLayerCompositor.cpp:
         (WebCore::RenderLayerCompositor::updateContentsScale):
         * rendering/RenderLayerCompositor.h:
 
2011-01-12  Stephen White  <senorblanco@chromium.org>

        Reviewed by James Robinson.

        Fix DrawingBuffer issues for depth/stencil, extensions, etc.
        https://bugs.webkit.org/show_bug.cgi?id=52310

        1)  GL_TEXTURE is not a valid argument to glFramebufferTexture2D()
        (should be GL_TEXTURE_2D).
        2)  Support for the multisampling extension was being checked after
        the DrawingBuffer constructor was called, which calls multisample()
        to check for the extension.
        3)  If depth or stencil is set, the corresponding framebuffers must
        be created in the DrawingBuffer constructor.
        4)  GL_DEPTH_STENCIL is not a valid framebuffer internal type in
        GLES2.  Must use GL_OES_DEPTH24_STENCIL8, and check for the
        OES_packed_depth_stencil extension.

        * platform/graphics/chromium/DrawingBufferChromium.cpp:
        (WebCore::DrawingBuffer::DrawingBuffer):
        Record the extension support in the constructor.  Create all the
        secondary drawing buffers (for multisampling, depth/stencil).
        * platform/graphics/gpu/DrawingBuffer.cpp:
        (WebCore::DrawingBuffer::create):
        Check for the extensions before calling the DrawingBuffer constructor.
        (WebCore::DrawingBuffer::createSecondaryBuffers):
        Refactor creation of the secondary buffers from DrawingBufferMac.mm to
        here.
        (WebCore::DrawingBuffer::reset):
        Use DEPTH24_STENCIL8 format, not DEPTH_STENCIL.  Use
        DEPTH_COMPONENT16, not DEPTH_COMPONENT.
        Use GL_TEXTURE_2D, not GL_TEXTURE (for glFramebufferTexture2D).
        * platform/graphics/gpu/DrawingBuffer.h:
        Refactor createSecondaryBuffers().  Add extension support arguments to
        constructor.  Add support for packed_depth_stencil extension.
        * platform/graphics/gpu/mac/DrawingBufferMac.mm:
        (WebCore::DrawingBuffer::DrawingBuffer):
        Record extension support in constructor.  Refactor out creation of
        secondary buffers.

2011-01-12  Beth Dakin  <bdakin@apple.com>

        Reviewed by Anders Carlsson.

        Fix for https://bugs.webkit.org/show_bug.cgi?id=52309 Expose
        fixed layout through WebKit SPI
        -and corresponding-
        <rdar://problem/8844464>

        Export symbols for ScrollView::setUseFixedLayout() and 
        ScrollView::setFixedLayoutSize()
        * WebCore.exp.in:

2011-01-12  Robert Hogan  <robert@webkit.org>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Search input field doesn't have cancel button

        Add a cancel button to the search field and make it customizable
        by the client. For now, use the close dialog button associated
        with the application's style as the default.

        Unskip a bunch of search field related tests that pass now:

        fast/forms/search-cancel-button-mouseup.html
        fast/forms/search-rtl.html
        fast/forms/search-abs-pos-cancel-button.html
        fast/forms/search-styled.html
        fast/forms/search-transformed.html
        fast/forms/search-zoomed.html
        fast/forms/search-cancel-button-style-sharing.html
        fast/forms/search-display-none-cancel-button.html
        fast/forms/search-placeholder-value-changed.html
        fast/repaint/search-field-cancel.html
        fast/forms/search-cancel-button-events.html

        https://bugs.webkit.org/show_bug.cgi?id=42887

        * platform/graphics/qt/ImageQt.cpp:
        (loadResourcePixmap):
        * platform/qt/RenderThemeQt.cpp:
        (WebCore::RenderThemeQt::isControlStyled):
        (WebCore::RenderThemeQt::computeSizeBasedOnStyle):
        (WebCore::RenderThemeQt::paintSearchField):
        (WebCore::RenderThemeQt::adjustSearchFieldStyle):
        (WebCore::RenderThemeQt::adjustSearchFieldCancelButtonStyle):
        (WebCore::RenderThemeQt::convertToPaintingRect):
        (WebCore::RenderThemeQt::paintSearchFieldCancelButton):
        * platform/qt/RenderThemeQt.h:

2011-01-12  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: cookie table is multiplied after repeated switching to cookies tab in network item view
        Only create cookiesTable is it hasn't been done yet.
        https://bugs.webkit.org/show_bug.cgi?id=52303

        * inspector/front-end/ResourceCookiesView.js:
        (WebInspector.ResourceCookiesView.prototype.show):

2011-01-12  Koan-Sin Tan  <koansin.tan@gmail.com>

        Reviewed by Martin Robinson.

        [Gtk] WebKitGtk+ doesn't build on Mac OS X 10.6
        https://bugs.webkit.org/show_bug.cgi?id=50867

        * config.h: Don't disallow ctype for (OS(DARWIN) && PLATFORM(GTK))
        Many GTK+ related files include <libintl.h> or <glib/gi18n-lib.h>.
        On Mac, <libintl.h> includes <xlocale.h>. <xclocale.h> includes 
        <xlocale/_ctype.h>, which uses isacii().
        * platform/UUID.cpp:
        (WebCore::createCanonicalUUIDString): For OS(DARWIN) && !PLATFORM(CF)
        use the Chromium Linux UUID generation.

2011-01-12  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Eric Seidel.

        [CSS Gradients] One color stop should not paint anything for linear-gradient
        https://bugs.webkit.org/show_bug.cgi?id=52259
        
        Share color stop parsing code between linear and radial gradients.
        Consider the gradient invalid if it has less than two color stops.

        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseLinearGradient):
        (WebCore::CSSParser::parseRadialGradient):
        (WebCore::CSSParser::parseGradientColorStops):
        * css/CSSParser.h:

2011-01-12  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Pavel Feldman.

        Fix inconsistencies in Inspector strings found by the new check-inspector-strings script.

        https://bugs.webkit.org/show_bug.cgi?id=52295

        * English.lproj/localizedStrings.js:
        * inspector/front-end/BreakpointsSidebarPane.js:
        (WebInspector.EventListenerBreakpointsSidebarPane):
        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel.prototype.setRecordingProfile):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource.Type.toString):
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourceRevisionTreeElement):
        * inspector/front-end/utilities.js:
        ():

2011-01-12  Yury Semikhatsky  <yurys@chromium.org>

        Unreviewed. Fix WML compilation on Mac.

        * wml/WMLInputElement.cpp:
        (WebCore::WMLInputElement::setValue):
        (WebCore::WMLInputElement::setValueForUser):
        (WebCore::WMLInputElement::initialize):
        (WebCore::WMLInputElement::validateInputMask):
        * wml/WMLSelectElement.cpp:
        (WebCore::WMLSelectElement::listBoxSelectItem):

2011-01-12  Justin Schuh  <jschuh@chromium.org>

        Unreviewed build fix for debug strict compiles.

        Use fprintf for debug statements instead of fwrite, which caused compile failures
        in debug strict mode because of failure to check the fwrite return value.

        No behavior changed.

        * rendering/CounterNode.cpp:
        (WebCore::showTreeAndMark):

2010-12-29  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Pavel Feldman.

        inspector/timeline-network-resource.html fails when run twice
        https://bugs.webkit.org/show_bug.cgi?id=37394

        Send didReceiveResponse notification to the timeline agent from ResourceLoadNotifier
        instead of ResourceLoader::didReceiveResponse to cover the cases when resources
        are loaded from memory cache.

        Network notifications are now sent to InspectorInstrumentation which dispatches
        them to interested agents and InspectorController.

        * inspector/Inspector.idl:
        * inspector/InspectorApplicationCacheAgent.cpp:
        (WebCore::InspectorApplicationCacheAgent::didReceiveManifestResponse):
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::didCommitLoad):
        (WebCore::InspectorController::willSendRequest):
        (WebCore::InspectorController::didReceiveResponse):
        (WebCore::InspectorController::didFailLoading):
        (WebCore::InspectorController::resourceRetrievedByXMLHttpRequest):
        * inspector/InspectorController.h:
        * inspector/InspectorInstrumentation.cpp:
        (WebCore::InspectorInstrumentation::identifierForInitialRequestImpl):
        (WebCore::InspectorInstrumentation::willSendRequestImpl):
        (WebCore::InspectorInstrumentation::markResourceAsCachedImpl):
        (WebCore::InspectorInstrumentation::didLoadResourceFromMemoryCacheImpl):
        (WebCore::InspectorInstrumentation::willReceiveResourceResponseImpl):
        (WebCore::InspectorInstrumentation::didReceiveContentLengthImpl):
        (WebCore::InspectorInstrumentation::didFinishLoadingImpl):
        (WebCore::InspectorInstrumentation::didFailLoadingImpl):
        (WebCore::InspectorInstrumentation::resourceRetrievedByXMLHttpRequestImpl):
        (WebCore::InspectorInstrumentation::scriptImportedImpl):
        (WebCore::InspectorInstrumentation::retrieveResourceAgent):
        * inspector/InspectorInstrumentation.h:
        (WebCore::InspectorInstrumentation::identifierForInitialRequest):
        (WebCore::InspectorInstrumentation::willSendRequest):
        (WebCore::InspectorInstrumentation::markResourceAsCached):
        (WebCore::InspectorInstrumentation::didLoadResourceFromMemoryCache):
        (WebCore::InspectorInstrumentation::willReceiveResourceResponse):
        (WebCore::InspectorInstrumentation::didReceiveContentLength):
        (WebCore::InspectorInstrumentation::didFinishLoading):
        (WebCore::InspectorInstrumentation::didFailLoading):
        (WebCore::InspectorInstrumentation::resourceRetrievedByXMLHttpRequest):
        (WebCore::InspectorInstrumentation::scriptImported):
        * inspector/InspectorResourceAgent.cpp:
        (WebCore::InspectorResourceAgent::identifierForInitialRequest):
        * inspector/InspectorResourceAgent.h:
        * inspector/InspectorTimelineAgent.cpp:
        (WebCore::InspectorTimelineAgent::willSendResourceRequest):
        * inspector/InspectorTimelineAgent.h:
        * inspector/TimelineRecordFactory.cpp:
        (WebCore::TimelineRecordFactory::createResourceSendRequestData):
        * inspector/TimelineRecordFactory.h:
        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager.prototype.identifierForInitialRequest):
        * inspector/front-end/TimelinePanel.js:
        (WebInspector.TimelinePanel.prototype.addRecordToTimeline):
        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::loadedResourceFromMemoryCache):
        * loader/ResourceLoadNotifier.cpp:
        (WebCore::ResourceLoadNotifier::didReceiveResponse):
        (WebCore::ResourceLoadNotifier::didFailToLoad):
        (WebCore::ResourceLoadNotifier::assignIdentifierToInitialRequest):
        (WebCore::ResourceLoadNotifier::dispatchWillSendRequest):
        (WebCore::ResourceLoadNotifier::dispatchDidReceiveResponse):
        (WebCore::ResourceLoadNotifier::dispatchDidReceiveContentLength):
        (WebCore::ResourceLoadNotifier::dispatchDidFinishLoading):
        (WebCore::ResourceLoadNotifier::sendRemainingDelegateMessages):
        * loader/ResourceLoader.cpp:
        (WebCore::ResourceLoader::didReceiveResponse):
        * loader/appcache/ApplicationCacheGroup.cpp:
        (WebCore::ApplicationCacheGroup::createResourceHandle):
        (WebCore::ApplicationCacheGroup::didReceiveResponse):
        (WebCore::ApplicationCacheGroup::didReceiveData):
        (WebCore::ApplicationCacheGroup::didFinishLoading):
        (WebCore::ApplicationCacheGroup::didFail):
        * loader/appcache/ApplicationCacheGroup.h:
        * workers/DefaultSharedWorkerRepository.cpp:
        (WebCore::SharedWorkerScriptLoader::notifyFinished):
        * workers/Worker.cpp:
        (WebCore::Worker::notifyFinished):
        * workers/WorkerContext.cpp:
        (WebCore::WorkerContext::importScripts):
        * xml/XMLHttpRequest.cpp:
        (WebCore::XMLHttpRequest::didFinishLoading):

2011-01-12  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: do not replace all tabs with spaces when editing script source
        https://bugs.webkit.org/show_bug.cgi?id=52291

        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype.setContent):
        (WebInspector.SourceFrame.prototype._editLine):

2011-01-11  Jeremy Orlow  <jorlow@chromium.org>

        Reviewed by Nate Chapin.

        Enforce READ_ONLY transactions in IndexedDB
        https://bugs.webkit.org/show_bug.cgi?id=52229

        Add READ_ONLY_ERR and return it whenever delete or put
        are called.  Note that IDBCursor's delete and update
        are simply aliases for delete/put, which is why no
        extra code is required to handle those cases.

        Test: storage/indexeddb/transaction-read-only.html

        * dom/ExceptionCode.cpp:
        * storage/IDBCursorBackendImpl.cpp:
        (WebCore::IDBCursorBackendImpl::deleteFunction):
        * storage/IDBDatabase.idl:
        * storage/IDBDatabaseException.h:
        * storage/IDBDatabaseException.idl:
        * storage/IDBObjectStoreBackendImpl.cpp:
        (WebCore::IDBObjectStoreBackendImpl::put):
        (WebCore::IDBObjectStoreBackendImpl::deleteFunction):
        (WebCore::IDBObjectStoreBackendImpl::deleteIndex):

2011-01-11  Philippe Normand  <pnormand@igalia.com>

        Reviewed by Eric Seidel.

        [GTK] minimal build breaks in RenderThemeGtk3
        https://bugs.webkit.org/show_bug.cgi?id=52202

        * platform/gtk/RenderThemeGtk3.cpp: Added VIDEO guards around
        initMediaColors().

2011-01-11  Philippe Normand  <pnormand@igalia.com>

        Reviewed by Eric Carlson.

        [GStreamer] PlatformVideoWindowMac implementation
        https://bugs.webkit.org/show_bug.cgi?id=50770

        This new implementation will be used on Mac OS to display the
        fullscreen video window with the GStreamer-based media player.

        * platform/graphics/gstreamer/GStreamerGWorld.cpp:
        (WebCore::gstGWorldSyncMessageCallback):
        * platform/graphics/gstreamer/PlatformVideoWindow.h:
        (WebCore::PlatformVideoWindow::window):
        * platform/graphics/gstreamer/PlatformVideoWindowMac.mm:
        (PlatformVideoWindow::PlatformVideoWindow):
        (PlatformVideoWindow::~PlatformVideoWindow):
        (PlatformVideoWindow::prepareForOverlay):

2011-01-11  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dan Bernstein.

        Webkit crashes when a gradient is applied using the first-line pseudo element
        https://bugs.webkit.org/show_bug.cgi?id=52225
        
        When a pseudostyle references images, we fail to register/unregister
        the relevant RenderObjects as clients of the image in the style.
        For gradients, this caused a crash.
        
        This patch fixes the crash by returning a null gradient image in this
        situation.

        Test: fast/gradients/gradient-on-pseudoelement-crash.html

        * css/CSSGradientValue.cpp:
        (WebCore::CSSGradientValue::image):

2011-01-11  Andy Estes  <aestes@apple.com>

        Reviewed by Darin Adler.

        REGRESSION (r71562): servePendingRequests() no longer called when
        resources are done loading.
        https://bugs.webkit.org/show_bug.cgi?id=52264
        <rdar://problem/8767429>
        
        In r71562, servePendingRequests() is no longer called in Loader's
        didFinishLoading(), didFail() and didReceiveResponse() methods. Since
        r71562 was intended only as a refactoring, these calls should be
        restored. At least one WebKit-based Mac OS X application relies on this
        for correct behavior.

        * loader/cache/CachedResourceLoader.cpp:
        (WebCore::CachedResourceLoader::loadDone): Call
        resourceLoadScheduler()->servePendingRequests().

2011-01-11  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Eric Seidel.

        Add Document::setContent()
        https://bugs.webkit.org/show_bug.cgi?id=52085

        Add a method to Document to set the whole content at once.
        This removes the hack of the insert method in the xml parser
        and is a predecessor to feed the xml parser with raw data.

        * dom/Document.cpp:
        (WebCore::Document::setContent):
        * dom/Document.h:
        * dom/XMLDocumentParser.cpp:
        (WebCore::XMLDocumentParser::insert): Added ASSERT_NOT_REACHED().
        * loader/cache/CachedFont.cpp:
        (WebCore::CachedFont::ensureSVGFontData): Use setContent.
        * xml/DOMParser.cpp:
        (WebCore::DOMParser::parseFromString): Ditto.
        * xml/XMLHttpRequest.cpp:
        (WebCore::XMLHttpRequest::responseXML): Ditto.
        * xml/XSLTProcessor.cpp:
        (WebCore::XSLTProcessor::createDocumentFromSource): Ditto.

2011-01-11  Brent Fulgham  <bfulgham@webkit.org>

        Unreviewed build fix.

        * platform/graphics/cairo/PathCairo.cpp:
        (WebCore::Path::addArc): Switch to MathExtra's piFloat define,
        rather than M_PI which is not always available.

2011-01-11  Nicolas Dufresne  <nicolas.dufresne@collabora.co.uk>

        Reviewed by Adam Barth.

        Use plug-in DB for extensions to MIME type convertion

        Plugins extension to MIME type conversion was not used in the
        frameLoader. This was causing some fallback to be use which as the side
        effect of loosing all the <OBJECT> parameters or <EMBED> attributes.
        This patch ensure that we try to convert the extension to MIME type
        using the plugin database beofre using this fallback.

        Attribute lost with Flash plugin without mime type set
        https://bugs.webkit.org/show_bug.cgi?id=50657

        Test: plugins/no-mime-with-valid-extension.html

        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::defaultObjectContentType): Use PluginDatabase for MIME

2011-01-11  James Simonsen  <simonjam@chromium.org>

        Reviewed by Eric Seidel.

        [Web Timing] Rename sslHandshakeStart to secureConnectionStart
        https://bugs.webkit.org/show_bug.cgi?id=52239

        * page/PerformanceTiming.cpp:
        (WebCore::PerformanceTiming::secureConnectionStart):
        * page/PerformanceTiming.h:
        * page/PerformanceTiming.idl:

2011-01-11  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        Introduce the notion of a "display-isolated" URL scheme for use by
        Chrome-internal URLs
        https://bugs.webkit.org/show_bug.cgi?id=50182

        This patch actually makes the display-isolated schemes display
        isolated.  The behavior should be the same as the previous iteration of
        this patch, but re-organized a bit because reading the access white
        list is expensive.

        * page/SecurityOrigin.cpp:
        (WebCore::SecurityOrigin::isAccessToURLWhiteListed):
        (WebCore::SecurityOrigin::canDisplay):
        * page/SecurityOrigin.h:
        * platform/SchemeRegistry.cpp:
        * platform/SchemeRegistry.h:

2011-01-11  Mihai Parparita  <mihaip@chromium.org>

        Reviewed by Darin Fisher.

        Scroll event should be fired asynchronously
        https://bugs.webkit.org/show_bug.cgi?id=45631

        Tests: fast/events/fire-scroll-event.html
               fast/events/fire-scroll-event-element.html
               fast/events/scroll-event-phase.html

        Makes scroll events fire asynchronously to be in compliance with the
        CSSOM View Module and consistent with Gecko, Opera and (to some degree)
        IE.
        
        Implemented via the EventQueue class added by r74062 (EventQueue now
        has a convenience enqueueScrollEvent method).

        * dom/EventQueue.cpp:
        (WebCore::EventQueue::enqueueScrollEvent):
        (WebCore::EventQueue::pendingEventTimerFired):
        * dom/EventQueue.h:
        * page/EventHandler.cpp:
        (WebCore::EventHandler::sendScrollEvent):
        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::scrollToOffset):
        * rendering/RenderListBox.cpp:
        (WebCore::RenderListBox::valueChanged):

2011-01-11  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r75523.

        * platform/wince/DragDataWinCE.cpp: Added missing include.

2011-01-11  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Dimitri Glazkov.

        RefPtr the FrameView to prevent scrollbar from getting deleted inside
        its scroll event.
        https://bugs.webkit.org/show_bug.cgi?id=52238

        Test: scrollbars/scrollable-iframe-remove-crash.html

        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::scrollTo):

2011-01-08  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by David Hyatt.

        Make pseudo-style resolution less hard-coded when used to select a shadow node
        https://bugs.webkit.org/show_bug.cgi?id=46595

        Essentially implements the plumbing for the XBL2 pseudo attribute:
        http://dev.w3.org/2006/xbl2/#the-pseudo-attribute

        Test: fast/css/unknown-pseudo-element-matching.html

        * css/CSSGrammar.y: Changed to handle specifier_list structure with the
            CSSParser::updateSpecifierWithElementName helper, added logic to
            keep unknown pseudo-element selectors at the top of the selector chain,
            so that we can easily check for them and grab them, and also because
            they would either not match anything or act as a descendant selector
            (descendant into a shadow DOM subtree that is), not a specifier.
        * css/CSSParser.cpp:
        (WebCore::CSSParser::updateSpecifiersWithElementName): Generalized/combined
            the logic adding element name to selectors and added the special case
            to handle unknown pseudo-element selectors.
        * css/CSSParser.h: Added def.
        * css/CSSSelector.cpp:
        (WebCore::CSSSelector::pseudoId): Removed any mention of PseudoSliderThumb/SLIDER_THUMB.
        (WebCore::nameToPseudoTypeMap): Ditto.
        (WebCore::CSSSelector::extractPseudoType): Ditto.
        * css/CSSSelector.h: Added a new ShadowDescendant relation type,
            removed PseudoSliderThumb def.
        (WebCore::CSSSelector::isUnknownPseudoElement): Added a helper method.
        * css/CSSSelectorList.cpp:
        (WebCore::SelectorHasUnknownPseudoElementFunctor::operator()): Added a functor
            to check for an unknown pseudo-element in the list.
        (WebCore::CSSSelectorList::hasUnknownPseudoElements): Added.
        * css/CSSSelectorList.h: Added a def.
        * css/CSSStyleSelector.cpp:
        (WebCore::CSSRuleSet::getPseudoRules): Added accessor to pseudo-element hash.
        (WebCore::CSSStyleSelector::matchRules): Added matching pseudo elements.
        (WebCore::CSSStyleSelector::SelectorChecker::checkSelector): Added handling
            of ShadowDescendant relation.
        (WebCore::CSSStyleSelector::SelectorChecker::checkOneSelector): Enabled handling
            of unknown pseudo-element selectors.
        (WebCore::CSSRuleSet::addRule): Added populating unknown pseudo-element hash.
        * css/html.css:
        (input[type="range"]::-webkit-slider-thumb): Added previously-hard-coded
            display:block.
        * dom/Element.h:
        (WebCore::Element::shadowPseudoId): Added new virtual method to allow
            elements to provide the value of pseudo-element selector they would match.
        * dom/Node.cpp:
        (WebCore::Node::querySelector): Added checking for unknown pseudo-element selectors,
            so that we can throw a SYNTAX_ERR if found.
        (WebCore::Node::querySelectorAll): Ditto.
        * html/shadow/SliderThumbElement.h:
        (WebCore::SliderThumbElement::shadowPseudoId): Added to return "-webkit-slider-thumb";
        * rendering/RenderSlider.cpp:
        (WebCore::RenderSlider::createThumbStyle): Changed to use the new styleForElement logic.
        * rendering/style/RenderStyleConstants.h: Removed SLIDER_THUMB.

2011-01-11  Dean Jackson  <dino@apple.com>

        Reviewed by Simon Fraser.

        https://bugs.webkit.org/show_bug.cgi?id=52233

        WebKitCSSMatrix constructor should accept 'none'
        as a valid string parameter.

        * css/WebKitCSSMatrix.cpp:
        (WebCore::WebKitCSSMatrix::setMatrixValue):

2011-01-11  James Robinson  <jamesr@chromium.org>

        Reviewed by Dimitri Glazkov.

        Set all RenderBlocks as replaced when an inline display type is specified
        https://bugs.webkit.org/show_bug.cgi?id=50858

        When a RenderBlock is created for an element with a specified display:inline style,
        it should always be treated as inline-block.  This situations often comes up for form
        controls.  Previously, RenderBlock::styleWillChange set the replaced flag for display
        values of inline-block, inline-table, and inline-table and a number of subclasses of
        RenderBlock set the replaced flag in styleDidChange for a display:inline.  However
        sometimes new subclasses would miss this step leading to bugs (such as with RenderDetails).
        This patch sets the replaced flag for all inline display types in RenderBlock::styleWillChange.

        Code cleanup only, no change in behavior so no new tests.

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::styleWillChange):
        * rendering/RenderButton.cpp:
        (WebCore::RenderButton::styleDidChange):
        * rendering/RenderFieldset.cpp:
        * rendering/RenderFieldset.h:
        * rendering/RenderFileUploadControl.cpp:
        (WebCore::RenderFileUploadControl::styleDidChange):
        * rendering/RenderListBox.cpp:
        * rendering/RenderListBox.h:
        * rendering/RenderMenuList.cpp:
        (WebCore::RenderMenuList::styleDidChange):
        * rendering/RenderSlider.cpp:
        (WebCore::RenderSlider::styleDidChange):
        * rendering/RenderTextControl.cpp:
        (WebCore::RenderTextControl::styleDidChange):

2011-01-11  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Eric Seidel.

        REGRESSION(r71934) Can't type in search edit field on skin-one.com
        https://bugs.webkit.org/show_bug.cgi?id=52195

        Restored the original behavior, where the selectstart event is not
        dispatched when selection changes inside of the shadow DOM.

        * dom/Node.cpp:
        (WebCore::determineDispatchBehavior): Moved EventDispatchBehavior-determining
            logic into a helper function, also added a check to keep selectstart
                events inside of the shadow DOM.
        (WebCore::Node::dispatchGenericEvent): Changed to use the helper function.

2011-01-11  Viatcheslav Ostapenko  <ostapenko.viatcheslav@nokia.com>

        Reviewed by Eric Seidel.

        [Qt] Provide plugin coordinates to windowless plugins on Symbian.
        https://bugs.webkit.org/show_bug.cgi?id=52213

        * plugins/symbian/PluginViewSymbian.cpp:
        (WebCore::PluginView::setNPWindowIfNeeded):

2011-01-10  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Need to consider UNPACK_ALIGNMENT in GraphicsContext3D::texImage2DResourceSafe
        https://bugs.webkit.org/show_bug.cgi?id=52068

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::copyTexImage2D): Use computeImageSizeInBytes.
        (WebCore::WebGLRenderingContext::copyTexSubImage2D): Ditto.
        (WebCore::WebGLRenderingContext::readPixels): Ditto, and fix a bug on generating the wrong error.
        (WebCore::WebGLRenderingContext::texImage2DBase): Ditto.
        (WebCore::WebGLRenderingContext::validateTexFuncData): Use computeImageSizeInBytes.
        * platform/graphics/GraphicsContext3D.cpp:
        (WebCore::GraphicsContext3D::texImage2DResourceSafe): Add a new parameter alignment.
        (WebCore::GraphicsContext3D::computeFormatAndTypeParameters): Add more supported format/type.
        (WebCore::GraphicsContext3D::computeImageSizeInBytes): Added.
        * platform/graphics/GraphicsContext3D.h:

2011-01-10  Enrica Casucci  <enrica@apple.com>

        Reviewed by Alexey Proskuryakov.

        Paste and drag and drop use different code paths to interact with the pasteboard.
        https://bugs.webkit.org/show_bug.cgi?id=52093
        The change consists in a refactoring of the code to have only one class that
        deals with the pasteboard on Mac.

        No new tests. A test is already available for this
        (editing/pasteboard/drag-image-to-contenteditable-in-iframe.html) but had incorrect results.

        * WebCore.exp.in:
        * loader/EmptyClients.h: Added two Mac only methods to call into WebKit to use functionality
        that is in NSURLExtras.
        (WebCore::EmptyEditorClient::canonicalizeURL):
        (WebCore::EmptyEditorClient::canonicalizeURLString):
        * page/DragController.cpp:
        The following methods have been changed to pass a pointer to the Frame object
        to the DragData class.
        (WebCore::documentFragmentFromDragData):
        (WebCore::DragController::performDrag):
        (WebCore::DragController::dispatchTextInputEventFor):
        (WebCore::DragController::concludeEditDrag):
        * page/EditorClient.h: Added two Mac only methods to call into WebKit to use functionality
        that is in NSURLExtras.
        The following files have been modified to pass the Frame object to the DragData method calls.
        * page/chromium/DragControllerChromium.cpp:
        (WebCore::DragController::dragOperation):
        * page/gtk/DragControllerGtk.cpp:
        (WebCore::DragController::dragOperation):
        * page/mac/DragControllerMac.mm:
        (WebCore::DragController::dragOperation):
        * page/qt/DragControllerQt.cpp:
        (WebCore::DragController::dragOperation):
        * page/win/DragControllerWin.cpp:
        (WebCore::DragController::dragOperation):
        * platform/DragData.h: Removed Mac specific constructor and reference to PasteboardHelper class.
        * platform/Pasteboard.h: Added public constructor to create a Pasteboard object from an NSPasteboard.
        The following files were all modified to match the new parameters of the methods listed.
        * platform/android/DragDataAndroid.cpp:
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):
        * platform/chromium/DragDataChromium.cpp:
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::asFragment):
        * platform/gtk/DragDataGtk.cpp:
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):
        * platform/haiku/DragDataHaiku.cpp:
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):
        * platform/mac/DragDataMac.mm:
        (WebCore::DragData::DragData):
        (WebCore::DragData::asPlainText):
        (WebCore::insertablePasteboardTypes):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):
        * platform/mac/PasteboardMac.mm:
        (WebCore::Pasteboard::getBestURL):
        (WebCore::Pasteboard::asURL):
        * platform/qt/DragDataQt.cpp:
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):
        * platform/win/DragDataWin.cpp:
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsCompatibleContent):
        (WebCore::DragData::asFragment):
        * platform/wince/DragDataWinCE.cpp:
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::asFragment):
        * platform/wx/DragDataWx.cpp:
        (WebCore::DragData::asPlainText):
        (WebCore::DragData::containsURL):
        (WebCore::DragData::asURL):
        (WebCore::DragData::asFragment):

2011-01-11  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Dimitri Glazkov.

        RefPtr text node in setOuterText since calling appendData
        on a text node can fire away dom event listener which might
        remove the text node from underneath.
        https://bugs.webkit.org/show_bug.cgi?id=52163

        Test: fast/dom/text-node-append-data-remove-crash.html

        * html/HTMLElement.cpp:
        (WebCore::HTMLElement::setOuterText):

2011-01-11  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Add support for <meter> element
        https://bugs.webkit.org/show_bug.cgi?id=48713

        * GNUmakefile.am: Enable meter element.

2011-01-11  Csaba Osztrogonác  <ossy@webkit.org>

        Unreviewed buildfix.

        [Qt][V8] Add missing include for debug build.

        * loader/cache/CachedResourceLoader.cpp:

2011-01-11  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: redirects are lost from the network panel upon navigation.
        https://bugs.webkit.org/show_bug.cgi?id=52210

        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager.prototype.didCommitLoadForFrame):

2011-01-11  Jocelyn Turcotte  <jocelyn.turcotte@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Remove uses of QFuture since it isn't supported on all platforms.
        https://bugs.webkit.org/show_bug.cgi?id=51204

        * platform/network/qt/QtNAMThreadSafeProxy.cpp:
        (WebCore::QtNAMThreadSafeProxy::QtNAMThreadSafeProxy):
        (WebCore::QtNAMThreadSafeProxy::localCookiesForUrl):
        (WebCore::QtNAMThreadSafeProxy::localWillLoadFromCache):
        * platform/network/qt/QtNAMThreadSafeProxy.h:
        (WebCore::QtNAMThreadSafeProxy::cookiesForUrl):
        (WebCore::QtNAMThreadSafeProxy::willLoadFromCache):

2011-01-11  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: recreate script view after live edit.
        https://bugs.webkit.org/show_bug.cgi?id=51751

        * inspector/front-end/Script.js:
        (WebInspector.Script.prototype.set source):
        * inspector/front-end/ScriptView.js:
        (WebInspector.ScriptView):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.editScriptSource.mycallback):
        (WebInspector.ScriptsPanel.prototype.editScriptSource):
        (WebInspector.ScriptsPanel.prototype.viewRecreated):
        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype._doEditLine):

2011-01-11  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: frameDetachedFromParent notification handler is missing in NetworkManager.
        https://bugs.webkit.org/show_bug.cgi?id=52205

        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager.prototype.frameDetachedFromParent):

2011-01-11  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: "Audit present state" always disabled
        https://bugs.webkit.org/show_bug.cgi?id=52199

        Removed all traces of resource tracking checks, as we have it no more.

        * English.lproj/localizedStrings.js:
        * inspector/front-end/AuditLauncherView.js:
        (WebInspector.AuditLauncherView.prototype._createLauncherUI):
        * inspector/front-end/AuditsPanel.js:

2011-01-11  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: move delayed search implementation to SourceFrame.
        https://bugs.webkit.org/show_bug.cgi?id=51753

        * inspector/front-end/SourceFrame.js:
        (WebInspector.SourceFrame.prototype._createViewerIfNeeded):
        (WebInspector.SourceFrame.prototype.findSearchMatches):
        (WebInspector.SourceFrame.prototype.cancelFindSearchMatches):
        * inspector/front-end/SourceView.js:
        (WebInspector.SourceView.prototype.hide):
        (WebInspector.SourceView.prototype.searchCanceled):
        (WebInspector.SourceView.prototype.performSearch.didFindSearchMatches):
        (WebInspector.SourceView.prototype.performSearch):

2011-01-11  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: innerFirstChild has a side effect which should be called explicitly.

        If a node is a frame's owner then innerFirstChild method
        subscribes DOMAgent instance to the frame's doc's events.
        I think this should be done explicitly when we meet with
        the node for the first time. As I understand it happens
        in buildArrayForContainerChildren method.

        https://bugs.webkit.org/show_bug.cgi?id=52204

        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::startListeningFrameDoc):
        (WebCore::InspectorDOMAgent::buildArrayForContainerChildren):
        (WebCore::InspectorDOMAgent::innerFirstChild):
        * inspector/InspectorDOMAgent.h:

2011-01-11  Adam Roben  <aroben@apple.com>

        Delete WKCACFLayer.{cpp,h}

        These have been unused since r75262

        * platform/graphics/win/WKCACFLayer.cpp: Removed.
        * platform/graphics/win/WKCACFLayer.h: Removed.

2011-01-11  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [regression] Cookies view does not allow columns resize.
        https://bugs.webkit.org/show_bug.cgi?id=51877

        * inspector/front-end/CookieItemsView.js:
        (WebInspector.CookieItemsView.prototype._updateWithCookies):

2011-01-11  Noel Gordon  <noel.gordon@gmail.com>

         Reviewed by James Robinson.

         [chromium] canvas.toDataURL("image/jpeg") should composite onto black.
         https://bugs.webkit.org/show_bug.cgi?id=51237

         The Canvas specification requires that the canvas image is composited using
         the Porter-Duff operator source-over onto a black background; the resultant
         image should be JPEG encoded and returned as a dataURL.  To composite image
         A and background B, for any Porter-Duff operator, produce pixels I with

            I = c(A)F(A) + c(B)F(B)

         where, F(X) is the fraction [0.0-1.0] contributed to the composite by image
         X, and c(X) are the premultiplied RGB color components of image X.  Note by
         definition, c(B) = 0 since the background is black, so I = c(A)F(A).  Since
         F(A) = 1 in Porter-Duff operator source-over, the composited pixels satisfy
         I = c(A).  Hence, to conform to the Canvas spec, pass the premultiplied RGB
         color components of the canvas image to the JPEG encoder.

         Covered by canvas/philip/tests/toDataURL.jpeg.alpha.html

         * platform/image-encoders/skia/JPEGImageEncoder.cpp:
         (WebCore::preMultipliedBGRAtoRGB): Use Porter-Duff source-over black.

2011-01-11  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Chromium DevTools: get rid of APU-related code in WebKit/chromium.
        https://bugs.webkit.org/show_bug.cgi?id=52152

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::restoreInspectorStateFromCookie):
        (WebCore::InspectorController::setInjectedScriptSource):
        * inspector/InspectorState.cpp:
        (WebCore::InspectorState::InspectorState):
        * inspector/InspectorState.h:
        * inspector/front-end/inspector.js:

2011-01-11  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: [REGRESSION] Load timing is requested
        for all resources (not only for the main one).
        https://bugs.webkit.org/show_bug.cgi?id=51749

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::willSendRequest):
        * loader/ResourceLoadNotifier.cpp:
        (WebCore::ResourceLoadNotifier::dispatchWillSendRequest):

2011-01-11  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] GRefPtr should not be used with Gtk widgets
        https://bugs.webkit.org/show_bug.cgi?id=51241

        GRefPtr breaks the widget life-cycle, the main problem is
        that GRefPtr calls g_object_unref() when it's destroyed,
        which is undesirable for widgets. In gtk+ widgets are created with
        a floating reference and when added to a container, the container
        takes the ownership of the widget consuming the floating
        reference. So you don't usually need to call g_object_ref/unref on
        widgets (only for some operations like reparent a widget) and
        toplevel widgets are destroyed with gtk_widget_destroy().

        * platform/ContextMenuItem.h:
        * platform/gtk/ContextMenuGtk.cpp:
        (WebCore::ContextMenu::ContextMenu):
        (WebCore::ContextMenu::~ContextMenu):
        (WebCore::ContextMenu::setPlatformDescription):
        * platform/gtk/ContextMenuItemGtk.cpp:
        (WebCore::ContextMenuItem::ContextMenuItem):
        (WebCore::ContextMenuItem::releasePlatformDescription):
        (WebCore::ContextMenuItem::type):
        (WebCore::ContextMenuItem::action):
        (WebCore::ContextMenuItem::setAction):
        (WebCore::ContextMenuItem::title):
        (WebCore::ContextMenuItem::setTitle):
        (WebCore::ContextMenuItem::platformSubMenu):
        (WebCore::ContextMenuItem::setSubMenu):
        (WebCore::ContextMenuItem::setChecked):
        (WebCore::ContextMenuItem::setEnabled):

2010-10-10  David Hyatt  <hyatt@apple.com>

        Reviewed by Simon Fraser.

        https://bugs.webkit.org/show_bug.cgi?id=51119, transformed 
        elements not responding properly to :hover after r73385.  
        Just use the entire document area as the hit test area, 
        since there appears to be a rounding bug/issues with relying 
        on float math when mapping the hit test area into
        transformed coordinates.

        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::hitTest):

2011-01-10  Stephen White  <senorblanco@chromium.org>

        Reviewed by James Robinson.

        Fix canvas->canvas draws on the GPU path.
        https://bugs.webkit.org/show_bug.cgi?id=52141
        
        Two problems:  according to the canvas spec, both source and
        destination rects can have negative width or height, but this shouldn't
        cause the image to be flipped.  So we need to normalize the rects (in
        the software path, this is done by BitmapImage*::draw).  Secondly, in
        the FBO->FBO path, the image needs to be flipped vertically, since it
        is drawn upside down.  We were doing this by flipping the destination
        rect, but this doesn't work if the source rect is not the entire image,
        since we extract the wrong part of the image.  Fixed by flipping the
        source rect instead (and flipping it within the image buffer's height,
        not the source rect's height).

        Covered by fast/canvas/drawImage-with-negative-source-destination.html.


        * platform/graphics/skia/BitmapImageSingleFrameSkia.h:
        Put normalizeRect() in global scope.
        * platform/graphics/skia/ImageBufferSkia.cpp:
        (WebCore::ImageBuffer::draw):
        Fix as above:  normalize both source and dest rects, and flip the
        source rect instead of the dest rect.
        * platform/graphics/skia/ImageSkia.cpp:
        (WebCore::normalizeRect):
        Put normalizeRect() in global scope.

2011-01-10  Laszlo Gombos  <laszlo.1.gombos@nokia.com>

        Reviewed by Csaba Osztrogonác.

        [Qt] Baseline qt_minimal configuration
        https://bugs.webkit.org/show_bug.cgi?id=51313

        No new tests as there is no new functionality.

        * platform/graphics/qt/GraphicsLayerQt.cpp: Fix the location of the
        QT_NO_ANIMATION guard.

        * platform/qt/WheelEventQt.cpp:
        (WebCore::PlatformWheelEvent::applyDelta): Fix the location of the
        QT_NO_WHEELEVENT guard.

2011-01-10  Joe Mason  <jmason@rim.com>

        Reviewed by Alexey Proskuryakov.

        WebSockets: unbounded buffer growth when server sends bad data
        https://bugs.webkit.org/show_bug.cgi?id=51253

        Fail a websocket handshake after 1024 bytes without a newline, or if it
        contains a null byte before the first newline.

        Tests: http/tests/websocket/tests/handshake-fail-by-maxlength.html
               http/tests/websocket/tests/handshake-fail-by-prepended-null.html

        * websockets/WebSocketHandshake.cpp:
        (WebCore::WebSocketHandshake::readStatusLine):

2011-01-10  Adam Barth  <abarth@webkit.org>

        Reviewed by Darin Adler.

        Introduce the notion of a "display-isolated" URL scheme for use by
        Chrome-internal URLs
        https://bugs.webkit.org/show_bug.cgi?id=50182

        This patch adds the basic plumbing for display-isolated URL schemes.
        Originally, this patch also had the functional change, but I've split
        that off into a separate patch because the original patch caused a
        performance regression.

        * page/SecurityOrigin.cpp:
        (WebCore::SecurityOrigin::canDisplay):
        * platform/SchemeRegistry.cpp:
        (WebCore::displayIsolatedURLSchemes):
        (WebCore::SchemeRegistry::registerURLSchemeAsLocal):
        (WebCore::SchemeRegistry::removeURLSchemeRegisteredAsLocal):
        (WebCore::SchemeRegistry::localSchemes):
        (WebCore::SchemeRegistry::deprecatedShouldTreatURLAsLocal):
        (WebCore::SchemeRegistry::shouldTreatURLSchemeAsLocal):
        (WebCore::SchemeRegistry::registerURLSchemeAsDisplayIsolated):
        (WebCore::SchemeRegistry::shouldTreatURLSchemeAsDisplayIsolated):
        * platform/SchemeRegistry.h:

2011-01-10  Jer Noble  <jer.noble@apple.com>

        Reviewed by Simon Fraser.

        https://bugs.webkit.org/show_bug.cgi?id=52095
        REGRESSION (r75277): 2 test cases (<1%) had incorrect layout
        
        Fixes tests:
            fullscreen/full-screen-remove-ancestor.html
            fullscreen/full-screen-remove.html
            
        Previously, the above tests were failing because DRT dumped the contents of their
        <script> tags, though all the explicit tests were passing.  This was caused by
        the document's render tree being left in an inconsistent state when a full screen
        element's ancestor was removed from the DOM.
        
        In nodeWillBeRemoved(), match the code in webkitDidExitFullScreen().
        Don't detach the documentElement, but rather simply call recalcStyle(Force).

        * dom/Document.cpp:
        (WebCore::Document::nodeWillBeRemoved):
        * rendering/RenderFullScreen.cpp:
        (RenderFullScreen::setAnimating): #if ENABLED -> # if USE
        * rendering/RenderFullScreen.h:
        (WebCore::RenderFullScreen::RenderFullScreen): RenderFullScreen should be an anonymous renderer.

2011-01-10  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Remove use of deprecated GTK+ methods before the 1.3.10 release
        https://bugs.webkit.org/show_bug.cgi?id=52173

        No new tests. This is only a build fix.

        * platform/gtk/GRefPtrGtk.cpp: Guard the GdkCursor specialization against GTK+ 3.x.
        In GTK+ 3.x, GdkCursor is just a GObject.
        * platform/gtk/GRefPtrGtk.h: Ditto.

2011-01-10  Geoffrey Garen  <ggaren@apple.com>

        Reviewed by Oliver Hunt.

        Moved Collector.* => Heap.*, since the file contains a class named "Heap".

        * ForwardingHeaders/runtime/Collector.h: Removed.
        * ForwardingHeaders/runtime/Heap.h: Copied from WebCore/ForwardingHeaders/runtime/Collector.h.
        * WebCore.vcproj/WebCore.vcproj:
        * bindings/js/GCController.cpp:
        * bindings/js/ScriptGCEvent.cpp:

2011-01-10  Leonid Ebril  <leonid.ebril@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        https://bugs.webkit.org/show_bug.cgi?id=51879

        Set the PluginQuirkDontSetNullWindowHandleOnDestroy for Adobe Lite  
        plugin if Flash 10 or newer (for Symbian platform), setting a nulled 
        window handler on destroy crashes WebKit.

        * plugins/symbian/PluginPackageSymbian.cpp:
        (WebCore::PluginPackage::fetchInfo):
        (WebCore::PluginPackage::determineQuirks):

2011-01-10  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Remove unecessary RenderThemeGtk and WidgetRenderingContext code
        https://bugs.webkit.org/show_bug.cgi?id=52170

        Remove unnecessary code from RenderThemeGtk3 and RenderThemeGtk now that the
        GtkStyleContext port is complete. Also remove WidgetRenderingContextGtk3 and
        move WidgetRenderingRenderingContextGtk2 to WidgetRenderingContext and make it
        GTK+ 2.x only. Some methods have been moved to RenderThemeGtk2 since they are
        GTK+ 2.x only now.

        No new tests. This should not change functionality.

        * GNUmakefile.am: Remove WidgetRenderingContextGtk3 and gtk3drawing.c
        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::RenderThemeGtk):
        (WebCore::gtkIconState): Made this method static. It isn't used outside RenderThemeGtk.
        (WebCore::RenderThemeGtk::paintSearchFieldResultsDecoration): Updated to refelct gtkIconState change.
        (WebCore::RenderThemeGtk::paintSearchFieldCancelButton): Ditto.
        (WebCore::RenderThemeGtk::paintMediaButton): Ditto
        * platform/gtk/RenderThemeGtk.h: Move a few methods which are now GTK+ 2.x only.
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::platformInit): Added this platform initialization method
        that is only used for GTK+ 2.x at the moment.
        (WebCore::RenderThemeGtk::~RenderThemeGtk): Added.
        (WebCore::getGtkStateType): Made this method static.
        (WebCore::RenderThemeGtk::getIndicatorMetrics): Moved this here from RenderThemeGtk.
        (WebCore::setToggleSize): Updated to reflect changes to getGtkStateType.
        (WebCore::RenderThemeGtk::paintButton): Ditto.
        (WebCore::RenderThemeGtk::paintSliderTrack): Ditto.
        (WebCore::RenderThemeGtk::paintSliderThumb): Ditto.
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::gtkScrollbarStyle): Moved to the top of the file.
        (WebCore::RenderThemeGtk::platformInit): Added.
        (WebCore::RenderThemeGtk::~RenderThemeGtk): Added.
        (WebCore::RenderThemeGtk::initMediaColors): Changed to use the GtkStyleContext API to
        fetch these colors. This was the last dependency on the old API.
        * platform/gtk/WidgetRenderingContext.cpp: Renamed from Source/WebCore/platform/gtk/WidgetRenderingContextGtk2.cpp.
        * platform/gtk/WidgetRenderingContext.h: Made GTK+ 2.x only.
        * platform/gtk/WidgetRenderingContextGtk3.cpp: Removed.
        * platform/gtk/gtk3drawing.c: Removed.
        * platform/gtk/gtkdrawing.h: Made GTK+ 2.x only.

2011-01-10  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Navigator.cookiesEnabled return true for Qt even if there is no cookie jar
        https://bugs.webkit.org/show_bug.cgi?id=52081

        Test for the availability of cookie jar to return if cookies are enabled or not.

        * platform/qt/CookieJarQt.cpp:
        (WebCore::cookiesEnabled):

2011-01-10  W. James MacLean  <wjmaclean@chromium.org>

        Reviewed by Kenneth Russell.

        [chromium] Enable reuse of RenderSurface for drawing.
        https://bugs.webkit.org/show_bug.cgi?id=51928

        Modifies RenderSurfaceChromium::prepareContentsTexture to avoid trying to 'reserve' a texture
        that is already reserved, should an attempt be made to re-select a previously drawn render surface
        in order to continue drawing to it. This use case appears when compositing into an offscreen texture.

        Covered by existing test (compositing/geometry/fixed-position.html) when offscreen compositing enabled.

        * platform/graphics/chromium/LayerTexture.h:
        (WebCore::LayerTexture::isReserved):
        * platform/graphics/chromium/RenderSurfaceChromium.cpp:
        (WebCore::RenderSurfaceChromium::prepareContentsTexture):
        * platform/graphics/chromium/TextureManager.cpp:
        (WebCore::TextureManager::isProtected):
        * platform/graphics/chromium/TextureManager.h:

2011-01-10  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Port combo box painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=51828

        Use GtkStyleContext API to paint combo boxes when building with
        GTK+ 3.x. Method paintButton() has been factored out and the new
        static method renderButton() is used by both paintButton() and
        paintMenuList().

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::adjustRepaintRect):
        (WebCore::renderButton):
        (WebCore::RenderThemeGtk::paintButton):
        (WebCore::getComboBoxMetrics):
        (WebCore::RenderThemeGtk::popupInternalPaddingLeft):
        (WebCore::RenderThemeGtk::popupInternalPaddingRight):
        (WebCore::RenderThemeGtk::popupInternalPaddingTop):
        (WebCore::RenderThemeGtk::popupInternalPaddingBottom):
        (WebCore::RenderThemeGtk::paintMenuList):

2011-01-10  Evan Martin  <evan@chromium.org>

        Reviewed by Tony Chang.

        [chromium] simplify complex glyph positioning code
        https://bugs.webkit.org/show_bug.cgi?id=52159

        Before, we had roughly same code duplicated for RTL and LTR.
        Now, use the same code for both directions by being careful about
        flipping signs where appropriate.

        * platform/graphics/chromium/ComplexTextControllerLinux.cpp:
        (WebCore::ComplexTextController::shapeGlyphs):
        (WebCore::ComplexTextController::setGlyphXPositions):

2011-01-10  Alejandro G. Castro  <alex@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Fix gtk2 compilation for master
        https://bugs.webkit.org/show_bug.cgi?id=51885

        * platform/gtk/GtkVersioning.h: Replaced the 2.24.0 check with
        2.23.0 to avoid using the old symbols in the 2.23 releases. Added
        support for gdk_pixmap_get_size before the 2.23.4.
        * platform/gtk/WidgetRenderingContextGtk2.cpp:
        (WebCore::WidgetRenderingContext::WidgetRenderingContext):
        Replaced the old gdk_drawable_get_size with gdk_pixmap_get_size.

2011-01-10  Ryosuke Niwa  <rniwa@webkit.org>

        Unreviewed; build fix for r75385.

        * rendering/mathml/RenderMathMLFraction.cpp:
        (WebCore::RenderMathMLFraction::paint):

2011-01-10  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r75341.
        http://trac.webkit.org/changeset/75341
        https://bugs.webkit.org/show_bug.cgi?id=52157

        Regressions on several pixel tests (Requested by jorlow on
        #webkit).

        * platform/graphics/cg/GraphicsContextCG.cpp:
        (WebCore::GraphicsContext::fillPath):

2011-01-10  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Port check and radio button painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=51815

        Use GtkStyleContext API to paint check and radio buttons when
        building with GTK+ 3.x.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::adjustRepaintRect):
        (WebCore::setToggleSize):
        (WebCore::paintToggle):
        (WebCore::RenderThemeGtk::setCheckboxSize):
        (WebCore::RenderThemeGtk::paintCheckbox):
        (WebCore::RenderThemeGtk::setRadioSize):
        (WebCore::RenderThemeGtk::paintRadio):

2011-01-10  François Sausset  <sausset@gmail.com>

        Reviewed by Kenneth Rohde Christiansen.

        MathML: vertical alignment & bar thickness adjustments of fractions.
        https://bugs.webkit.org/show_bug.cgi?id=50018

        The fraction bar thickness default value should follow the w3c MathML 3 recommendation:
        http://www.w3.org/TR/MathML3/chapter3.html#presm.mfrac
        The vertical alignment of the fraction bar should be more accurate, specially with operators (+,=,...).

        Test: mathml/presentation/fractions.xhtml

        * rendering/mathml/RenderMathMLFraction.cpp:
        (WebCore::RenderMathMLFraction::RenderMathMLFraction):
        (WebCore::RenderMathMLFraction::updateFromElement):
        (WebCore::RenderMathMLFraction::layout):
        (WebCore::RenderMathMLFraction::paint):
        (WebCore::RenderMathMLFraction::baselinePosition):
        * rendering/mathml/RenderMathMLFraction.h:

2011-01-10  Antti Koivisto  <antti@apple.com>

        Reviewed by Alexey Proskuryakov.

        https://bugs.webkit.org/show_bug.cgi?id=52044
        REGRESSION(r74807): No-store is ignored within a document
        
        Don't use cached resources with Cache-control: no-store (unless cache policy is CachePolicyHistoryBuffer).
        This matches a behavior that got lost in r74807.

        Test: http/tests/misc/script-no-store.html
        (by Alexey Proskuryakov)

        * loader/cache/CachedResourceLoader.cpp:
        (WebCore::CachedResourceLoader::determineRevalidationPolicy):

2011-01-10  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Laszlo Gombos.

        [WIN] Add ProxyServerWin.cpp
        https://bugs.webkit.org/show_bug.cgi?id=52031

        Add stub implementation to fix ENABLE_NETSCAPE_PLUGIN_API on WinCE.

        * CMakeLists.txt:
        * CMakeListsWinCE.txt:
        * platform/network/win/ProxyServerWin.cpp: Added.
        (WebCore::proxyServersForURL):

2011-01-10  Alejandro G. Castro  <alex@igalia.com>

        Reviewed by Martin Robinson.

        [cairo] Rendering a lot of arcs on top of each other causes time
        outs in some tests
        https://bugs.webkit.org/show_bug.cgi?id=50869

        We avoid the situation where we have to render the same arc
        multiple times over itself. Now it renders just one oval and
        moves to the end angle.

        * platform/graphics/cairo/PathCairo.cpp:
        (WebCore::Path::addArc):

2011-01-10  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Port text input control painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=51870

        Use GtkStyleContext API to paint text input controls when building
        with GTK+ 3.x.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::adjustRepaintRect):
        (WebCore::RenderThemeGtk::paintTextField):

2011-01-09  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Alexey Proskuryakov.

        Forward declare some headers where possible
        https://bugs.webkit.org/show_bug.cgi?id=52133

        No new tests because no new functionality.

        * css/CSSValue.h:
        * dom/BeforeLoadEvent.h:
        * dom/Event.cpp:
        * dom/Event.h:
        * dom/StyledElement.cpp:
        * dom/StyledElement.h:
        * loader/DocumentLoader.h:
        * loader/FrameLoader.h:
        * page/Frame.h:
        * platform/graphics/GraphicsContext.cpp:
        * platform/graphics/GraphicsContext.h:
        * platform/graphics/filters/FEBlend.cpp:
        * platform/graphics/filters/FEColorMatrix.cpp:
        * platform/graphics/filters/FEComponentTransfer.cpp:
        * platform/graphics/filters/FEComposite.cpp:
        * platform/graphics/filters/FEConvolveMatrix.cpp:
        * platform/graphics/filters/FEDiffuseLighting.cpp:
        * platform/graphics/filters/FEDisplacementMap.cpp:
        * platform/graphics/filters/FEFlood.cpp:
        * platform/graphics/filters/FEGaussianBlur.cpp:
        * platform/graphics/filters/FEMerge.cpp:
        * platform/graphics/filters/FEMorphology.cpp:
        * platform/graphics/filters/FEOffset.cpp:
        * platform/graphics/filters/FESpecularLighting.cpp:
        * platform/graphics/filters/FETile.cpp:
        * platform/graphics/filters/FETurbulence.cpp:
        * platform/graphics/filters/FilterEffect.cpp:
        * platform/graphics/filters/FilterEffect.h:
        * platform/graphics/filters/SourceAlpha.cpp:
        * platform/graphics/filters/SourceGraphic.cpp:
        * svg/SVGElement.cpp:
        * svg/SVGElement.h:
        * svg/SVGFEBlendElement.cpp:
        * svg/SVGFEColorMatrixElement.cpp:
        * svg/SVGFEComponentTransferElement.cpp:
        * svg/SVGFECompositeElement.cpp:
        * svg/SVGFEConvolveMatrixElement.cpp:
        * svg/SVGFEConvolveMatrixElement.h:
        * svg/SVGFEDiffuseLightingElement.cpp:
        * svg/SVGFEDisplacementMapElement.cpp:
        * svg/SVGFEGaussianBlurElement.cpp:
        * svg/SVGFEImageElement.h:
        * svg/SVGFEMergeElement.cpp:
        * svg/SVGFEMorphologyElement.cpp:
        * svg/SVGFEOffsetElement.cpp:
        * svg/SVGFESpecularLightingElement.cpp:
        * svg/SVGFETileElement.cpp:
        * svg/SVGFETurbulenceElement.h:
        * svg/SVGFilterPrimitiveStandardAttributes.cpp:
        * svg/SVGFilterPrimitiveStandardAttributes.h:
        * svg/SVGTextContentElement.cpp:
        * svg/graphics/filters/SVGFEImage.cpp:
        * svg/graphics/filters/SVGFEImage.h:

2011-01-10  Adam Roben  <aroben@apple.com>

        Windows build fix after r75313

        * WebCore.vcproj/build-generated-files.sh: Updated for the change in
        this script's path.

2011-01-10  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: make properties on Array's prototype non-enumerable.
        https://bugs.webkit.org/show_bug.cgi?id=51776

        * inspector/front-end/utilities.js:
        ():

2011-01-10  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Simon Fraser.

        Specificity of negated selectors apparently miscalculated
        https://bugs.webkit.org/show_bug.cgi?id=41206

        Give negated selectors the specificity of the selector they are negating.
        This is the same as the behavior of other browsers.

        Test: fast/css/pseudo-not.html

        * css/CSSSelector.cpp:
        (WebCore::CSSSelector::specificityForOneSelector):

2011-01-10  Adam Roben  <aroben@apple.com>

        Windows build fix after r75353

        * WebCore.vcproj/WebCoreCommon.vsprops: Added rendering/mathml to the
        include path.

2011-01-10  John Knottenbelt  <jknotten@chromium.org>

        Reviewed by Jeremy Orlow.

        [Chromium] Remove non-client-based Geolocation code
        https://bugs.webkit.org/show_bug.cgi?id=50921

        Code clean up, covered by existing tests.

        * WebCore.gyp/WebCore.gyp:
        * WebCore.gypi:
        * platform/chromium/ChromiumBridge.h:
        * platform/chromium/GeolocationServiceChromium.cpp: Removed.
        * platform/chromium/GeolocationServiceChromium.h: Removed.

2011-01-10  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: protocol related change. Rename stepIntoStatement, stepOutOfFunction, stepOverStatement.
        stepIntoStatement => stepInto
        stepOutOfFunction => stepOut
        stepOverStatement => stepOver

        https://bugs.webkit.org/show_bug.cgi?id=52142

        * inspector/Inspector.idl:
        * inspector/InspectorDebuggerAgent.cpp:
        (WebCore::InspectorDebuggerAgent::stepOver):
        (WebCore::InspectorDebuggerAgent::stepInto):
        (WebCore::InspectorDebuggerAgent::stepOut):
        * inspector/InspectorDebuggerAgent.h:
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._stepOverClicked):
        (WebInspector.ScriptsPanel.prototype._stepIntoClicked):
        (WebInspector.ScriptsPanel.prototype._stepOutClicked):

2011-01-10  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Port progressbar painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=52054

        Use GtkStyleContext API to paint progressbars when building with
        GTK+ 3.x. Also add support for indeterminate progressbars.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk.cpp:
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::animationRepeatIntervalForProgressBar):
        (WebCore::RenderThemeGtk::animationDurationForProgressBar):
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::animationRepeatIntervalForProgressBar):
        (WebCore::RenderThemeGtk::animationDurationForProgressBar):
        (WebCore::RenderThemeGtk::paintProgressBar):

2011-01-10  Andreas Kling  <kling@webkit.org>

        Reviewed by Darin Adler.

        Remove unused class "Pen" in WebCore/platform/graphics
        https://bugs.webkit.org/show_bug.cgi?id=49955

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * platform/graphics/Pen.cpp: Removed.
        * platform/graphics/Pen.h: Removed.
        * platform/graphics/haiku/GraphicsContextHaiku.cpp:
        * platform/graphics/wx/GraphicsContextWx.cpp:
        * platform/graphics/wx/PenWx.cpp: Removed.

2011-01-10  Xan Lopez  <xlopez@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Create intermediate libWebCore library
        https://bugs.webkit.org/show_bug.cgi?id=52116

        Create intermediate libWebCore.la to avoid overflowing the linker
        in the final link stage.

        * GNUmakefile.am: define the new library.

2011-01-09  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r75337.
        http://trac.webkit.org/changeset/75337
        https://bugs.webkit.org/show_bug.cgi?id=52137

        It made fast/dom/navigator-detached-no-crash.html crash
        (Requested by Ossy on #webkit).

        * platform/qt/CookieJarQt.cpp:
        (WebCore::cookiesEnabled):

2011-01-09  Mark Rowe  <mrowe@apple.com>

        Fix the build.

        * WebCore.xcodeproj/project.pbxproj: Copy SVGResourcesCache.h in to PrivateHeaders
        once more.

2011-01-09  Dan Bernstein  <mitz@apple.com>

        Reviewed by Sam Weinig.

        <rdar://problem/8765555> WebKit2: Search field focus ring is missing

        Provide a focus ring visible rect to AppKit.

        * platform/mac/ThemeMac.mm:
        (-[WebCoreFlippedView _focusRingVisibleRect]):
        (-[WebCoreFlippedView _focusRingClipAncestor]):

2011-01-09  Dirk Schulze  <krit@webkit.org>

        Reviewed by Rob Buis.

        Move MathML renderer to rendering/mathml
        https://bugs.webkit.org/show_bug.cgi?id=52131

        Move all renderer of MathML to WebCore/rendering/mathml

        No change of functionality, no new tests added.

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * mathml/RenderMathMLBlock.cpp: Removed.
        * mathml/RenderMathMLBlock.h: Removed.
        * mathml/RenderMathMLFenced.cpp: Removed.
        * mathml/RenderMathMLFenced.h: Removed.
        * mathml/RenderMathMLFraction.cpp: Removed.
        * mathml/RenderMathMLFraction.h: Removed.
        * mathml/RenderMathMLMath.cpp: Removed.
        * mathml/RenderMathMLMath.h: Removed.
        * mathml/RenderMathMLOperator.cpp: Removed.
        * mathml/RenderMathMLOperator.h: Removed.
        * mathml/RenderMathMLRoot.cpp: Removed.
        * mathml/RenderMathMLRoot.h: Removed.
        * mathml/RenderMathMLRow.cpp: Removed.
        * mathml/RenderMathMLRow.h: Removed.
        * mathml/RenderMathMLSquareRoot.cpp: Removed.
        * mathml/RenderMathMLSquareRoot.h: Removed.
        * mathml/RenderMathMLSubSup.cpp: Removed.
        * mathml/RenderMathMLSubSup.h: Removed.
        * mathml/RenderMathMLUnderOver.cpp: Removed.
        * mathml/RenderMathMLUnderOver.h: Removed.
        * rendering/mathml: Added.
        * rendering/mathml/RenderMathMLBlock.cpp: Copied from Source/WebCore/mathml/RenderMathMLBlock.cpp.
        * rendering/mathml/RenderMathMLBlock.h: Copied from Source/WebCore/mathml/RenderMathMLBlock.h.
        * rendering/mathml/RenderMathMLFenced.cpp: Copied from Source/WebCore/mathml/RenderMathMLFenced.cpp.
        * rendering/mathml/RenderMathMLFenced.h: Copied from Source/WebCore/mathml/RenderMathMLFenced.h.
        * rendering/mathml/RenderMathMLFraction.cpp: Copied from Source/WebCore/mathml/RenderMathMLFraction.cpp.
        * rendering/mathml/RenderMathMLFraction.h: Copied from Source/WebCore/mathml/RenderMathMLFraction.h.
        * rendering/mathml/RenderMathMLMath.cpp: Copied from Source/WebCore/mathml/RenderMathMLMath.cpp.
        * rendering/mathml/RenderMathMLMath.h: Copied from Source/WebCore/mathml/RenderMathMLMath.h.
        * rendering/mathml/RenderMathMLOperator.cpp: Copied from Source/WebCore/mathml/RenderMathMLOperator.cpp.
        * rendering/mathml/RenderMathMLOperator.h: Copied from Source/WebCore/mathml/RenderMathMLOperator.h.
        * rendering/mathml/RenderMathMLRoot.cpp: Copied from Source/WebCore/mathml/RenderMathMLRoot.cpp.
        * rendering/mathml/RenderMathMLRoot.h: Copied from Source/WebCore/mathml/RenderMathMLRoot.h.
        * rendering/mathml/RenderMathMLRow.cpp: Copied from Source/WebCore/mathml/RenderMathMLRow.cpp.
        * rendering/mathml/RenderMathMLRow.h: Copied from Source/WebCore/mathml/RenderMathMLRow.h.
        * rendering/mathml/RenderMathMLSquareRoot.cpp: Copied from Source/WebCore/mathml/RenderMathMLSquareRoot.cpp.
        * rendering/mathml/RenderMathMLSquareRoot.h: Copied from Source/WebCore/mathml/RenderMathMLSquareRoot.h.
        * rendering/mathml/RenderMathMLSubSup.cpp: Copied from Source/WebCore/mathml/RenderMathMLSubSup.cpp.
        * rendering/mathml/RenderMathMLSubSup.h: Copied from Source/WebCore/mathml/RenderMathMLSubSup.h.
        * rendering/mathml/RenderMathMLUnderOver.cpp: Copied from Source/WebCore/mathml/RenderMathMLUnderOver.cpp.
        * rendering/mathml/RenderMathMLUnderOver.h: Copied from Source/WebCore/mathml/RenderMathMLUnderOver.h.

2011-01-08  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Alexey Proskuryakov.

        HTMLStyleElement.disabled doesn't work (affects jQuery)
        https://bugs.webkit.org/show_bug.cgi?id=25287
        
        Fix the disabled property of a HTMLStyleElement to reflect,
        and set the disabled state of its style sheet, as required
        by DOM1 etc.

        Based on initial patch by Tarun Nainani.

        Test: fast/html/disable-style-element.html

        * dom/StyleElement.h:
        (WebCore::StyleElement::sheet): Make const.
        
        * html/HTMLStyleElement.h:
        * html/HTMLStyleElement.idl:
        * html/HTMLStyleElement.cpp:
        (WebCore::HTMLStyleElement::disabled): 
        (WebCore::HTMLStyleElement::setDisabled): Getter and setter for disabled
        call through to the sheet (if any).

2011-01-09  Dirk Schulze  <krit@webkit.org>

        Reviewed by Nikolas Zimmermann.

        Rename RenderForeignObject to RenderSVGForeignObject
        https://bugs.webkit.org/show_bug.cgi?id=52129

        Rename RenderForeignObject to RenderSVGForeignObject to match the naming schema in render/svg.

        No change of functionality, no new tests.

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.xcodeproj/project.pbxproj:
        * rendering/RenderingAllInOne.cpp:
        * rendering/svg/RenderForeignObject.cpp: Removed.
        * rendering/svg/RenderForeignObject.h: Removed.
        * rendering/svg/RenderSVGAllInOne.cpp:
        * rendering/svg/RenderSVGBlock.cpp:
        (WebCore::RenderSVGBlock::updateBoxModelInfoFromStyle):
        * rendering/svg/RenderSVGForeignObject.cpp: Copied from Source/WebCore/rendering/svg/RenderForeignObject.cpp.
        (WebCore::RenderSVGForeignObject::RenderSVGForeignObject):
        (WebCore::RenderSVGForeignObject::~RenderSVGForeignObject):
        (WebCore::RenderSVGForeignObject::paint):
        (WebCore::RenderSVGForeignObject::clippedOverflowRectForRepaint):
        (WebCore::RenderSVGForeignObject::computeRectForRepaint):
        (WebCore::RenderSVGForeignObject::localToParentTransform):
        (WebCore::RenderSVGForeignObject::computeLogicalWidth):
        (WebCore::RenderSVGForeignObject::computeLogicalHeight):
        (WebCore::RenderSVGForeignObject::layout):
        (WebCore::RenderSVGForeignObject::nodeAtFloatPoint):
        (WebCore::RenderSVGForeignObject::nodeAtPoint):
        (WebCore::RenderSVGForeignObject::mapLocalToContainer):
        * rendering/svg/RenderSVGForeignObject.h: Copied from Source/WebCore/rendering/svg/RenderForeignObject.h.
        (WebCore::RenderSVGForeignObject::renderName):
        * svg/SVGForeignObjectElement.cpp:
        (WebCore::SVGForeignObjectElement::createRenderer):

2011-01-09  Dirk Schulze  <krit@webkit.org>

        Reviewed by Nikolas Zimmermann.

        Move all SVG renderer to WebCore/rendering/svg
        https://bugs.webkit.org/show_bug.cgi?id=52087

        No change of functionality. Just moved all SVG renderer to WebCore/rendering/svg.

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vjproj/project.vjproj:
        * WebCore.xcodeproj/project.pbxproj:
        * rendering/RenderForeignObject.cpp: Removed.
        * rendering/RenderForeignObject.h: Removed.
        * rendering/RenderSVGAllInOne.cpp: Removed.
        * rendering/RenderSVGBlock.cpp: Removed.
        * rendering/RenderSVGBlock.h: Removed.
        * rendering/RenderSVGContainer.cpp: Removed.
        * rendering/RenderSVGContainer.h: Removed.
        * rendering/RenderSVGGradientStop.cpp: Removed.
        * rendering/RenderSVGGradientStop.h: Removed.
        * rendering/RenderSVGHiddenContainer.cpp: Removed.
        * rendering/RenderSVGHiddenContainer.h: Removed.
        * rendering/RenderSVGImage.cpp: Removed.
        * rendering/RenderSVGImage.h: Removed.
        * rendering/RenderSVGModelObject.cpp: Removed.
        * rendering/RenderSVGModelObject.h: Removed.
        * rendering/RenderSVGResource.cpp: Removed.
        * rendering/RenderSVGResource.h: Removed.
        * rendering/RenderSVGResourceClipper.cpp: Removed.
        * rendering/RenderSVGResourceClipper.h: Removed.
        * rendering/RenderSVGResourceContainer.cpp: Removed.
        * rendering/RenderSVGResourceContainer.h: Removed.
        * rendering/RenderSVGResourceFilter.cpp: Removed.
        * rendering/RenderSVGResourceFilter.h: Removed.
        * rendering/RenderSVGResourceFilterPrimitive.cpp: Removed.
        * rendering/RenderSVGResourceFilterPrimitive.h: Removed.
        * rendering/RenderSVGResourceGradient.cpp: Removed.
        * rendering/RenderSVGResourceGradient.h: Removed.
        * rendering/RenderSVGResourceLinearGradient.cpp: Removed.
        * rendering/RenderSVGResourceLinearGradient.h: Removed.
        * rendering/RenderSVGResourceMarker.cpp: Removed.
        * rendering/RenderSVGResourceMarker.h: Removed.
        * rendering/RenderSVGResourceMasker.cpp: Removed.
        * rendering/RenderSVGResourceMasker.h: Removed.
        * rendering/RenderSVGResourcePattern.cpp: Removed.
        * rendering/RenderSVGResourcePattern.h: Removed.
        * rendering/RenderSVGResourceRadialGradient.cpp: Removed.
        * rendering/RenderSVGResourceRadialGradient.h: Removed.
        * rendering/RenderSVGResourceSolidColor.cpp: Removed.
        * rendering/RenderSVGResourceSolidColor.h: Removed.
        * rendering/RenderSVGRoot.cpp: Removed.
        * rendering/RenderSVGRoot.h: Removed.
        * rendering/RenderSVGShadowTreeRootContainer.cpp: Removed.
        * rendering/RenderSVGShadowTreeRootContainer.h: Removed.
        * rendering/RenderSVGTransformableContainer.cpp: Removed.
        * rendering/RenderSVGTransformableContainer.h: Removed.
        * rendering/RenderSVGViewportContainer.cpp: Removed.
        * rendering/RenderSVGViewportContainer.h: Removed.
        * rendering/SVGImageBufferTools.cpp: Removed.
        * rendering/SVGImageBufferTools.h: Removed.
        * rendering/SVGMarkerData.h: Removed.
        * rendering/SVGMarkerLayoutInfo.cpp: Removed.
        * rendering/SVGMarkerLayoutInfo.h: Removed.
        * rendering/SVGRenderSupport.cpp: Removed.
        * rendering/SVGRenderSupport.h: Removed.
        * rendering/SVGRenderTreeAsText.cpp: Removed.
        * rendering/SVGRenderTreeAsText.h: Removed.
        * rendering/SVGResources.cpp: Removed.
        * rendering/SVGResources.h: Removed.
        * rendering/SVGResourcesCache.cpp: Removed.
        * rendering/SVGResourcesCache.h: Removed.
        * rendering/SVGResourcesCycleSolver.cpp: Removed.
        * rendering/SVGResourcesCycleSolver.h: Removed.
        * rendering/SVGShadowTreeElements.cpp: Removed.
        * rendering/SVGShadowTreeElements.h: Removed.
        * rendering/svg/RenderForeignObject.cpp: Copied from Source/WebCore/rendering/RenderForeignObject.cpp.
        * rendering/svg/RenderForeignObject.h: Copied from Source/WebCore/rendering/RenderForeignObject.h.
        * rendering/svg/RenderSVGAllInOne.cpp: Copied from Source/WebCore/rendering/RenderSVGAllInOne.cpp.
        * rendering/svg/RenderSVGBlock.cpp: Copied from Source/WebCore/rendering/RenderSVGBlock.cpp.
        * rendering/svg/RenderSVGBlock.h: Copied from Source/WebCore/rendering/RenderSVGBlock.h.
        * rendering/svg/RenderSVGContainer.cpp: Copied from Source/WebCore/rendering/RenderSVGContainer.cpp.
        * rendering/svg/RenderSVGContainer.h: Copied from Source/WebCore/rendering/RenderSVGContainer.h.
        * rendering/svg/RenderSVGGradientStop.cpp: Copied from Source/WebCore/rendering/RenderSVGGradientStop.cpp.
        * rendering/svg/RenderSVGGradientStop.h: Copied from Source/WebCore/rendering/RenderSVGGradientStop.h.
        * rendering/svg/RenderSVGHiddenContainer.cpp: Copied from Source/WebCore/rendering/RenderSVGHiddenContainer.cpp.
        * rendering/svg/RenderSVGHiddenContainer.h: Copied from Source/WebCore/rendering/RenderSVGHiddenContainer.h.
        * rendering/svg/RenderSVGImage.cpp: Copied from Source/WebCore/rendering/RenderSVGImage.cpp.
        * rendering/svg/RenderSVGImage.h: Copied from Source/WebCore/rendering/RenderSVGImage.h.
        * rendering/svg/RenderSVGModelObject.cpp: Copied from Source/WebCore/rendering/RenderSVGModelObject.cpp.
        * rendering/svg/RenderSVGModelObject.h: Copied from Source/WebCore/rendering/RenderSVGModelObject.h.
        * rendering/svg/RenderSVGResource.cpp: Copied from Source/WebCore/rendering/RenderSVGResource.cpp.
        * rendering/svg/RenderSVGResource.h: Copied from Source/WebCore/rendering/RenderSVGResource.h.
        * rendering/svg/RenderSVGResourceClipper.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceClipper.cpp.
        * rendering/svg/RenderSVGResourceClipper.h: Copied from Source/WebCore/rendering/RenderSVGResourceClipper.h.
        * rendering/svg/RenderSVGResourceContainer.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceContainer.cpp.
        * rendering/svg/RenderSVGResourceContainer.h: Copied from Source/WebCore/rendering/RenderSVGResourceContainer.h.
        * rendering/svg/RenderSVGResourceFilter.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceFilter.cpp.
        * rendering/svg/RenderSVGResourceFilter.h: Copied from Source/WebCore/rendering/RenderSVGResourceFilter.h.
        * rendering/svg/RenderSVGResourceFilterPrimitive.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceFilterPrimitive.cpp.
        * rendering/svg/RenderSVGResourceFilterPrimitive.h: Copied from Source/WebCore/rendering/RenderSVGResourceFilterPrimitive.h.
        * rendering/svg/RenderSVGResourceGradient.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceGradient.cpp.
        * rendering/svg/RenderSVGResourceGradient.h: Copied from Source/WebCore/rendering/RenderSVGResourceGradient.h.
        * rendering/svg/RenderSVGResourceLinearGradient.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceLinearGradient.cpp.
        * rendering/svg/RenderSVGResourceLinearGradient.h: Copied from Source/WebCore/rendering/RenderSVGResourceLinearGradient.h.
        * rendering/svg/RenderSVGResourceMarker.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceMarker.cpp.
        * rendering/svg/RenderSVGResourceMarker.h: Copied from Source/WebCore/rendering/RenderSVGResourceMarker.h.
        * rendering/svg/RenderSVGResourceMasker.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceMasker.cpp.
        * rendering/svg/RenderSVGResourceMasker.h: Copied from Source/WebCore/rendering/RenderSVGResourceMasker.h.
        * rendering/svg/RenderSVGResourcePattern.cpp: Copied from Source/WebCore/rendering/RenderSVGResourcePattern.cpp.
        * rendering/svg/RenderSVGResourcePattern.h: Copied from Source/WebCore/rendering/RenderSVGResourcePattern.h.
        * rendering/svg/RenderSVGResourceRadialGradient.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceRadialGradient.cpp.
        * rendering/svg/RenderSVGResourceRadialGradient.h: Copied from Source/WebCore/rendering/RenderSVGResourceRadialGradient.h.
        * rendering/svg/RenderSVGResourceSolidColor.cpp: Copied from Source/WebCore/rendering/RenderSVGResourceSolidColor.cpp.
        * rendering/svg/RenderSVGResourceSolidColor.h: Copied from Source/WebCore/rendering/RenderSVGResourceSolidColor.h.
        * rendering/svg/RenderSVGRoot.cpp: Copied from Source/WebCore/rendering/RenderSVGRoot.cpp.
        * rendering/svg/RenderSVGRoot.h: Copied from Source/WebCore/rendering/RenderSVGRoot.h.
        * rendering/svg/RenderSVGShadowTreeRootContainer.cpp: Copied from Source/WebCore/rendering/RenderSVGShadowTreeRootContainer.cpp.
        * rendering/svg/RenderSVGShadowTreeRootContainer.h: Copied from Source/WebCore/rendering/RenderSVGShadowTreeRootContainer.h.
        * rendering/svg/RenderSVGTransformableContainer.cpp: Copied from Source/WebCore/rendering/RenderSVGTransformableContainer.cpp.
        * rendering/svg/RenderSVGTransformableContainer.h: Copied from Source/WebCore/rendering/RenderSVGTransformableContainer.h.
        * rendering/svg/RenderSVGViewportContainer.cpp: Copied from Source/WebCore/rendering/RenderSVGViewportContainer.cpp.
        * rendering/svg/RenderSVGViewportContainer.h: Copied from Source/WebCore/rendering/RenderSVGViewportContainer.h.
        * rendering/svg/SVGImageBufferTools.cpp: Copied from Source/WebCore/rendering/SVGImageBufferTools.cpp.
        * rendering/svg/SVGImageBufferTools.h: Copied from Source/WebCore/rendering/SVGImageBufferTools.h.
        * rendering/svg/SVGMarkerData.h: Copied from Source/WebCore/rendering/SVGMarkerData.h.
        * rendering/svg/SVGMarkerLayoutInfo.cpp: Copied from Source/WebCore/rendering/SVGMarkerLayoutInfo.cpp.
        * rendering/svg/SVGMarkerLayoutInfo.h: Copied from Source/WebCore/rendering/SVGMarkerLayoutInfo.h.
        * rendering/svg/SVGRenderSupport.cpp: Copied from Source/WebCore/rendering/SVGRenderSupport.cpp.
        * rendering/svg/SVGRenderSupport.h: Copied from Source/WebCore/rendering/SVGRenderSupport.h.
        * rendering/svg/SVGRenderTreeAsText.cpp: Copied from Source/WebCore/rendering/SVGRenderTreeAsText.cpp.
        * rendering/svg/SVGRenderTreeAsText.h: Copied from Source/WebCore/rendering/SVGRenderTreeAsText.h.
        * rendering/svg/SVGResources.cpp: Copied from Source/WebCore/rendering/SVGResources.cpp.
        * rendering/svg/SVGResources.h: Copied from Source/WebCore/rendering/SVGResources.h.
        * rendering/svg/SVGResourcesCache.cpp: Copied from Source/WebCore/rendering/SVGResourcesCache.cpp.
        * rendering/svg/SVGResourcesCache.h: Copied from Source/WebCore/rendering/SVGResourcesCache.h.
        * rendering/svg/SVGResourcesCycleSolver.cpp: Copied from Source/WebCore/rendering/SVGResourcesCycleSolver.cpp.
        * rendering/svg/SVGResourcesCycleSolver.h: Copied from Source/WebCore/rendering/SVGResourcesCycleSolver.h.
        * rendering/svg/SVGShadowTreeElements.cpp: Copied from Source/WebCore/rendering/SVGShadowTreeElements.cpp.
        * rendering/svg/SVGShadowTreeElements.h: Copied from Source/WebCore/rendering/SVGShadowTreeElements.h.

2011-01-09  Xianzhu Wang  <phnixwxz@gmail.com>

        Reviewed by Darin Fisher.

        https://bugs.webkit.org/show_bug.cgi?id=41441
        createWindow method should only do window-creating without URL navigation.
        Let client APIs know which URL a new window will start with

        * loader/FrameLoader.cpp:
        (WebCore::createWindow):
        * page/ContextMenuController.cpp:
        (WebCore::openNewWindow):
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::createWindow):

2011-01-09  Dirk Schulze  <krit@webkit.org>

        Unreviewed sort of Xcode project file.

        * WebCore.xcodeproj/project.pbxproj:

2011-01-09  Amruth Raj  <amruthraj@motorola.com> and Ravi Phaneendra Kasibhatla  <ravi.kasibhatla@motorola.com>

        Reviewed by Martin Robinson.

        Changes to add Process Launcher and Thread Launcher implementation to the WebKit2 GTK port.
        https://bugs.webkit.org/show_bug.cgi?id=48511

        * platform/FileSystem.h: 
        * platform/gtk/FileSystemGtk.cpp: Implement function to get a binary's path
        (WebCore::applicationDirectoryPath):

2011-01-08  Martin Robinson  <mrobinson@igalia.com>

        GTK+ Build fix. Add missing headers to the source list, fixing make dist.

        No new tests. This is only a build change.

        * GNUmakefile.am: Add missing headers to the source list.

2011-01-08 Amruth Raj  <amruthraj@motorola.com> and Ravi Phaneendra Kasibhatla  <ravi.kasibhatla@motorola.com>

        Reviewed by Martin Robinson.

        [GTK] WebKit2 GNUmakefile is out of date from trunk
        https://bugs.webkit.org/show_bug.cgi?id=51883

        Added stubs for WebKit2 compilation.

        * platform/gtk/ContextMenuGtk.cpp:
        (WebCore::contextMenuItemVector):
        * platform/gtk/ContextMenuItemGtk.cpp:
        (WebCore::ContextMenuItem::ContextMenuItem):
        (WebCore::ContextMenuItem::checked):
        (WebCore::ContextMenuItem::enabled):
        * platform/network/soup/AuthenticationChallenge.h:
        (WebCore::AuthenticationChallenge::authenticationClient):

2011-01-08  Helder Correia  <helder@sencha.com>

        Reviewed by Simon Fraser.

        Shadow is not drawn when filling a path with a gradient
        https://bugs.webkit.org/show_bug.cgi?id=51982

        This happens in CG and is related to bug 51869, this time to be fixed
        in GraphicsContext::fillPath(const Path& path). We need to draw the
        gradient clipped to the path on a CGLayer first, and then draw the
        layer on the GraphicsContext.

        Test: fast/canvas/canvas-fillPath-gradient-shadow.html

        * platform/graphics/cg/GraphicsContextCG.cpp:
        (WebCore::GraphicsContext::fillPath):

2011-01-08  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] PasteboardQt.cpp has coding-style errors
        https://bugs.webkit.org/show_bug.cgi?id=39771

        Update the code to follow the coding style.

        * platform/qt/PasteboardQt.cpp:
        (WebCore::Pasteboard::writeSelection):
        (WebCore::Pasteboard::plainText):
        (WebCore::Pasteboard::writePlainText):
        (WebCore::Pasteboard::writeURL):

2011-01-08  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Eric Seidel.

        HTML5 Conformance Test failure: approved/xhtml5/html_style_in_comment.xhtml
        https://bugs.webkit.org/show_bug.cgi?id=48593

        XHTML <style> blocks, unlike HTML <style> blocks, should respect HTML
        comments.

        Test: fast/parser/xhtml-html-comment-in-style-block.xhtml

        * dom/StyleElement.cpp:
        (WebCore::isValidStyleChild): Remove the COMMENT_NODE check as the HTML parser doesn't add COMMENT_NODEs as children of style blocks.
        (WebCore::StyleElement::process): Factored out a condition that must remain in sync.

2011-01-08  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Navigator.cookiesEnabled return true for Qt even if there is no cookie jar
        https://bugs.webkit.org/show_bug.cgi?id=52081

        Test for the availability of cookie jar to return if cookies are enabled or not. The network access
        manager always exist, not the cookie jar.

        * platform/qt/CookieJarQt.cpp:
        (WebCore::cookiesEnabled):

2011-01-08  Charlie Reis  <creis@chromium.org>

        Reviewed by Mihai Parparita.

        Canceled frame loads can corrupt back forward list
        https://bugs.webkit.org/show_bug.cgi?id=50254

        Avoids changing m_currentItem until the navigation commits.
        Also resets top-level history items if a subframe navigation is canceled.

        * WebCore/loader/FrameLoader.cpp:
        (WebCore::FrameLoader::checkLoadCompleteForThisFrame):
        * WebCore/loader/HistoryController.cpp:
        * WebCore/loader/HistoryController.h:

2011-01-08  Chang Shu  <chang.shu@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        Support createTouchList with Touch list for test automation.
        Implemented JS/V8 custom functions for createTouchList.
        https://bugs.webkit.org/show_bug.cgi?id=51196

        * bindings/js/JSDocumentCustom.cpp:
        (WebCore::JSDocument::createTouchList):
        * bindings/v8/custom/V8DocumentCustom.cpp:
        (WebCore::V8Document::createTouchListCallback):
        * dom/Document.idl:
        * dom/TouchEvent.cpp:
        (WebCore::TouchEvent::initTouchEvent):

2011-01-08  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] CookieJarQt.cpp has coding-style errors
        https://bugs.webkit.org/show_bug.cgi?id=39778

        Improve the coding style of CookieJarQt.cpp.

        * platform/qt/CookieJarQt.cpp:
        (WebCore::networkAccessManager):
        (WebCore::cookiesEnabled):

2011-01-08  Jeff Miller  <jeffm@apple.com>

        Rubber-stamped by Dan Bernstein.

        Fix QTMovieWin.vcproj to account for moving WebCore to Source\WebCore
        https://bugs.webkit.org/show_bug.cgi?id=52114

        * WebCore.vcproj/QTMovieWin.vcproj:
        Add an extra .. to some InheritedPropertySheets entries since WebCore is now one level deeper.

2011-01-08  Dirk Schulze  <krit@webkit.org>

        Reviewed by Mihai Parparita.

        SVG rendering clean up according to the webkit style rules 2
        https://bugs.webkit.org/show_bug.cgi?id=52112

        Modified the style of the license of all files in WebCore/rendering/svg to match the style
        in WebCore/svg. Cleaned up the code according to the webkit style rules.

        No change of functionality. No test added.

        * rendering/svg/RenderSVGInline.cpp:
        * rendering/svg/RenderSVGInline.h:
        * rendering/svg/RenderSVGInlineText.cpp:
        * rendering/svg/RenderSVGInlineText.h:
        * rendering/svg/RenderSVGPath.cpp:
        * rendering/svg/RenderSVGPath.h:
        * rendering/svg/RenderSVGTSpan.cpp:
        * rendering/svg/RenderSVGTSpan.h:
        * rendering/svg/RenderSVGText.cpp:
        * rendering/svg/RenderSVGText.h:
        * rendering/svg/RenderSVGTextPath.cpp:
        * rendering/svg/RenderSVGTextPath.h:
        * rendering/svg/SVGInlineFlowBox.cpp:
        * rendering/svg/SVGInlineFlowBox.h:
        * rendering/svg/SVGInlineTextBox.cpp:
        * rendering/svg/SVGInlineTextBox.h:
        * rendering/svg/SVGRootInlineBox.cpp:
        * rendering/svg/SVGRootInlineBox.h:
        * rendering/svg/SVGTextLayoutEngineBaseline.cpp: Brace was misplaced accoring to check-webkit-style.
        (WebCore::SVGTextLayoutEngineBaseline::calculateGlyphOrientationAngle):
        * rendering/svg/SVGTextQuery.cpp:
        * rendering/svg/SVGTextQuery.h:

2011-01-08  Dirk Schulze  <krit@webkit.org>

        Reviewed by Mihai Parparita.

        SVG rendering clean up according to the webkit style rules
        https://bugs.webkit.org/show_bug.cgi?id=52107

        Cleanup of the SVG rendering code according to the webbkit style rules.
        Changed style of licensing texts to match the style in WebCore/svg, no change
        of the licensing text itself.

        * rendering/RenderForeignObject.cpp:
        * rendering/RenderForeignObject.h:
        * rendering/RenderSVGBlock.cpp:
        * rendering/RenderSVGBlock.h:
        * rendering/RenderSVGContainer.cpp:
        * rendering/RenderSVGContainer.h:
        * rendering/RenderSVGGradientStop.cpp:
        * rendering/RenderSVGGradientStop.h:
        * rendering/RenderSVGHiddenContainer.cpp:
        * rendering/RenderSVGHiddenContainer.h:
        (WebCore::RenderSVGHiddenContainer::renderName):
        (WebCore::RenderSVGHiddenContainer::isSVGHiddenContainer):
        (WebCore::RenderSVGHiddenContainer::requiresLayer):
        (WebCore::RenderSVGHiddenContainer::clippedOverflowRectForRepaint):
        * rendering/RenderSVGImage.cpp:
        * rendering/RenderSVGImage.h:
        * rendering/RenderSVGModelObject.h:
        * rendering/RenderSVGResource.cpp:
        * rendering/RenderSVGResource.h:
        * rendering/RenderSVGResourceClipper.cpp:
        * rendering/RenderSVGResourceClipper.h:
        * rendering/RenderSVGResourceContainer.cpp:
        * rendering/RenderSVGResourceContainer.h:
        * rendering/RenderSVGResourceFilter.cpp:
        * rendering/RenderSVGResourceFilter.h:
        * rendering/RenderSVGResourceFilterPrimitive.cpp:
        * rendering/RenderSVGResourceFilterPrimitive.h:
        * rendering/RenderSVGResourceGradient.cpp:
        * rendering/RenderSVGResourceGradient.h:
        * rendering/RenderSVGResourceLinearGradient.cpp:
        * rendering/RenderSVGResourceLinearGradient.h:
        * rendering/RenderSVGResourceMarker.cpp:
        * rendering/RenderSVGResourceMarker.h:
        * rendering/RenderSVGResourceMasker.cpp:
        * rendering/RenderSVGResourceMasker.h:
        * rendering/RenderSVGResourcePattern.cpp:
        * rendering/RenderSVGResourcePattern.h:
        * rendering/RenderSVGResourceRadialGradient.cpp:
        * rendering/RenderSVGResourceRadialGradient.h:
        * rendering/RenderSVGResourceSolidColor.cpp:
        * rendering/RenderSVGResourceSolidColor.h:
        * rendering/RenderSVGRoot.cpp:
        (WebCore::RenderSVGRoot::nodeAtPoint):
        * rendering/RenderSVGRoot.h:
        * rendering/RenderSVGShadowTreeRootContainer.cpp:
        * rendering/RenderSVGShadowTreeRootContainer.h:
        * rendering/RenderSVGTransformableContainer.cpp:
        (WebCore::RenderSVGTransformableContainer::calculateLocalTransform):
        * rendering/RenderSVGTransformableContainer.h:
        (WebCore::RenderSVGTransformableContainer::localToParentTransform):
        (WebCore::RenderSVGTransformableContainer::setNeedsTransformUpdate):
        (WebCore::RenderSVGTransformableContainer::localTransform):
        * rendering/RenderSVGViewportContainer.cpp:
        * rendering/RenderSVGViewportContainer.h:
        * rendering/SVGImageBufferTools.cpp:
        * rendering/SVGImageBufferTools.h:
        * rendering/SVGMarkerData.h:
        * rendering/SVGMarkerLayoutInfo.cpp:
        * rendering/SVGMarkerLayoutInfo.h:
        * rendering/SVGRenderSupport.cpp:
        * rendering/SVGRenderSupport.h:
        * rendering/SVGRenderTreeAsText.cpp:
        (WebCore::operator<<):
        * rendering/SVGRenderTreeAsText.h:
        * rendering/SVGResources.cpp:
        * rendering/SVGResources.h:
        * rendering/SVGResourcesCache.cpp:
        * rendering/SVGResourcesCache.h:
        * rendering/SVGResourcesCycleSolver.cpp:
        * rendering/SVGResourcesCycleSolver.h:
        * rendering/SVGShadowTreeElements.cpp:
        * rendering/SVGShadowTreeElements.h:

2011-01-07  Adam Barth  <abarth@webkit.org>

        Rubber-stamped by Eric Seidel.

        Move WebCore to Source
        https://bugs.webkit.org/show_bug.cgi?id=52050

        Update project files to understand WebCore's new location.  I suspect
        there will be some follow-up patches after we land this patch.

        * Android.derived.jscbindings.mk:
        * Android.jscbindings.mk:
        * Android.v8bindings.mk:
        * GNUmakefile.am:
        * WebCore.gyp/WebCore.gyp:
        * WebCore.pri:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.vcproj/WebCoreGeneratedCairo.vsprops:
        * WebCore.vcproj/WebCoreGeneratedCommon.vsprops:

2011-01-07  Justin Garcia  <justin.garcia@apple.com>

        Reviewed by Dan Bernstein.

        https://bugs.webkit.org/show_bug.cgi?id=51851
        Implement RenderSVGInlineText::localCaretRect()

        * rendering/svg/RenderSVGInlineText.cpp:
        (WebCore::RenderSVGInlineText::localCaretRect): Implemented.

2011-01-07  Ryosuke Niwa  <rniwa@webkit.org>

        Unreviewed; Added the missing null pointer check for r75293.

        * dom/Document.cpp:
        (WebCore::Document::adoptNode):

2011-01-07  Stephanie Lewis  <slewis@apple.com>

        Reviewed by Geoff Garen.

         <rdar://problem/8649617> Migrate memory tracking from Safari to WebKit
        https://bugs.webkit.org/show_bug.cgi?id=50799 Add Memory Sampler to WebKit
        
        Add a sampler for printing off process memory statistics.
        Export file mode.

        * WebCore.exp.in:

2011-01-06  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Adam Barth.

        onbeforeunload is broken for framesets
        https://bugs.webkit.org/show_bug.cgi?id=19418

        Added beforeunload event support for sub frames. WebKit's implementation tries to match
        that of Internet Explorer as much as possible. beforeunload event is fired for each and
        every descendent of a frame that is about to navigate.

        When a value other than null is returned by a beforeunload handler, a confirmation dialog
        is shown for each handler (calls chrome's runBeforeUnloadConfirmPanel) just like it is done
        for main frames.

        In addition, navigation is forbidden while beforeunload handlers are being called.
        Setting values to location.href, location.reload, and other means of navigations are thus
        ignored while beforeunload event handler is being ran, matching Internet Explorer's behavior.

        Because navigation needs to prevented globally, NavigationDisablerForBeforeUnload is added to
        NavigationScheduler.h, which is instantiated as a RAII object in FrameLoader::shouldClose.

        Tests: fast/events/before-unload-adopt-subframe-to-outside.html
               fast/events/before-unload-adopt-within-subframes.html
               fast/events/before-unload-forbidden-navigation.html
               fast/events/before-unload-in-multiple-subframes.html
               fast/events/before-unload-in-subframe.html
               fast/events/before-unload-javascript-navigation.html
               fast/events/before-unload-remove-and-add-subframe.html
               fact/events/before-unload-remove-itself.html
               fast/events/before-unload-with-subframes.html

       * loader/FrameLoader.cpp:
       (WebCore::FrameLoader::shouldClose): Calls fireBeforeUnloadEvent on m_frame and m_frame's
       descendents. Returns true only if every call to fireBeforeUnloadEvent returned true.
       (WebCore::FrameLoader::fireBeforeUnloadEvent): Fires a beforeunload event and calls
       chrome's runBeforeUnloadConfirmPanel as needed.
       (WebCore::FrameLoader::continueLoadAfterNavigationPolicy): Calls shouldClose for all frames.
       * loader/FrameLoader.h:
       * loader/NavigationScheduler.cpp:
       (WebCore::NavigationScheduler::shouldScheduleNavigation): Checks the nullity of Page and calls
       NavigationDisablerForBeforeUnload::isNavigationAllowed when url is not javascript scheme.
       (WebCore::NavigationScheduler::scheduleRedirect): Calls shouldScheduleNavigation.
       (WebCore::NavigationScheduler::scheduleLocationChange): Ditto.
       (WebCore::NavigationScheduler::scheduleRefresh): Ditto.
       (WebCore::NavigationScheduler::scheduleHistoryNavigation): Ditto.
       * loader/NavigationScheduler.h:
       (WebCore::NavigationDisablerForBeforeUnload::NavigationDisablerForBeforeUnload): Disables navigation.
       (WebCore::NavigationDisablerForBeforeUnload::~NavigationDisablerForBeforeUnload): Enables navigation
       when called on the last instance of NavigationDisablerForBeforeUnload.
       (WebCore::NavigationDisablerForBeforeUnload::isNavigationAllowed): Returns true if there are no instance
       of NavigationDisablerForBeforeUnload left on the stack.

2011-01-07  Martin Robinson  <mrobinson@igalia.com>

        Build fix for GTK+.

        * GNUmakefile.am: Add RenderFullScreen.cpp to the sources list.
        * rendering/RenderFullScreen.cpp:
        (RenderFullScreen::setAnimating): Guard the call to contentChanged
        with ENABLED(ACCELERATED_COMPOSITING).

2011-01-07  Ryosuke Niwa  <rniwa@webkit.org>

        Unreviewed; speculative fix for Windows debug build.

        * bindings/js/JSBindingsAllInOne.cpp:

2011-01-07  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Ojan Vafai.

        Adopting an iframe to a child frame results in stack overflow
        https://bugs.webkit.org/show_bug.cgi?id=52018

        Throws an exception when a document adopts an iframe that is an ancestor
        of the document in the frame hierarchy. New behavior matches that of Firefox.

        Test: fast/html/adopt-parent-frame.html

        * dom/Document.cpp:
        (WebCore::Document::adoptNode):

2011-01-07  Mihai Parparita  <mihaip@chromium.org>

        Reviewed by Darin Fisher.

        [Chromium] Scrollbar code cleanup
        https://bugs.webkit.org/show_bug.cgi?id=52073

        Scrollbar code cleanup:
        - Remove ScrollbarThemeMac.{mm|h} from the mac sources list, we use
          ScrollbarThemeChromiumMac.{mm|h}
        - Remove USE_WEB_THEME_ENGINE_TO_PAINT_THUMB #define now that switch to
          WebThemeEngine is permanent
        - Fix typo in Linux scrollbar enum name

        No new tests (compiles).

        * WebCore.gypi:
        * platform/chromium/ChromiumBridge.h:
        * platform/chromium/ScrollbarThemeChromiumLinux.cpp:
        (WebCore::ScrollbarThemeChromiumLinux::paintTrackPiece):
        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::scrollbarStateToThemeState):
        (WebCore::ScrollbarThemeChromiumMac::paint):

2011-01-07  Jer Noble  <jer.noble@apple.com>

        GTK Linux build fix: isDocumentRunningFullScreenAnimation should
        be protected both by ENABLE(FULLSCREEN_API) && USE(ACCELERATED_COMPOSITING)

        * page/FrameView.cpp:

2011-01-07  Rafael Weinstein  <rafaelw@chromium.org>

        Reviewed by Eric Seidel.

        Cleanup: Fold shadowParentNode into shadowHost
        https://bugs.webkit.org/show_bug.cgi?id=51059

        Replaces all uses of shadowParentNode.

        No new tests because no behavior has changed.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::initForStyleResolve):
        * dom/Node.cpp:
        (WebCore::Node::shadowHost):
        (WebCore::Node::shadowAncestorNode):
        (WebCore::eventTargetRespectingSVGTargetRules):
        (WebCore::Node::getEventAncestors):
        * dom/Node.h:
        * editing/Editor.cpp:
        (WebCore::Editor::findString):
        * page/DragController.cpp:
        (WebCore::asFileInput):
        * page/EventHandler.cpp:
        (WebCore::EventHandler::handleMousePressEvent):
        (WebCore::instanceAssociatedWithShadowTreeElement):
        (WebCore::EventHandler::dispatchMouseEvent):
        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::hasLineIfEmpty):
        * rendering/RenderSVGShadowTreeRootContainer.cpp:
        (WebCore::RenderSVGShadowTreeRootContainer::updateFromElement):
        * svg/SVGStyledElement.cpp:
        (WebCore::SVGStyledElement::title):

2011-01-07  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        I mistakenly included a Windows only file in a
        cross platform file. 

        * platform/graphics/ca/GraphicsLayerCA.cpp:

2011-01-07  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Get rid of include of <QuartzCore/QuartzCore.h>

        * platform/graphics/ca/GraphicsLayerCA.cpp:

2011-01-07  Jer Noble  <jer.noble@apple.com>

        Further build fixes.  Add a ENABLE(FULLSCREEN_API) guard around
        the implementation of requiresCompositingfForFullScreen.

        * rendering/RenderLayerCompositor.cpp:
        (WebCore::RenderLayerCompositor::requiresCompositingForFullScreen):

2011-01-07  Jer Noble  <jer.noble@apple.com>

        No review, build fix only.  Removed parameter who was causing
        a warning in Release builds.

        * dom/Document.cpp:
        (WebCore::Document::webkitDidExitFullScreenForElement):

2011-01-07  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Use new wkCACFLayerGetContextUserData function

        * platform/graphics/ca/win/PlatformCALayerWin.cpp:

2011-01-07  James Robinson  <jamesr@chromium.org>

        Fix compile bustage due to bad merge in 75276.

        * page/animation/AnimationController.cpp:
        (WebCore::AnimationControllerPrivate::beginAnimationUpdateTime):

2010-12-17  Jer Noble  <jer@kokode.apple.com>

        Reviewed by Simon Fraser.

        Implement WebKit Full Screen support.
        https://bugs.webkit.org/show_bug.cgi?id=49481
        rdar://problem/8247444

        Mark for export all those WebCore functions needed by WebFullscreenController.

        * WebCore.exp.in:

2010-12-17  Jer Noble  <jer@kokode.apple.com>

        Reviewed by Simon Fraser.

        Implement WebKit Full Screen support.
        https://bugs.webkit.org/show_bug.cgi?id=49481
        rdar://problem/8247444
        
        screenRect is useful for more than just HTMLMediaElements.  Promote it into
        Element.

        * dom/Element.cpp: Moved into Element from HTMLMediaElement.
        * dom/Element.h: Ditto.
        * dom/Node.cpp:
        * html/HTMLMediaElement.cpp: Moved screenRect into Element.
        * html/HTMLMediaElement.h: Ditto.
        * WebCore.exp.in: Modify the exports list to reflect the new symbol name.

2010-12-17  Jer Noble  <jer@kokode.apple.com>

        Reviewed by Simon Fraser.

        Implement WebKit Full Screen support.
        https://bugs.webkit.org/show_bug.cgi?id=49481
        rdar://problem/8247444

        The RenderFullScreen is intended to be used by clients of that API to allow a DOM subtree to
        be rendered outside its original Frame. Because of this, there are a few areas of the
        rendering code which need to be special cased: RenderFullScreen layers should not be clipped
        to the viewport, as they will almost always be rendering outside the viewport area;
        RenderFullScreen graphics layers should not be reparented by the RenderLayerCompositor, as
        the client will likely want to reparent the platformLayer into their own fullscreen platform
        window; the FrameView must update the RenderFullScreen graphics layer tree separately from
        the root layer, as the two trees are disconnected.

        * page/FrameView.cpp:
        (WebCore::FrameView::updateCompositingLayers):  Special treatment for fullscreen renderer.
        (WebCore::FrameView::syncCompositingStateRecursive): Ditto.
        (WebCore::FrameView::paintContents): Ditto.
        * rendering/RenderLayer.h: Add a new ContentChangeType enum entry for FullScreen.
        * rendering/RenderLayer.cpp: 
        (WebCore::RenderLayer::contentChanged): Add support for above.
        * rendering/RenderLayerBacking.cpp:
        (WebCore::layerOrAncestorIsFullScreen): New function.
        (WebCore::RenderLayerBacking::updateCompositedBounds): Do not clip if the layerOrAncestorIsFullScreen.
        * rendering/RenderLayerCompositor.cpp:
        (WebCore::RenderLayerCompositor::rebuildCompositingLayerTree): Special treatment for fullscreen renderer.
        (WebCore::RenderLayerCompositor::requiresCompositingLayer): Ditto.
        (WebCore::RenderLayerCompositor::requiresCompositingForFullScreen): Ditto.
        * rendering/RenderLayerCompositor.h:

2010-12-17  Jer Noble  <jer@kokode.apple.com>

        Reviewed by Simon Fraser.

        Implemented non-accelerated fullscreen support.  The Document will now vend a RenderFullScreen object for clients to
        use to relocate the fullscreen element subtree.

        https://bugs.webkit.org/show_bug.cgi?id=49481
        rdar://problem/8247444

        * css/CSSStyleSelector.cpp:
        (WebCore::loadFullScreenRulesIfNeeded): Change webkitFullScreen -> webkitIsFullScreen.
        (WebCore::CSSStyleSelector::SelectorChecker::checkOneSelector): Ditto.
        * dom/Document.cpp:
        (WebCore::Document::Document): Initialize m_fullScreenRenderer.
        (WebCore::Document::detach): Call setFullScreenRenderer(0).
        (WebCore::Document::nodeWillBeRemoved): Replicate the logic in webkitWillEnterFullScreenForElement.
        (WebCore::Document::webkitWillEnterFullScreenForElement):  Detach the fullscreen element to cause
            a new RenderFullScreen renderer to be created with the new fullscreen element.
        (WebCore::Document::webkitDidEnterFullScreenForElement):  Notify clients of a fullscreen change
            here, rather in "willEnter", to avoid reentrancy problems when clients remove nodes in response
            to webkitfullscreenchange events.
        (WebCore::Document::webkitWillExitFullScreenForElement): Recalculate the fullscreen element's style.
        (WebCore::Document::webkitDidExitFullScreenForElement): Ditto.
        (WebCore::Document::setFullScreenRenderer): Accessor for m_fullScreenRenderer.
        (WebCore::Document::setFullScreenRendererSize): Set the style on the m_fullScreenRenderer with a new
            size; this keeps clients from having to access the renderer's style directly.
        (WebCore::Document::setFullScreenRendererBackgroundColor): Ditto.
        * dom/Document.h:
        (WebCore::Document::webkitIsFullScreen): Change webkitFullScreen -> webkitIsFullScreen.
        (WebCore::Document::fullScreenRenderer): Accessor.
        * dom/Document.idl:
        * dom/Node.cpp:
        (WebCore::Node::createRendererIfNeeded): If the document is in fullscreen mode, create a RenderFullScreen
            object to insert between the fullscreen element and its parent.
        * page/ChromeClient.h:
        (WebCore::ChromeClient::fullScreenRendererChanged): Added.
        * rendering/MediaControlElements.cpp:
        (WebCore::MediaControlFullscreenButtonElement::defaultEventHandler): Change webkitFullScreen -> webkitIsFullScreen.

2010-12-17  Jer Noble  <jer@kokode.apple.com>

        Reviewed by Simon Fraser.

        Implement WebKit Full Screen support.
        https://bugs.webkit.org/show_bug.cgi?id=49481
        rdar://problem/8247444
        
        This patch introduces a new RenderObject type: RenderFullScreen.  The RenderFullScreen renderer 
        will be used to implement new FullScreen APIs.  Because the RenderFullScreen object will be the
        parent of the current fullscreen element, the style rules for fullscreen objects must change to
        match.
        
        * WebCore.xcodeproj/project.pbxproj:
        * rendering/RenderFullScreen.cpp: Added.
        (RenderFullScreen::setAnimating): Sets the m_isAnimating flag.
        (RenderFullScreen::createFullScreenStyle): Returns a new RenderStyle containing the default stye
            for RenderFullScreen objects.
        * rendering/RenderFullScreen.h: Added.
        (WebCore::RenderFullScreen::isRenderFullScreen): Added.  Overrides the RenderObject version.
        * rendering/RenderObject.h:
        (WebCore::RenderObject::isRenderFullScreen): Added.  Used for type-checking RenderFullScreen objects.
        * css/fullscreen.css:  Modified the contained fullscreen styles.


2011-01-07  James Robinson  <jamesr@chromium.org>

        Revert "Implement mozilla's animationTime property"
        https://bugs.webkit.org/show_bug.cgi?id=51952

        This approach isn't quite right.

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.exp.in:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * page/DOMWindow.cpp:
        * page/DOMWindow.h:
        * page/DOMWindow.idl:
        * page/Frame.cpp:
        * page/Frame.h:
        * page/Page.cpp:
        (WebCore::Page::Page):
        * page/Page.h:
        * page/animation/AnimationController.cpp:
        (WebCore::AnimationControllerPrivate::beginAnimationUpdateTime):
        * page/animation/AnimationTimeController.cpp: Removed.
        * page/animation/AnimationTimeController.h: Removed.

2011-01-07  Jan Erik Hanssen  <jhanssen@sencha.com>

        Reviewed by Andreas Kling.

        [Qt] Black text on black buttons using a dark theme
        https://bugs.webkit.org/show_bug.cgi?id=35024

        Implement RenderThemeQt::systemColor to apply the correct colors from the current Qt style.

        * platform/qt/RenderThemeQt.cpp:
        (WebCore::RenderThemeQt::systemColor):
        * platform/qt/RenderThemeQt.h:

2011-01-05  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        Add WEBKIT_lose_context WebGL extension.
        https://bugs.webkit.org/show_bug.cgi?id=51492

        Tests: fast/canvas/webgl/context-lost-restored.html
               fast/canvas/webgl/context-lost.html

        * CMakeLists.txt:
        * DerivedSources.make:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pri:
        * WebCore.pro:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/JSWebGLRenderingContextCustom.cpp:
        (WebCore::toJS):
        (WebCore::JSWebGLRenderingContext::getSupportedExtensions):
        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
        (WebCore::toV8Object):
        (WebCore::V8WebGLRenderingContext::getSupportedExtensionsCallback):
        * html/canvas/WebGLExtension.h:
        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::WebGLRenderingContextRestoreTimer::fired):
        (WebCore::WebGLRenderingContext::getExtension):
        (WebCore::WebGLRenderingContext::getSupportedExtensions):
        (WebCore::WebGLRenderingContext::forceLostContext):
        (WebCore::WebGLRenderingContext::onLostContext):
        (WebCore::WebGLRenderingContext::getNumberOfExtensions):
        (WebCore::WebGLRenderingContext::getExtensionNumber):
        * html/canvas/WebGLRenderingContext.h:
        * html/canvas/WebKitLoseContext.cpp: Copied from WebCore/html/canvas/WebGLExtension.h.
        (WebCore::WebKitLoseContext::WebKitLoseContext):
        (WebCore::WebKitLoseContext::~WebKitLoseContext):
        (WebCore::WebKitLoseContext::getName):
        (WebCore::WebKitLoseContext::create):
        (WebCore::WebKitLoseContext::loseContext):
        * html/canvas/WebKitLoseContext.h: Copied from WebCore/html/canvas/WebGLExtension.h.
        * html/canvas/WebKitLoseContext.idl: Copied from WebCore/html/canvas/WebGLExtension.h.

2011-01-07  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Build fix for Chromium. Missing include.

        * page/animation/AnimationBase.cpp:

2011-01-07  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Build fix.

        * platform/graphics/ca/win/PlatformCALayerWin.cpp:

2011-01-06  Gavin Barraclough  <barraclough@apple.com>

        Reviewed by Geoff Garen.

        Bug 52035 - Unregistering DOMWrapperWorlds is unsafe

        The method DOMWrapperWorld::unregisterWorld() effectively calls the DOMWrapperWorld's
        destructor early, in order to release wrappers once we know we no longer intend to use them.
        Whilst it is okay to have a method to throw away wrappers (assuming we know we're willing to
        lose any state stored on them) it is not okay to deregister the world from the JSGlobalData.
        A sequence of events that triggers the bug would look like this:

        (1) Create a DOMWrapperWorld.
        (2) Register a timer in the world.
        (3) Call unregisterWorld() on the world.
        (4) Timer goes off, code is executed in the world, creates a Node not attached to a Document.
        (5) We attempt to lookup a wrapper map for the world on the JSGlobalData, but because we've
            called forgetWorld() none exists.
        (6) Attempt to add a wrapper to a NULL map.

        Fix the problem by not removing the JSGlobalData's wrapper map until the world really goes away.

        * WebCore.exp.in:
        * bindings/js/DOMWrapperWorld.cpp:
        (WebCore::DOMWrapperWorld::DOMWrapperWorld):
        (WebCore::DOMWrapperWorld::~DOMWrapperWorld):
        (WebCore::DOMWrapperWorld::clearWrappers):
        * bindings/js/DOMWrapperWorld.h:

2011-01-07  Chris Marrin  <cmarrin@apple.com>

        Rubber-stamped by Simon Fraser.

        Share code between Mac (CA) and Windows (CACF) GraphicsLayer implementations
        https://bugs.webkit.org/show_bug.cgi?id=49388

        Final step in unifying GraphicsLayer logic across Win and Mac. This 
        implements the Windows side classes for PlatformCALayer and supporting
        classes. Also changed MediaPlayer to use new PlatformCALayerClient
        so it can use PlatformCALayer directly rather than a dummy GraphicsLayer.
        WKCACFLayerRenderer now does the task of notifying animations of their
        start time. Also commented out an assert in AnimationBase because
        AnimationController's frame time is not in sync with the new 
        AnimationTimeController. I've opened a new bug for that issue:

            https://bugs.webkit.org/show_bug.cgi?id=52037
            
        This also includes the Mac side changes backed out in 
        http://trac.webkit.org/changeset/75227.

        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.vcproj/WebCoreCommon.vsprops:
        * WebCore.vcproj/copyForwardingHeaders.cmd:
        * WebCore.xcodeproj/project.pbxproj:
        * config.h:
        * page/animation/AnimationBase.cpp:
        (WebCore::AnimationBase::freezeAtTime):
        (WebCore::AnimationBase::getElapsedTime):
        * page/animation/AnimationController.cpp:
        (WebCore::AnimationControllerPrivate::beginAnimationUpdateTime):
        * page/animation/KeyframeAnimation.cpp:
        (WebCore::KeyframeAnimation::fetchIntervalEndpointsForProperty):
        * platform/graphics/GraphicsLayer.h:
        (WebCore::GraphicsLayer::layerDidDisplay):
        (WebCore::GraphicsLayer::showDebugBorders):
        (WebCore::GraphicsLayer::showRepaintCounter):
        * platform/graphics/ca/GraphicsLayerCA.cpp:
        (WebCore::GraphicsLayerCA::platformCALayerAnimationStarted):
        (WebCore::GraphicsLayerCA::setContentsToImage):
        (WebCore::GraphicsLayerCA::setContentsToMedia):
        (WebCore::GraphicsLayerCA::layerDidDisplay):
        (WebCore::GraphicsLayerCA::updateSublayerList):
        * platform/graphics/ca/GraphicsLayerCA.h:
        (WebCore::GraphicsLayerCA::platformCALayer):
        (WebCore::GraphicsLayerCA::platformCALayerLayoutSublayersOfLayer):
        (WebCore::GraphicsLayerCA::platformCALayerRespondsToLayoutChanges):
        (WebCore::GraphicsLayerCA::platformCALayerContentsOrientation):
        (WebCore::GraphicsLayerCA::platformCALayerPaintContents):
        (WebCore::GraphicsLayerCA::platformCALayerShowDebugBorders):
        (WebCore::GraphicsLayerCA::platformCALayerShowRepaintCounter):
        (WebCore::GraphicsLayerCA::platformCALayerIncrementRepaintCount):
        (WebCore::GraphicsLayerCA::platformCALayerContentsOpaque):
        (WebCore::GraphicsLayerCA::platformCALayerDrawsContent):
        (WebCore::GraphicsLayerCA::platformCALayerLayerDidDisplay):
        * platform/graphics/ca/PlatformCAAnimation.h:
        * platform/graphics/ca/PlatformCALayer.h:
        (WebCore::PlatformCALayer::owner):
        (WebCore::PlatformCALayer::animationStarted):
        * platform/graphics/ca/PlatformCALayerClient.h: Copied from WebCore/platform/graphics/ca/PlatformCALayerClient.h.
        * platform/graphics/ca/mac/PlatformCALayerMac.mm:
        (PlatformCALayer::setOwner):
        (PlatformCALayer::create):
        (PlatformCALayer::PlatformCALayer):
        (PlatformCALayer::contents):
        (PlatformCALayer::setContents):
        * platform/graphics/ca/win: Added.
        * platform/graphics/ca/win/PlatformCAAnimationWin.cpp: Added.
        * platform/graphics/ca/win/PlatformCALayerWin.cpp: Added.
        * platform/graphics/ca/win/PlatformCALayerWinInternal.cpp: Added.
        * platform/graphics/ca/win/PlatformCALayerWinInternal.h: Added.
        (WebCore::PlatformCALayerWinInternal::owner):
        * platform/graphics/mac/WebGLLayer.mm:
        (-[WebGLLayer display]):
        * platform/graphics/mac/WebLayer.h:
        * platform/graphics/mac/WebLayer.mm:
        (drawLayerContents):
        (setLayerNeedsDisplayInRect):
        (-[WebLayer setNeedsDisplay]):
        (-[WebLayer display]):
        * platform/graphics/mac/WebTiledLayer.mm:
        (-[WebTiledLayer setNeedsDisplay]):
        (-[WebTiledLayer display]):
        * platform/graphics/win/GraphicsContextCGWin.cpp:
        (WebCore::CGContextWithHDC):
        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
        (WebCore::MediaPlayerPrivateFullscreenWindow::setRootChildLayer):
        (WebCore::MediaPlayerPrivateFullscreenWindow::wndProc):
        * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h:
        (WebCore::MediaPlayerPrivateFullscreenWindow::rootChildLayer):
        * platform/graphics/win/MediaPlayerPrivateQuickTimeVisualContext.cpp:
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::~LayerClient):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerRespondsToLayoutChanges):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerAnimationStarted):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerContentsOrientation):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerPaintContents):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerShowDebugBorders):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerShowRepaintCounter):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerIncrementRepaintCount):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerContentsOpaque):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerDrawsContent):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerLayerDidDisplay):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::LayerClient::platformCALayerLayoutSublayersOfLayer):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::MediaPlayerPrivateQuickTimeVisualContext):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::platformMedia):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::retrieveCurrentImage):
        (WebCore::MediaPlayerPrivateQuickTimeVisualContext::createLayerForMovie):
        * platform/graphics/win/MediaPlayerPrivateQuickTimeVisualContext.h:
        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.cpp:
        (WebCore::MediaPlayerPrivate::movieNewImageAvailable):
        (WebCore::MediaPlayerPrivate::createLayerForMovie):
        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        (WebCore::WKCACFLayerRenderer::WKCACFLayerRenderer):
        (WebCore::WKCACFLayerRenderer::rootLayer):
        (WebCore::WKCACFLayerRenderer::addPendingAnimatedLayer):
        (WebCore::WKCACFLayerRenderer::setRootChildLayer):
        (WebCore::WKCACFLayerRenderer::setNeedsDisplay):
        (WebCore::WKCACFLayerRenderer::destroyRenderer):
        (WebCore::WKCACFLayerRenderer::render):
        * platform/graphics/win/WKCACFLayerRenderer.h:
        (WebCore::WKCACFLayerRendererClient::animationsStarted):
        (WebCore::WKCACFLayerRendererClient::syncCompositingState):
        * rendering/RenderLayerBacking.cpp:
        (WebCore::RenderLayerBacking::showDebugBorders):
        (WebCore::RenderLayerBacking::showRepaintCounter):
        * rendering/RenderLayerCompositor.cpp:
        (WebCore::RenderLayerCompositor::ensureRootPlatformLayer):
        * rendering/RenderLayerCompositor.h:
        (WebCore::RenderLayerCompositor::compositorShowDebugBorders):
        (WebCore::RenderLayerCompositor::compositorShowRepaintCounter):
        (WebCore::RenderLayerCompositor::notifyAnimationStarted):
        (WebCore::RenderLayerCompositor::notifySyncRequired):
        (WebCore::RenderLayerCompositor::paintContents):
        (WebCore::RenderLayerCompositor::showDebugBorders):
        (WebCore::RenderLayerCompositor::showRepaintCounter):

2011-01-07  Nate Chapin  <japhet@chromium.org>

        Reviewed by Darin Fisher.

        Let PingLoader send cookies if FrameLoaderClient permits it.
        https://bugs.webkit.org/show_bug.cgi?id=51898

        Test: http/tests/navigation/ping-cookie.html

        * loader/PingLoader.cpp:
        (WebCore::PingLoader::PingLoader): Set m_shouldUseCredentialStorage
            at load start time, since we won't be able to call 
            FrameLoaderClient::shouldUseCredentialStorage() later.
        * loader/PingLoader.h:
        (WebCore::PingLoader::shouldUseCredentialStorage):

2011-01-07  Xan Lopez  <xlopez@igalia.com>

        Unreviewed, rolling out r75256.
        http://trac.webkit.org/changeset/75256
        https://bugs.webkit.org/show_bug.cgi?id=50869

        Broke GTK+ canvas tests

        * platform/graphics/cairo/PathCairo.cpp:
        (WebCore::Path::addArc):

2011-01-07  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Port scrollbar painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=52051

        Use GtkStyleContext API to paint scrollbars when building with
        GTK+ 3.x.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk.h:
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::gtkScrollbarStyle):
        * platform/gtk/ScrollbarThemeGtk.cpp:
        * platform/gtk/ScrollbarThemeGtk.h:
        * platform/gtk/ScrollbarThemeGtk2.cpp:
        (WebCore::gtkStyleSetCallback):
        (WebCore::ScrollbarThemeGtk::ScrollbarThemeGtk):
        * platform/gtk/ScrollbarThemeGtk3.cpp:
        (WebCore::gtkStyleChangedCallback):
        (WebCore::ScrollbarThemeGtk::ScrollbarThemeGtk):
        (WebCore::ScrollbarThemeGtk::updateThemeProperties):
        (WebCore::ScrollbarThemeGtk::paintTrackBackground):
        (WebCore::ScrollbarThemeGtk::paintScrollbarBackground):
        (WebCore::ScrollbarThemeGtk::paintThumb):
        (WebCore::ScrollbarThemeGtk::paintButton):

2011-01-07  Dan Bernstein  <mitz@apple.com>

        Reviewed by Darin Adler.

        <rdar://problem/8783318> Text emphasis marks should not appear over characters that have ruby annotations
        https://bugs.webkit.org/show_bug.cgi?id=51267

        Test: fast/text/emphasis-avoid-ruby.html

        * rendering/InlineFlowBox.cpp:
        (WebCore::InlineFlowBox::placeBoxesInBlockDirection): Use getEmphasisMarkPosition() to check if
        there are text emphasis marks.
        (WebCore::InlineFlowBox::addTextBoxVisualOverflow): Ditto.
        (WebCore::InlineFlowBox::computeOverAnnotationAdjustment): Ditto.
        * rendering/InlineTextBox.cpp:
        (WebCore::InlineTextBox::getEmphasisMarkPosition): Added. Returns true and sets the emphasis mark
        position if the text is style with emphasis marks and there isn’t a ruby annotation that should
        suppress them. Otherwise returns false.
        (WebCore::InlineTextBox::paint): Use getEmphasisMarkPosition() to check if emphasis marks should
        be painted.
        * rendering/InlineTextBox.h:

2011-01-07  Alejandro G. Castro  <alex@igalia.com>

        Reviewed by Martin Robinson.

        [cairo] Rendering a lot of arcs on top of each other causes time
        outs in some tests
        https://bugs.webkit.org/show_bug.cgi?id=50869

        We avoid the situation where we have to render the same arc
        multiple times over itself. Now it renders just one oval and
        moves to the end angle.

        * platform/graphics/cairo/PathCairo.cpp:
        (WebCore::Path::addArc):

2011-01-07  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Port buttons painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=51812

        Use GtkStyleContext API to paint buttons when building with GTK+
        3.x.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::adjustRectForFocus):
        (WebCore::RenderThemeGtk::adjustRepaintRect):
        (WebCore::RenderThemeGtk::paintButton):

2011-01-07  Zhenyao Mo  <zmo@google.com>

        Unreviewed, build fix.

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::copyTexSubImage2D):

2011-01-06  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        copyTexSubImage2D shouldn't have undefined pixels
        https://bugs.webkit.org/show_bug.cgi?id=51559

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::copyTexImage2D): Refactor to share some code with copyTexSubImage2D through helper function clip2D.
        (WebCore::WebGLRenderingContext::copyTexSubImage2D): Initialize undefined pixels to 0.
        (WebCore::WebGLRenderingContext::validateTexFuncLevel): Seperate the validation of level from validateTexFuncParameters.
        (WebCore::WebGLRenderingContext::validateTexFuncParameters): Ditto.
        * html/canvas/WebGLRenderingContext.h:
        * html/canvas/WebGLTexture.cpp:
        (WebCore::WebGLTexture::getType): Expose the type of a texture.
        * html/canvas/WebGLTexture.h:

2011-01-07  Takashi Toyoshima  <toyoshim@google.com>

        Reviewed by Kenneth Russell.

        cleanupAfterGraphicsCall() is never called in
        WebGLRenderingContext::checkFramebufferStatus()
        https://bugs.webkit.org/show_bug.cgi?id=51668

        No new tests. This is a trivial bug.

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::checkFramebufferStatus):

2011-01-07  Mario Sanchez Prada  <msanchez@igalia.com>

        Reviewed by Chris Fleizach.

        GTK: AX: atk tests need to be updated after recent changes
        https://bugs.webkit.org/show_bug.cgi?id=51932

        Make sure we can always get the right accesssible parent for an
        AtkObject when traversing the hierarchy bottom up.

        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
        (isRootObject): New function to check whether an
        AccessibilityObject is the root one or not, according to the
        latest changes in the hierarchy.
        (atkParentOfRootObject): Gets the appropriate AtkObject from GTK's
        GAIL as the parent of the root AtkObject from WebCore.
        (webkit_accessible_get_parent): Use atkParentOfRootObject.
        (webkit_accessible_get_index_in_parent): Ditto.
        (atkRole): Expose AccessibilityObjects with ScrollAreaRole as
        AtkObject's of role ATK_ROLE_SCROLLED_PANE.

2011-01-07  Zhenyao Mo  <zmo@google.com>

        Unreviewed, Mac 32-bit build fix.
        Use float instead of double in GL function arguments to avoid implicit type down casting.

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::blendColor):
        (WebCore::WebGLRenderingContext::clearColor):
        (WebCore::WebGLRenderingContext::clearDepth):
        (WebCore::WebGLRenderingContext::depthRange):
        (WebCore::WebGLRenderingContext::lineWidth):
        (WebCore::WebGLRenderingContext::polygonOffset):
        (WebCore::WebGLRenderingContext::sampleCoverage):
        * html/canvas/WebGLRenderingContext.h:
        * html/canvas/WebGLRenderingContext.idl:

2011-01-07  Carlos Garcia Campos  <cgarcia@igalia.com> and Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Port slider painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=51874

        Use GtkStyleContext API to paint sliders when building with GTK+
        3.x. Also move the code to adjust media slider to its own method
        in RenderThemeGtk.cpp since it's common to both gtk 2 and 3.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::adjustMediaSliderThumbSize):
        * platform/gtk/RenderThemeGtk.h:
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::adjustSliderThumbSize):
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::paintSliderTrack):
        (WebCore::RenderThemeGtk::paintSliderThumb):
        (WebCore::RenderThemeGtk::adjustSliderThumbSize):

2011-01-07  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Andreas Kling.

        [Qt] [WK2] QtWebKit does not build in debug, FileReader.cpp does not compile
        https://bugs.webkit.org/show_bug.cgi?id=51992

        Add the missing header. CString is used in debug by the calls to LOG().

        * fileapi/FileReader.cpp:

2011-01-07  Alejandro G. Castro  <alex@igalia.com>

        Reviewed by Martin Robinson.

        Cairo's ContextShadow may mis-render some box shadows
        https://bugs.webkit.org/show_bug.cgi?id=51374

        The space required for the internal shadow of the corners was not
        correctly considered.

        * platform/graphics/cairo/ContextShadowCairo.cpp:
        (WebCore::ContextShadow::drawRectShadow):

2011-01-06  Adam Barth  <abarth@webkit.org>

        Reviewed by Darin Adler.

        REGRESSION (r74663): ASSERTION FAILED: m_tokenizer->lineNumber() == line.zeroBasedInt()
        https://bugs.webkit.org/show_bug.cgi?id=52013

        When excluding line numbers for composite strings, we forgot to exclude
        the line number for the current string!

        Test: fast/parser/line-number-composite-segmented-string.html

        * platform/text/SegmentedString.cpp:
        (WebCore::SegmentedString::setExcludeLineNumbers):

2011-01-06  Chris Marrin  <cmarrin@apple.com>

        Unreviewed.

        Back out changes in http://trac.webkit.org/changeset/75199
        This breaks the Windows build. Fixing it on that side. Until
        then I'll back this out.

2011-01-06  Jenn Braithwaite  <jennb@chromium.org>

        Reviewed by Dmitry Titov.

        When a live frame is moved between pages, some plug-in DOM methods cease to function
        https://bugs.webkit.org/show_bug.cgi?id=45770

        Test: fast/frames/iframe-reparenting-plugins.html

        * page/Frame.cpp:
        (WebCore::Frame::~Frame):
        (WebCore::Frame::addObserver):
        (WebCore::Frame::removeObserver):
        * page/Frame.h:
        (WebCore::FrameDestructionObserver::~FrameDestructionObserver):
        Added observer to be notified when frame is destroyed.
        * page/Page.cpp:
        (WebCore::Page::~Page):
        (WebCore::Page::refreshPlugins):
        PluginData no longer stores page pointer.
        * plugins/DOMMimeType.cpp:
        (WebCore::DOMMimeType::DOMMimeType):
        (WebCore::DOMMimeType::~DOMMimeType):
        (WebCore::DOMMimeType::enabledPlugin):
        * plugins/DOMMimeType.h:
        (WebCore::DOMMimeType::create):
        (WebCore::DOMMimeType::frameDestroyed):
        Store frame instead of page pointer in DOMMimeType.
        * plugins/DOMMimeTypeArray.cpp:
        (WebCore::DOMMimeTypeArray::item):
        (WebCore::DOMMimeTypeArray::namedItem):
        Provide frame to create DOMMimeType.
        * plugins/DOMPlugin.cpp:
        (WebCore::DOMPlugin::DOMPlugin):
        (WebCore::DOMPlugin::~DOMPlugin):
        (WebCore::DOMPlugin::item):
        (WebCore::DOMPlugin::namedItem):
        * plugins/DOMPlugin.h:
        (WebCore::DOMPlugin::create):
        (WebCore::DOMPlugin::frameDestroyed):
        Store frame instead of page pointer in DOMPlugin.
        * plugins/DOMPluginArray.cpp:
        (WebCore::DOMPluginArray::item):
        (WebCore::DOMPluginArray::namedItem):
        Provide frame to create DOMPlugin.
        * plugins/PluginData.cpp:
        (WebCore::PluginData::PluginData):
        (WebCore::PluginData::initPlugins):
        * plugins/PluginData.h:
        No longer stores a pointer to the page.
        Added page parameter to initPlugins.
        * plugins/PluginDataNone.cpp:
        (WebCore::PluginData::initPlugins):
        * plugins/chromium/PluginDataChromium.cpp:
        (WebCore::PluginData::initPlugins):
        * plugins/gtk/PluginDataGtk.cpp:
        (WebCore::PluginData::initPlugins):
        * plugins/wx/PluginDataWx.cpp:
        (WebCore::PluginData::initPlugins):
        Updated platforms to add (unused) page parameter to initPlugins.

2011-01-05  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Define GC3D types to match GL types and use them in GraphicsContext3D
        https://bugs.webkit.org/show_bug.cgi?id=45557

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::readPixels):
        (WebCore::WebGLRenderingContext::validateTexFuncData):
        * platform/graphics/GraphicsContext3D.cpp:
        (WebCore::GraphicsContext3D::texImage2DResourceSafe):
        (WebCore::GraphicsContext3D::computeFormatAndTypeParameters):
        (WebCore::GraphicsContext3D::extractImageData):
        (WebCore::GraphicsContext3D::extractTextureData):
        * platform/graphics/GraphicsContext3D.h:
        * platform/graphics/cg/GraphicsContext3DCG.cpp:
        (WebCore::GraphicsContext3D::getImageData):
        * platform/graphics/gpu/SharedGraphicsContext3D.cpp:
        (WebCore::SharedGraphicsContext3D::enable):
        (WebCore::SharedGraphicsContext3D::disable):
        (WebCore::SharedGraphicsContext3D::clear):
        (WebCore::SharedGraphicsContext3D::drawArrays):
        (WebCore::SharedGraphicsContext3D::getError):
        (WebCore::SharedGraphicsContext3D::getIntegerv):
        (WebCore::SharedGraphicsContext3D::createFramebuffer):
        (WebCore::SharedGraphicsContext3D::createTexture):
        (WebCore::SharedGraphicsContext3D::deleteFramebuffer):
        (WebCore::SharedGraphicsContext3D::deleteTexture):
        (WebCore::SharedGraphicsContext3D::framebufferTexture2D):
        (WebCore::SharedGraphicsContext3D::texParameteri):
        (WebCore::SharedGraphicsContext3D::texImage2D):
        (WebCore::SharedGraphicsContext3D::texSubImage2D):
        (WebCore::SharedGraphicsContext3D::readPixels):
        (WebCore::SharedGraphicsContext3D::setActiveTexture):
        (WebCore::SharedGraphicsContext3D::bindTexture):
        (WebCore::SharedGraphicsContext3D::bindFramebuffer):
        * platform/graphics/gpu/SharedGraphicsContext3D.h:
        * platform/graphics/opengl/GraphicsContext3DOpenGL.cpp:
        (WebCore::GraphicsContext3D::activeTexture):
        (WebCore::GraphicsContext3D::attachShader):
        (WebCore::GraphicsContext3D::bindAttribLocation):
        (WebCore::GraphicsContext3D::bindBuffer):
        (WebCore::GraphicsContext3D::bindFramebuffer):
        (WebCore::GraphicsContext3D::bindRenderbuffer):
        (WebCore::GraphicsContext3D::bindTexture):
        (WebCore::GraphicsContext3D::blendColor):
        (WebCore::GraphicsContext3D::blendEquation):
        (WebCore::GraphicsContext3D::blendEquationSeparate):
        (WebCore::GraphicsContext3D::blendFunc):
        (WebCore::GraphicsContext3D::blendFuncSeparate):
        (WebCore::GraphicsContext3D::bufferData):
        (WebCore::GraphicsContext3D::bufferSubData):
        (WebCore::GraphicsContext3D::checkFramebufferStatus):
        (WebCore::GraphicsContext3D::clearColor):
        (WebCore::GraphicsContext3D::clear):
        (WebCore::GraphicsContext3D::clearDepth):
        (WebCore::GraphicsContext3D::clearStencil):
        (WebCore::GraphicsContext3D::colorMask):
        (WebCore::GraphicsContext3D::compileShader):
        (WebCore::GraphicsContext3D::copyTexImage2D):
        (WebCore::GraphicsContext3D::copyTexSubImage2D):
        (WebCore::GraphicsContext3D::cullFace):
        (WebCore::GraphicsContext3D::depthFunc):
        (WebCore::GraphicsContext3D::depthMask):
        (WebCore::GraphicsContext3D::depthRange):
        (WebCore::GraphicsContext3D::detachShader):
        (WebCore::GraphicsContext3D::disable):
        (WebCore::GraphicsContext3D::disableVertexAttribArray):
        (WebCore::GraphicsContext3D::drawArrays):
        (WebCore::GraphicsContext3D::drawElements):
        (WebCore::GraphicsContext3D::enable):
        (WebCore::GraphicsContext3D::enableVertexAttribArray):
        (WebCore::GraphicsContext3D::framebufferRenderbuffer):
        (WebCore::GraphicsContext3D::framebufferTexture2D):
        (WebCore::GraphicsContext3D::frontFace):
        (WebCore::GraphicsContext3D::generateMipmap):
        (WebCore::GraphicsContext3D::getActiveAttrib):
        (WebCore::GraphicsContext3D::getActiveUniform):
        (WebCore::GraphicsContext3D::getAttachedShaders):
        (WebCore::GraphicsContext3D::getAttribLocation):
        (WebCore::GraphicsContext3D::getError):
        (WebCore::GraphicsContext3D::getString):
        (WebCore::GraphicsContext3D::hint):
        (WebCore::GraphicsContext3D::isBuffer):
        (WebCore::GraphicsContext3D::isEnabled):
        (WebCore::GraphicsContext3D::isFramebuffer):
        (WebCore::GraphicsContext3D::isProgram):
        (WebCore::GraphicsContext3D::isRenderbuffer):
        (WebCore::GraphicsContext3D::isShader):
        (WebCore::GraphicsContext3D::isTexture):
        (WebCore::GraphicsContext3D::lineWidth):
        (WebCore::GraphicsContext3D::linkProgram):
        (WebCore::GraphicsContext3D::pixelStorei):
        (WebCore::GraphicsContext3D::polygonOffset):
        (WebCore::GraphicsContext3D::readPixels):
        (WebCore::GraphicsContext3D::renderbufferStorage):
        (WebCore::GraphicsContext3D::sampleCoverage):
        (WebCore::GraphicsContext3D::scissor):
        (WebCore::GraphicsContext3D::stencilFunc):
        (WebCore::GraphicsContext3D::stencilFuncSeparate):
        (WebCore::GraphicsContext3D::stencilMask):
        (WebCore::GraphicsContext3D::stencilMaskSeparate):
        (WebCore::GraphicsContext3D::stencilOp):
        (WebCore::GraphicsContext3D::stencilOpSeparate):
        (WebCore::GraphicsContext3D::texParameterf):
        (WebCore::GraphicsContext3D::texParameteri):
        (WebCore::GraphicsContext3D::uniform1f):
        (WebCore::GraphicsContext3D::uniform1fv):
        (WebCore::GraphicsContext3D::uniform2f):
        (WebCore::GraphicsContext3D::uniform2fv):
        (WebCore::GraphicsContext3D::uniform3f):
        (WebCore::GraphicsContext3D::uniform3fv):
        (WebCore::GraphicsContext3D::uniform4f):
        (WebCore::GraphicsContext3D::uniform4fv):
        (WebCore::GraphicsContext3D::uniform1i):
        (WebCore::GraphicsContext3D::uniform1iv):
        (WebCore::GraphicsContext3D::uniform2i):
        (WebCore::GraphicsContext3D::uniform2iv):
        (WebCore::GraphicsContext3D::uniform3i):
        (WebCore::GraphicsContext3D::uniform3iv):
        (WebCore::GraphicsContext3D::uniform4i):
        (WebCore::GraphicsContext3D::uniform4iv):
        (WebCore::GraphicsContext3D::uniformMatrix2fv):
        (WebCore::GraphicsContext3D::uniformMatrix3fv):
        (WebCore::GraphicsContext3D::uniformMatrix4fv):
        (WebCore::GraphicsContext3D::useProgram):
        (WebCore::GraphicsContext3D::validateProgram):
        (WebCore::GraphicsContext3D::vertexAttrib1f):
        (WebCore::GraphicsContext3D::vertexAttrib1fv):
        (WebCore::GraphicsContext3D::vertexAttrib2f):
        (WebCore::GraphicsContext3D::vertexAttrib2fv):
        (WebCore::GraphicsContext3D::vertexAttrib3f):
        (WebCore::GraphicsContext3D::vertexAttrib3fv):
        (WebCore::GraphicsContext3D::vertexAttrib4f):
        (WebCore::GraphicsContext3D::vertexAttrib4fv):
        (WebCore::GraphicsContext3D::vertexAttribPointer):
        (WebCore::GraphicsContext3D::viewport):
        (WebCore::GraphicsContext3D::getBooleanv):
        (WebCore::GraphicsContext3D::getBufferParameteriv):
        (WebCore::GraphicsContext3D::getFloatv):
        (WebCore::GraphicsContext3D::getFramebufferAttachmentParameteriv):
        (WebCore::GraphicsContext3D::getIntegerv):
        (WebCore::GraphicsContext3D::getProgramiv):
        (WebCore::GraphicsContext3D::getProgramInfoLog):
        (WebCore::GraphicsContext3D::getRenderbufferParameteriv):
        (WebCore::GraphicsContext3D::getShaderiv):
        (WebCore::GraphicsContext3D::getShaderInfoLog):
        (WebCore::GraphicsContext3D::getTexParameterfv):
        (WebCore::GraphicsContext3D::getTexParameteriv):
        (WebCore::GraphicsContext3D::getUniformfv):
        (WebCore::GraphicsContext3D::getUniformiv):
        (WebCore::GraphicsContext3D::getUniformLocation):
        (WebCore::GraphicsContext3D::getVertexAttribfv):
        (WebCore::GraphicsContext3D::getVertexAttribiv):
        (WebCore::GraphicsContext3D::getVertexAttribOffset):
        (WebCore::GraphicsContext3D::texImage2D):
        (WebCore::GraphicsContext3D::texSubImage2D):
        (WebCore::GraphicsContext3D::createBuffer):
        (WebCore::GraphicsContext3D::createFramebuffer):
        (WebCore::GraphicsContext3D::createProgram):
        (WebCore::GraphicsContext3D::createRenderbuffer):
        (WebCore::GraphicsContext3D::createShader):
        (WebCore::GraphicsContext3D::createTexture):
        (WebCore::GraphicsContext3D::deleteBuffer):
        (WebCore::GraphicsContext3D::deleteFramebuffer):
        (WebCore::GraphicsContext3D::deleteProgram):
        (WebCore::GraphicsContext3D::deleteRenderbuffer):
        (WebCore::GraphicsContext3D::deleteShader):
        (WebCore::GraphicsContext3D::deleteTexture):
        (WebCore::GraphicsContext3D::sizeInBytes):
        (WebCore::GraphicsContext3D::synthesizeGLError):
        * platform/graphics/qt/GraphicsContext3DQt.cpp:
        (WebCore::GraphicsContext3D::activeTexture):
        (WebCore::GraphicsContext3D::attachShader):
        (WebCore::GraphicsContext3D::getAttachedShaders):
        (WebCore::GraphicsContext3D::bindAttribLocation):
        (WebCore::GraphicsContext3D::bindBuffer):
        (WebCore::GraphicsContext3D::bindFramebuffer):
        (WebCore::GraphicsContext3D::bindRenderbuffer):
        (WebCore::GraphicsContext3D::bindTexture):
        (WebCore::GraphicsContext3D::blendColor):
        (WebCore::GraphicsContext3D::blendEquation):
        (WebCore::GraphicsContext3D::blendEquationSeparate):
        (WebCore::GraphicsContext3D::blendFunc):
        (WebCore::GraphicsContext3D::blendFuncSeparate):
        (WebCore::GraphicsContext3D::bufferData):
        (WebCore::GraphicsContext3D::bufferSubData):
        (WebCore::GraphicsContext3D::checkFramebufferStatus):
        (WebCore::GraphicsContext3D::clearColor):
        (WebCore::GraphicsContext3D::clear):
        (WebCore::GraphicsContext3D::clearDepth):
        (WebCore::GraphicsContext3D::clearStencil):
        (WebCore::GraphicsContext3D::colorMask):
        (WebCore::GraphicsContext3D::compileShader):
        (WebCore::GraphicsContext3D::copyTexImage2D):
        (WebCore::GraphicsContext3D::copyTexSubImage2D):
        (WebCore::GraphicsContext3D::cullFace):
        (WebCore::GraphicsContext3D::depthFunc):
        (WebCore::GraphicsContext3D::depthMask):
        (WebCore::GraphicsContext3D::depthRange):
        (WebCore::GraphicsContext3D::detachShader):
        (WebCore::GraphicsContext3D::disable):
        (WebCore::GraphicsContext3D::disableVertexAttribArray):
        (WebCore::GraphicsContext3D::drawArrays):
        (WebCore::GraphicsContext3D::drawElements):
        (WebCore::GraphicsContext3D::enable):
        (WebCore::GraphicsContext3D::enableVertexAttribArray):
        (WebCore::GraphicsContext3D::framebufferRenderbuffer):
        (WebCore::GraphicsContext3D::framebufferTexture2D):
        (WebCore::GraphicsContext3D::frontFace):
        (WebCore::GraphicsContext3D::generateMipmap):
        (WebCore::GraphicsContext3D::getActiveAttrib):
        (WebCore::GraphicsContext3D::getActiveUniform):
        (WebCore::GraphicsContext3D::getAttribLocation):
        (WebCore::GraphicsContext3D::getError):
        (WebCore::GraphicsContext3D::getString):
        (WebCore::GraphicsContext3D::hint):
        (WebCore::GraphicsContext3D::isBuffer):
        (WebCore::GraphicsContext3D::isEnabled):
        (WebCore::GraphicsContext3D::isFramebuffer):
        (WebCore::GraphicsContext3D::isProgram):
        (WebCore::GraphicsContext3D::isRenderbuffer):
        (WebCore::GraphicsContext3D::isShader):
        (WebCore::GraphicsContext3D::isTexture):
        (WebCore::GraphicsContext3D::linkProgram):
        (WebCore::GraphicsContext3D::pixelStorei):
        (WebCore::GraphicsContext3D::polygonOffset):
        (WebCore::GraphicsContext3D::readPixels):
        (WebCore::GraphicsContext3D::renderbufferStorage):
        (WebCore::GraphicsContext3D::sampleCoverage):
        (WebCore::GraphicsContext3D::scissor):
        (WebCore::GraphicsContext3D::stencilFunc):
        (WebCore::GraphicsContext3D::stencilFuncSeparate):
        (WebCore::GraphicsContext3D::stencilMask):
        (WebCore::GraphicsContext3D::stencilMaskSeparate):
        (WebCore::GraphicsContext3D::stencilOp):
        (WebCore::GraphicsContext3D::stencilOpSeparate):
        (WebCore::GraphicsContext3D::texParameterf):
        (WebCore::GraphicsContext3D::texParameteri):
        (WebCore::GraphicsContext3D::uniform1f):
        (WebCore::GraphicsContext3D::uniform1fv):
        (WebCore::GraphicsContext3D::uniform2f):
        (WebCore::GraphicsContext3D::uniform2fv):
        (WebCore::GraphicsContext3D::uniform3f):
        (WebCore::GraphicsContext3D::uniform3fv):
        (WebCore::GraphicsContext3D::uniform4f):
        (WebCore::GraphicsContext3D::uniform4fv):
        (WebCore::GraphicsContext3D::uniform1i):
        (WebCore::GraphicsContext3D::uniform1iv):
        (WebCore::GraphicsContext3D::uniform2i):
        (WebCore::GraphicsContext3D::uniform2iv):
        (WebCore::GraphicsContext3D::uniform3i):
        (WebCore::GraphicsContext3D::uniform3iv):
        (WebCore::GraphicsContext3D::uniform4i):
        (WebCore::GraphicsContext3D::uniform4iv):
        (WebCore::GraphicsContext3D::uniformMatrix2fv):
        (WebCore::GraphicsContext3D::uniformMatrix3fv):
        (WebCore::GraphicsContext3D::uniformMatrix4fv):
        (WebCore::GraphicsContext3D::useProgram):
        (WebCore::GraphicsContext3D::validateProgram):
        (WebCore::GraphicsContext3D::vertexAttrib1f):
        (WebCore::GraphicsContext3D::vertexAttrib1fv):
        (WebCore::GraphicsContext3D::vertexAttrib2f):
        (WebCore::GraphicsContext3D::vertexAttrib2fv):
        (WebCore::GraphicsContext3D::vertexAttrib3f):
        (WebCore::GraphicsContext3D::vertexAttrib3fv):
        (WebCore::GraphicsContext3D::vertexAttrib4f):
        (WebCore::GraphicsContext3D::vertexAttrib4fv):
        (WebCore::GraphicsContext3D::vertexAttribPointer):
        (WebCore::GraphicsContext3D::viewport):
        (WebCore::GraphicsContext3D::getBooleanv):
        (WebCore::GraphicsContext3D::getBufferParameteriv):
        (WebCore::GraphicsContext3D::getFloatv):
        (WebCore::GraphicsContext3D::getFramebufferAttachmentParameteriv):
        (WebCore::GraphicsContext3D::getIntegerv):
        (WebCore::GraphicsContext3D::getProgramiv):
        (WebCore::GraphicsContext3D::getProgramInfoLog):
        (WebCore::GraphicsContext3D::getRenderbufferParameteriv):
        (WebCore::GraphicsContext3D::getShaderiv):
        (WebCore::GraphicsContext3D::getShaderInfoLog):
        (WebCore::GraphicsContext3D::getShaderSource):
        (WebCore::GraphicsContext3D::getTexParameterfv):
        (WebCore::GraphicsContext3D::getTexParameteriv):
        (WebCore::GraphicsContext3D::getUniformfv):
        (WebCore::GraphicsContext3D::getUniformiv):
        (WebCore::GraphicsContext3D::getUniformLocation):
        (WebCore::GraphicsContext3D::getVertexAttribfv):
        (WebCore::GraphicsContext3D::getVertexAttribiv):
        (WebCore::GraphicsContext3D::getVertexAttribOffset):
        (WebCore::GraphicsContext3D::texImage2D):
        (WebCore::GraphicsContext3D::texSubImage2D):
        (WebCore::GraphicsContext3D::createBuffer):
        (WebCore::GraphicsContext3D::createFramebuffer):
        (WebCore::GraphicsContext3D::createProgram):
        (WebCore::GraphicsContext3D::createRenderbuffer):
        (WebCore::GraphicsContext3D::createShader):
        (WebCore::GraphicsContext3D::createTexture):
        (WebCore::GraphicsContext3D::deleteBuffer):
        (WebCore::GraphicsContext3D::deleteFramebuffer):
        (WebCore::GraphicsContext3D::deleteProgram):
        (WebCore::GraphicsContext3D::deleteRenderbuffer):
        (WebCore::GraphicsContext3D::deleteShader):
        (WebCore::GraphicsContext3D::deleteTexture):
        (WebCore::GraphicsContext3D::sizeInBytes):
        (WebCore::GraphicsContext3D::synthesizeGLError):
        (WebCore::GraphicsContext3D::getImageData):
        * platform/graphics/skia/GraphicsContext3DSkia.cpp:
        (WebCore::GraphicsContext3D::getImageData):

2011-01-06  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Eric Seidel.

        [GTK] Initial build support for WebGL
        https://bugs.webkit.org/show_bug.cgi?id=51716

        Add initial build support for WebGL and insert bits of implementation
        necessary for clean compilation into GraphicsContext3D.

        No new tests. This is just a build change.

        * GNUmakefile.am: Add missing files to the source lists.
        * platform/graphics/GraphicsContext3D.h: Include IntSize.h as it's used below.
        Include typedefs necessary for WebGL on GTK+ and consolidate typdefs which are the
        same across different platforms. X11 headers define the VERSION symbol, so it's
        necessary to undefine it, since it's used as an enum value.

2011-01-06  Helder Correia  <helder@sencha.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] GraphicsContext::drawConvexPolygon() has unnecessary code for shadow
        https://bugs.webkit.org/show_bug.cgi?id=52014

        The function is only used by RenderObject to draw box sides.
        The shadow branch is never used and thus can be removed.

        No new tests are necessary.

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::drawConvexPolygon):

2011-01-06  Laszlo Gombos  <laszlo.1.gombos@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] Make sure touch is disabled in the minimal configuration
        https://bugs.webkit.org/show_bug.cgi?id=51316

        No new tests as there is no new functionality.

        * features.pri:

2011-01-06  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Eric Seidel.

        [GTK] Freetype backend does not support WOFF
        https://bugs.webkit.org/show_bug.cgi?id=51904

        * CMakeListsEfl.txt: Add WOFF support to the sources list.
        * GNUmakefile.am: Add WOFF support to the sources list.
        * platform/graphics/freetype/FontCustomPlatformDataFreeType.cpp:
        (WebCore::createFontCustomPlatformData): Call the WOFF decoder when appropriate.
        (WebCore::FontCustomPlatformData::supportsFormat): Advertise support for WOFF.

2011-01-06  James Simonsen  <simonjam@chromium.org>

        Reviewed by Darin Fisher.

        [Web Timing] Remove vendor prefix
        https://bugs.webkit.org/show_bug.cgi?id=48922

        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::performance): Rename to performance.
        * page/DOMWindow.h:
        * page/DOMWindow.idl: Rename to performance and make replaceable.

2011-01-06  Chris Marrin  <cmarrin@apple.com>

        Reviewed by Simon Fraser.

        Share code between Mac (CA) and Windows (CACF) GraphicsLayer implementations
        https://bugs.webkit.org/show_bug.cgi?id=49388

        Changed PlatformCALayer API. Added PlatformCALayerClient abstract class which is
        used to communicate from PlatformCALayer to the owner. This replaces passing
        GraphicsLayerCA pointer when creating PlatformCALayer. It also includes the
        API that used to be in PlatformCALayerLayout. GraphicsLayerCA now implements
        the PlatformCALayerClient API.

        This change has little impact on the Mac side but makes the Windows
        interface simpler, especially when handling video layers on Windows.

        * WebCore.xcodeproj/project.pbxproj:
        * config.h:
        * platform/graphics/GraphicsLayer.h:
        (WebCore::GraphicsLayer::layerDidDisplay):
        (WebCore::GraphicsLayer::showDebugBorders):
        (WebCore::GraphicsLayer::showRepaintCounter):
        * platform/graphics/ca/GraphicsLayerCA.cpp:
        (WebCore::GraphicsLayerCA::platformCALayerAnimationStarted):
        (WebCore::GraphicsLayerCA::setContentsToImage):
        (WebCore::GraphicsLayerCA::setContentsToMedia):
        (WebCore::GraphicsLayerCA::layerDidDisplay):
        (WebCore::GraphicsLayerCA::updateSublayerList):
        * platform/graphics/ca/GraphicsLayerCA.h:
        (WebCore::GraphicsLayerCA::platformCALayerLayoutSublayersOfLayer):
        (WebCore::GraphicsLayerCA::platformCALayerRespondsToLayoutChanges):
        (WebCore::GraphicsLayerCA::platformCALayerContentsOrientation):
        (WebCore::GraphicsLayerCA::platformCALayerPaintContents):
        (WebCore::GraphicsLayerCA::platformCALayerShowDebugBorders):
        (WebCore::GraphicsLayerCA::platformCALayerShowRepaintCounter):
        (WebCore::GraphicsLayerCA::platformCALayerIncrementRepaintCount):
        (WebCore::GraphicsLayerCA::platformCALayerContentsOpaque):
        (WebCore::GraphicsLayerCA::platformCALayerDrawsContent):
        (WebCore::GraphicsLayerCA::platformCALayerLayerDidDisplay):
        (WebCore::GraphicsLayerCA::platformCALayer):
        * platform/graphics/ca/PlatformCALayer.h:
        (WebCore::PlatformCALayer::owner):
        (WebCore::PlatformCALayer::animationStarted):
        * platform/graphics/ca/PlatformCALayerClient.h: Added.
        (WebCore::PlatformCALayerClient::~PlatformCALayerClient):
        * platform/graphics/ca/mac/PlatformCALayerMac.mm:
        (PlatformCALayer::setOwner):
        (PlatformCALayer::create):
        (PlatformCALayer::PlatformCALayer):
        (PlatformCALayer::contents):
        (PlatformCALayer::setContents):
        * platform/graphics/mac/WebGLLayer.mm:
        (-[WebGLLayer display]):
        * platform/graphics/mac/WebLayer.h:
        * platform/graphics/mac/WebLayer.mm:
        (drawLayerContents):
        (setLayerNeedsDisplayInRect):
        (-[WebLayer setNeedsDisplay]):
        (-[WebLayer display]):
        * platform/graphics/mac/WebTiledLayer.mm:
        (-[WebTiledLayer setNeedsDisplay]):
        (-[WebTiledLayer display]):
        * rendering/RenderLayerBacking.cpp:
        (WebCore::RenderLayerBacking::showDebugBorders):
        (WebCore::RenderLayerBacking::showRepaintCounter):
        * rendering/RenderLayerCompositor.cpp:
        (WebCore::RenderLayerCompositor::ensureRootPlatformLayer):
        * rendering/RenderLayerCompositor.h:
        (WebCore::RenderLayerCompositor::compositorShowDebugBorders):
        (WebCore::RenderLayerCompositor::compositorShowRepaintCounter):
        (WebCore::RenderLayerCompositor::notifyAnimationStarted):
        (WebCore::RenderLayerCompositor::notifySyncRequired):
        (WebCore::RenderLayerCompositor::paintContents):
        (WebCore::RenderLayerCompositor::showDebugBorders):
        (WebCore::RenderLayerCompositor::showRepaintCounter):

2011-01-06  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Eric Seidel.

        Allow framesets after hidden inputs
        https://bugs.webkit.org/show_bug.cgi?id=51998

        This implements the HTML5 spec update in response to:
        http://www.w3.org/Bugs/Public/show_bug.cgi?id=11156

        * html/parser/HTMLTreeBuilder.cpp:
        (WebCore::HTMLTreeBuilder::processStartTagForInBody):

2010-12-29  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        vertexAttribPointer should raise INVALID_OPERATION if stride/offset is not multiple of the type size
        https://bugs.webkit.org/show_bug.cgi?id=51725

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::vertexAttribPointer):

2011-01-06  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Eric Seidel.

        [WINCE] Remove JSC::g_stackBase
        https://bugs.webkit.org/show_bug.cgi?id=51779

        * platform/wince/SharedTimerWinCE.cpp:
        (WebCore::TimerWindowWndProc):

2011-01-06  Robert Hogan  <robert@webkit.org>

        Reviewed by Antonio Gomes.

        [Qt] Introduce QDRTNode for passing WebCore::Node across JS bridge

        This allows LayoutTestController to pass WebCore::Node back to
        layout tests.

        Also amend nodesFromRect-links-and-text.html and
        nodesFromRect-inner-documents.html so that they do not produce
        platform-specific results.

        Unskip:
        fast/dom/nodesFromRect-links-and-text.html
        fast/dom/nodesFromRect-inner-documents.html

        https://bugs.webkit.org/show_bug.cgi?id=48957

        * bridge/qt/qt_runtime.cpp:
        (JSC::Bindings::QtDRTNodeRuntime::create):
        (JSC::Bindings::QtDRTNodeRuntime::get):
        (JSC::Bindings::convertValueToQVariant):
        (JSC::Bindings::convertQVariantToValue):

2011-01-06  Joone Hur  <joone.hur@collabora.co.uk>

        Reviewed by Eric Seidel.

        WML Parser should treat line/column number in a consistent way
        https://bugs.webkit.org/show_bug.cgi?id=51601

        XML Parser treats line/column number as 1-based values, but WML ErrorHandler treat them as 0-based.
        Therefore, this patch allows WML ErrorHandler to use 1-based values.

        * dom/XMLDocumentParser.cpp:
        (WebCore::XMLDocumentParser::handleError): Treat line/column number as 1 based values.
        * dom/XMLDocumentParser.h: Make textPositionOneBased public and Add TextPosition1(m_lastErrorPosition) to keep error line/column number.
        * dom/XMLDocumentParserLibxml2.cpp:
        (WebCore::XMLDocumentParser::XMLDocumentParser): Initialize m_lastErrorPosition. 
        * dom/XMLDocumentParserQt.cpp:
        (WebCore::XMLDocumentParser::XMLDocumentParser): Initialize m_lastErrorPosition. 
        * wml/WMLErrorHandling.cpp:
        (WebCore::reportWMLError): Use 1 based value instead of 0 based value to report error line/column number.

2011-01-05  Adam Roben  <aroben@apple.com>

        Remove some dead code from WKCACFLayerRenderer

        Fixes <http://webkit.org/b/51954> WKCACFLayerRenderer has dead and
        redundant code for reacting to changes to the layer tree

        Reviewed by Sam Weinig.

        * platform/graphics/win/WKCACFLayerRenderer.cpp:
        * platform/graphics/win/WKCACFLayerRenderer.h:
        Removed didFlushContext and the HashMap it depended on. We react to
        changes to the layer tree in layerTreeDidChange instead.

2011-01-06  Chris Fleizach  <cfleizach@apple.com>

        Reviewed by Beth Dakin.

        AX: "AXExpanded" not exposed on most ARIA roles that use aria-expanded
        https://bugs.webkit.org/show_bug.cgi?id=51995

        Test: platform/mac/accessibility/aria-expanded-standard-items.html

        * accessibility/AccessibilityObject.cpp:
        (WebCore::AccessibilityObject::supportsARIAExpanded):
        (WebCore::AccessibilityObject::isExpanded):
        * accessibility/AccessibilityObject.h:
        * accessibility/AccessibilityRenderObject.cpp:
        (WebCore::AccessibilityRenderObject::isVisited):
        * accessibility/AccessibilityRenderObject.h:
        * accessibility/mac/AccessibilityObjectWrapper.mm:
        (-[AccessibilityObjectWrapper additionalAccessibilityAttributeNames]):

2010-12-28  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Must generate INVALID_VALUE errors for strings containing out-of-range characters
        https://bugs.webkit.org/show_bug.cgi?id=50929

        * html/canvas/WebGLRenderingContext.cpp: Validate characters according to GLSL ES 1.0 spec section 3.1.
        (WebCore::WebGLRenderingContext::bindAttribLocation):
        (WebCore::WebGLRenderingContext::getAttribLocation):
        (WebCore::WebGLRenderingContext::getUniformLocation):
        (WebCore::WebGLRenderingContext::shaderSource):
        (WebCore::WebGLRenderingContext::validateString): Helper function to perform the character validation.
        * html/canvas/WebGLRenderingContext.h: Declare validateString().

2011-01-06  Yong Li  <yoli@rim.com>

        Reviewed by Adam Barth.
        Add the test case that is missed in r75066.
        https://bugs.webkit.org/show_bug.cgi?id=48077

        Test case: WebCore/manual-tests/bugzilla-48077.html.

2011-01-06  James Robinson  <jamesr@chromium.org>

        Reviewed by Simon Fraser.

        Implement mozilla's animationTime property
        https://bugs.webkit.org/show_bug.cgi?id=51952

        Implements mozilla's animationTime property as described here:
        https://developer.mozilla.org/en/DOM/window.mozAnimationStartTime
        and http://hacks.mozilla.org/2010/08/more-efficient-javascript-animations-with-mozrequestanimationframe/
        The property is called webkitAnimationTime as calling it the 'Start' time is not very informative.
        This property exposes a notion of a 'current' time to use for declarative animations and allows
        scripts to synchronize imperative animations with declarative ones if they choose to.  Once queried
        this time is saved and used for all declarative animation updates until the embedder paints/composites
        the next frame and clears it, or 15ms elapse (in case the embedder isn't producing frames, for example
        if the page is in a background tab).

        This patch also ensures that all declarative animations started in the same script execution block
        are synchronized even if some time elapses while script is running.

        Test: fast/animation/animation-time.html

        * WebCore.gypi:
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::webkitAnimationTime):
        * page/DOMWindow.h:
        * page/DOMWindow.idl:
        * page/Frame.cpp:
        (WebCore::Frame::currentAnimationTime):
        * page/Frame.h:
        * page/Page.cpp:
        (WebCore::Page::Page):
        * page/Page.h:
        (WebCore::Page::animationTime):
        * page/animation/AnimationController.cpp:
        (WebCore::AnimationControllerPrivate::beginAnimationUpdateTime):
        * page/animation/AnimationTimeController.cpp: Added.
        (WebCore::AnimationTimeController::AnimationTimeController):
        (WebCore::AnimationTimeController::~AnimationTimeController):
        (WebCore::AnimationTimeController::currentAnimationTime):
        (WebCore::AnimationTimeController::clearCurrentAnimationTime):
        (WebCore::AnimationTimeController::clearCurrentAnimationTimeTimerFired):
        * page/animation/AnimationTimeController.h: Added.
        (WebCore::AnimationTimeController::create):

2011-01-06  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Simon Fraser.

        Null out the parent stylesheet pointer when a css rule is removed.
        https://bugs.webkit.org/show_bug.cgi?id=51993

        Tests: fast/dom/StyleSheet/removed-media-rule-deleted-parent-crash.html
               fast/dom/StyleSheet/removed-stylesheet-rule-deleted-parent-crash.html

        * css/CSSRuleList.cpp:
        (WebCore::CSSRuleList::deleteRule):
        * css/CSSStyleSheet.cpp:
        (WebCore::CSSStyleSheet::deleteRule):

2011-01-04  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        NaN in a TypedArray should be converted to zero only for Float32Array.
        https://bugs.webkit.org/show_bug.cgi?id=46990

        Test: LayoutTests/fast/canvas/webgl/array-unit-tests.html

        * bindings/js/JSArrayBufferViewHelper.h:
        (WebCore::convertArrayValue):
        (WebCore::constructArrayBufferView):
        * html/canvas/Float32Array.h:
        (WebCore::Float32Array::set):
        (WebCore::Float32Array::item):

2011-01-06  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed Windows build fix for r75161.

        * platform/graphics/cg/GraphicsContextCG.cpp: Missing include added.

2011-01-06  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r75139.

        Try to remove include after adding forward-declaration in r75145.

        * platform/graphics/Gradient.h:

2011-01-06  Renata Hodovan  <reni@webkit.org>

        Reviewed by Andreas Kling.

        https://bugs.webkit.org/show_bug.cgi?id=51811
        Merge m_height and m_width members of ImageData into the new m_size member.

        Image (BitmapImage, ImageSource) types in WebKit use IntSize to store their
        width and height argument, except ImageData. This patch refactors ImageData
        to follow the style of other Image types in WebKit.
        Using of PassRefPtrs other than argument passing is not allowed in WebKit anymore.
        This patch also refactors the PassRefPtr usages of ImageData.

        It's just a refactoring, so we don't need any new tests.

        * bindings/js/SerializedScriptValue.cpp:
        (WebCore::CloneSerializer::write):
        (WebCore::CloneDeserializer::readTerminal):
        * bindings/v8/SerializedScriptValue.cpp:
        (WebCore::ZigZag::Reader::readImageData):
        * html/ImageData.cpp:
        (WebCore::ImageData::create):
        (WebCore::ImageData::ImageData):
        * html/ImageData.h:
        (WebCore::ImageData::size):
        (WebCore::ImageData::width):
        (WebCore::ImageData::height):
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::createEmptyImageData):
        (WebCore::CanvasRenderingContext2D::createImageData):
        (WebCore::CanvasRenderingContext2D::getImageData):
        * html/canvas/CanvasRenderingContext2D.h:
        * platform/graphics/haiku/ImageBufferHaiku.cpp:
        (WebCore::getImageData):

2011-01-06  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Darin Adler.

        document.querySelector(':nth-child(foo)') should throw a syntax error
        https://bugs.webkit.org/show_bug.cgi?id=51231

        Also fixes 
        CSSNthSelector parsing code is illegible and buggy (allows "n3" as a valid selector)
        https://bugs.webkit.org/show_bug.cgi?id=21815

        Add a check in the parser that other than an+b, only "odd" or "even" would be allowed
        as parameters to nth selector.

        Tests: fast/css/css3-nth-tokens-script.html
               fast/css/css3-nth-tokens-style.html

        * css/CSSGrammar.y:
        * css/CSSParser.cpp:
        (WebCore::isValidNthToken):
        * css/CSSParser.h:

2011-01-06  Jan Erik Hanssen  <jhanssen@sencha.com>

        Reviewed by Andreas Kling.

        [Qt] crash in QNetworkReplyHandler::sendResponseIfNeeded()
        https://bugs.webkit.org/show_bug.cgi?id=51453

        Check if m_reply is NULL before accessing.

        * manual-tests/load-deferrer-resume-crash.html: Added.
        * platform/network/qt/QNetworkReplyHandler.cpp:
        (WebCore::QNetworkReplyHandler::setLoadMode):
        (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):

2011-01-06  Andras Becsi  <abecsi@webkit.org>

        Reviewed by Csaba Osztrogonác.

        [Qt][V8] Fix the build when DEVICE_ORIENTATION is enabled.

        No new tests needed.

        * WebCore.pro: remove duplications and globally add RuntimeEnabledFeatures.

2011-01-06  Helder Correia  <helder@sencha.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt][GTK] Use GraphicsContext::hasShadow() in port-specific code
        https://bugs.webkit.org/show_bug.cgi?id=51985

        r75139 introduced GraphicsContext::hasShadow(). This can now simplify
        and unify some code in the Qt and GTK ports.

        No new tests necessary for this refactoring.

        * platform/graphics/cairo/GraphicsContextCairo.cpp:
        (WebCore::GraphicsContext::fillRect):
        (WebCore::GraphicsContext::fillRoundedRect):
        * platform/graphics/cairo/GraphicsContextPlatformPrivateCairo.h:
        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::drawConvexPolygon):
        (WebCore::GraphicsContext::fillPath):
        (WebCore::GraphicsContext::strokePath):
        (WebCore::GraphicsContext::fillRect):
        (WebCore::GraphicsContext::fillRoundedRect):

2011-01-05  Darin Adler  <darin@apple.com>

        Fix Chromium Mac build.

        * platform/graphics/Gradient.h: Forward-declare CGContextRef.
        This might even make it possible to remove the include of
        <CoreGraphics/CoreGraphics.h> for PLATFORM(WIN), but I did not
        do that at this time because I don't want to break the Windows
        build when fixing the Chromium build.

2011-01-05  Xianzhu Wang  <wangxianzhu@google.com>

        Reviewed by David Levin.

        Implement RemoteFontStream's skip behavior (in FontCustomPlatformData.cpp)
        https://bugs.webkit.org/show_bug.cgi?id=51736

        No new tests. This change has potential effect on @font-face CSS feature
        on ports using Skia. Tested on Chromium that this change won't break
        fast/css/font-face-remote.html. This change can make the test pass on
        other ports using Skia.

        * platform/graphics/skia/FontCustomPlatformData.cpp:
        (WebCore::RemoteFontStream::read):

2011-01-05  Helder Correia  <helder@sencha.com>

        Reviewed by Simon Fraser.

        Shadows are not drawn when filling a rect with a gradient fillStyle on Mac and Chromium-Mac
        https://bugs.webkit.org/show_bug.cgi?id=51869

        GraphicsContext::fillRect(const FloatRect&) is clipping to the rect.
        The shadow is being drawn, but getting clipped to the rect being filled.
        The solution is to draw the gradient into a CGLayer (when a shadow is
        required), then render the layer to the GraphicsContext.

        This patch also fixes:
        canvas/philip/tests/2d.shadow.gradient.alpha.html
        canvas/philip/tests/2d.shadow.gradient.basic.html
        canvas/philip/tests/2d.shadow.gradient.transparent.2.html

        Test: fast/canvas/canvas-fillRect-gradient-shadow.html

        * platform/graphics/Gradient.h:
        * platform/graphics/cg/GradientCG.cpp:
        (WebCore::Gradient::paint):
        * platform/graphics/cg/GraphicsContextCG.cpp:
        (WebCore::GraphicsContext::fillRect):

2011-01-05  Steve Falkenburg  <sfalken@apple.com>

        Reviewed by Darin Adler.

        Debug and Release builds on Windows clobber each other
        https://bugs.webkit.org/show_bug.cgi?id=49185

        Changes the structure of WebKitBuild build products directory so we
        completely separate each build configuration into independent directories.
        
        Although we previously had per-configuration directories for obj, this change adds
        per-configuration directories for bin, lib, obj, and include. Each configuration's
        build products are stored within a directory inside of WebKitBuild.
        
        Most use of $(WebKitOutputDir) in the build files has been replaced by $(ConfigurationBuildDir),
        defined in common.vsprops to be $(WebKitOutputDir)\$(ConfigurationName).

        * WebCore.vcproj/QTMovieWinCommon.vsprops:
        * WebCore.vcproj/QTMovieWinPostBuild.cmd:
        * WebCore.vcproj/QTMovieWinPreBuild.cmd:
        * WebCore.vcproj/WebCore.make:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.vcproj/WebCoreCommon.vsprops:
        * WebCore.vcproj/WebCoreGeneratedCairo.vsprops:
        * WebCore.vcproj/WebCoreGeneratedCommon.vsprops:
        * WebCore.vcproj/WebCoreMediaQT.vsprops:
        * WebCore.vcproj/WebCorePostBuild.cmd:
        * WebCore.vcproj/WebCorePreBuild.cmd:
        * WebCore.vcproj/copyForwardingHeaders.cmd:
        * WebCore.vcproj/copyInspectorFiles.cmd:

2011-01-05  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Ariya Hidayat.

        Directly composited SVG images fail to render
        https://bugs.webkit.org/show_bug.cgi?id=51975
        
        There was already code, added in r67900, to detect whether an image
        may be directly composited, by checking to see if it's a bitmap image.
        
        However, CachedImage::image() returns the nullImage() if m_image is null,
        which is a BitmapImage, confusing this test.

        Test: compositing/images/direct-svg-image.html

        * loader/cache/CachedImage.cpp: Remove nullImage(), since Image has
        exactly the same method.
        (WebCore::CachedImage::image): Use Image::nullImage().
        * loader/cache/CachedImage.h:
        (WebCore::CachedImage::hasImage): New method to ask whether the m_image is
        non-null.
        * rendering/RenderLayerBacking.cpp:
        (WebCore::RenderLayerBacking::isDirectlyCompositedImage): Use hasImage()
        so that we don't test the nullImage.

2011-01-05  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Darin Adler.

        Fix percentage values in radius of radial gradients
        https://bugs.webkit.org/show_bug.cgi?id=51979
        
        Handle percentage values for the ending size of radial gradients.

        Test: fast/gradients/css3-radial-gradients3.html

        * css/CSSGradientValue.cpp:
        (WebCore::CSSRadialGradientValue::resolveRadius): Add parameter for height or width, which is
        non-null if percentage values are allowed, and compute percentage values when we see them.
        (WebCore::CSSRadialGradientValue::createGradient): Pass height or width down to say that
        percentages are OK when resolving end radii.
        * css/CSSGradientValue.h: New parameter for resolveRadius.

2011-01-05  James Simonsen  <simonjam@chromium.org>

        Reviewed by Adam Barth.

        [Web Timing] Zero out some values on cross-origin redirects
        https://bugs.webkit.org/show_bug.cgi?id=49294

        Tests: http/tests/misc/webtiming-cross-origin-redirect.php
               http/tests/misc/webtiming-origins.html

        * loader/DocumentLoadTiming.h:
        (WebCore::DocumentLoadTiming::DocumentLoadTiming): Add flags for cross-origin redirects and same-origin navigation.
        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::~FrameLoader):
        (WebCore::FrameLoader::stopLoading): Don't overwrite previous unload times.
        (WebCore::FrameLoader::completed):
        (WebCore::FrameLoader::loadWithDocumentLoader): Remember previous URL to see if navigation is same-origin.
        (WebCore::FrameLoader::commitProvisionalLoad): Set flag if navigation is same-origin.
        * loader/FrameLoader.h:
        * loader/MainResourceLoader.cpp:
        (WebCore::MainResourceLoader::willSendRequest): Set flag on cross-origin redirects.
        * page/PerformanceNavigation.cpp:
        (WebCore::PerformanceNavigation::redirectCount): Clear if cross-origin redirect flag is set.
        * page/PerformanceTiming.cpp:
        (WebCore::PerformanceTiming::redirectStart): Ditto.
        (WebCore::PerformanceTiming::redirectEnd): Ditto.
        (WebCore::PerformanceTiming::unloadEventStart): Clear if cross-origin navigation is set.
        (WebCore::PerformanceTiming::unloadEventEnd): Ditto.

2011-01-05  Helder Correia  <helder@sencha.com>

        Reviewed by Ariya Hidayat.

        [Qt] Default focus ring is too wide
        https://bugs.webkit.org/show_bug.cgi?id=51854

        This is an intermediate step to solve this bug. Use QPalette::Highlight
        instead of default half-transparent black as the focus ring color.

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::drawFocusRingForPath):
        * platform/qt/RenderThemeQt.cpp:
        (WebCore::RenderThemeQt::platformFocusRingColor):
        * platform/qt/RenderThemeQt.h:

2011-01-05  James Simonsen  <simonjam@chromium.org>

        Reviewed by Darin Fisher.

        [Web Timing] requestStart and responseStart should be available even if the document is still loading
        https://bugs.webkit.org/show_bug.cgi?id=51368

        Test: http/tests/misc/webtiming-slow-load.php

        * page/PerformanceTiming.cpp:
        (WebCore::getPossiblySkewedTimeInKnownRange): Handle case where response is not yet complete.
        (WebCore::PerformanceTiming::resourceLoadTimeRelativeToAbsolute): Use full upper bound.

2011-01-05  Chris Rogers  <crogers@google.com>

        Reviewed by Darin Fisher.

        Add WebKitClient::createAudioDevice() for Chromium port of web audio API
        https://bugs.webkit.org/show_bug.cgi?id=51424

        No new tests since audio API is not yet implemented.

        * WebCore.gyp/WebCore.gyp:
        * WebCore.gypi:

2011-01-05  Anders Carlsson  <andersca@apple.com>

        Try again.

        * WebCore.exp.in:

2011-01-05  Anders Carlsson  <andersca@apple.com>

        Attempt to fix Leopard build.

        * WebCore.exp.in:

2011-01-05  Evan Martin  <evan@chromium.org>

        Reviewed by Tony Chang.

        [chromium] refactor complex text on Linux
        https://bugs.webkit.org/show_bug.cgi?id=51956

        Pull out TextRunWalker from FontLinux.cpp.  Put it in its own file.
        Rename it to ComplexTextController, to match platform/graphics/mac
        more closely.

        No tests because the change is just renaming a class.

        * WebCore.gyp/WebCore.gyp:
        * platform/graphics/chromium/ComplexTextControllerLinux.cpp: Added.
        (WebCore::ComplexTextController::ComplexTextController):
        (WebCore::ComplexTextController::~ComplexTextController):
        (WebCore::ComplexTextController::isWordBreak):
        (WebCore::ComplexTextController::determineWordBreakSpacing):
        (WebCore::ComplexTextController::setPadding):
        (WebCore::ComplexTextController::reset):
        (WebCore::ComplexTextController::setBackwardsIteration):
        (WebCore::ComplexTextController::nextScriptRun):
        (WebCore::ComplexTextController::widthOfFullRun):
        (WebCore::ComplexTextController::setupFontForScriptRun):
        (WebCore::ComplexTextController::allocHarfbuzzFont):
        (WebCore::ComplexTextController::deleteGlyphArrays):
        (WebCore::ComplexTextController::createGlyphArrays):
        (WebCore::ComplexTextController::resetGlyphArrays):
        (WebCore::ComplexTextController::shapeGlyphs):
        (WebCore::ComplexTextController::setGlyphXPositions):
        (WebCore::ComplexTextController::normalizeSpacesAndMirrorChars):
        (WebCore::ComplexTextController::getNormalizedTextRun):
        * platform/graphics/chromium/ComplexTextControllerLinux.h: Added.
        (WebCore::ComplexTextController::setWordSpacingAdjustment):
        (WebCore::ComplexTextController::setLetterSpacingAdjustment):
        (WebCore::ComplexTextController::letterSpacing):
        (WebCore::ComplexTextController::setXOffsetToZero):
        (WebCore::ComplexTextController::rtl):
        (WebCore::ComplexTextController::glyphs):
        (WebCore::ComplexTextController::length):
        (WebCore::ComplexTextController::xPositions):
        (WebCore::ComplexTextController::advances):
        (WebCore::ComplexTextController::width):
        (WebCore::ComplexTextController::logClusters):
        (WebCore::ComplexTextController::numCodePoints):
        (WebCore::ComplexTextController::fontPlatformDataForScriptRun):
        (WebCore::ComplexTextController::isCodepointSpace):
        * platform/graphics/chromium/FontLinux.cpp:
        (WebCore::Font::drawComplexText):
        (WebCore::Font::floatWidthForComplexText):
        (WebCore::glyphIndexForXPositionInScriptRun):
        (WebCore::Font::offsetForPositionForComplexText):
        (WebCore::Font::selectionRectForComplexText):

2011-01-05  Pratik Solanki  <psolanki@apple.com>

        Reviewed by Darin Adler.

        Merge cf and mac header files with same name
        https://bugs.webkit.org/show_bug.cgi?id=51916

        Since most of the code in the header files is identical, we can merge them and have #if
        USE(CFNETWORK) to separate out the network specific parts.

        * WebCore.xcodeproj/project.pbxproj:
        * platform/network/cf/AuthenticationChallenge.h:
        (WebCore::AuthenticationChallenge::sender):
        (WebCore::AuthenticationChallenge::nsURLAuthenticationChallenge):
        * platform/network/cf/ResourceError.h:
        (WebCore::ResourceError::ResourceError):
        * platform/network/cf/ResourceRequest.h:
        (WebCore::ResourceRequest::ResourceRequest):
        * platform/network/cf/ResourceResponse.h:
        (WebCore::ResourceResponse::ResourceResponse):
        * platform/network/mac/AuthenticationChallenge.h: Removed.
        * platform/network/mac/ResourceError.h: Removed.
        * platform/network/mac/ResourceRequest.h: Removed.
        * platform/network/mac/ResourceResponse.h: Removed.

2011-01-05  Anders Carlsson  <andersca@apple.com>

        Reviewed by Adele Peterson.

        Implement word transformation
        https://bugs.webkit.org/show_bug.cgi?id=51943

        Export Editor functions needed by WebKit2.

        * WebCore.exp.in:

2011-01-05  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dave Hyatt.

        Implement repeating CSS3 gradients
        https://bugs.webkit.org/show_bug.cgi?id=51843
        
        Add support for repeating gradients, via the new gradient functions
        -webkit-repeating-linear-gradient and -webkit-repeating-radial-gradient.

        Tests: fast/gradients/css3-repeating-linear-gradients.html
               fast/gradients/css3-repeating-radial-gradients.html

        * css/CSSGradientValue.h:
        (WebCore::CSSGradientValue::isRepeating): Accessor for whethe the gradient repeats.
        (WebCore::CSSGradientValue::CSSGradientValue): Pass CSSGradientRepeat in.
        (WebCore::CSSLinearGradientValue::create): Pass CSSGradientRepeat.
        (WebCore::CSSLinearGradientValue::CSSLinearGradientValue): Ditto
        (WebCore::CSSRadialGradientValue::create): Ditto.
        (WebCore::CSSRadialGradientValue::CSSRadialGradientValue): Ditto.

        * css/CSSGradientValue.cpp:
        (WebCore::CSSGradientValue::addStops): Pass maxLengthForRepeat, which
        is used for repeating radial gradients. Add code to repeat the stops,
        adding stops before the start, and after the end until the 0-N range is
        covered, where N is large enough to ensure the box is covered. Fix an issue
        with repeating gradients where if both stops were < 0, it would fail to clamp
        them to 0.
        
        (WebCore::CSSLinearGradientValue::cssText): Output strings for repeating gradients.
        (WebCore::CSSLinearGradientValue::createGradient): maxExtent for linear gradients is 1,
        because they are guaranteed to fill the box already.
        (WebCore::CSSRadialGradientValue::cssText): Output strings for repeating gradients.
        (WebCore::CSSRadialGradientValue::createGradient): Compute the distance to the furthest
        corner in order to inform addStops() how much additional extent is required.

        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseDeprecatedGradient): Old gradients never repeat.
        (WebCore::CSSParser::parseLinearGradient): Pass down CSSGradientRepeat.
        (WebCore::CSSParser::parseRadialGradient): Ditto.
        (WebCore::CSSParser::isGeneratedImageValue): Add repeating gradient functions.
        (WebCore::CSSParser::parseGeneratedImage): Ditto.
        * css/CSSParser.h: Pass CSSGradientRepeat to gradient functions.
        * platform/graphics/cg/GradientCG.cpp: Remove unused #include.

2011-01-05  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Ariya Hidayat.

        ContextShadow::blurLayerImage() not endian-safe
        https://bugs.webkit.org/show_bug.cgi?id=51822

        Correct the channel map in ContextShadow to reflect the different
        ordering of pixels on processors with different endianness.

        No new tests. This is covered by the existing shadow tests. It was
        not discovered, because all of the bots using ContextShadow are
        little-endian.

        * platform/graphics/ContextShadow.cpp:
        (WebCore::ContextShadow::blurLayerImage): Initialize the channel mapping
        based on machine endianness.

2011-01-05  Mihai Parparita  <mihaip@chromium.org>

        Reviewed by Nate Chapin.

        [Chromium] Crash when drawing PDF plug-in scrollbars
        https://bugs.webkit.org/show_bug.cgi?id=51942

        Pepper plug-in scrollbars don't have a parent, guard against that before
        seeing if the parent is a FrameView.

        Not testable via layout tests, verified fix by hand.
        
        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::ScrollbarThemeChromiumMac::paint):

2011-01-05  Abhishek Arya  <inferno@chromium.org>

        Unreviewed.

        Update FIXME comment to sound better. Also initialize the block to fix compile.

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::removeChild):

2011-01-05  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Dave Hyatt.

        Do not merge anonymous blocks when one of them is the one getting removed.
        https://bugs.webkit.org/show_bug.cgi?id=51919

        Test: fast/block/merge-anonymous-block-remove-child-crash.html

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::removeChild):

2011-01-05  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Eric Seidel.

        ApplyStyleCommand::applyRelativeFontStyleChange should take EditingStyle*
        https://bugs.webkit.org/show_bug.cgi?id=50641

        Modified applyRelativeFontStyleChange to take EditingStyle instead of CSSMutableStyleDeclaration.
        Also extracted the logic to obtain the font size delta from ApplyStyleCommand to EditingStyle.
        The font size delta is now stored as a member variable of EditingStyle as supposed to a property
        in CSSMutableStyleDeclration as soon as EditingStyle is instantiated.

        No new tests are added since this is a refactoring.

        * editing/ApplyStyleCommand.cpp:
        (WebCore::ApplyStyleCommand::doApply): Calls applyRelativeFontStyleChange.
        (WebCore::ApplyStyleCommand::applyRelativeFontStyleChange): Takes EditingStyle.
        * editing/ApplyStyleCommand.h:
        * editing/EditingStyle.cpp:
        (WebCore::EditingStyle::EditingStyle): Initializes m_fontSizeDelta.
        (WebCore::EditingStyle::init): Ditto.
        (WebCore::EditingStyle::extractFontSizeDelta): Extracted from applyRelativeFontStyleChange.
        (WebCore::EditingStyle::isEmpty): Takes care of m_fontSizeDelta.
        (WebCore::EditingStyle::setStyle): Calls extractFontSizeDelta.
        (WebCore::EditingStyle::overrideWithStyle): Ditto.
        (WebCore::EditingStyle::clear): Initializes m_fontSizeDelta.
        (WebCore::EditingStyle::copy): Calls extractFontSizeDelta.
        * editing/EditingStyle.h:
        (WebCore::EditingStyle::fontSizeDelta): Added.
        (WebCore::EditingStyle::hasFontSizeDelta): Added.
        * editing/Editor.h:

2011-01-05  Dan Bernstein  <mitz@apple.com>

        Reviewed by Darin Adler.

        <rdar://problem/8799835> hyphenate-character: auto should fall back to hyphen-minus if the primary font lacks a hyphen glyph
        https://bugs.webkit.org/show_bug.cgi?id=51915

        This changes the results of existing tests in fast/text.

        * platform/graphics/Font.h:
        * platform/graphics/FontFastPath.cpp:
        (WebCore::Font::primaryFontHasGlyphForCharacter): Added.
        * rendering/style/RenderStyle.cpp:
        * platform/graphics/qt/FontQt.cpp:
        (WebCore::Font::primaryFontHasGlyphForCharacter): Added a stub.
        (WebCore::RenderStyle::hyphenString): For hyphenate-character: auto, return a
        hyphen only if the primary font has a hyphen glyph, and otherwise return a
        hyphen-minus.

2011-01-05  Laszlo Gombos  <laszlo.1.gombos@nokia.com>

        Reviewed by Ariya Hidayat.

        [Qt] [Symbian] Make CONFIG-=def_files the default configuration for trunk builds
        https://bugs.webkit.org/show_bug.cgi?id=51888

        Overrule Qt's default from qconfig.pri for non-production builds so
        that CONFIG(def_files) evaluates to false and QtWebKit trunk builds succeed.

        No new tests as there is no new functionality.

        * WebCore.pro:

2011-01-05  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r74778.
        http://trac.webkit.org/changeset/74778
        https://bugs.webkit.org/show_bug.cgi?id=51930

        Android and QtWebKit-V8 uses V8DOMWindowShell::setContext.
        (Requested by bbandix on #webkit).

        * bindings/v8/V8DOMWindowShell.cpp:
        (WebCore::V8DOMWindowShell::setContext):
        * bindings/v8/V8DOMWindowShell.h:

2011-01-05  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Andreas Kling.

        [Qt] Animated GIF images does not animate 10x as expected by default.
        https://bugs.webkit.org/show_bug.cgi?id=36818

        Add a test animated GIF which should be displayed 2 times and stop.

        * manual-tests/animated-gif-looping.html:
        * manual-tests/resources/animated-2x.gif: Added.

2011-01-05  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Fork code of ScrollbarThemeGtk that will differ for GTK+ 3
        https://bugs.webkit.org/show_bug.cgi?id=51923

        Split out pieces of ScrollbarThemeGtk into ScrollbarThemeGtk2 and
        ScrollbarThemeGtk3 that will differ between GTK+ 2 and GTK+ 3.

        No new tests. This should not change functionality.

        * GNUmakefile.am: Add ScrollbarThemeGtk2.cpp and ScrollbarThemeGtk3.cpp
        * platform/gtk/ScrollbarThemeGtk.cpp:
        (WebCore::ScrollbarThemeGtk::updateScrollbarsFrameThickness):
        * platform/gtk/ScrollbarThemeGtk.h:
        * platform/gtk/ScrollbarThemeGtk2.cpp: Added.
        (WebCore::ScrollbarThemeGtk::updateThemeProperties):
        (WebCore::ScrollbarThemeGtk::paintTrackBackground):
        (WebCore::ScrollbarThemeGtk::paintScrollbarBackground):
        (WebCore::ScrollbarThemeGtk::paintThumb):
        (WebCore::ScrollbarThemeGtk::paintButton):
        * platform/gtk/ScrollbarThemeGtk3.cpp: Added.
        (WebCore::ScrollbarThemeGtk::updateThemeProperties):
        (WebCore::ScrollbarThemeGtk::paintTrackBackground):
        (WebCore::ScrollbarThemeGtk::paintScrollbarBackground):
        (WebCore::ScrollbarThemeGtk::paintThumb):
        (WebCore::ScrollbarThemeGtk::paintButton):

2011-01-05  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Andreas Kling.

        [CMake] Fix the usage of SOURCE_GROUP
        https://bugs.webkit.org/show_bug.cgi?id=51739

        * CMakeLists.txt:

2011-01-05  Andras Becsi  <abecsi@webkit.org>

        Reviewed by Csaba Osztrogonác.

        [Qt][V8] Fix the build after recent changes.

        No new tests needed.

        * WebCore.pro: Add missing files, and remove obsolete ones.

2011-01-05  Yong Li  <yoli@rim.com>

        Reviewed by Adam Barth.

        Suspend HTMLParserScheduler when page load is deferred to
        avoid potential JS re-entrancy. Otherwise, when JS execution is triggered
        from an external script or by events, and is blocked by a modal dialog,
        WebKit can parse more HTML source and also start another JS execution.
        
        https://bugs.webkit.org/show_bug.cgi?id=48077

        Test case: WebCore/manual-tests/bugzilla-48077.html.

        * dom/DocumentParser.cpp:
        (WebCore::DocumentParser::suspendScheduledTasks):
        (WebCore::DocumentParser::resumeScheduledTasks):
        * dom/DocumentParser.h:
        * html/parser/HTMLDocumentParser.cpp:
        (WebCore::HTMLDocumentParser::suspendScheduledTasks):
        (WebCore::HTMLDocumentParser::resumeScheduledTasks):
        * html/parser/HTMLParserScheduler.cpp:
        (WebCore::HTMLParserScheduler::HTMLParserScheduler):
        (WebCore::HTMLParserScheduler::suspend):
        (WebCore::HTMLParserScheduler::resume):
        * html/parser/HTMLParserScheduler.h:
        (WebCore::HTMLParserScheduler::isScheduledForResume):
        * page/PageGroupLoadDeferrer.cpp:
        (WebCore::PageGroupLoadDeferrer::PageGroupLoadDeferrer):
        (WebCore::PageGroupLoadDeferrer::~PageGroupLoadDeferrer):

2011-01-05  Simon Hausmann  <simon.hausmann@nokia.com>

        Reviewed by Kenneth Rohde Christiansen, Gustavo Noronha Silva

        [GStreamer] MediaPlayerPrivateGStreamer::totalBytes() does not work reliably
        https://bugs.webkit.org/show_bug.cgi?id=51926

        Work around potential upstream bug: Querying a GstBin for the duration,
        will forward the query to all sink children. Our WebKitWebSrc however
        is a bin with only source children, therefore the query fails. Until
        this is changed upstream, this patch works around it as follows,
        based on suggestion by Philippe Normand and Sebastian Dröge:

        When the initial query fails, attempt the same query on all source
        pads and take the maximum length reported.

        * platform/graphics/gstreamer/MediaPlayerPrivateGStreamer.cpp:
        (WebCore::MediaPlayerPrivateGStreamer::totalBytes):

2011-01-05  Philippe Normand  <pnormand@igalia.com>

        Rubber-stamped by Eric Seidel.

        [GStreamer] build fails with gstreamer core 0.10.31 and -plugins-base 0.10.30
        https://bugs.webkit.org/show_bug.cgi?id=51810

        Based on a patch by Mart Raudsepp.

        No new tests, build fix only.

        * platform/graphics/gstreamer/GStreamerGWorld.cpp:
        (WebCore::GStreamerGWorld::setWindowOverlay): Use the new xoverlay
        API if the GST_CHECK_PLUGINS_BASE_VERSION macro is defined. It was
        introduced in same version as the xoverlay API change.

2011-01-05  Leo Yang  <leo.yang@torchmobile.com.cn>

        Reviewed by Dirk Schulze.

        Malformed SVG causes crash in updateContainerOffset
        https://bugs.webkit.org/show_bug.cgi?id=44610

        We should check recursive <use> at the begining of
        WebCore::SVGUseElement::buildInstanceTree instead
        of at the end of it because the target element's
        children may cause infinite recursive <use>.

        Test: svg/custom/recursive-use.svg

        * svg/SVGUseElement.cpp:
        (WebCore::SVGUseElement::buildInstanceTree):
        (WebCore::SVGUseElement::hasCycleUseReferencing):
        * svg/SVGUseElement.h:

2011-01-04  Antti Koivisto  <antti@apple.com>

        Reviewed by Dan Bernstein.

        https://bugs.webkit.org/show_bug.cgi?id=51907
        Style selector should only be recalculated when the pending sheet count goes to zero
        
        Shark says this is a significant performance improvement on some sites with lots of stylesheets.

        * dom/Document.cpp:
        (WebCore::Document::removePendingSheet):

2011-01-05  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Use GtkStyleContext to get platform colors
        https://bugs.webkit.org/show_bug.cgi?id=51830

        Use GtkStyleContext API to get platform colors when building with
        GTK+ 3.x.

        No new tests. This should not change functionality.

        * platform/graphics/Color.h: Add specialized constructor for GdkRGBA.
        * platform/graphics/gtk/ColorGtk.cpp:
        (WebCore::Color::Color):
        (WebCore::Color::operator GdkRGBA):
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::platformActiveSelectionBackgroundColor):
        (WebCore::RenderThemeGtk::platformInactiveSelectionBackgroundColor):
        (WebCore::RenderThemeGtk::platformActiveSelectionForegroundColor):
        (WebCore::RenderThemeGtk::platformInactiveSelectionForegroundColor):
        (WebCore::RenderThemeGtk::activeListBoxSelectionBackgroundColor):
        (WebCore::RenderThemeGtk::inactiveListBoxSelectionBackgroundColor):
        (WebCore::RenderThemeGtk::activeListBoxSelectionForegroundColor):
        (WebCore::RenderThemeGtk::inactiveListBoxSelectionForegroundColor):
        (WebCore::RenderThemeGtk::systemColor):

2011-01-05  Carlos Garcia Campos  <cgarcia@igalia.com>

        Unreviewed. Build fix for GTK when using gtk+-3 after r75009.

        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::RenderThemeGtk::getStockIcon): Use adoptGRef instead of
        adoptGRefPtr which doesn't exist.

2011-01-05  Alexey Proskuryakov  <ap@apple.com>

        Reviewed by Sam Weinig.

        https://bugs.webkit.org/show_bug.cgi?id=51903
        Tell UI process which subframe is largest

        * WebCore.exp.in: Exported FrameView::contentsSize().

2011-01-04  Chris Fleizach  <cfleizach@apple.com>

        Unreviewed. GTK build fix.

        WK2: Support Accessibility
        https://bugs.webkit.org/show_bug.cgi?id=51859

        * page/FrameView.cpp:
        (WebCore::FrameView::axObjectCache):

2011-01-04  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r74992.
        http://trac.webkit.org/changeset/74992
        https://bugs.webkit.org/show_bug.cgi?id=51917

        Crash in HTMLDocumentParser::suspendScheduledTasks()
        (Requested by tkent on #webkit).

        * dom/DocumentParser.cpp:
        * dom/DocumentParser.h:
        * html/parser/HTMLDocumentParser.cpp:
        * html/parser/HTMLDocumentParser.h:
        * html/parser/HTMLParserScheduler.cpp:
        (WebCore::HTMLParserScheduler::HTMLParserScheduler):
        * html/parser/HTMLParserScheduler.h:
        (WebCore::HTMLParserScheduler::isScheduledForResume):
        * page/PageGroupLoadDeferrer.cpp:
        (WebCore::PageGroupLoadDeferrer::PageGroupLoadDeferrer):
        (WebCore::PageGroupLoadDeferrer::~PageGroupLoadDeferrer):

2011-01-04  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] [WK2] Add support for non-trivial context menu action
        https://bugs.webkit.org/show_bug.cgi?id=51902

        Fix the preprocessor guard for ContextMenuItemTagSelectAll in
        the implementation of ContextMenuController::contextMenuItemSelected(). The guard was
        inconsistent with what is defined in ContextMenuItem.h.

        * page/ContextMenuController.cpp:
        (WebCore::ContextMenuController::contextMenuItemSelected):

2011-01-04  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Ryosuke Niwa.

        Avoid manual ref/deref in AsyncScriptRunner by using PendingScript
        https://bugs.webkit.org/show_bug.cgi?id=51723

        ScriptElement should also be able to keep its Element+CachedScript in
        a PendingScript, and then executeScriptSoon can accept a PendingScript.
        Once HTMLScriptRunner, ScriptElement, and AsyncScriptRunner all use
        PendingScripts, then generic request and execute which operate on
        PendingScripts can be factored out to avoid code duplicate that we have.

        No new tests because no new functionality.

        * dom/AsyncScriptRunner.cpp:
        (WebCore::AsyncScriptRunner::~AsyncScriptRunner):
        (WebCore::AsyncScriptRunner::executeScriptSoon):
        (WebCore::AsyncScriptRunner::timerFired):
        * dom/AsyncScriptRunner.h:
        * dom/PendingScript.h: Add ctor which sets element and cachedScript. Rename adoptElement->setElement.
        * dom/HTMLScriptRunner.cpp:
        (WebCore::HTMLScriptRunner::requestPendingScript):

2011-01-04  Jeff Miller  <jeffm@apple.com>

        Reviewed by Darin Adler.

        Member variable and method naming cleanup to be consistent with WebKit2.
        https://bugs.webkit.org/show_bug.cgi?id=51228

        * page/win/EventHandlerWin.cpp:
        (WebCore::EventHandler::eventActivatedView):
        Rename activatedWebView() to didActivateWebView().
        
        * platform/PlatformMouseEvent.h:
        Rename m_activatedWebView to m_didActivateWebView.
        
        (WebCore::PlatformMouseEvent::PlatformMouseEvent):
        Initialize platform-specific member variables in PlatformMouseEvent constructors.
        
        (WebCore::PlatformMouseEvent::didActivateWebView):
        Rename activatedWebView() to didActivateWebView().

        * platform/win/PlatformMouseEventWin.cpp:
        (WebCore::PlatformMouseEvent::PlatformMouseEvent):
        Rename m_activatedWebView to m_didActivateWebView.

2011-01-04  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Darin Adler.

        CSS3 :nth-child selector and valid whitespace test fails
        https://bugs.webkit.org/show_bug.cgi?id=36279

        Teach the tokenizer to allow white spaces around [+/-] signs in nth constructs.

        Test: fast/css/css3-nth-space.html

        * css/tokenizer.flex:

2011-01-04  Chris Fleizach  <cfleizach@apple.com>

        Unreviewed. Build fix.

        WK2: Support Accessibility
        https://bugs.webkit.org/show_bug.cgi?id=51859

        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
        (fallbackObject):

2011-01-04  Cosmin Truta  <ctruta@chromium.org>

        Reviewed by Eric Seidel.

        [chromium] PNG compression settings optimized for speed
        https://bugs.webkit.org/show_bug.cgi?id=51719

        Although Z_HUFFMAN_ONLY is the fastest on hard-to-compress images,
        it is also the slowest, by a wide margin, on easy-to-compress images.
        Use a more balanced configuration, based on the libpng compression defaults,
        but with a faster compression level (3 instead of 6), and a faster filter
        ("sub" instead of "all").

        No change in behaviour, so no new tests.

        * platform/image-encoders/skia/PNGImageEncoder.cpp:
        (WebCore::PNGImageEncoder::encode):

2011-01-04  Chris Fleizach  <cfleizach@apple.com>

        Reviewed by Sam Weinig.

        WK2: Support Accessibility
        https://bugs.webkit.org/show_bug.cgi?id=51859

        WK2 doesn't use platform scroll views anymore. Accessibility code
        needs to have its own scroll views. 

        Test: platform/mac/accessibility/webkit-scrollarea.html

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.exp.in:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * accessibility/AXObjectCache.cpp:
        (WebCore::AXObjectCache::AXObjectCache):
        (WebCore::AXObjectCache::get):
        (WebCore::AXObjectCache::getOrCreate):
        (WebCore::AXObjectCache::rootObject):
        (WebCore::AXObjectCache::remove):
        (WebCore::AXObjectCache::handleScrollbarUpdate):
        * accessibility/AXObjectCache.h:
        (WebCore::AXObjectCache::handleScrollbarUpdate):
        * accessibility/AccessibilityARIAGrid.h:
        * accessibility/AccessibilityAllInOne.cpp:
        * accessibility/AccessibilityImageMapLink.cpp:
        * accessibility/AccessibilityImageMapLink.h:
        * accessibility/AccessibilityListBoxOption.cpp:
        * accessibility/AccessibilityListBoxOption.h:
        * accessibility/AccessibilityObject.cpp:
        (WebCore::AccessibilityObject::updateChildrenIfNecessary):
        (WebCore::AccessibilityObject::elementAccessibilityHitTest):
        (WebCore::AccessibilityObject::axObjectCache):
        (WebCore::AccessibilityObject::focusedUIElement):
        * accessibility/AccessibilityObject.h:
        (WebCore::AccessibilityObject::isAccessibilityScrollView):
        (WebCore::AccessibilityObject::isScrollView):
        (WebCore::AccessibilityObject::canSetNumericValue):
        (WebCore::AccessibilityObject::scrollBar):
        (WebCore::AccessibilityObject::size):
        (WebCore::AccessibilityObject::setValue):
        * accessibility/AccessibilityRenderObject.cpp:
        (WebCore::AccessibilityRenderObject::parentObject):
        (WebCore::AccessibilityRenderObject::accessibilityHitTest):
        (WebCore::AccessibilityRenderObject::updateChildrenIfNecessary):
        (WebCore::AccessibilityRenderObject::addChildren):
        * accessibility/AccessibilityRenderObject.h:
        * accessibility/AccessibilityScrollView.cpp: Added.
        (WebCore::AccessibilityScrollView::AccessibilityScrollView):
        (WebCore::AccessibilityScrollView::create):
        (WebCore::AccessibilityScrollView::scrollBar):
        (WebCore::AccessibilityScrollView::children):
        (WebCore::AccessibilityScrollView::updateChildrenIfNecessary):
        (WebCore::AccessibilityScrollView::removeChildScrollbar):
        (WebCore::AccessibilityScrollView::addChildScrollbar):
        (WebCore::AccessibilityScrollView::addChildren):
        (WebCore::AccessibilityScrollView::webAreaObject):
        (WebCore::AccessibilityScrollView::accessibilityHitTest):
        (WebCore::AccessibilityScrollView::document):
        (WebCore::AccessibilityScrollView::elementRect):
        (WebCore::AccessibilityScrollView::parentObject):
        * accessibility/AccessibilityScrollView.h: Added.
        (WebCore::AccessibilityScrollView::roleValue):
        (WebCore::AccessibilityScrollView::scrollView):
        (WebCore::AccessibilityScrollView::accessibilityIsIgnored):
        (WebCore::AccessibilityScrollView::isAccessibilityScrollView):
        (WebCore::toAccessibilityScrollView):
        * accessibility/AccessibilityScrollbar.cpp:
        (WebCore::AccessibilityScrollbar::AccessibilityScrollbar):
        (WebCore::AccessibilityScrollbar::create):
        (WebCore::AccessibilityScrollbar::elementRect):
        (WebCore::AccessibilityScrollbar::document):
        (WebCore::AccessibilityScrollbar::orientation):
        (WebCore::AccessibilityScrollbar::isEnabled):
        (WebCore::AccessibilityScrollbar::valueForRange):
        (WebCore::AccessibilityScrollbar::setValue):
        * accessibility/AccessibilityScrollbar.h:
        (WebCore::AccessibilityScrollbar::setParent):
        (WebCore::AccessibilityScrollbar::canSetValueAttribute):
        (WebCore::AccessibilityScrollbar::canSetNumericValue):
        (WebCore::AccessibilityScrollbar::isAccessibilityScrollbar):
        (WebCore::AccessibilityScrollbar::parentObject):
        (WebCore::AccessibilityScrollbar::roleValue):
        * accessibility/mac/AccessibilityObjectMac.mm:
        (WebCore::AccessibilityObject::accessibilityIgnoreAttachment):
        * accessibility/mac/AccessibilityObjectWrapper.mm:
        (-[AccessibilityObjectWrapper accessibilityAttributeNames]):
        (-[AccessibilityObjectWrapper remoteAccessibilityParentObject]):
        (-[AccessibilityObjectWrapper position]):
        (-[AccessibilityObjectWrapper scrollViewParent]):
        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
        (-[AccessibilityObjectWrapper accessibilityHitTest:]):
        (-[AccessibilityObjectWrapper accessibilitySetValue:forAttribute:]):
        * dom/Document.cpp:
        (WebCore::Document::axObjectCache):
        * loader/EmptyClients.h:
        (WebCore::EmptyFrameLoaderClient::accessibilityRemoteObject):
        * loader/FrameLoaderClient.h:
        * page/FrameView.cpp:
        (WebCore::FrameView::~FrameView):
        (WebCore::FrameView::axObjectCache):
        * page/FrameView.h:
        * platform/ScrollView.cpp:
        (WebCore::ScrollView::setHasHorizontalScrollbar):
        (WebCore::ScrollView::setHasVerticalScrollbar):
        * platform/Scrollbar.cpp:
        (WebCore::Scrollbar::~Scrollbar):
        (WebCore::Scrollbar::scroll):
        (WebCore::Scrollbar::axObjectCache):
        * platform/Scrollbar.h:
        * platform/Widget.h:
        (WebCore::Widget::axObjectCache):

2011-01-04  W. James MacLean  <wjmaclean@chromium.org>

        Reviewed by Kenneth Russell.

        [chromium] Add support to compositor to composite to offscreen texture.
        https://bugs.webkit.org/show_bug.cgi?id=50833

        A patch to extend compositor to be able to composite into an offscreen texture instead
        of just directly to the display buffer. Builds on RenderSurfaceChromium support.
        Explicitly resets alpha channel before rendering to display.

        * platform/graphics/chromium/LayerRendererChromium.cpp:
        (WebCore::LayerRendererChromium::LayerRendererChromium):
        (WebCore::LayerRendererChromium::updateAndDrawRootLayer):
        (WebCore::LayerRendererChromium::drawLayers):
        (WebCore::LayerRendererChromium::setCompositeOffscreen):
        (WebCore::LayerRendererChromium::useRenderSurface):
        (WebCore::LayerRendererChromium::setScissorToRect):
        * platform/graphics/chromium/LayerRendererChromium.h:
        (WebCore::LayerRendererChromium::isCompositingOffscreen):
        (WebCore::LayerRendererChromium::getOffscreenLayerTexture):

2011-01-04  Evan Martin  <evan@chromium.org>

        Reviewed by Tony Chang.

        [chromium] depend on harfbuzz explicitly
        https://bugs.webkit.org/show_bug.cgi?id=51895

        platform/graphics/chromium uses Harfbuzz directly.  Rather than
        expecting Skia to adjust the include paths, be explicit about
        the dependency.

        * WebCore.gyp/WebCore.gyp:

2011-01-04  Darin Adler  <darin@apple.com>

        Reviewed by Brady Eidson.

        Add back/forward encoding and decoding to WebKit2
        https://bugs.webkit.org/show_bug.cgi?id=51901

        * WebCore.exp.in: Export functions used in WebKit2.

        * history/HistoryItem.cpp:
        (WebCore::HistoryItem::encodeBackForwardTree): Use references instead of pointers.
        (WebCore::HistoryItem::encodeBackForwardTreeNode): Ditto.
        (WebCore::HistoryItem::decodeBackForwardTree): Ditto.
        * history/HistoryItem.h: Ditto.
        * platform/network/FormData.cpp:
        (WebCore::encode): Ditto.
        (WebCore::decode): Ditto.
        (WebCore::FormData::encodeForBackForward): Ditto.
        (WebCore::FormData::decodeForBackForward): Ditto.
        * platform/network/FormData.h: Ditto.

2011-01-04  Xiaomei Ji  <xji@chromium.org>

        Reviewed by Dan Bernstein.

        Implement sel.modify('move', 'left'/'right', 'lineBoundary').
        https://bugs.webkit.org/show_bug.cgi?id=33435

        * editing/SelectionController.cpp:
        (WebCore::SelectionController::modifyMovingRight):
        (WebCore::SelectionController::modifyMovingLeft):
        * editing/visible_units.cpp:
        (WebCore::logicalStartOfLine):
        (WebCore::logicalEndOfLine):
        (WebCore::leftBoundaryOfLine):
        (WebCore::rightBoundaryOfLine):
        * editing/visible_units.h:

2011-01-04  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Use the default CSS text input control border width of relying on the GTK+ theme
        https://bugs.webkit.org/show_bug.cgi?id=51887

        Do not rely on the GTK+ theme to determine text control borders. This simplifies
        the RenderTheme code, prevents metrics differences between GTK+ 2.x and 3.x and
        doesn't break the rendering of any theme that I've encountered.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::adjustSearchFieldStyle): No longer call setTextInputBorders, but
        still disable any border radius.
        * platform/gtk/RenderThemeGtk.h: Remove setTextInputBorders and no longer override the
        default style of text areas and text input controls.
        * platform/gtk/RenderThemeGtk2.cpp: Ditto.
        * platform/gtk/RenderThemeGtk3.cpp: Ditto.

2011-01-03  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Darin Adler.

        Remove the last non-GObject usage of PlatformRefPtr and move the code to GRefPtr
        https://bugs.webkit.org/show_bug.cgi?id=51846

        No new tests. This should not introduce any functional changes.

        Changed all references to PlatformRefPtr in GTK+ code to GRefPtr. Changed
        all references to PlatformRefPtr in Brew code to RefPtr.

2011-01-04  David Kilzer  <ddkilzer@apple.com>

        <http://webkit.org/b/51890> Move ResourceLoadPriority.h into WebCore/platform/network

        Reviewed by Antti Koivisto.

        This is needed to prevent a WebCore/platform policy violation in
        my next patch.

        * WebCore.gypi: Updated for moved header.
        * WebCore.pro: Ditto.
        * WebCore.vcproj/WebCore.vcproj: Ditto.
        * WebCore.xcodeproj/project.pbxproj: Ditto.
        * platform/network/ResourceLoadPriority.h: Renamed from WebCore/loader/ResourceLoadPriority.h.

2011-01-04  Brady Eidson  <beidson@apple.com>

        Reviewed by a spell checker.

        * storage/StorageMap.h: mesured?  Really?

2011-01-04  Carlos Garcia Campos  <cgarcia@igalia.com> and Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Port stock icon painting to GtkStyleContext
        https://bugs.webkit.org/show_bug.cgi?id=51764

        Port stock icon painting for media and search input elements to
        GtkStyleContext. Also create the initial machinery for accessing
        style contexts for all GTK+ 3.x based widgets.

        No new tests. This should not change functionality.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::paintGdkPixbuf):
        (WebCore::RenderThemeGtk::paintSearchFieldResultsDecoration):
        (WebCore::RenderThemeGtk::paintSearchFieldCancelButton):
        (WebCore::RenderThemeGtk::paintMediaButton):
        * platform/gtk/RenderThemeGtk.h:
        * platform/gtk/RenderThemeGtk2.cpp:
        (WebCore::RenderThemeGtk::getStockIcon):
        * platform/gtk/RenderThemeGtk3.cpp:
        (WebCore::gtkStyleChangedCallback):
        (WebCore::styleContextMap):
        (WebCore::getStyleContext):
        (WebCore::RenderThemeGtk::paintMenuList):

2010-12-31  Antti Koivisto  <antti@apple.com>

        Reviewed by Dave Hyatt.

        Scripts should not be executed before preceding stylesheets are loaded
        https://bugs.webkit.org/show_bug.cgi?id=8852

        Block inline script execution on pending stylesheet loads. This matches
        other browsers and HTML5.

        Tests: fast/tokenizer/inline-script-stylesheet-write.html
               fast/tokenizer/inline-script-stylesheet.html

        * dom/PendingScript.cpp:
        (WebCore::PendingScript::releaseElementAndClear):
        * dom/PendingScript.h:
        (WebCore::PendingScript::PendingScript):
        (WebCore::PendingScript::operator=):
        (WebCore::PendingScript::startingPosition):
        (WebCore::PendingScript::setStartingPosition):
        * html/HTMLLinkElement.cpp:
        (WebCore::HTMLLinkElement::process):
        
        This fixes an unrelated bug with beforeload events that was exposed by the other
        changes (fast/dom/beforeload/remove-link-in-beforeload-listener.html).
        
        * html/parser/HTMLScriptRunner.cpp:
        (WebCore::HTMLScriptRunner::sourceFromPendingScript):
        (WebCore::HTMLScriptRunner::runScript):

2011-01-04  Xianzhu Wang  <wangxianzhu@google.com>

        Reviewed by Darin Adler.

        Let DataView.getInt8() and DataView.setInt8() use int8_t instead of
        ambiguous 'char' to fix fast/canvas/webgl/data-view-test.html failure
        on ARM.
        https://bugs.webkit.org/show_bug.cgi?id=51861

        By the way, changed other getIntXX() and setIntXX() methods to use
        more precise integer types.

        * bindings/js/JSDataViewCustom.cpp:
        (WebCore::setDataViewMember):
        * bindings/v8/custom/V8DataViewCustom.cpp:
        (WebCore::V8DataView::getInt8Callback):
        (WebCore::V8DataView::setInt8Callback):
        * html/canvas/DataView.cpp:
        (WebCore::DataView::getInt8):
        (WebCore::DataView::setInt8):
        * html/canvas/DataView.h:
        * html/canvas/DataView.idl:

2011-01-04  Yong Li  <yoli@rim.com>

        Reviewed by Adam Barth.

        Suspend HTMLParserScheduler when page load is deferred to
        avoid potential JS re-entrancy. Otherwise, when JS execution is triggered
        from an external script or by events, and is blocked by a modal dialog,
        WebKit can parse more HTML source and also start another JS execution.
        
        https://bugs.webkit.org/show_bug.cgi?id=48077

        Test case: WebCore/manual-tests/bugzilla-48077.html.

        * dom/DocumentParser.cpp:
        (WebCore::DocumentParser::suspendScheduledTasks):
        (WebCore::DocumentParser::resumeScheduledTasks):
        * dom/DocumentParser.h:
        * html/parser/HTMLDocumentParser.cpp:
        (WebCore::HTMLDocumentParser::suspendScheduledTasks):
        (WebCore::HTMLDocumentParser::resumeScheduledTasks):
        * html/parser/HTMLParserScheduler.cpp:
        (WebCore::HTMLParserScheduler::HTMLParserScheduler):
        (WebCore::HTMLParserScheduler::suspend):
        (WebCore::HTMLParserScheduler::resume):
        * html/parser/HTMLParserScheduler.h:
        (WebCore::HTMLParserScheduler::isScheduledForResume):
        * page/PageGroupLoadDeferrer.cpp:
        (WebCore::PageGroupLoadDeferrer::PageGroupLoadDeferrer):
        (WebCore::PageGroupLoadDeferrer::~PageGroupLoadDeferrer):

2011-01-04  Tony Gentilcore  <tonyg@chromium.org>

        Unreviewed build fix.

        Include glib-object.h for GObject
        https://bugs.webkit.org/show_bug.cgi?id=51876

        * bindings/gobject/DOMObjectCache.cpp:

2011-01-04  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Dan Bernstein.

        Clicking on the first or the last letter of LTR/RTL text in a RTL/LTR block puts caret on the opposite side.
        https://bugs.webkit.org/show_bug.cgi?id=50992

        Fixed the bug by interchanging the offset when the direction of inline text box and the containing block
        does not match. Reused the code added by http://trac.webkit.org/changeset/73553.

        Test: editing/selection/caret-bidi-first-and-last-letters.html

        * rendering/InlineTextBox.cpp:
        (WebCore::InlineTextBox::offsetForPosition):

2010-12-29  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Darin Adler.

        Remove 2 unnecessary includes from Document.h
        https://bugs.webkit.org/show_bug.cgi?id=51727

        No new tests because no changed functionality.

        * dom/Document.cpp:
        * dom/Document.h:
        * editing/Editor.cpp:
        * editing/SpellChecker.h:
        * editing/SplitTextNodeCommand.cpp:
        * editing/TextCheckingHelper.cpp:
        * page/FrameView.cpp:
        * page/Page.cpp:
        * rendering/HitTestResult.cpp:
        * rendering/InlineTextBox.cpp:
        * rendering/InlineTextBox.h:
        * rendering/svg/SVGInlineFlowBox.cpp:

2011-01-04  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix.

        * CMakeListsWinCE.txt: Added missing include directories, files and libraries.

2011-01-04  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Simon Hausmann.

        Provide an interface to require using fullscreen mediaplayer
        https://bugs.webkit.org/show_bug.cgi?id=51133

        Only video should be displayed in fullscreen when 
        requiresFullscreenForVideoPlayback is specified.

        No new tests because no client implements requiresFullscreenForVideoPlayback yet.

        * html/HTMLMediaElement.cpp:
        (WebCore::HTMLMediaElement::updatePlayState):

2011-01-04  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Kenneth Rohde Christiansen.

        [Qt] [WK2] create an initial implementation of the context menu handling for WebKit 2
        https://bugs.webkit.org/show_bug.cgi?id=51825

        Implement contextMenuItemVector() for Qt, this method is used in WebKit 2 to get the
        platform independent menu informations.

        * platform/qt/ContextMenuQt.cpp:
        (WebCore::contextMenuItemVector):

2011-01-04  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r74960.
        http://trac.webkit.org/changeset/74960
        https://bugs.webkit.org/show_bug.cgi?id=51868

        Rollout since we hit an assert after this patch. (Requested by
        krit on #webkit).

        * svg/SVGUseElement.cpp:
        (WebCore::SVGUseElement::buildInstanceTree):

2011-01-04  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r74961.
        http://trac.webkit.org/changeset/74961
        https://bugs.webkit.org/show_bug.cgi?id=51867

        breaks 32/64-bits debug bots build (Requested by philn-tp on
        #webkit).

        * platform/graphics/gstreamer/GStreamerGWorld.cpp:
        (WebCore::GStreamerGWorld::setWindowOverlay):

2011-01-03  Philippe Normand  <pnormand@igalia.com>

        Rubber-stamped by Eric Seidel.

        [GStreamer] build fails with gstreamer core 0.10.31 and -plugins-base 0.10.30
        https://bugs.webkit.org/show_bug.cgi?id=51810

        Based on a patch by Mart Raudsepp.

        No new tests, build fix only.

        * platform/graphics/gstreamer/GStreamerGWorld.cpp:
        (WebCore::GStreamerGWorld::setWindowOverlay): Use the new xoverlay
        API if the GST_CHECK_PLUGINS_BASE_VERSION macro is defined. It was
        introduced in same version as the xoverlay API change.

2011-01-04  Leo Yang  <leo.yang@torchmobile.com.cn>

        Reviewed by Dirk Schulze.

        Malformed SVG causes crash in updateContainerOffset
        https://bugs.webkit.org/show_bug.cgi?id=44610

        We should check recursive <use> at the begining of
        WebCore::SVGUseElement::buildInstanceTree instead
        of at the end of it because the target element's
        children may cause infinite recursive <use>.

        Test: svg/custom/recursive-use.svg

        * svg/SVGUseElement.cpp:
        (WebCore::SVGUseElement::buildInstanceTree):

2011-01-04  Kent Tamura  <tkent@chromium.org>

        Unreviewed, build fix.

        Try to fix Clang build.

        * css/CSSParser.cpp:
        (WebCore::valueFromSideKeyword):
        (WebCore::CSSParser::parseLinearGradient):

2011-01-03  Julie-Jeongeun-Kim  <Jeongeun.Kim@obigo.com>

        Reviewed by Darin Adler.

        HTML5 Conformance Test failure: approved/xhtml5/object_border_pixel.xhtml
        https://bugs.webkit.org/show_bug.cgi?id=48596
        
        border attribute was not parsed in HTMLObjectElement.
        I added code for it as HTMLImageElement handled.

        new test:fast/html/object-border.html

        * html/HTMLObjectElement.cpp:
        (WebCore::HTMLObjectElement::parseMappedAttribute):

2011-01-03  Darin Adler  <darin@apple.com>

        Try to fix Chromium build.

        * history/HistoryItem.cpp:
        (WebCore::HistoryItem::encodeBackForwardTreeNode): Added a V8 case here.
        Not sure this ever will be used with V8.
        (WebCore::HistoryItem::decodeBackForwardTree): Ditto.

2011-01-03  Darin Adler  <darin@apple.com>

        Try to fix Leopard build.

        * history/HistoryItem.cpp: Use a consistent type, uint64_t, for the
        size variable.

2011-01-03  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Darin Adler.

        Fixes before child calculation when adding anonymous childs to table parts.
        https://bugs.webkit.org/show_bug.cgi?id=50932

        Fix in r74364 was incomplete. When before child is equal to the table part(to
        which the new child is getting added), it confuses the table part to add it
        incorrectly as an after child. The patch fixes by passing the before child as
        the table part's first child.

        Tests: fast/css-generated-content/table-before-after-child-add.html
               fast/css-generated-content/table-cell-before-after-child-add.html
               fast/css-generated-content/table-row-before-after-child-add.html
               fast/css-generated-content/table-row-before-after-child-add.html

        * rendering/RenderTable.cpp:
        (WebCore::RenderTable::addChild):
        * rendering/RenderTableRow.cpp:
        (WebCore::RenderTableRow::addChild):
        * rendering/RenderTableSection.cpp:
        (WebCore::RenderTableSection::addChild):

2011-01-03  Dan Bernstein  <mitz@apple.com>

        Reviewed by Simon Fraser.

        Shrink HTMLTableCellElement
        https://bugs.webkit.org/show_bug.cgi?id=51858

        * html/HTMLTableCellElement.cpp:
        (WebCore::HTMLTableCellElement::HTMLTableCellElement): Removed intialization of m_row and
        m_col.
        * html/HTMLTableCellElement.h: Removed m_row and m_col and their accessors.

2011-01-03  Darin Adler  <darin@apple.com>

        Fix build.

        * platform/network/FormData.cpp:
        (WebCore::FormData::create): Roll back uint8_t change.
        (WebCore::FormData::flatten): Ditto.
        (WebCore::FormData::flattenToString): Ditto.
        (WebCore::encode): Ditto.
        (WebCore::decode): Ditto.
        (WebCore::FormData::encodeForBackForward):
        * platform/network/FormData.h: Ditto.
        * platform/network/mac/FormDataStreamMac.mm:
        (WebCore::advanceCurrentStream): Ditto.

2011-01-03  Darin Adler  <darin@apple.com>

        Reviewed by Brady Eidson.

        Add code to encode/decode the back/forward tree
        https://bugs.webkit.org/show_bug.cgi?id=51853

        * history/HistoryItem.cpp:
        (WebCore::HistoryItem::encodeBackForwardTree): Added.
        (WebCore::HistoryItem::encodeBackForwardTreeNode): Added.
        (WebCore::HistoryItem::decodeBackForwardTree): Added.
        * history/HistoryItem.h: Added functions above.

        * platform/network/FormData.cpp:
        (WebCore::FormData::create): Changed type to Vector<uint8_t> instead of
        Vector<char>. This type is used in our newer code for vectors of bytes.
        (WebCore::FormData::flatten): Ditto.
        (WebCore::FormData::flattenToString): Ditto. Had to add a cast here.
        (WebCore::FormData::encodeForBackForward): Added.
        (WebCore::FormData::decodeForBackForward): Added.
        * platform/network/FormData.h: Changed type to Vector<uint8_t> instead of
        Vector<char>. Also made some single-argument constructors explicit.
        Also added the new functions.

        * platform/network/mac/FormDataStreamMac.mm:
        (WebCore::advanceCurrentStream): Changed to use uint8_t to match above.

2011-01-03  Simon Fraser  <simon.fraser@apple.com>

        Attempt to fix GTK build.

        * platform/graphics/gtk/FontGtk.cpp:
        (WebCore::drawGlyphsShadow):

2011-01-03  Helder Correia  <helder@sencha.com>

        Reviewed by Simon Fraser.

        ContextShadow can avoid code duplication for getting the CTM
        https://bugs.webkit.org/show_bug.cgi?id=51799

        ContextShadow defines its own getTransformationMatrixFromContext()
        which does exactly the same as GraphicsContext::getCTM().

        Existing tests: fast/canvas/canvas*shadow*html

        * platform/graphics/ContextShadow.cpp:
        (WebCore::ContextShadow::mustUseContextShadow):
        (WebCore::ContextShadow::adjustBlurDistance):
        (WebCore::ContextShadow::calculateLayerBoundingRect):
        * platform/graphics/ContextShadow.h:
        * platform/graphics/cairo/ContextShadowCairo.cpp:
        (WebCore::ContextShadow::beginShadowLayer):
        (WebCore::ContextShadow::endShadowLayer):
        (WebCore::ContextShadow::drawRectShadowWithoutTiling):
        * platform/graphics/cairo/FontCairo.cpp:
        (WebCore::drawGlyphsShadow):
        * platform/graphics/cairo/GraphicsContextCairo.cpp:
        (WebCore::drawPathShadow):
        * platform/graphics/cairo/ImageCairo.cpp:
        (WebCore::BitmapImage::draw):
        * platform/graphics/gtk/FontGtk.cpp:
        (WebCore::drawGlyphsShadow):
        * platform/graphics/qt/ContextShadowQt.cpp:
        (WebCore::ContextShadow::beginShadowLayer):
        (WebCore::ContextShadow::endShadowLayer):
        * platform/graphics/qt/FontQt.cpp:
        (WebCore::drawTextCommon):
        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::fillPath):
        (WebCore::GraphicsContext::strokePath):
        (WebCore::GraphicsContext::fillRect):
        (WebCore::GraphicsContext::fillRoundedRect):
        * platform/graphics/qt/ImageQt.cpp:
        (WebCore::BitmapImage::draw):
        * platform/graphics/qt/StillImageQt.cpp:
        (WebCore::StillImage::draw):

2011-01-03  Darin Adler  <darin@apple.com>

        Reviewed by Dan Bernstein.

        InsertTextCommand::m_charactersAdded is unused
        https://bugs.webkit.org/show_bug.cgi?id=51849

        * editing/InsertTextCommand.cpp:
        (WebCore::InsertTextCommand::InsertTextCommand): Don't initialize m_charactersAdded.
        (WebCore::InsertTextCommand::input): Don't update m_charactersAdded.
        * editing/InsertTextCommand.h: Removed charactersAdded function and
        m_charactersAdded data member.

2011-01-03  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] Move paintMenuListButton() to RenderThemeGtk.cpp
        https://bugs.webkit.org/show_bug.cgi?id=51832

        Method paintMenuListButton() contains code common to both gtk 2
        and 3, so it can be moved to RenderThemeGtk.cpp instead of
        duplicating it.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::paintMenuListButton):
        * platform/gtk/RenderThemeGtk2.cpp:
        * platform/gtk/RenderThemeGtk3.cpp:

2011-01-03  Pratik Solanki  <psolanki@apple.com>

        Reviewed by Darin Adler.

        https://bugs.webkit.org/show_bug.cgi?id=51850
        Put CFNetwork loader code inside USE(CFNETWORK)

        Add USE(CFNETWORK) macros around all the cf/mac network files. Also added all CFNetwork
        files to the WebCore Xcode project.

        * WebCore.xcodeproj/project.pbxproj:
        * loader/cf/ResourceLoaderCFNet.cpp:
        * loader/mac/ResourceLoaderMac.mm:
        * platform/network/cf/AuthenticationCF.cpp:
        * platform/network/cf/AuthenticationCF.h:
        * platform/network/cf/CookieJarCFNet.cpp:
        * platform/network/cf/CookieStorageCFNet.cpp:
        * platform/network/cf/CookieStorageCFNet.h:
        * platform/network/cf/CredentialStorageCFNet.cpp:
        * platform/network/cf/FormDataStreamCFNet.cpp:
        * platform/network/cf/FormDataStreamCFNet.h:
        * platform/network/cf/LoaderRunLoopCF.cpp:
        * platform/network/cf/LoaderRunLoopCF.h:
        * platform/network/cf/ResourceError.h:
        * platform/network/cf/ResourceHandleCFNet.cpp:
        * platform/network/cf/ResourceRequest.h:
        * platform/network/cf/ResourceRequestCFNet.cpp:
        * platform/network/cf/ResourceRequestCFNet.h:
        * platform/network/cf/ResourceResponse.h:
        * platform/network/cf/ResourceResponseCFNet.cpp:
        * platform/network/mac/AuthenticationMac.h:
        * platform/network/mac/AuthenticationMac.mm:
        * platform/network/mac/FormDataStreamMac.h:
        * platform/network/mac/FormDataStreamMac.mm:
        * platform/network/mac/ResourceError.h:
        * platform/network/mac/ResourceHandleMac.mm:
        * platform/network/mac/ResourceRequest.h:
        * platform/network/mac/ResourceRequestMac.mm:
        * platform/network/mac/ResourceResponse.h:
        * platform/network/mac/ResourceResponseMac.mm:

2011-01-03  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Adam Barth.

        [Qt] Add SelectAll option to the context menu for the editor
        https://bugs.webkit.org/show_bug.cgi?id=50049

        Enable SelectAll for the Qt context menu.

        * page/ContextMenuController.cpp:
        (WebCore::ContextMenuController::populate):
        * platform/ContextMenuItem.h:
        * platform/LocalizationStrategy.h:
        * platform/LocalizedStrings.cpp:
        (WebCore::contextMenuItemTagSelectAll):
        * platform/LocalizedStrings.h:

2011-01-03  Dan Bernstein  <mitz@apple.com>

        Reviewed by Darin Adler.

        Shrink RootInlineBox
        https://bugs.webkit.org/show_bug.cgi?id=51847

        * rendering/RootInlineBox.cpp:
        (WebCore::RootInlineBox::alignBoxesInBlockDirection): Changed to use the baselineType()
        accessor.
        * rendering/RootInlineBox.h: Rolled m_baselineType into a bitfield. Changed its type to
        unsigned because otherwise MSVC treats it as signed.
        (WebCore::RootInlineBox::baselineType): Added a cast.

2011-01-03  Gustavo Noronha Silva  <gustavo.noronha@collabora.co.uk>

        Reviewed by Martin Robinson.

        [GTK] Split webkitprivate.{cpp,h} in more manageable chunks
        https://bugs.webkit.org/show_bug.cgi?id=50698

        Fix DOM bindings generation to no longer include the now-gone
        webkitprivate.h header, including the appropriate replacements
        instead.

        * bindings/scripts/CodeGeneratorGObject.pm:

2011-01-03  Brady Eidson  <beidson@apple.com>

        Reviewed by Darin Adler.

        Add Encode/Decode machinery Darin and I plan to work with for back/forward stuff in WebKit2.

        * ForwardingHeaders/wtf/Decoder.h: Added.
        * ForwardingHeaders/wtf/Encoder.h: Added.

2011-01-03  Chris Fleizach  <cfleizach@apple.com>

        Reviewed by Darin Adler.

        AX: Regression: WebKit no longer auto-scrolls with VoiceOver navigation
        https://bugs.webkit.org/show_bug.cgi?id=51833

        Make sure the web area returns the contentsSize, not the same size as what is displayed.

        Test: platform/mac/accessibility/webarea-size-equals-content-size.html

        * accessibility/AccessibilityRenderObject.cpp:
        (WebCore::AccessibilityRenderObject::boundingBoxRect):

2011-01-03  Simon Fraser  <simon.fraser@apple.com>

        Fix warning in 32-bit builds.

        * css/CSSGradientValue.cpp:
        (WebCore::CSSLinearGradientValue::createGradient):

2011-01-03  Benjamin C Meyer  <bmeyer@rim.com>

        Reviewed by Daniel Bates.

        In the cmake build system move logic related to ENABLE_NOTIFICATIONS into its own block.
        https://bugs.webkit.org/show_bug.cgi?id=51827

        * CMakeLists.txt:

2011-01-03  Dan Bernstein  <mitz@apple.com>

        Reviewed by Simon Fraser.

        Remove the unused RenderTableCell::m_percentageHeight
        https://bugs.webkit.org/show_bug.cgi?id=51837

        * rendering/RenderTableCell.cpp:
        (WebCore::RenderTableCell::RenderTableCell): Removed initialization of m_percentageHeight.
        * rendering/RenderTableCell.h: Removed m_percentageHeight.

2011-01-03  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by David Hyatt.

        Implement -webkit-linear-gradient and -webkit-radial-gradient
        https://bugs.webkit.org/show_bug.cgi?id=28152

        Add support for -webkit-radial-gradients.

        Tests: fast/gradients/css3-radial-gradients.html
               fast/gradients/css3-radial-gradients2.html

        * css/CSSGradientValue.cpp:
        (WebCore::blend): Used to blend colors, which is necessary when truncating
        the start of radial gradients.
        (WebCore::GradientStop): Small struct to aid gradient stop processing.
        (WebCore::CSSGradientValue::addStops): Rename 'positions' to 'stops', and store
        the color so that we can blend it when truncating radial gradients. Changed
        to handle both linear and radial gradients.
        (WebCore::CSSRadialGradientValue::cssText): Update to follow the spec.
        (WebCore::CSSRadialGradientValue::resolveRadius): Stylistic change.
        (WebCore::distanceToClosestCorner): New utility method.
        (WebCore::distanceToFarthestCorner): Ditto.
        (WebCore::CSSRadialGradientValue::createGradient): New logic to deal with shape and
        fill rules.

        * css/CSSGradientValue.h:
        (WebCore::CSSGradientValue::isLinearGradient): Color-stop processing needs to know what
        kind of gradient it's dealing with, so add new isFooGradient methods.
        (WebCore::CSSGradientValue::isRadialGradient): Ditto.
        (WebCore::CSSLinearGradientValue::isLinearGradient):
        (WebCore::CSSRadialGradientValue::setShape): New setters for shape, size etc.
        (WebCore::CSSRadialGradientValue::setSizingBehavior):
        (WebCore::CSSRadialGradientValue::setEndHorizontalSize):
        (WebCore::CSSRadialGradientValue::setEndVerticalSize):
        (WebCore::CSSRadialGradientValue::isRadialGradient):

        * css/CSSParser.h:
        * css/CSSParser.h: Pass a CSSParserValueList* into parseFillPositionXY() and parseFillPosition()
        so we can use parseFillPosition() when parsing a gradient function.
        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseFillPositionXY): Pass in a CSSParserValueList*
        (WebCore::CSSParser::parseFillPosition): Ditto
        (WebCore::CSSParser::parseFillProperty): Pass m_valueList to parseFillPosition.
        (WebCore::CSSParser::parseTransformOriginShorthand): Ditto
        (WebCore::CSSParser::parseRadialGradient): Flesh out radial gradient parsing.
        (WebCore::CSSParser::parseTransformOrigin): Pass m_valueList to parseFillPosition.
        (WebCore::CSSParser::parsePerspectiveOrigin): Ditto

        * css/CSSValueKeywords.in: New keywords for radial gradient shape and fill behaviors.

        * platform/graphics/Gradient.cpp:
        (WebCore::Gradient::Gradient): Pass aspect ratio for elliptical gradients.
        * platform/graphics/Gradient.h: Add aspect ratio for elliptical gradients.
        (WebCore::Gradient::create):
        (WebCore::Gradient::startRadius): Expose radii.
        (WebCore::Gradient::endRadius):
        (WebCore::Gradient::setStartRadius): Setters are required for when we need to scale color stops.
        (WebCore::Gradient::setEndRadius):
        (WebCore::Gradient::aspectRatio):
        * platform/graphics/cg/GradientCG.cpp:
        (WebCore::Gradient::paint): For elliptical gradients, scale the CTM.
        * platform/graphics/wince/GraphicsContextWinCE.cpp:
        (WebCore::GraphicsContext::fillRect): Use start/endRadius() rather than r0() and r1().

2011-01-03  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by David Hyatt.

        Implement -webkit-linear-gradient and -webkit-radial-gradient
        https://bugs.webkit.org/show_bug.cgi?id=28152
        
        Add support for the parsing and rendering of non-repeating CSS3 linear gradients,
        according to <http://dev.w3.org/csswg/css3-images/#linear-gradients>.

        Tests: fast/gradients/css3-color-stop-units.html
               fast/gradients/css3-color-stops.html
               fast/gradients/css3-gradient-parsing.html
               fast/gradients/css3-linear-angle-gradients.html

        * css/CSSGradientValue.h:
        Add subclasses of CSSGradientValue for linear and radial gradients.
        
        * css/CSSGradientValue.cpp:
        (WebCore::CSSGradientValue::image): Add FIXME comment about why we can't cache
        the gradient sometimes.
        (WebCore::compareStops): positions are CSSValues now.
        (WebCore::CSSGradientValue::sortStopsIfNeeded): Add assertion that this is only called
        for old-style gradients.
        (WebCore::CSSGradientValue::addStops): New method that handles the spec rules about
        missing positions, ensuring that stop position is ordered, and spacing out stops
        without positions. Also normalize gradients which use stops outside the 0-1 range
        so that platforms can render them correctly.
        (WebCore::positionFromValue): Determin the position on the gradient line for percentage,
        number and length values.
        (WebCore::CSSGradientValue::computeEndPoint):
        (WebCore::CSSLinearGradientValue::cssText):
        (WebCore::endPointsFromAngle): Compute endpoints for a gradient which covers the rectangle
        given an angle.
        (WebCore::CSSLinearGradientValue::createGradient):
        (WebCore::CSSRadialGradientValue::cssText):
        (WebCore::CSSRadialGradientValue::resolveRadius):
        (WebCore::CSSRadialGradientValue::createGradient):

        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseValue): Style fix.
        (WebCore::CSSParser::parseContent): Use isGeneratedImageValue() and parseGeneratedImage()
        (WebCore::CSSParser::parseFillImage): Use isGeneratedImageValue() and parseGeneratedImage()
        (WebCore::CSSParser::parseBorderImage): Use isGeneratedImageValue() and parseGeneratedImage()
        (WebCore::parseDeprecatedGradientPoint): Renamed to indicate that it's only used for -webkit-gradient.
        (WebCore::parseDeprecatedGradientColorStop): Renamed to indicate that it's only used for -webkit-gradient,
        and fixed to store CSSValues for the stop position.
        (WebCore::CSSParser::parseDeprecatedGradient): Renamed to indicate that it's only used for -webkit-gradient,
        and create CSSLinearGradientValue and CSSRadialGradientValue as appropriate.
        (WebCore::valueFromSideKeyword):
        (WebCore::parseGradientColorOrKeyword): Color parsing utility.
        (WebCore::CSSParser::parseLinearGradient): New method to parse linear gradients.
        (WebCore::CSSParser::parseRadialGradient): Stub for new method to parse radial gradients.
        (WebCore::CSSParser::isGeneratedImageValue): Detect gradients and CSS canvas.
        (WebCore::CSSParser::parseGeneratedImage): Parser for generated images like gradients
        and CSS canvas.
        * css/CSSParser.h:
        * platform/graphics/Gradient.h:
        (WebCore::Gradient::setP0): We need to be able to change the points when normalizing gradients.
        (WebCore::Gradient::setP1): Ditto.

2011-01-03  Noam Rosenthal  <noam.rosenthal@nokia.com>

        Reviewed by Andreas Kling.

        [Qt] document.getElementById(...) doesn't return the right object in combination with QGraphicsWidget
        https://bugs.webkit.org/show_bug.cgi?id=51464

        Added a way to bind any QObject created as a plugin to JavaScript, 
        by adding a custom member (qtObject) to WebCore::Widget. 
        Added a test to tst_qwebpage to make sure plugins created 
        as QGraphicsWidget are accessible through JavaScript.

        * bindings/js/ScriptControllerQt.cpp:
        (WebCore::ScriptController::createScriptInstanceForWidget):
        * platform/Widget.h:
        * platform/qt/WidgetQt.cpp:
        (WebCore::Widget::Widget):
        (WebCore::Widget::setBindingObject):
        (WebCore::Widget::bindingObject):

2011-01-03  David Hyatt  <hyatt@apple.com>

        Reviewed by Simon Fraser.

        https://bugs.webkit.org/show_bug.cgi?id=51328

        Printing on a page with body { height: 100% } clips out the overflow contents.  This happened
        because the computePageRects function was never correct.  It was using the layer's width and height
        for the document's width and height, and the layer no longer includes overflow in its width and
        height.  It was also incorrectly assuming the first page would begin at (0,0), and this is an invalid
        assumption in RTL or vertical text environments.

        Added printing/page-count-percentage-height.html

        * page/PrintContext.cpp:
        (WebCore::PrintContext::computePageRects):
        (WebCore::PrintContext::computePageRectsWithPageSizeInternal):

2011-01-03  Csaba Osztrogonác  <ossy@webkit.org>

        [Qt] Unreviewed buildfix for --minimal build after r74895.

        * html/InputType.cpp: Missing include added.
        * html/NumberInputType.cpp: Missing include added.

2011-01-02  Darin Adler  <darin@apple.com>

        Reviewed by Kent Tamura.

        Eliminate HTMLInputElement::m_deprecatedTypeNumber, other input refactoring and renaming
        https://bugs.webkit.org/show_bug.cgi?id=51791

        * dom/InputElement.h: Make sanitizeValueForTextField public so it can
        be called by InputType.

        * html/BaseButtonInputType.cpp:
        (WebCore::BaseButtonInputType::accessKeyAction): Added.
        (WebCore::BaseButtonInputType::storesValueSeparateFromAttribute): Added.
        * html/BaseButtonInputType.h: Ditto.

        * html/BaseCheckableInputType.cpp:
        (WebCore::BaseCheckableInputType::canSetStringValue): Added.
        (WebCore::BaseCheckableInputType::accessKeyAction): Added.
        (WebCore::BaseCheckableInputType::fallbackValue): Added.
        (WebCore::BaseCheckableInputType::storesValueSeparateFromAttribute): Added.
        (WebCore::BaseCheckableInputType::isCheckable): Added.
        * html/BaseCheckableInputType.h: Ditto.

        * html/BaseDateAndTimeInputType.cpp:
        (WebCore::BaseDateAndTimeInputType::hasSpinButton): Added.
        * html/BaseDateAndTimeInputType.h: Ditto.

        * html/BaseTextInputType.h: Made more functions private.

        * html/ButtonInputType.cpp:
        (WebCore::ButtonInputType::isTextButton): Added.
        * html/ButtonInputType.h: Ditto.

        * html/CheckboxInputType.cpp:
        (WebCore::CheckboxInputType::willDispatchClick): Added.
        (WebCore::CheckboxInputType::didDispatchClick): Added.
        (WebCore::CheckboxInputType::isCheckbox): Added.
        * html/CheckboxInputType.h: Ditto.

        * html/DateTimeInputType.cpp:
        (WebCore::DateTimeInputType::scaledStepValueShouldBeInteger): Fixed
        typo in name of this function.
        * html/DateTimeInputType.h: Ditto.
        * html/DateTimeLocalInputType.cpp:
        (WebCore::DateTimeLocalInputType::scaledStepValueShouldBeInteger): Ditto.
        * html/DateTimeLocalInputType.h: Ditto.

        * html/EmailInputType.cpp:
        (WebCore::EmailInputType::isEmailField): Added.
        * html/EmailInputType.h: Ditto.

        * html/FileInputType.cpp:
        (WebCore::FileInputType::FileInputType): Added.
        (WebCore::FileInputType::canSetStringValue): Added.
        (WebCore::FileInputType::canChangeFromAnotherType): Added.
        (WebCore::FileInputType::files): Added.
        (WebCore::FileInputType::canSetValue): Added.
        (WebCore::FileInputType::getTypeSpecificValue): Added.
        (WebCore::FileInputType::storesValueSeparateFromAttribute): Added.
        (WebCore::FileInputType::setFileList): Added.
        (WebCore::FileInputType::isFileUpload): Added.
        * html/FileInputType.h: Ditto.

        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::HTMLInputElement): Updated for data member
        renaming and removal.
        (WebCore::HTMLInputElement::isValidValue): Call canSetStringValue
        instead of checking specific type numbers.
        (WebCore::HTMLInputElement::getAllowedValueStepWithDecimalPlaces):
        Use fastGetAttribute and fixed typo in the name of the
        scaledStepValueShouldBeInteger function.
        (WebCore::HTMLInputElement::isKeyboardFocusable): Call
        InputType::isKeyboardFocusable; moved most of the type-specific
        logic there.
        (WebCore::HTMLInputElement::shouldUseInputMethod): Call
        InputType::shouldUseInputMethod; moved the type-specific logic there.
        (WebCore::HTMLInputElement::handleBlurEvent): Call
        InputType::handleBlurEvent; moved the type-specific logic there.
        (WebCore::HTMLInputElement::setType): Tweak the names and types
        in this function.
        (WebCore::HTMLInputElement::updateType): Removed the code that
        set m_deprecatedTypeNumber. Compare types by comparing the value
        from formControlType. Removed file-specific logic and instead call
        InputType::canChangeFromAnotherType. Streamlined the logic for
        activation callbacks.
        (WebCore::HTMLInputElement::accessKeyAction): Call
        InputType::accessKeyAction; moved the type-specific logic there.
        (WebCore::HTMLInputElement::mapToEntry): Call
        InputType::shouldRespectHeightAndWidthAttributes and
        InputType::shouldRespectAlignAttribute.
        (WebCore::HTMLInputElement::parseMappedAttribute): Updated
        for name changes and the removal of m_defaultChecked. Changed the
        alt attribute logic to be based on the class of the renderer.
        Call InputType::srcAttributeChanged and moved the type-specific
        logic there. Call shouldRespectAlignAttribute and
        shouldRespectHeightAndWidthAttributes rather than having
        type-specific logic here. Call minOrMaxAttributeChanged.
        (WebCore::HTMLInputElement::rendererIsNeeded): Call
        InputType::rendererIsNeeded; moved the type-specific logic there.
        (WebCore::HTMLInputElement::attach): Removed the unneeded m_inited
        flag, which was redundant with the m_haveType flag. Call
        InputType::attach; moved the type-specific logic there.
        (WebCore::HTMLInputElement::altText): Use fastGetAttribute.
        (WebCore::HTMLInputElement::isSuccessfulSubmitButton): Call
        InputType::canBeSuccessfulSubmitButton; moved the type-specific
        logic there.
        (WebCore::HTMLInputElement::isActivatedSubmit): Updated for
        name changes.
        (WebCore::HTMLInputElement::setActivatedSubmit): Ditto.
        (WebCore::HTMLInputElement::reset): Updated to use
        InputType::storesValueSeparateFromAttribute. Also use
        hasAttribute(checkedAttr) rather than m_defaultChecked,
        since both are the same. Also updated for name change.
        (WebCore::HTMLInputElement::setChecked): Updated for name
        changes. Also added call to
        InputType::shouldSendChangeEventAfterCheckedChanged and
        moved the type-specific logic there.
        (WebCore::HTMLInputElement::setIndeterminate): Call
        isCheckable to see if indeterminate is allowed.
        Also updated for name changes.
        (WebCore::HTMLInputElement::copyNonAttributeProperties):
        Updated for name changes and removed data members.
        (WebCore::HTMLInputElement::value): Call
        InputType::getTypeSpecificValue and InputType::fallbackValue.
        Moved the type-specific logic there.
        (WebCore::HTMLInputElement::valueWithDefault): Call
        InputType::defaultValue. Moved the type-specific logic there.
        (WebCore::HTMLInputElement::setSuggestedValue): Call
        InputType::canSetSuggestedValue. Moved the type-specific logic
        there.
        (WebCore::HTMLInputElement::setValue): Call
        InputType::canSetValue. Moved the type-specific logic there.
        Clear the file list if it exists rather than checking the
        type explicitly. We could probably do that a more elegant way.
        (WebCore::HTMLInputElement::placeholder): Use fastGetAttribute.
        (WebCore::HTMLInputElement::setValueFromRenderer): Use the
        isFileUpload function in the assertion.
        (WebCore::HTMLInputElement::setFileListFromRenderer): Put most
        of the code from this function into FileInputType::setFileList.
        (WebCore::HTMLInputElement::preDispatchEventHandler): Changed
        to call InputType::willDispatchClick, which does the type-specific
        work. Still need to use a single struct for all types, because
        the type of the element could change during the event handling.
        (WebCore::HTMLInputElement::postDispatchEventHandler): Changed
        to call InputType::didDispatchClick.
        (WebCore::HTMLInputElement::defaultValue): Use fastGetAttribute.
        (WebCore::HTMLInputElement::accept): Use fastGetAttribute.
        (WebCore::HTMLInputElement::alt): Use fastGetAttribute.
        (WebCore::HTMLInputElement::src): Use fastGetAttribute.
        (WebCore::HTMLInputElement::setAutofilled): Updated for name
        changes.
        (WebCore::HTMLInputElement::files): Use InputType::files.
        (WebCore::HTMLInputElement::isAcceptableValue): Use
        InputType::isAcceptableValue.
        (WebCore::HTMLInputElement::sanitizeValue): Use
        InputType::sanitizeValue.
        (WebCore::HTMLInputElement::hasUnacceptableValue): Use
        InputType::hasUnacceptableValue.
        (WebCore::HTMLInputElement::needsActivationCallback): Use
        InputType::shouldResetOnDocumentActivation.
        (WebCore::HTMLInputElement::willMoveToNewOwnerDocument): Use
        InputType::willMoveToNewOwnerDocument.
        (WebCore::HTMLInputElement::dataList): Use
        InputType::shouldRespectListAttribute.
        (WebCore::HTMLInputElement::selectedOption): Tweaked logic
        and naming a bit.
        (WebCore::HTMLInputElement::stepUpFromRenderer): Use
        fastGetAttribute.
        (WebCore::HTMLInputElement::isSpeechEnabled): Use
        InputType::shouldRespectSpeechAttribute.
        (WebCore::HTMLInputElement::isTextButton): No longer inline.
        Calls through to InputType.
        (WebCore::HTMLInputElement::isRadioButton): Ditto.
        (WebCore::HTMLInputElement::isSearchField): Ditto.
        (WebCore::HTMLInputElement::isInputTypeHidden): Ditto.
        (WebCore::HTMLInputElement::isPasswordField): Ditto.
        (WebCore::HTMLInputElement::isCheckbox): Ditto.
        (WebCore::HTMLInputElement::isText): Ditto.
        (WebCore::HTMLInputElement::isEmailField): Ditto.
        (WebCore::HTMLInputElement::isFileUpload): Ditto.
        (WebCore::HTMLInputElement::isImageButton): Ditto.
        (WebCore::HTMLInputElement::isNumberField): Ditto.
        (WebCore::HTMLInputElement::isSubmitButton): Ditto.
        (WebCore::HTMLInputElement::isTelephoneField): Ditto.
        (WebCore::HTMLInputElement::isURLField): Ditto.
        (WebCore::HTMLInputElement::isEnumeratable): Ditto.
        (WebCore::HTMLInputElement::isChecked): No longer inline.
        Calls InputType::isCheckable.
        (WebCore::HTMLInputElement::hasSpinButton): No longer inline.
        Calls through to InputType.
        (WebCore::HTMLInputElement::supportsPlaceholder): No longer
        inline. Calls isTextType as before, but with no special case
        for ISINDEX. That special case was unneeded since it returns
        true from isTextType.
        (WebCore::HTMLInputElement::checkedRadioButtons): No longer
        inline.
        (WebCore::HTMLInputElement::handleBeforeTextInsertedEvent):
        No longer inline.

        * html/HTMLInputElement.h: Removed multiple unneeded includes.
        The big one is probably InputType.h, but also HTMLFormElement.h.
        Removed unneeded forward declarations. Made many functions
        no longer inline since they now need to make virtual function
        dispatches. Removed the unneeded defaultChecked and
        webkitdirectory functions. Both are handled by HTML attribute
        reflection for DOM bindings, and the callers instead can get
        at the attribute. Made updateCheckedRadioButtons public so it
        can be called by an InputType class. Removed
        DeprecatedInputType, InputTypeMap, createTypeMap,
        deprecatedInputType, allowsIndeterminate,
        respectHeightAndWidthAttrs, storesValueSeparateFromAttribute,
        m_imageLoader, m_fileList, m_deprecatedTypeNumber,
        m_defaultChecked, and m_inited. Renamed m_checked to
        m_isChecked, m_useDefaultChecked to m_reflectsCheckedAttribute,
        m_indeterminate tom_isIndeterminate, m_haveType to m_hasType,
        m_activeSubmit to m_isActivatedSubmit, and m_autofilled to
        m_isAutofilled.
        
        * html/HiddenInputType.cpp:
        (WebCore::HiddenInputType::accessKeyAction): Added.
        (WebCore::HiddenInputType::rendererIsNeeded) Added.:
        (WebCore::HiddenInputType::storesValueSeparateFromAttribute): Added.
        (WebCore::HiddenInputType::isHiddenType): Added.
        (WebCore::HiddenInputType::shouldRespectHeightAndWidthAttributes): Added.
        * html/HiddenInputType.h: Ditto.

        * html/ImageInputType.cpp:
        (WebCore::ImageInputType::ImageInputType): Moved out of the header file.
        (WebCore::ImageInputType::srcAttributeChanged): Added.
        (WebCore::ImageInputType::attach): Added.
        (WebCore::ImageInputType::willMoveToNewOwnerDocument): Added.
        (WebCore::ImageInputType::shouldRespectAlignAttribute): Added.
        (WebCore::ImageInputType::canBeSuccessfulSubmitButton): Added.
        (WebCore::ImageInputType::isImageButton): Added.
        (WebCore::ImageInputType::isEnumeratable): Added.
        (WebCore::ImageInputType::shouldRespectHeightAndWidthAttributes): Added.
        * html/ImageInputType.h: Ditto.

        * html/InputType.cpp:
        (WebCore::InputType::create): Changed argument type to String. There
        is no value in taking an AtomicString here.
        (WebCore::InputType::scaledStepValueShouldBeInteger): Fixed typo in
        this function name.
        (WebCore::InputType::canSetStringValue): Added.
        (WebCore::InputType::isKeyboardFocusable): Added.
        (WebCore::InputType::shouldUseInputMethod): Added.
        (WebCore::InputType::handleBlurEvent): Added.
        (WebCore::InputType::accessKeyAction): Added.
        (WebCore::InputType::attach): Added.
        (WebCore::InputType::srcAttributeChanged): Added.
        (WebCore::InputType::willMoveToNewOwnerDocument): Added.
        (WebCore::InputType::shouldRespectAlignAttribute): Added.
        (WebCore::InputType::canChangeFromAnotherType): Added.
        (WebCore::InputType::minOrMaxAttributeChanged): Added.
        (WebCore::InputType::canBeSuccessfulSubmitButton): Added.
        (WebCore::InputType::rendererIsNeeded): Added.
        (WebCore::InputType::files): Added.
        (WebCore::InputType::getTypeSpecificValue): Added.
        (WebCore::InputType::fallbackValue): Added.
        (WebCore::InputType::defaultValue): Added.
        (WebCore::InputType::canSetSuggestedValue): Added.
        (WebCore::InputType::shouldSendChangeEventAfterCheckedChanged): Added.
        (WebCore::InputType::storesValueSeparateFromAttribute): Added.
        (WebCore::InputType::canSetValue): Added.
        (WebCore::InputType::willDispatchClick): Added.
        (WebCore::InputType::didDispatchClick): Added.
        (WebCore::InputType::isAcceptableValue): Added.
        (WebCore::InputType::sanitizeValue): Added.
        (WebCore::InputType::hasUnacceptableValue): Added.
        (WebCore::InputType::setFileList): Added.
        (WebCore::InputType::shouldResetOnDocumentActivation): Added.
        (WebCore::InputType::shouldRespectListAttribute): Added.
        (WebCore::InputType::shouldRespectSpeechAttribute): Added.
        (WebCore::InputType::isTextButton): Added.
        (WebCore::InputType::isRadioButton): Added.
        (WebCore::InputType::isSearchField): Added.
        (WebCore::InputType::isHiddenType): Added.
        (WebCore::InputType::isPasswordField): Added.
        (WebCore::InputType::isCheckbox): Added.
        (WebCore::InputType::isEmailField): Added.
        (WebCore::InputType::isFileUpload): Added.
        (WebCore::InputType::isImageButton): Added.
        (WebCore::InputType::isNumberField): Added.
        (WebCore::InputType::isSubmitButton): Added.
        (WebCore::InputType::isTelephoneField): Added.
        (WebCore::InputType::isURLField): Added.
        (WebCore::InputType::isEnumeratable): Added.
        (WebCore::InputType::isCheckable): Added.
        (WebCore::InputType::hasSpinButton): Added.
        (WebCore::InputType::shouldRespectHeightAndWidthAttributes): Added.

        * html/InputType.h: Removed unneeded ExceptionCode.h include and
        used a typedef instead as we do when we want for forward declare it.
        Added includes and forward declarations needed for new functions.
        Added ClickHandlingState structure. Changed the argument to create
        to a String rather than AtomicString. Added many virtual functions.
        
        * html/IsIndexInputType.cpp:
        (WebCore::IsIndexInputType::shouldRespectListAttribute): Added.
        * html/IsIndexInputType.h: Ditto.

        * html/NumberInputType.cpp:
        (WebCore::NumberInputType::handleBlurEvent): Added.
        (WebCore::NumberInputType::isAcceptableValue): Added.
        (WebCore::NumberInputType::sanitizeValue): Added.
        (WebCore::NumberInputType::hasUnacceptableValue): Added.
        (WebCore::NumberInputType::shouldRespectSpeechAttribute): Added.
        (WebCore::NumberInputType::isNumberField): Added.
        (WebCore::NumberInputType::hasSpinButton): Added.
        * html/NumberInputType.h: Ditto.

        * html/PasswordInputType.cpp:
        (WebCore::PasswordInputType::shouldUseInputMethod): Added.
        (WebCore::PasswordInputType::shouldResetOnDocumentActivation): Added.
        (WebCore::PasswordInputType::shouldRespectListAttribute): Added.
        (WebCore::PasswordInputType::shouldRespectSpeechAttribute): Added.
        (WebCore::PasswordInputType::isPasswordField): Added.
        * html/PasswordInputType.h: Ditto.

        * html/RadioInputType.cpp:
        (WebCore::RadioInputType::isKeyboardFocusable): Added.
        (WebCore::RadioInputType::attach): Added.
        (WebCore::RadioInputType::shouldSendChangeEventAfterCheckedChanged): Added.
        (WebCore::RadioInputType::willDispatchClick): Added.
        (WebCore::RadioInputType::didDispatchClick): Added.
        (WebCore::RadioInputType::isRadioButton): Added.
        * html/RadioInputType.h: Ditto.

        * html/RangeInputType.cpp:
        (WebCore::RangeInputType::accessKeyAction): Added.
        (WebCore::RangeInputType::minOrMaxAttributeChanged): Added.
        (WebCore::RangeInputType::fallbackValue): Added.
        (WebCore::RangeInputType::sanitizeValue): Added.
        (WebCore::RangeInputType::shouldRespectListAttribute): Added.
        * html/RangeInputType.h: Ditto.

        * html/ResetInputType.cpp:
        (WebCore::ResetInputType::defaultValue): Added.
        (WebCore::ResetInputType::isTextButton): Added.
        * html/ResetInputType.h: Ditto.

        * html/SearchInputType.cpp:
        (WebCore::SearchInputType::shouldRespectSpeechAttribute): Added.
        (WebCore::SearchInputType::isSearchField): Added.
        * html/SearchInputType.h: Ditto.

        * html/SubmitInputType.cpp:
        (WebCore::SubmitInputType::canBeSuccessfulSubmitButton): Added.
        (WebCore::SubmitInputType::defaultValue): Added.
        (WebCore::SubmitInputType::isSubmitButton): Added.
        (WebCore::SubmitInputType::isTextButton): Added.
        * html/SubmitInputType.h: Ditto.

        * html/TelephoneInputType.cpp:
        (WebCore::TelephoneInputType::shouldRespectSpeechAttribute): Added.
        (WebCore::TelephoneInputType::isTelephoneField): Added.
        * html/TelephoneInputType.h: Ditto.

        * html/TextFieldInputType.cpp:
        (WebCore::TextFieldInputType::shouldUseInputMethod): Added.
        (WebCore::TextFieldInputType::sanitizeValue): Added.
        (WebCore::TextFieldInputType::shouldRespectListAttribute): Added.
        * html/TextFieldInputType.h: Ditto.

        * html/TextInputType.cpp:
        (WebCore::TextInputType::canSetSuggestedValue): Added.
        (WebCore::TextInputType::shouldRespectSpeechAttribute): Added.
        * html/TextInputType.h: Ditto.

        * html/TimeInputType.cpp:
        (WebCore::TimeInputType::scaledStepValueShouldBeInteger): Fixed
        typo in the name of this function.
        * html/TimeInputType.h: Ditto.

        * html/URLInputType.cpp:
        (WebCore::URLInputType::isURLField): Added.
        * html/URLInputType.h: Ditto.

2011-01-03  Mihai Parparita  <mihaip@chromium.org>

        Unreviewed.

        NSScrollView-based scrollbars and ScrollBarTheme-based scrollbars don't look the same
        https://bugs.webkit.org/show_bug.cgi?id=51151

        Flip switch to use WebThemeEngine for Chromium/Mac scrollbar rendering,
        so that it can match Safari's (and thus use the same baselines).

        No new tests, should be covered by layout tests (which will need
        expectation changes)

        * platform/chromium/ScrollbarThemeChromiumMac.mm:

2011-01-03  Antonio Gomes  <agomes@rim.com>

        Unreviewed build fix for WebKit/Gtk+.

        RenderThemeGtk::initMediaColors() in RenderThemeGtk2.cpp needs to be
        guarded by ENABLE(VIDEO), as it is in its header.

        No new tests.

        * platform/gtk/RenderThemeGtk2.cpp:

2011-01-02  Dan Bernstein  <mitz@apple.com>

        Rubber-stamped by Simon Fraser.

        <rdar://problem/8812159> Update copyright strings

        * Info.plist:

2011-01-02  Dan Bernstein  <mitz@apple.com>

        Reviewed by Sam Weinig.

        <rdar://problem/8806570> REGRESSION (r73337): Incorrect text match count when a match occurs in a text field
        https://bugs.webkit.org/show_bug.cgi?id=51623

        * editing/Editor.cpp:
        (WebCore::Editor::countMatchesForText): Actually remember the original search range end
        container and offset and restore them when needed, instead of using two references to the
        same Range.
        * manual-tests/find-count-matches-after-text-control.html: Added.

2011-01-02  Benjamin Poulain  <benjamin.poulain@nokia.com>

        Reviewed by Csaba Osztrogonác.

        WebKit 2 does not build on 64bits with a recent GCC
        https://bugs.webkit.org/show_bug.cgi?id=51754

        Use explicitely 64 bits types for the attributes of DatabaseDetails.

        * storage/DatabaseDetails.h:
        (WebCore::DatabaseDetails::expectedUsage):
        (WebCore::DatabaseDetails::currentUsage):

2011-01-02  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed WinCE build fix for r74868.

        * platform/graphics/wince/ImageBufferWinCE.cpp:
        (WebCore::getImageData):

2011-01-02  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r74847.
        http://trac.webkit.org/changeset/74847
        https://bugs.webkit.org/show_bug.cgi?id=51803

        "Preprocessor guards should be in header files" (Requested by
        ap on #webkit).

        * bindings/js/JSDOMWindowBase.cpp:
        * dom/Document.cpp:
        (WebCore::Document::recalcStyle):
        * html/HTMLDocument.cpp:
        * loader/FrameLoader.cpp:
        * loader/ResourceLoadNotifier.cpp:
        * page/Chrome.cpp:
        * page/Console.cpp:
        * page/ContextMenuController.cpp:
        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::dispatchEvent):
        * page/EventHandler.cpp:
        * page/Page.cpp:
        * storage/Database.cpp:
        * workers/AbstractWorker.cpp:
        * workers/DefaultSharedWorkerRepository.cpp:
        * workers/SharedWorker.cpp:
        * workers/Worker.cpp:
        * workers/WorkerContext.cpp:
        * workers/WorkerMessagingProxy.cpp:
        * xml/XMLHttpRequest.cpp:
        (WebCore::XMLHttpRequest::callReadyStateChangeListener):

2011-01-02  Patrick Gansterer  <paroga@webkit.org>

        [CMake] Unreviewed build fix.

        * CMakeLists.txt:

2011-01-02  Dirk Schulze  <krit@webkit.org>

        Reviewed by Simon Fraser.

        Clarify ImageBuffer and ImageData relationship
        https://bugs.webkit.org/show_bug.cgi?id=51297

        Remove references to ImageData and CanvasPixelArray from ImageBuffer and SVG filter/masker code,
        since this was a layering violation, and replaced it by ByteArray.

        No change of functionality, so no new test added.

        * html/ImageData.cpp:
        (WebCore::ImageData::create):
        (WebCore::ImageData::ImageData):
        * html/ImageData.h: Added new constructor with ByteArray input.
        (WebCore::ImageData::width):
        (WebCore::ImageData::height):
        (WebCore::ImageData::data):
        * html/canvas/CanvasPixelArray.cpp:
        (WebCore::CanvasPixelArray::create):
        (WebCore::CanvasPixelArray::CanvasPixelArray):
        * html/canvas/CanvasPixelArray.h: New conctructor with ByteArray input, used by HTML Canvas.
        (WebCore::CanvasPixelArray::data):
        (WebCore::CanvasPixelArray::length):
        (WebCore::CanvasPixelArray::set):
        (WebCore::CanvasPixelArray::get):
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::getImageData):
        (WebCore::CanvasRenderingContext2D::putImageData):
        * platform/graphics/ImageBuffer.h:
        * platform/graphics/cairo/ImageBufferCairo.cpp:
        (WebCore::getImageData):
        (WebCore::ImageBuffer::getUnmultipliedImageData):
        (WebCore::ImageBuffer::getPremultipliedImageData):
        (WebCore::putImageData):
        (WebCore::ImageBuffer::putUnmultipliedImageData):
        (WebCore::ImageBuffer::putPremultipliedImageData):
        * platform/graphics/cg/ImageBufferCG.cpp:
        (WebCore::getImageData):
        (WebCore::ImageBuffer::getUnmultipliedImageData):
        (WebCore::ImageBuffer::getPremultipliedImageData):
        (WebCore::putImageData):
        (WebCore::ImageBuffer::putUnmultipliedImageData):
        (WebCore::ImageBuffer::putPremultipliedImageData):
        * platform/graphics/filters/FEBlend.cpp:
        (WebCore::FEBlend::apply):
        * platform/graphics/filters/FEColorMatrix.cpp:
        (WebCore::FEColorMatrix::apply):
        * platform/graphics/filters/FEComponentTransfer.cpp:
        (WebCore::FEComponentTransfer::apply):
        * platform/graphics/filters/FEComposite.cpp:
        (WebCore::FEComposite::apply):
        * platform/graphics/filters/FEConvolveMatrix.cpp:
        (WebCore::setDestinationPixels):
        (WebCore::FEConvolveMatrix::apply):
        * platform/graphics/filters/FEConvolveMatrix.h:
        * platform/graphics/filters/FEDisplacementMap.cpp:
        (WebCore::FEDisplacementMap::apply):
        * platform/graphics/filters/FEGaussianBlur.cpp:
        (WebCore::FEGaussianBlur::apply):
        * platform/graphics/filters/FELighting.cpp:
        (WebCore::FELighting::apply):
        * platform/graphics/filters/FEMorphology.cpp:
        (WebCore::FEMorphology::apply):
        * platform/graphics/filters/FETurbulence.cpp:
        (WebCore::FETurbulence::apply):
        * platform/graphics/filters/FilterEffect.cpp:
        (WebCore::FilterEffect::asImageBuffer):
        (WebCore::FilterEffect::asUnmultipliedImage):
        (WebCore::FilterEffect::asPremultipliedImage):
        (WebCore::FilterEffect::copyImageBytes):
        (WebCore::FilterEffect::copyUnmultipliedImage):
        (WebCore::FilterEffect::copyPremultipliedImage):
        (WebCore::FilterEffect::createUnmultipliedImageResult):
        (WebCore::FilterEffect::createPremultipliedImageResult):
        * platform/graphics/filters/FilterEffect.h:
        * platform/graphics/qt/ImageBufferQt.cpp:
        (WebCore::getImageData):
        (WebCore::ImageBuffer::getUnmultipliedImageData):
        (WebCore::ImageBuffer::getPremultipliedImageData):
        (WebCore::putImageData):
        (WebCore::ImageBuffer::putUnmultipliedImageData):
        (WebCore::ImageBuffer::putPremultipliedImageData):
        * platform/graphics/skia/ImageBufferSkia.cpp:
        (WebCore::getImageData):
        (WebCore::ImageBuffer::getUnmultipliedImageData):
        (WebCore::ImageBuffer::getPremultipliedImageData):
        (WebCore::putImageData):
        (WebCore::ImageBuffer::putUnmultipliedImageData):
        (WebCore::ImageBuffer::putPremultipliedImageData):
        * platform/graphics/wince/ImageBufferWinCE.cpp:
        (WebCore::getImageData):
        (WebCore::ImageBuffer::getUnmultipliedImageData):
        (WebCore::ImageBuffer::getPremultipliedImageData):
        (WebCore::putImageData):
        (WebCore::ImageBuffer::putUnmultipliedImageData):
        (WebCore::ImageBuffer::putPremultipliedImageData):
        * platform/graphics/wx/ImageBufferWx.cpp:
        (WebCore::ImageBuffer::getUnmultipliedImageData):
        (WebCore::ImageBuffer::getPremultipliedImageData):
        (WebCore::ImageBuffer::putUnmultipliedImageData):
        (WebCore::ImageBuffer::putPremultipliedImageData):
        * rendering/RenderSVGResourceMasker.cpp:
        (WebCore::RenderSVGResourceMasker::drawContentIntoMaskImage):

2011-01-01  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        Move JavaScriptCore to Source
        https://bugs.webkit.org/show_bug.cgi?id=51604

        Update references to JavaScriptCore.

        * Android.derived.jscbindings.mk:
        * Android.v8bindings.mk:
        * CMakeLists.txt:
        * WebCore.gyp/WebCore.gyp:
        * WebCore.pro:
          - These changes are subtle and might not be 100% correct.
        * move-js-headers.sh:

2011-01-01  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        forbid sandboxed frames to call top.close() when allow-same-origin is not setted
        https://bugs.webkit.org/show_bug.cgi?id=38340

        We now pass the ScriptExecutionContext to window.close so it can find
        the Frame and check whether navigation is allowed.  This check will
        almost always pass because you can only close top-level frames, but the
        check will fail when the calling script is sandboxed.

        Tests: fast/frames/sandboxed-iframe-close-top-noclose.html
               fast/frames/sandboxed-iframe-close-top.html

        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::close):
        * page/DOMWindow.h:
        * page/DOMWindow.idl:

2011-01-01  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        sandbox iframes have access to top.history methods
        https://bugs.webkit.org/show_bug.cgi?id=38152

        To enforce the sandbox restrictions on History, we need to pass the
        ScriptExecutionContext to WebCore.  This patch leaves the original
        History methods in place because they are used directly by folks who
        don't care about security checks.

        Test: fast/frames/sandboxed-iframe-history-denied.html

        * page/History.cpp:
        (WebCore::History::back):
        (WebCore::History::forward):
        (WebCore::History::go):
        * page/History.h:
        * page/History.idl:

2011-01-01  Adam Barth  <abarth@webkit.org>

        Remove empty file.

        * Android.mk:
        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * dom/DOMAllInOne.cpp:
        * dom/Entity.cpp: Removed.

2011-01-01  Adam Barth  <abarth@webkit.org>

        Remove empty file.

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/js/JSBindingsAllInOne.cpp:
        * bindings/js/JSPopStateEventCustom.cpp: Removed.

2011-01-01  Adam Barth  <abarth@webkit.org>

        Remove empty files.

        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * bindings/generic/BindingFrame.h: Removed.
        * bindings/generic/BindingLocation.h: Removed.

2011-01-01  Konstantin Tokarev  <annulen@yandex.ru>

        Reviewed by Darin Adler.

        Don't include Inspector headers when Inspector is disabled
        https://bugs.webkit.org/show_bug.cgi?id=51789

        * bindings/js/JSDOMWindowBase.cpp: Include Inspector headers when
        Inspector is enabled
        * dom/Document.cpp: Include Inspector headers when
        Inspector is enabled
        (WebCore::Document::recalcStyle): Disabled InspectorInstrumentationCookie
        handling
        * html/HTMLDocument.cpp: Include Inspector headers when
        Inspector is enabled
        * loader/FrameLoader.cpp: Include Inspector headers when
        Inspector is enabled
        * loader/ResourceLoadNotifier.cpp: Include Inspector headers when
        Inspector is enabled
        * page/Chrome.cpp: Include Inspector headers when
        Inspector is enabled
        * page/Console.cpp: Include Inspector headers when
        Inspector is enabled
        * page/ContextMenuController.cpp: Include Inspector headers when
        Inspector is enabled
        * page/DOMWindow.cpp: Include Inspector headers when
        Inspector is enabled
        (WebCore::DOMWindow::dispatchEvent): Disabled InspectorInstrumentationCookie
        handling
        * page/EventHandler.cpp: Include Inspector headers when
        Inspector is enabled
        * page/Page.cpp: Include Inspector headers when
        Inspector is enabled
        * storage/Database.cpp: Include Inspector headers when
        Inspector is enabled
        * workers/AbstractWorker.cpp: Include Inspector headers when
        Inspector is enabled
        * workers/DefaultSharedWorkerRepository.cpp: Include Inspector headers when
        Inspector is enabled
        * workers/SharedWorker.cpp: Include Inspector headers when
        Inspector is enabled
        * workers/Worker.cpp: Include Inspector headers when
        Inspector is enabled
        * workers/WorkerContext.cpp: Include Inspector headers when
        Inspector is enabled
        * workers/WorkerMessagingProxy.cpp: Include Inspector headers when
        Inspector is enabled
        * xml/XMLHttpRequest.cpp: Include Inspector headers when
        Inspector is enabled
        (WebCore::XMLHttpRequest::callReadyStateChangeListener): Disabled
        InspectorInstrumentationCookie handling

2010-12-31  Adam Barth  <abarth@webkit.org>

        Reviewed by Darin Adler.

        fast/loader/about-blank-hash-change.html fails on Chromium
        https://bugs.webkit.org/show_bug.cgi?id=51788

        I'm unable to reproduce the failure locally, so this patch is slightly
        speculative.  We need to be slighly more careful how we compare the
        fragment identifiers for Chromium because Chromium uses a URL parser
        that is more agressive about canonicalization.

        * page/Location.cpp:
        (WebCore::Location::setHash):

2010-12-31  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Use GLib/GIO API for FileSystemGtk implementation
        https://bugs.webkit.org/show_bug.cgi?id=51617

        Complete implementation of FileSystem platform code for GLib. This
        converts remaining API points using POSIX calls to platform-independent
        GLib calls and fixes other compilation errors.

        No new tests. This code will be tested when an implementation
        of beginDragWithFiles is complete.

        (WebCore::JSDirectoryEntry::getFile):
        (WebCore::JSDirectoryEntry::getDirectory):
        * platform/FileSystem.h: Added forward declarations for GLib types to
        avoid GLib includes and changed the PlatformFileHandle to be a GIOStream.
        * platform/gtk/FileSystemGtk.cpp:
        (WebCore::openTemporaryFile): Reimplement using only GLib calls.
        (WebCore::openFile): Ditto.
        (WebCore::closeFile): Ditto.
        (WebCore::seekFile): Added implementation.
        (WebCore::writeToFile): Reimplement using only GLib calls.
        (WebCore::readFromFile): Ditto.

2010-12-31  Darin Adler  <darin@apple.com>

        Reviewed by Dan Bernstein.

        Some renaming and refactoring of form element code
        https://bugs.webkit.org/show_bug.cgi?id=51784

        * bindings/js/JSHTMLSelectElementCustom.cpp:
        (WebCore::JSHTMLSelectElement::remove): Call new overload of remove
        for option elements instead of putting the logic in the binding.

        * html/HTMLButtonElement.cpp:
        (WebCore::HTMLButtonElement::HTMLButtonElement): Updated for name changes.
        (WebCore::HTMLButtonElement::defaultEventHandler): Renamed argument to
        "event" instead of "evt". Also updated for name changes.
        (WebCore::HTMLButtonElement::isActivatedSubmit): Ditto.
        (WebCore::HTMLButtonElement::setActivatedSubmit): Ditto.
        (WebCore::HTMLButtonElement::appendFormData): Ditto.
        * html/HTMLButtonElement.h: Renamed m_activeSubmit to m_isActivatedSubmit
        to match the getter function name. The name still doesn't seem great.

        * html/HTMLFormElement.cpp:
        (WebCore::HTMLFormElement::HTMLFormElement): Updated for name changes.
        (WebCore::HTMLFormElement::~HTMLFormElement): Use autoComplete function
        instead of m_autocomplete data member.
        (WebCore::HTMLFormElement::rendererIsNeeded): Use m_wasDemoted data member
        instead of otherwise-unused isDemoted function.
        (WebCore::HTMLFormElement::submitImplicitly): Updated for name changes.
        (WebCore::HTMLFormElement::validateInteractively): Removed code to clear
        m_insubmit. This is now handled by the caller, prepareForSubmission.
        (WebCore::HTMLFormElement::prepareForSubmission): Renamed. Updated for
        name changes. Moved code to clear m_isSubmittingOrPreparingForSubmission
        here from validateInteractively. Removed unneeded check of m_doingsubmit
        boolean before setting it.
        (WebCore::HTMLFormElement::submit): Factored this function into two.
        One for JavaScript and one for non-JavaScript. Neither function needs a frame
        argument, because the question being asked, anyPageIsProcessingUserGesture,
        is a question asked of an entire page group, not a specific frame or page,
        so it's not important which is the active frame.
        (WebCore::HTMLFormElement::submitFromJavaScript): Ditto.
        (WebCore::HTMLFormElement::reset): Updated for name changes.
        (WebCore::HTMLFormElement::parseMappedAttribute): Removed code to parse
        acceptAttr and got rid of code to set m_autocomplete.
        (WebCore::HTMLFormElement::elementForAlias): Changed return type to a raw
        pointer.
        (WebCore::HTMLFormElement::getNamedElements): Updated to use raw pointer
        and the vector find function. Added a FIXME about the comment.
        (WebCore::HTMLFormElement::documentDidBecomeActive): Use autoComplete
        function instead of m_autocomplete data member.
        (WebCore::HTMLFormElement::willMoveToNewOwnerDocument): Ditto.
        (WebCore::HTMLFormElement::didMoveToNewOwnerDocument): Ditto.
        (WebCore::HTMLFormElement::autoComplete): Ditto.
        * html/HTMLFormElement.h: Added a FIXME about renaming the autoComplete
        function. Renamed prepareSubmit to prepareForSubmission. Got rid of the
        frame argument from the submit function and added a new submitFromJavaScript
        variant. Removed the unneeded isDemoted function. Changed the return type
        of elementForAlias to a raw pointer. Removed m_autocomplete. Renamed
        m_insubmit to m_isSubmittingOrPreparingForSubmission, m_doingsubmit to
        m_shouldSubmit, m_inreset to m_inResetFunction, m_malformed to m_wasMalformed,
        m_demoted to m_wasDemoted. Use plain bool instead of bitfields.

        * html/HTMLFormElement.idl: Use the function named submitFromJavaScript
        instead of using CallWith=DynamicFrame because we don't need to know
        what frame is calling. If we did, it's not clear that the "dynamic"
        frame would be the right one anyway.

        * html/HTMLSelectElement.cpp:
        (WebCore::HTMLSelectElement::remove): Added an overload that takes an option
        element, since the JavaScript binding supports this.
        * html/HTMLSelectElement.h: Ditto.

        * html/ImageInputType.cpp:
        (WebCore::ImageInputType::handleDOMActivateEvent): Updated for name changes.
        * html/ImageInputType.h: Ditto.
        * html/SubmitInputType.cpp:
        (WebCore::SubmitInputType::handleDOMActivateEvent): Ditto.

2010-12-31  Daniel Bates  <dbates@rim.com>

        Reviewed by Darin Adler.

        Pass style for <area> instead of associated <img> when querying whether
        the theme draws the focus ring for an <area>
        https://bugs.webkit.org/show_bug.cgi?id=51632

        Fixes an issue where the style for the associated <img> of an <area>
        was passed when considering whether the theme should draw a focus ring
        for the <area>. Instead, we should pass the theme the style for the <area>.

        It's not possible to test this at this time since there are no themes
        that override focus ring drawing for <area>s.

        * rendering/RenderImage.cpp:
        (WebCore::RenderImage::paintFocusRing): Moved call to RenderTheme::supportsFocusRing()
        such that it's called with respect to the focused <area>.

2010-12-31  Darin Adler  <darin@apple.com>

        * WebCore.xcodeproj/project.pbxproj: Added back the language.
        Developers should be using Xcode 3.2.5 or newer.

2010-12-31  Adam Barth  <abarth@webkit.org>

        Reviewed by Eric Seidel.

        Move V8 to WebCore Location implementation
        https://bugs.webkit.org/show_bug.cgi?id=51768

        * bindings/generic/BindingFrame.h:
        * bindings/generic/BindingLocation.h:
        * bindings/v8/V8Binding.h:
        * bindings/v8/V8DOMWindowShell.cpp:
        (WebCore::V8DOMWindowShell::setLocation):
        * bindings/v8/V8Utilities.cpp:
        * bindings/v8/V8Utilities.h:
        * bindings/v8/custom/V8LocationCustom.cpp:
        (WebCore::V8Location::hashAccessorSetter):
        (WebCore::V8Location::hostAccessorSetter):
        (WebCore::V8Location::hostnameAccessorSetter):
        (WebCore::V8Location::hrefAccessorSetter):
        (WebCore::V8Location::pathnameAccessorSetter):
        (WebCore::V8Location::portAccessorSetter):
        (WebCore::V8Location::protocolAccessorSetter):
        (WebCore::V8Location::searchAccessorSetter):
        (WebCore::V8Location::reloadCallback):
        (WebCore::V8Location::replaceCallback):
        (WebCore::V8Location::assignCallback):

2010-12-31  Yi Shen  <yi.4.shen@nokia.com>

        Reviewed by Eric Seidel.

        Make retrieving extraMediaControlsStyleSheet be page dependent.
        https://bugs.webkit.org/show_bug.cgi?id=51752

        Use themeForPage to retrieve extraMediaControlsStyleSheet for media
        controls.

        No new tests because no platform-specific theme implementation uses
        the passed page pointer yet.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::styleForElement):

2010-12-31  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [REGRESSION] WebInspector.ResourcesPanel.prototype.canShowSourceLine() broken.

        https://bugs.webkit.org/show_bug.cgi?id=51709

        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel.prototype.canShowSourceLine):

2010-12-31  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed build fix after r74800.

        * bindings/js/JSDOMWindowCustom.cpp: Add missing header.
        * bindings/js/JSLocationCustom.cpp: Ditto.

2010-12-31  Adam Barth  <abarth@webkit.org>

        Rubber-stamped by Eric Seidel.

        Move HTML and XML parser benchmarks into PerformanceTests/Parser
        https://bugs.webkit.org/show_bug.cgi?id=51772

        Remove the benchmarks folder now that it's empty.  Future benchmarks
        should go in the PerformanceTests directory.

        * benchmarks: Removed.
        * benchmarks/parser: Removed.
        * benchmarks/parser/html-parser.html: Removed.
        * benchmarks/parser/resources: Removed.
        * benchmarks/parser/resources/html5.html: Removed.
        * benchmarks/parser/resources/runner.js: Removed.
        * benchmarks/parser/xml-parser.html: Removed.

2010-12-31  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Adam Barth.

        Add XML parser benchmark
        https://bugs.webkit.org/show_bug.cgi?id=51612

        Move the JavaScript code of html parser into a separate file to share it with xml parser.

        * benchmarks/parser/html-parser.html:
        * benchmarks/parser/resources/runner.js: Copied from WebCore/benchmarks/parser/html-parser.html.
        (runFunction):
        (run):
        (start):
        * benchmarks/parser/xml-parser.html: Copied from WebCore/benchmarks/parser/html-parser.html.

2010-12-29  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Update validation of stencil mask and ref values
        https://bugs.webkit.org/show_bug.cgi?id=50716

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::initializeNewContext): Initialize cached stencil settings.
        (WebCore::WebGLRenderingContext::drawArrays): Validate stencil settings.
        (WebCore::WebGLRenderingContext::drawElements): Ditto.
        (WebCore::WebGLRenderingContext::stencilFunc): Cache stencil settings, but generate no error.
        (WebCore::WebGLRenderingContext::stencilFuncSeparate): Ditto.
        (WebCore::WebGLRenderingContext::stencilMask): Ditto.
        (WebCore::WebGLRenderingContext::stencilMaskSeparate): Ditto.
        (WebCore::WebGLRenderingContext::validateStencilSettings): Helper function to validate stencil settings.
        * html/canvas/WebGLRenderingContext.h: Declare stencil setting members.

2010-12-30  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Fork pieces of RenderThemeGtk that will differ for GTK+ 3
        https://bugs.webkit.org/show_bug.cgi?id=51755

        Split out pieces of RenderThemeGtk into RenderThemeGtk2 and RenderThemeGtk3
        if they are going to differ between GTK+ 2.x and GTK+ 3.x. This is the preliminary
        step to landing support for the new GTK+ 3.x theming API.

        No new tests. This should not change functionality.

        * GNUmakefile.am: Add RenderThemeGtk2 and RenderThemeGtk3 to the sources list.
        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::adjustTextFieldStyle): Call the setTextInputBorders static method.
        (WebCore::RenderThemeGtk::adjustTextAreaStyle): Ditto.
        (WebCore::RenderThemeGtk::paintMediaButton): Ditto.
        (WebCore::RenderThemeGtk::adjustProgressBarStyle): ditto.
        * platform/gtk/RenderThemeGtk.h: Make setTextInputBorders a method, so that
        it can be exist in RenderThemeGtk{2,3} and be called from RenderThemeGtk.
        * platform/gtk/RenderThemeGtk2.cpp: Added. A fork of the bits of RenderThemeGtk
        that will eventually be platform-dependent.
        * platform/gtk/RenderThemeGtk3.cpp: Added. Ditto.

2010-12-30  Justin Schuh  <jschuh@chromium.org>

        Reviewed by James Robinson.

        Reverting r74292 because it introduced a crash with ruby text.
        https://bugs.webkit.org/show_bug.cgi?id=51637

        Test: fast/css/counters/counter-ruby-text-cleared.html

        * rendering/RenderCounter.cpp:
        (WebCore::findPlaceForCounter):
        * rendering/RenderObject.cpp:
        (WebCore::RenderObject::addChild):
        * rendering/RenderObjectChildList.cpp:
        (WebCore::RenderObjectChildList::appendChildNode):
        (WebCore::RenderObjectChildList::insertChildNode):

2010-12-30  Darin Adler  <darin@apple.com>

        Reviewed by David Kilzer.

        Remove unused JSBinding source files
        https://bugs.webkit.org/show_bug.cgi?id=51762

        * bindings/js/JSBinding.h: Removed.
        * bindings/js/specialization: Removed.
        * bindings/js/specialization/JSBindingState.cpp: Removed.
        * bindings/js/specialization/JSBindingState.h: Removed.

        * CMakeLists.txt: Removed references to files.
        * GNUmakefile.am: Ditto.
        * WebCore.gypi: Ditto.
        * WebCore.pro: Ditto.
        * WebCore.vcproj/WebCore.vcproj: Ditto.
        * bindings/js/JSBindingsAllInOne.cpp: Ditto.

2010-12-30  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Darin Adler.

        Remove Document.h include from some headers where it isn't necessary
        https://bugs.webkit.org/show_bug.cgi?id=51730

        No new tests because no new functionality.

        * editing/EditingStyle.cpp:
        * editing/EditingStyle.h:
        * editing/SelectionController.h:
        * editing/visible_units.h:
        * html/HTMLAudioElement.h:
        * html/HTMLBodyElement.h:
        * inspector/InspectorCSSAgent.h:
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorInstrumentation.h:
        * xml/DOMParser.cpp:
        * xml/DOMParser.h:
        (WebCore::DOMParser::create):
        (WebCore::DOMParser::DOMParser):

2010-12-30  Benjamin C Meyer  <bmeyer@rim.com>

        Reviewed by Darin Adler.

        bindings/js/JSDesktopNotificationsCustom.cpp is not included in the cmake build
        which is required when NOTIFICATIONS is enabled.

        https://bugs.webkit.org/show_bug.cgi?id=51761

        * CMakeLists.txt:

2010-12-30  Antti Koivisto  <antti@apple.com>

        Not reviewed.

        Revert accidental project file change.

        * WebCore.xcodeproj/project.pbxproj:

2010-12-30  Antti Koivisto  <antti@apple.com>

        Reviewed by Darin Adler.

        https://bugs.webkit.org/show_bug.cgi?id=51134
        Move loading related code from MemoryCache to CachedResourceLoader

        - Merge MemoryCache::requestResource to CachedResourceLoader::requestResource
        - Merge MemoryCache::requestUserCSSStyleSheet to CachedResourceLoader::requestUserCSSStyleSheet
        - Move MemoryCache::revalidateResource to CachedResourceLoader::revalidateResource
        - Add MemoryCache::add
        - Refactor the decision on whether to reload, revalidate or use the existing resource to 
          a single function, CachedResourceLoader::determineRevalidationPolicy

        * css/CSSImageValue.cpp:
        (WebCore::CSSImageValue::cachedImage):
            
            Remove a code path that called MemoryCache::requestResource directly. This code path would have crashed
            if ever taken (since it passes null CachedResourceLoader pointer).
            
        * loader/ImageLoader.cpp:
        (WebCore::ImageLoader::updateFromElement):
        * loader/cache/CachedImage.cpp:
        * loader/cache/CachedResource.cpp:
        (WebCore::CachedResource::CachedResource):
        (WebCore::CachedResource::~CachedResource):
        (WebCore::CachedResource::mustRevalidateDueToCacheHeaders):
        
            Moved tests that were not about cache headers to CachedResourceLoader::determineRevalidationPolicy and renamed.
        
        (WebCore::CachedResource::setLoadPriority):
        
            Check for Unresolved value before setting.
        
        * loader/cache/CachedResource.h:
        (WebCore::CachedResource::setOwningCachedResourceLoader):
        
            Rename to be bit less mysterious.
        
        * loader/cache/CachedResourceLoader.cpp:
        (WebCore::createResource):
        
            This was moved from MemoryCache.
        
        (WebCore::CachedResourceLoader::~CachedResourceLoader):
        (WebCore::CachedResourceLoader::determineRevalidationPolicy):
        (WebCore::CachedResourceLoader::requestUserCSSStyleSheet):
        
            This was moved/merged from MemoryCache.
        
        (WebCore::CachedResourceLoader::canRequest):
        (WebCore::CachedResourceLoader::requestResource):
        
            This combines MemoryCache::requestResource and the existing method.
        
        (WebCore::CachedResourceLoader::revalidateResource):
        
            This was moved from MemoryCache.
        
        (WebCore::CachedResourceLoader::loadResource):
        
            New method for initiating loading.
        
        (WebCore::CachedResourceLoader::notifyLoadedFromMemoryCache):
        
            Renamed the mysterious CachedResourceLoader::checkCacheObjectStatus
        
        * loader/cache/CachedResourceLoader.h:
        * loader/cache/MemoryCache.cpp:
        (WebCore::MemoryCache::add):
        * loader/cache/MemoryCache.h:
        (WebCore::MemoryCache::remove):

2010-12-30  Steve Block  <steveblock@google.com>

        Reviewed by Gavin Barraclough.

        Enable JSC Rich Source Info for Android even when Inspector and Debugger are disabled
        https://bugs.webkit.org/show_bug.cgi?id=51740

        This is a policy decision for Android.

        No new tests, simply enabling existing, tested code on Android.

        * bindings/js/JSDOMWindowBase.cpp:
        (WebCore::JSDOMWindowBase::supportsRichSourceInfo):

2010-12-30  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Adam Barth.

        REGRESSION: fast/dom/cssTarget-crash.html fails
        https://bugs.webkit.org/show_bug.cgi?id=20342

        Do not reload the page when submitting a form, using "GET" method, and the
        form action url matches the location url, except for the fragment.
      
        Test: fast/forms/submit-change-fragment.html

        * loader/FrameLoader.cpp:
        (WebCore::FrameLoader::loadURL):
        (WebCore::FrameLoader::loadWithDocumentLoader):
        (WebCore::FrameLoader::shouldScrollToAnchor):
        * loader/FrameLoader.h:

2010-12-30  Darin Adler  <darin@apple.com>

        Reviewed by Adam Barth.

        Move security logic out of the JavaScript binding for location into the DOM class
        https://bugs.webkit.org/show_bug.cgi?id=51714

        * WebCore.xcodeproj/project.pbxproj: Removed JSBindingState.cpp, JSBindingState.h,
        and JSBinding.h. Later, we'll remove them from other project files and delete
        the source files.

        * bindings/js/JSBinding.h: Emptied out, marked for later deletion.

        * bindings/js/JSDOMBinding.cpp: Removed unused overload of the jsOwnedStringOrNull
        function, unused shouldAllowNavigation function, unused allowSettingSrcToJavascriptURL
        function, unused toLexicalFrame function, unused completeURL function, unused
        getCachedDOMStructure and cacheDOMStructure overloads, and unused
        getCachedDOMConstructor and cacheDOMConstruction functions.
        (WebCore::activeDOMWindow): Added.
        (WebCore::firstDOMWindow): Added.
        (WebCore::toDynamicFrame): Changed to use firstDOMWindow instead of calling through
        JSBindingState, since the latter is an unneeded abstraction.
        (WebCore::processingUserGesture): Changed to call ScriptController's function
        rather than calling through JSBindingState, which is an unneeded abstraction

        * bindings/js/JSDOMBinding.h: Removed the functions mentioned above. Added
        activeDOMWindow and firstDOMWindow. Also added a FIXME for the extremely poorly
        named allowsAccessFromFrame functions, which answer the question of whether
        script is allowed access *to* a frame.

        * bindings/js/JSDOMWindowCustom.cpp: Removed many unneeded includes.
        (WebCore::JSDOMWindow::setLocation): Streamlined by using the new
        activeDOMWindow and firstDOMWindow functions.
        (WebCore::JSDOMWindow::open): Ditto.
        (WebCore::JSDOMWindow::showModalDialog): Ditto.
        (WebCore::JSDOMWindow::postMessage): Ditto.

        * bindings/js/JSLocationCustom.cpp:
        (WebCore::JSLocation::setHref): Changed to pass the active and first windows through
        to the Location::setHref function, with it doing the rest of the work. This moves
        work out of the DOM binding that belongs in the DOM itself. Eventually such functions
        could even be automatically generated by the bindings script.
        (WebCore::JSLocation::setProtocol): Ditto.
        (WebCore::JSLocation::setHost): Ditto.
        (WebCore::JSLocation::setHostname): Ditto.
        (WebCore::JSLocation::setPort): Ditto.
        (WebCore::JSLocation::setPathname): Ditto.
        (WebCore::JSLocation::setSearch): Ditto.
        (WebCore::JSLocation::setHash): Ditto.
        (WebCore::JSLocation::replace): Ditto.
        (WebCore::JSLocation::reload): Ditto.
        (WebCore::JSLocation::assign): Ditto.

        * bindings/js/specialization/JSBindingState.cpp: Emptied out, marked for later deletion.
        * bindings/js/specialization/JSBindingState.h: Emptied out, marked for later deletion.

        * page/DOMWindow.cpp:
        (WebCore::DOMWindow::setLocation): Added a SetLocationLocking argument that allows us
        to use this function for Location::replace, which is the same as setLocation except that
        it locks both history and the back/forward list.
        * page/DOMWindow.h: Ditto.

        * page/Location.cpp:
        (WebCore::Location::setHref): Added. Uses DOMWindow::setLocation so that the security
        logic there does not have to be repeated or even refactored.
        (WebCore::Location::setProtocol): Ditto.
        (WebCore::Location::setHost): Ditto.
        (WebCore::Location::setHostname): Ditto.
        (WebCore::Location::setPort): Ditto.
        (WebCore::Location::setPathname): Ditto.
        (WebCore::Location::setSearch): Ditto.
        (WebCore::Location::setHash): Ditto.
        (WebCore::Location::assign): Ditto.
        (WebCore::Location::replace): Ditto.
        (WebCore::Location::reload): Added. Security logic was refactored from the code in
        JSLocationCustom.cpp. Added a FIXME about the fact that this security logic seems
        possibly unneeded.

        * page/Location.h: Fixed indentation on the whole file. Added the new functions above.
        (WebCore::Location::create):
        (WebCore::Location::frame):

2010-12-30  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: Pasting a style property with value should automatically split it into prop/value
        https://bugs.webkit.org/show_bug.cgi?id=51581

        The "paste" DOM event is handled for the CSS property name field to parse out the name and value parts
        of a CSS property being pasted (by the first ':' found). The property is committed (if not a new one),
        and the edit focus is transferred to the value field.

        * inspector/front-end/StylesSidebarPane.js:
        (WebInspector.StylePropertyTreeElement.prototype.selectElement):
        (WebInspector.StylePropertyTreeElement.prototype):
        * inspector/front-end/inspector.js:
        (WebInspector.completeURL): Drive-by: return full URLs as-is.
        (WebInspector.startEditing.cleanUpAfterEditing):
        (WebInspector.startEditing):
        (WebInspector.startEditing.pasteEventListener):
        (WebInspector.startEditing.keyDownEventListener):

2010-12-30  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: breakpoint is not disabled when clicking on breakpoints sidebar pane checkbox.
        https://bugs.webkit.org/show_bug.cgi?id=51745

        * inspector/front-end/Breakpoint.js:
        (WebInspector.Breakpoint.prototype.set enabled):

2010-12-30  Pavel Podivilov  <podivilov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: call stack shows "Paused on a JavaScript breakpoint" when stepping.
        https://bugs.webkit.org/show_bug.cgi?id=51748

        * inspector/front-end/CallStackSidebarPane.js:
        (WebInspector.CallStackSidebarPane.prototype.update):
        (WebInspector.CallStackSidebarPane.prototype.registerShortcuts):
        (WebInspector.CallStackSidebarPane.prototype._scriptBreakpointHit):
        (WebInspector.CallStackSidebarPane.prototype._nativeBreakpointHit):

2010-12-30  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Pavel Feldman.

        Fix leak of MemoryInfo wrappers introduced in r57004 (see issue 51712).

        https://bugs.webkit.org/show_bug.cgi?id=51713

        * WebCore.gypi:
        * WebCore.pro:
        * bindings/v8/custom/V8ConsoleCustom.cpp:
        (WebCore::V8Console::memoryAccessorGetter):
        * bindings/v8/custom/V8PerformanceCustom.cpp: Copied from V8ConsoleCustom.cpp.
        (WebCore::V8Performance::memoryAccessorGetter):
        * page/Console.idl:
        * page/Performance.idl:

2010-12-30  Steve Block  <steveblock@google.com>

        Reviewed by Sam Weinig.

        Visiting macnn.com often causes SQL spew via geolocation database
        https://bugs.webkit.org/show_bug.cgi?id=51557

        If the Geolocation position cache database path has not been set, early-out
        rather than using an empty path and thus failing to open the database.
        This avoids SQL log spew.

        Also, avoid starting the database thread until the path has been set, and
        shorten the thread name to avoid warnings due to exceeding 30 characters.

        No new tests, implementation clean-up only.

        * page/GeolocationPositionCache.cpp:
        (WebCore::GeolocationPositionCache::addUser):
        (WebCore::GeolocationPositionCache::removeUser):
        (WebCore::GeolocationPositionCache::setDatabasePath):
        (WebCore::GeolocationPositionCache::startBackgroundThread):

2010-12-29  Philippe Normand  <pnormand@igalia.com>

        Reviewed by Martin Robinson.

        [GTK] minimal build fails at link time due to missing sqlite3 symbols
        https://bugs.webkit.org/show_bug.cgi?id=51327

        Guard the code calling sqlite3 with the ENABLE(DATABASE) check.

        No new tests, build fix only.

        * platform/sql/SQLiteAuthorizer.cpp:
        * platform/sql/SQLiteDatabase.cpp:
        * platform/sql/SQLiteFileSystem.cpp:
        * platform/sql/SQLiteStatement.cpp:
        * platform/sql/SQLiteTransaction.cpp:

2010-12-30  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Dirk Schulze.

        Prevent stringToLengthType() from skipping past end-of-string on invalid length unit. 
        https://bugs.webkit.org/show_bug.cgi?id=51692

        * svg/SVGLength.cpp:
        (WebCore::stringToLengthType):
        (WebCore::SVGLength::setValueAsString):

2010-12-30  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Eric Seidel.

        Create a helper function for finding descendent video elements for a node.
        https://bugs.webkit.org/show_bug.cgi?id=51696

        Test: media/video-element-other-namespace-crash.html

        * html/MediaDocument.cpp:
        (WebCore::descendentVideoElement): helper function.
        (WebCore::MediaDocument::defaultEventHandler): use the new helper function. fix code repetitions.
        (WebCore::MediaDocument::replaceMediaElementTimerFired): use the new helper function.

2010-12-29  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: extract Database & DOM Storage agents; remove InspectorBackend.
        https://bugs.webkit.org/show_bug.cgi?id=51707

        This change brushes up storage agents + removes redundant InspectorBackend class.

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::databaseForId):
        (WebCore::InjectedScriptHost::selectDatabase):
        (WebCore::InjectedScriptHost::selectDOMStorage):
        (WebCore::InjectedScriptHost::inspectorDOMAgent):
        * inspector/Inspector.idl:
        * inspector/InspectorBackend.cpp: Removed.
        * inspector/InspectorBackend.h: Removed.
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::~InspectorController):
        (WebCore::InspectorController::connectFrontend):
        (WebCore::InspectorController::releaseFrontendLifetimeAgents):
        (WebCore::InspectorController::didUseDOMStorage):
        (WebCore::InspectorController::setInjectedScriptSource):
        (WebCore::InspectorController::dispatchOnInjectedScript):
        (WebCore::InspectorController::releaseWrapperObjectGroup):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMStorageAgent.cpp: Added.
        (WebCore::InspectorDOMStorageAgent::~InspectorDOMStorageAgent):
        (WebCore::InspectorDOMStorageAgent::getDOMStorageEntries):
        (WebCore::InspectorDOMStorageAgent::setDOMStorageItem):
        (WebCore::InspectorDOMStorageAgent::removeDOMStorageItem):
        (WebCore::InspectorDOMStorageAgent::selectDOMStorage):
        (WebCore::InspectorDOMStorageAgent::InspectorDOMStorageAgent):
        (WebCore::InspectorDOMStorageAgent::getDOMStorageResourceForId):
        * inspector/InspectorDOMStorageAgent.h: Copied from WebCore/inspector/InspectorStorageAgent.h.
        (WebCore::InspectorDOMStorageAgent::create):
        (WebCore::InspectorDOMStorageAgent::frontend):
        * inspector/InspectorDatabaseAgent.cpp: Renamed from WebCore/inspector/InspectorStorageAgent.cpp.
        (WebCore::InspectorDatabaseAgent::~InspectorDatabaseAgent):
        (WebCore::InspectorDatabaseAgent::getDatabaseTableNames):
        (WebCore::InspectorDatabaseAgent::executeSQL):
        (WebCore::InspectorDatabaseAgent::databaseForId):
        (WebCore::InspectorDatabaseAgent::selectDatabase):
        (WebCore::InspectorDatabaseAgent::clearFrontend):
        (WebCore::InspectorDatabaseAgent::InspectorDatabaseAgent):
        * inspector/InspectorDatabaseAgent.h: Renamed from WebCore/inspector/InspectorStorageAgent.h.
        (WebCore::InspectorDatabaseAgent::create):
        (WebCore::InspectorDatabaseAgent::frontend):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.show):
        (WebInspector.ScriptsPanel.prototype.attachDebuggerWhenShown):
        (WebInspector.ScriptsPanel.prototype._toggleDebugging):

2010-12-29  Dirk Schulze  <krit@webkit.org>

        Reviewed by Darin Adler.

        Cleanup SVG code according to the webkit style rules 3
        https://bugs.webkit.org/show_bug.cgi?id=51490

        Last patch to fix indention and other style issues according to the WebKit style rules in the SVG code.
        Just one file can't be fixed for check-webkit-style.
        * SVGAllInOne.cpp: check-webkit-style wants a config.h at the beginning

        No changes of functionality, so no new tests. 

        * svg/SVGAllInOne.cpp:
        * svg/SVGImage.cpp:
        * svg/SVGLength.cpp:
        (WebCore::SVGLength::setValue):
        * svg/SVGPolygonElement.h:
        * svg/SVGPolylineElement.h:
        * svg/SVGPreserveAspectRatio.cpp:
        (WebCore::SVGPreserveAspectRatio::parsePreserveAspectRatio):
        (WebCore::SVGPreserveAspectRatio::transformRect):
        * svg/SVGSVGElement.cpp:
        (WebCore::SVGSVGElement::viewport):
        * svg/SVGSetElement.h:
        * svg/SVGStylable.h:
        (WebCore::SVGStylable::~SVGStylable):
        * svg/SVGStyledLocatableElement.h:
        (WebCore::SVGStyledLocatableElement::localCoordinateSpaceTransform):
        (WebCore::SVGStyledLocatableElement::isStyledLocatable):
        * svg/SVGStyledTransformableElement.cpp:
        (WebCore::SVGStyledTransformableElement::isKnownAttribute):
        * svg/SVGSwitchElement.cpp:
        (WebCore::SVGSwitchElement::childShouldCreateRenderer):
        * svg/SVGTests.cpp:
        (WebCore::SVGTests::parseMappedAttribute):
        * svg/SVGTextContentElement.cpp:
        (WebCore::SVGTextContentElement::isKnownAttribute):
        * svg/SVGTextPathElement.cpp:
        * svg/SVGTextPathElement.h:
        * svg/SVGTitleElement.h:
        (WebCore::SVGTitleElement::rendererIsNeeded):
        * svg/SVGTransformDistance.cpp:
        (WebCore::SVGTransformDistance::SVGTransformDistance):
        (WebCore::SVGTransformDistance::scaledDistance):
        (WebCore::SVGTransformDistance::addSVGTransforms):
        (WebCore::SVGTransformDistance::addSVGTransform):
        (WebCore::SVGTransformDistance::addToSVGTransform):
        (WebCore::SVGTransformDistance::isZero):
        * svg/SVGTransformList.cpp:
        * svg/SVGURIReference.cpp:
        (WebCore::SVGURIReference::getTarget):
        * svg/SVGVKernElement.h:
        * svg/SVGViewSpec.cpp:
        (WebCore::SVGViewSpec::parseViewSpec):
        * svg/SVGZoomAndPan.h:
        (WebCore::SVGZoomAndPan::SVGZoomAndPan):
        (WebCore::SVGZoomAndPan::~SVGZoomAndPan):
        (WebCore::SVGZoomAndPan::zoomAndPan):
        * svg/SVGZoomEvent.h:
        (WebCore::SVGZoomEvent::create):
        * svg/animation/SMILTime.cpp:
        (WebCore::operator*):
        * svg/animation/SMILTime.h:
        (WebCore::SMILTime::SMILTime):
        (WebCore::SMILTime::unresolved):
        (WebCore::SMILTime::indefinite):
        (WebCore::SMILTime::operator=):
        (WebCore::SMILTime::value):
        (WebCore::SMILTime::isFinite):
        (WebCore::SMILTime::isIndefinite):
        (WebCore::SMILTime::isUnresolved):
        (WebCore::operator==):
        (WebCore::operator!): new operator checks for 0 or infinite values.
        (WebCore::operator!=):
        (WebCore::operator>):
        (WebCore::operator<):
        (WebCore::operator>=):
        (WebCore::operator<=):
        * svg/animation/SMILTimeContainer.h:
        (WebCore::SMILTimeContainer::create):
        (WebCore::SMILTimeContainer::setDocumentOrderIndexesDirty):
        * svg/animation/SVGSMILElement.cpp:
        (WebCore::ConditionEventListener::operator==):
        (WebCore::SVGSMILElement::repeatingDuration):
        (WebCore::SVGSMILElement::resolveInterval):
        (WebCore::SVGSMILElement::calculateAnimationPercentAndRepeat):
        * svg/animation/SVGSMILElement.h:
        (WebCore::SVGSMILElement::timeContainer):
        (WebCore::SVGSMILElement::intervalBegin):
        (WebCore::SVGSMILElement::intervalEnd):
        (WebCore::SVGSMILElement::previousIntervalBegin):
        (WebCore::SVGSMILElement::documentOrderIndex):
        (WebCore::SVGSMILElement::setDocumentOrderIndex):
        * svg/graphics/SVGImage.h:
        (WebCore::SVGImage::create):
        (WebCore::SVGImage::destroyDecodedData):
        (WebCore::SVGImage::decodedSize):
        (WebCore::SVGImage::frameAtIndex):
        * svg/graphics/filters/SVGFilterBuilder.h:
        (WebCore::SVGFilterBuilder::create):
        (WebCore::SVGFilterBuilder::lastEffect):
        (WebCore::SVGFilterBuilder::getEffectReferences):
        (WebCore::SVGFilterBuilder::addBuiltinEffects):

2010-12-29  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Darin Adler.

        ASSERT(oldchild->parent() == owner) fails.
        https://bugs.webkit.org/show_bug.cgi?id=50480

        In RenderBlock removeChild function, when the inlineChildrenBlock(equal to prev or next)
        is reparented to blockChildrenBlock, it is no longer a child of "this". This causes the
        assertion failure when removeChildNode executes on the child(equal to prev or next).
        Fix a typo in canMergeContiguousAnonymousBlocks.

        Test: fast/multicol/span/double-merge-anonymous-block-crash.html

        * rendering/RenderBlock.cpp:
        (WebCore::canMergeContiguousAnonymousBlocks): fix typo, change prev to next.
        (WebCore::RenderBlock::removeChild): if prev or not is reparented, then set it to zero.

2010-12-29  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Darin Adler.

        Check SVG element type in FrameView::scrollToAnchor
        https://bugs.webkit.org/show_bug.cgi?id=51718

        Test: svg/custom/scroll-to-anchor-in-symbol.svg

        * page/FrameView.cpp:
        (WebCore::FrameView::scrollToAnchor):

2010-12-29  Anton Muhin  <antonm@chromium.org>

        Reviewed by Eric Seidel.

        [v8] Minor cleanup: remove unused method (the only method which can mutate context of V8DOMWindowShell)
        https://bugs.webkit.org/show_bug.cgi?id=51704

        * bindings/v8/V8DOMWindowShell.cpp:
        * bindings/v8/V8DOMWindowShell.h:

2010-12-29  Kenichi Ishibashi  <bashi@google.com>

        Reviewed by Darin Adler.

        Use a HashMap for m_continuation to save memory
        https://bugs.webkit.org/show_bug.cgi?id=43716

        Saving memory consumption by applying a HashMap convention to
        continuation pointers of RenderInline and RenderBlock classes.

        * rendering/RenderBlock.cpp: Removed m_continuation.
        (WebCore::RenderBlock::RenderBlock):
        (WebCore::RenderBlock::destroy):
        (WebCore::RenderBlock::inlineElementContinuation):
        (WebCore::RenderBlock::blockElementContinuation):
        * rendering/RenderBlock.h: Removed m_continuation.
        * rendering/RenderBoxModelObject.cpp: Added a hash map for continuations.
        (WebCore::RenderBoxModelObject::destroy): Added an assertion.
        (WebCore::RenderBoxModelObject::continuation): Added.
        (WebCore::RenderBoxModelObject::setContinuation): Added.
        * rendering/RenderBoxModelObject.h:
        * rendering/RenderInline.cpp: Removed m_continuation.
        (WebCore::RenderInline::RenderInline):
        (WebCore::RenderInline::destroy):
        (WebCore::RenderInline::inlineElementContinuation):
        * rendering/RenderInline.h: Removed m_continuation.

2010-12-27  Amruth Raj  <amruthraj@motorola.com> and Ravi Kasibhatla  <ravi.kasibhatla@motorola.com>

        Reviewed by Martin Robinson.

        [GTK] Enable building whatever already exists of WebKit2
        https://bugs.webkit.org/show_bug.cgi?id=37369

        No new functionality added or deleted. Only makefile change. Hence, no tests added.

        * GNUmakefile.am: Removed bindings/gobject from webcore_sources & webcore_cppflags and
        added them to WebKit/gtk/GNUmakefile.am
        * platform/network/soup/cache/webkit/soup-cache.h: Remove include <webkit/webkitdefines.h>
        and declare WEBKIT_API directly

2010-12-29  Eric Seidel  <eric@webkit.org>

        Unreviewed.

        Simplify make-hash-tools.pl
        https://bugs.webkit.org/show_bug.cgi?id=49922

        Added HashTools.h to the project file now that its not autogenerated.
        I also sorted the project file using sort-xcode-project-file

        * WebCore.xcodeproj/project.pbxproj:

2010-12-29  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: revert r74755 and 74757.

2010-12-29  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Sam Weinig.

        JSDataViewCustom.cpp gives the fastcall calling convention to functions called via C++
        https://bugs.webkit.org/show_bug.cgi?id=51722

        Remove the JSC_HOST_CALL from methods that are called from C++. JSC_HOST_CALL gives
        methods the fastcall calling convention, which leads to runtime errors when they are
        called from C++. Also remove a bit of unnecessary code duplication.

        No new tests. This is covered by fast/canvas/webgl/data-view-test.html.

        * bindings/js/JSDataViewCustom.cpp:
        (WebCore::getDataViewMember): Remove duplicated code.
        (WebCore::JSDataView::getInt8): Remove JSC_HOST_CALL.
        (WebCore::JSDataView::getUint8): Ditto.
        (WebCore::JSDataView::getFloat32): Ditto.
        (WebCore::JSDataView::getFloat64): Ditto.
        (WebCore::setDataViewMember): Remove duplicated code.
        (WebCore::JSDataView::setInt8): Remove JSC_HOST_CALL.
        (WebCore::JSDataView::setUint8): Ditto.

2010-12-29  Dan Bernstein  <mitz@apple.com>

        Reviewed by Kenneth Russel.

        A more robust fix for https://bugs.webkit.org/show_bug.cgi?id=51681

        * html/HTMLCanvasElement.cpp:
        (WebCore::HTMLCanvasElement::attach): Added. Like recalcStyle(), calls
        CanvasRenderingContext2D::updateFont() if necessary. This covers the case of a detach/
        attach-type style recalc.
        * html/HTMLCanvasElement.h:
        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::drawTextInternal): Removed the early return added in
        r74716. A font that is loading custom fonts is okay to use, as long as it is valid.
        (WebCore::CanvasRenderingContext2D::accessFont): Added a call to
        Document::updateStyleIfNeeded(). This ensures that any pending style recalc will take place
        and update the font if it is invalid.
        * platform/graphics/Font.h:
        (WebCore::Font::loadingCustomFonts): Made this private.

2010-12-29  Pavel Feldman  <pfeldman@chromium.org>

        Not reviewed: Qt build fix.

        * inspector/InspectorController.cpp:

2010-12-29  Pavel Feldman  <pfeldman@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: extract Database & DOM Storage
        agents; remove InspectorBackend.
        https://bugs.webkit.org/show_bug.cgi?id=51707

        This change brushes up storage agents + removes redundant
        InspectorBackend class.

        * CMakeLists.txt:
        * GNUmakefile.am:
        * WebCore.gypi:
        * WebCore.pro:
        * WebCore.vcproj/WebCore.vcproj:
        * WebCore.xcodeproj/project.pbxproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/InjectedScriptHost.cpp:
        (WebCore::InjectedScriptHost::databaseForId):
        (WebCore::InjectedScriptHost::selectDatabase):
        (WebCore::InjectedScriptHost::selectDOMStorage):
        (WebCore::InjectedScriptHost::inspectorDOMAgent):
        * inspector/Inspector.idl:
        * inspector/InspectorBackend.cpp: Removed.
        * inspector/InspectorBackend.h: Removed.
        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::InspectorController):
        (WebCore::InspectorController::~InspectorController):
        (WebCore::InspectorController::connectFrontend):
        (WebCore::InspectorController::releaseFrontendLifetimeAgents):
        (WebCore::InspectorController::didUseDOMStorage):
        (WebCore::InspectorController::setInjectedScriptSource):
        (WebCore::InspectorController::dispatchOnInjectedScript):
        (WebCore::InspectorController::releaseWrapperObjectGroup):
        * inspector/InspectorController.h:
        * inspector/InspectorDOMStorageAgent.cpp: Added.
        (WebCore::InspectorDOMStorageAgent::~InspectorDOMStorageAgent):
        (WebCore::InspectorDOMStorageAgent::getDOMStorageEntries):
        (WebCore::InspectorDOMStorageAgent::setDOMStorageItem):
        (WebCore::InspectorDOMStorageAgent::removeDOMStorageItem):
        (WebCore::InspectorDOMStorageAgent::selectDOMStorage):
        (WebCore::InspectorDOMStorageAgent::InspectorDOMStorageAgent):
        (WebCore::InspectorDOMStorageAgent::getDOMStorageResourceForId):
        * inspector/InspectorDOMStorageAgent.h: Copied from WebCore/inspector/InspectorStorageAgent.h.
        (WebCore::InspectorDOMStorageAgent::create):
        (WebCore::InspectorDOMStorageAgent::frontend):
        * inspector/InspectorDatabaseAgent.cpp: Renamed from WebCore/inspector/InspectorStorageAgent.cpp.
        (WebCore::InspectorDatabaseAgent::~InspectorDatabaseAgent):
        (WebCore::InspectorDatabaseAgent::getDatabaseTableNames):
        (WebCore::InspectorDatabaseAgent::executeSQL):
        (WebCore::InspectorDatabaseAgent::databaseForId):
        (WebCore::InspectorDatabaseAgent::selectDatabase):
        (WebCore::InspectorDatabaseAgent::clearFrontend):
        (WebCore::InspectorDatabaseAgent::InspectorDatabaseAgent):
        * inspector/InspectorDatabaseAgent.h: Renamed from WebCore/inspector/InspectorStorageAgent.h.
        (WebCore::InspectorDatabaseAgent::create):
        (WebCore::InspectorDatabaseAgent::frontend):
        * inspector/InspectorFrontendClientLocal.cpp:
        * inspector/InspectorFrontendClientLocal.h:
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype.show):

2010-12-29  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Eric Seidel.

        Assertion failure: element->inDocument() in AsyncScriptRunner::executeScriptSoon()
        https://bugs.webkit.org/show_bug.cgi?id=51067

        Typically when a script element is removed from the document, the cached script
        client is removed. However, during the before load event, the cached script client
        hasn't been created yet so it can't be removed.

        This patch handles that case by explicitly checking if the script element was
        removed during the beforeload event. Also, it avoids caching the Document references
        over the arbitrary script execution in the before load event.

        Test: fast/dom/HTMLScriptElement/move-in-beforeload.html
              fast/dom/HTMLScriptElement/remove-in-beforeload.html

        * dom/ScriptElement.cpp:
        (WebCore::ScriptElement::requestScript):

2010-12-29  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Element highlight tooltip displays wrong element size when zoomed in
        https://bugs.webkit.org/show_bug.cgi?id=51703

        * inspector/InspectorController.cpp:
        (WebCore::InspectorController::drawElementTitle):

2010-12-29  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Kent Tamura.

        [HTML5][Forms] Support for :in-range and :out-of-range CSS selectors
        https://bugs.webkit.org/show_bug.cgi?id=29071

        Use InputType::rangeUnderflow() and InputType::rangeOverflow()
        to determine if a control is in-range or out-of-range.

        Tests: fast/css/pseudo-in-range-invalid-value.html
               fast/css/pseudo-in-range.html
               fast/css/pseudo-out-of-range.html

        * css/CSSSelector.cpp:
        (WebCore::CSSSelector::pseudoId):
        (WebCore::nameToPseudoTypeMap):
        (WebCore::CSSSelector::extractPseudoType):
        * css/CSSSelector.h:
        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::canShareStyleWithElement):
        (WebCore::CSSStyleSelector::SelectorChecker::checkOneSelector):
        * dom/Element.h:
        (WebCore::Element::isInRange):
        (WebCore::Element::isOutOfRange):
        * html/BaseDateAndTimeInputType.cpp:
        (WebCore::BaseDateAndTimeInputType::supportsRangeLimitation):
        * html/BaseDateAndTimeInputType.h:
        * html/HTMLInputElement.cpp:
        (WebCore::HTMLInputElement::isInRange):
        (WebCore::HTMLInputElement::isOutOfRange):
        * html/HTMLInputElement.h:
        * html/InputType.cpp:
        (WebCore::InputType::supportsRangeLimitation):
        * html/InputType.h:
        * html/NumberInputType.cpp:
        (WebCore::NumberInputType::supportsRangeLimitation):
        * html/NumberInputType.h:
        * html/RangeInputType.cpp:
        (WebCore::RangeInputType::supportsRangeLimitation):
        * html/RangeInputType.h:

2010-12-29  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Eric Seidel.

        When cloning an anonymous block, make sure to set the childrenInline flag based
        on the state of the block to be cloned.
        https://bugs.webkit.org/show_bug.cgi?id=51489

        Test: fast/multicol/span/clone-anonymous-block-non-inline-child-crash.html

        * rendering/RenderBlock.cpp:
        (WebCore::RenderBlock::clone): add code to handle cloning of anonymous blocks.
        (WebCore::RenderBlock::splitBlocks): remove anonymous block creation calls since it is now handled by clone().

2010-12-29  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed build fix for WinCE after r73802.

        Reapply parts from r72585:
        Port ContextMenuWin.cpp to WinCE
        https://bugs.webkit.org/show_bug.cgi?id=48408

        * CMakeLists.txt:
        * platform/ContextMenu.h:
        * platform/win/ContextMenuWin.cpp:
        (WebCore::ContextMenu::getContextMenuItems):
        (WebCore::ContextMenu::createNativeMenuFromItems):

2010-12-29  Kent Hansen  <kent.hansen@nokia.com>

        Reviewed by Simon Hausmann.

        [Qt] Fix compilation with Qt in namespace
        https://bugs.webkit.org/show_bug.cgi?id=51701

        * platform/graphics/ContextShadow.h:
        * platform/graphics/GraphicsContext3D.h:
        * platform/network/NetworkingContext.h:
        * platform/network/qt/QtNAMThreadSafeProxy.h:
        * plugins/PluginView.h:

2010-12-28  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: A disabled style property should get enabled when edited
        https://bugs.webkit.org/show_bug.cgi?id=51679

        Test: inspector/styles-disable-then-change.html

        * inspector/front-end/CSSStyleModel.js:
        (WebInspector.CSSProperty.prototype.setText):
        (WebInspector.CSSProperty.prototype.setText.callback):

2010-12-29  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Andreas Kling.

        [CMake] Remove WebKitGenerators
        https://bugs.webkit.org/show_bug.cgi?id=50445

        * CMakeLists.txt: Pass preprocessor to generate-bindings.pl.

2010-12-28  Pratik Solanki  <psolanki@apple.com>

        Reviewed by Eric Seidel.

        https://bugs.webkit.org/show_bug.cgi?id=51522
        Use deviceRGBColorSpaceRef() instead of calling CGColorSpaceCreateDeviceRGB()

        * page/win/FrameCGWin.cpp:
        (WebCore::imageFromRect):
        * platform/graphics/cg/GradientCG.cpp:
        (WebCore::Gradient::platformGradient):
        * platform/graphics/cg/GraphicsContext3DCG.cpp:
        (WebCore::GraphicsContext3D::paintToCanvas):
        * platform/graphics/cg/ImageCG.cpp:
        (WebCore::BitmapImage::checkForSolidColor):
        * platform/graphics/gstreamer/ImageGStreamerCG.mm:
        (ImageGStreamer::ImageGStreamer):
        * platform/graphics/win/GraphicsContextCGWin.cpp:
        (WebCore::CGContextWithHDC):
        (WebCore::GraphicsContext::releaseWindowsContext):
        (WebCore::GraphicsContext::drawWindowsBitmap):
        * platform/graphics/win/ImageCGWin.cpp:
        (WebCore::BitmapImage::create):
        (WebCore::BitmapImage::getHBITMAPOfSize):
        * platform/image-decoders/cg/ImageDecoderCG.cpp:
        (WebCore::createColorSpace):
        * platform/win/DragImageCGWin.cpp:
        (WebCore::allocImage):
        (WebCore::createCgContextFromBitmap):
        * rendering/RenderThemeMac.mm:
        (WebCore::RenderThemeMac::paintMenuListButtonGradients):
        (WebCore::RenderThemeMac::paintSliderTrack):
        * rendering/RenderThemeSafari.cpp:
        (WebCore::RenderThemeSafari::paintMenuListButtonGradients):
        (WebCore::RenderThemeSafari::paintSliderTrack):

2010-12-28  Daniel Bates  <dbates@rim.com>

        Reviewed by Sam Weinig.

        Substitute // MARK: for compiler-specific #pragma mark
        https://bugs.webkit.org/show_bug.cgi?id=51657

        Fix compilation warnings about "#pragma mark" on GTK+ bots by
        substituting  "// MARK:" for "#pragma mark", which provides
        analogous code-bookmarking functionality under Xcode.

        * platform/graphics/cg/PathCG.cpp:
        * platform/graphics/mac/WebLayer.mm:

2010-12-28  Jan Erik Hanssen  <jhanssen@sencha.com>

        Reviewed by Eric Seidel.

        [Qt] GraphicsContext::getCTM() does not need to make a copy of QPainter::combinedTransform()
        https://bugs.webkit.org/show_bug.cgi?id=51687

        Use a const reference instead of a copy of QPainter::combinedTransform() 
        in GraphicsContext::getCTM()

        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::getCTM):

2010-12-28  Takashi Toyoshima  <toyoshim@google.com>

        Reviewed by Eric Seidel.

        gcc detected 'control reaches end of non-void function' with
        -finstrument-functions option.
        https://bugs.webkit.org/show_bug.cgi?id=51669

        No new tests. These fixes are trivial.

        * dom/Element.cpp:
        (WebCore::Element::childTypeAllowed):
        * inspector/InspectorResourceAgent.cpp:
        (WebCore::cachedResourceTypeString):

2010-12-28  Tony Gentilcore  <tonyg@chromium.org>

        Reviewed by Eric Seidel.

        Remove unused member of PendingScript
        https://bugs.webkit.org/show_bug.cgi?id=51684

        This was used when HTMLScriptRunner::runScript created a PendingScript
        for inline scripts. But now it just calls executeScript() directly.
        External scripts always have the minimum starting line number.

        No new tests because no changed functionality.

        * dom/PendingScript.cpp:
        (WebCore::PendingScript::releaseElementAndClear):
        * dom/PendingScript.h:
        (WebCore::PendingScript::PendingScript):
        (WebCore::PendingScript::operator=):
        * html/parser/HTMLScriptRunner.cpp:
        (WebCore::HTMLScriptRunner::sourceFromPendingScript):

2010-12-20  Antonio Gomes  <agomes@rim.com>

        Reviewed by Daniel Bates.

        Spatial Navigation: code clean up (Part VI)
        https://bugs.webkit.org/show_bug.cgi?id=50666

        No new tests needed.

        * page/FocusController.cpp:
        (WebCore::updatFocusCandidateIfNeeded): Assert renderer() and
        isElementNode() now that we are bailing out earlier in both the
        FocusCandidate constructor and FocusController::findFocusCandidateInContainer().
        * page/SpatialNavigation.h: Swapped the parameters order in canScrollInDirection
        and virtualRectForAreaElementAndDirection functions.
        (WebCore::FocusController::findFocusCandidateInContainer):
        (WebCore::FocusController::advanceFocusDirectionallyInContainer): Adjusted callsites
        of canScrollInDirection(), and added an early return if !isElementNode().
        (WebCore::FocusController::advanceFocusDirectionally): Adjusted callsite of
        virtualRectForAreaElementAndDirection();
        * page/SpatialNavigation.cpp:
        (WebCore::FocusCandidate::FocusCandidate): Assert if node is not a element node;
        (WebCore::isScrollableNode): Renamed from isScrollableContainerNode;
        (WebCore::scrollInDirection): Adjusted callsite after function name change;
        (WebCore::scrollableEnclosingBoxOrParentFrameForNodeInDi:rection): Assert if node is
        a documentNode.
        (WebCore::canScrollInDirection): Signature changed.
        (WebCore::canBeScrolledIntoView): Ditto.
        (WebCore::virtualRectForAreaElementAndDirection): Ditto.

2010-12-28  Adrienne Walker  <enne@google.com>

        Reviewed by Kenneth Russell.

        [chromium] Fix tiled compositor assertion after GPU process recovery.
        https://bugs.webkit.org/show_bug.cgi?id=51682

        After the GPU process recovers, the layer size is set to IntSize(),
        but IntRect::unite() has a special case for empty rects.  This
        behavior was causing the layer size to be too small, causing an
        out-of-bounds array access elsewhere.

        No new tests.

        * platform/graphics/chromium/LayerTilerChromium.cpp:
        (WebCore::LayerTilerChromium::growLayerToContain):

2010-12-23  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Initialize to 0 for undefined values in CopyTexImage2D
        https://bugs.webkit.org/show_bug.cgi?id=51421

        * html/canvas/WebGLFramebuffer.cpp: Track width/height/internalFormat of color buffer.
        (WebCore::WebGLFramebuffer::WebGLFramebuffer):
        (WebCore::WebGLFramebuffer::setAttachment):
        (WebCore::WebGLFramebuffer::getWidth):
        (WebCore::WebGLFramebuffer::getHeight):
        (WebCore::WebGLFramebuffer::getColorBufferFormat):
        * html/canvas/WebGLFramebuffer.h:
        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::copyTexImage2D): Initialize undefined pixels to 0.
        (WebCore::WebGLRenderingContext::copyTexSubImage2D):
        (WebCore::WebGLRenderingContext::framebufferTexture2D):
        (WebCore::WebGLRenderingContext::renderbufferStorage):
        (WebCore::WebGLRenderingContext::getBoundFramebufferWidth):
        (WebCore::WebGLRenderingContext::getBoundFramebufferHeight):
        * html/canvas/WebGLRenderingContext.h:
        * html/canvas/WebGLTexture.cpp: Track width/height/internalFormat of a texture by target/level.
        (WebCore::WebGLTexture::getInternalFormat):
        (WebCore::WebGLTexture::getWidth):
        (WebCore::WebGLTexture::getHeight):
        (WebCore::WebGLTexture::mapTargetToIndex):
        (WebCore::WebGLTexture::getLevelInfo):
        * html/canvas/WebGLTexture.h:
        (WebCore::WebGLTexture::isTexture):
        * platform/graphics/GraphicsContext3D.h: Add getInternalFramebufferSize() function.
        * platform/graphics/opengl/GraphicsContext3DOpenGL.cpp:
        (WebCore::GraphicsContext3D::getInternalFramebufferSize):
        * platform/graphics/qt/GraphicsContext3DQt.cpp:
        (WebCore::GraphicsContext3D::getInternalFramebufferSize):

2010-12-23  Zhenyao Mo  <zmo@google.com>

        Reviewed by Kenneth Russell.

        Map GLsizei to long instead of unsigned long in WebGLRenderingContext and GraphicsContext3D
        https://bugs.webkit.org/show_bug.cgi?id=39855

        * html/canvas/WebGLRenderingContext.cpp:
        (WebCore::WebGLRenderingContext::copyTexImage2D): Map GLsizei to long.
        (WebCore::WebGLRenderingContext::copyTexSubImage2D): Ditto.
        (WebCore::WebGLRenderingContext::renderbufferStorage): Ditto.
        (WebCore::WebGLRenderingContext::scissor): Ditto.
        (WebCore::WebGLRenderingContext::texImage2DBase): Ditto.
        (WebCore::WebGLRenderingContext::texImage2D): Ditto.
        (WebCore::WebGLRenderingContext::texSubImage2DBase): Ditto.
        (WebCore::WebGLRenderingContext::texSubImage2DImpl): Ditto.
        (WebCore::WebGLRenderingContext::texSubImage2D): Ditto.
        (WebCore::WebGLRenderingContext::viewport): Ditto.
        (WebCore::WebGLRenderingContext::validateSize): Check the sizes are non-negative.
        * html/canvas/WebGLRenderingContext.h:
        * html/canvas/WebGLRenderingContext.idl:

2010-12-28  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Kenneth Russell.

        Fix crash with invalid font in m_fontList by not drawing text when a custom font is in the
        process of loading.
        https://bugs.webkit.org/show_bug.cgi?id=51681

        Test: canvas/philip/tests/2d.text-custom-font-load-crash.html

        * html/canvas/CanvasRenderingContext2D.cpp:
        (WebCore::CanvasRenderingContext2D::drawTextInternal): bail out if a custom font is loading.
        * platform/graphics/Font.cpp:
        (WebCore::Font::operator==): Replace condition with new function loadingCustomFonts()
        (WebCore::Font::drawText): Replace condition with new function loadingCustomFonts()
        (WebCore::Font::drawEmphasisMarks): Replace condition with new function loadingCustomFonts()
        * platform/graphics/Font.h:
        (WebCore::Font::loadingCustomFonts): new function that returns if a custom font is loading.

2010-12-28  Dimitri Glazkov  <dglazkov@chromium.org>

        Reviewed by Eric Seidel.

        Combine setShadowRoot and clearShadowRoot into a simpler API
        https://bugs.webkit.org/show_bug.cgi?id=50971

        No change in behavior, and API is not used yet.

        * dom/Element.cpp:
        (WebCore::Element::setShadowRoot): Combined clearing and setting of
            the shadowRoot, also hooked up with setting and clearing of the
            corresponding shadowHost values.
        * dom/Element.h: renamed clearShadowRoot to removeShadowRoot and made it
            private.
        * dom/Node.h: Made shadow host-related functions public so that
            Element::setShadowRoot can access setShadowHost. It seems logical
            to make shadowHost public as well to keep the defs together.

2010-12-28  Andrey Kosyakov  <caseq@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: [Chromium] Expose extension API to select a node in WebInspector
        Do not request content for resources with non-numeric identifiers.
        https://bugs.webkit.org/show_bug.cgi?id=49727

        Test: http/tests/inspector/extensions-resources-redirect.html

        * inspector/front-end/NetworkManager.js:
        (WebInspector.NetworkManager.prototype._appendRedirect):

2010-12-28  Ilya Tikhonovsky  <loislo@chromium.org>

        Unreviewed build fix for Qt.

        ResourceTreeModel.js was added.

        * inspector/front-end/WebKit.qrc:

2010-12-28  Mikhail Naganov  <mnaganov@chromium.org>

        Reviewed by Pavel Feldman.

        [Chromium] Fix memory leak in Profiles tab concerned with heap profiles views.

        https://bugs.webkit.org/show_bug.cgi?id=51680

        * inspector/front-end/ProfilesPanel.js:
        (WebInspector.ProfilesPanel.prototype._reset):

2010-12-28  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: REGRESSION: Clicking image resource in style sidebar doesn't actually go to resource anymore
        https://bugs.webkit.org/show_bug.cgi?id=51663

        The base URI is now computed correctly for links from CSS property uri(...) values. Additionally,
        optional quotes/apostrophes and spaces are now allowed inside uri(...).

        Test: inspector/styles-url-linkify.html

        * inspector/front-end/StylesSidebarPane.js:
        (WebInspector.StylePropertyTreeElement.prototype.updateTitle.linkifyURL):
        (WebInspector.StylePropertyTreeElement.prototype.updateTitle):

2010-12-21  Ilya Tikhonovsky  <loislo@chromium.org>

        Reviewed by Pavel Feldman.

        Web Inspector: Protocol cleanup task. Introduce Network, DOMStorage and Database domains.

        Domain was changed for Resources, FileSystem etc. related methods.
        ResourcesManager was renamed to NetworkManager.
        ResourceTreeModel was extracted as separate file.
        FileSystem, Database, DOMStorage and ApplicationCache methods were
        removed from NetworkManager and added to corresponding classes.

        https://bugs.webkit.org/show_bug.cgi?id=51334

        * WebCore.gypi:
        * WebCore.vcproj/WebCore.vcproj:
        * inspector/CodeGeneratorInspector.pm:
        * inspector/Inspector.idl:
        * inspector/front-end/AuditRules.js:
        (WebInspector.AuditRules.UnusedCssRule.prototype.doRun.evalCallback.selectorsCallback):
        * inspector/front-end/CSSStyleModel.js:
        (WebInspector.CSSStyleModel.prototype._styleSheetChanged.callback):
        (WebInspector.CSSStyleModel.prototype._styleSheetChanged):
        * inspector/front-end/ConsoleView.js:
        (WebInspector.ConsoleView.prototype.addMessage):
        (WebInspector.ConsoleView.prototype.clearMessages):
        * inspector/front-end/DOMAgent.js:
        (WebInspector.ApplicationCache.updateApplicationCacheStatus):
        (WebInspector.ApplicationCache.updateNetworkState):
        * inspector/front-end/DOMStorage.js:
        (WebInspector.DOMStorage.addDOMStorage):
        (WebInspector.DOMStorage.selectDOMStorage):
        (WebInspector.DOMStorage.updateDOMStorage):
        * inspector/front-end/Database.js:
        (WebInspector.Database.prototype.executeSql):
        (WebInspector.Database.addDatabase):
        (WebInspector.Database.selectDatabase):
        (WebInspector.Database.sqlTransactionSucceeded):
        (WebInspector.Database.sqlTransactionFailed):
        * inspector/front-end/FileSystemView.js:
        (WebInspector.FileSystem.didGetFileSystemPath):
        (WebInspector.FileSystem.didGetFileSystemError):
        (WebInspector.FileSystem.didGetFileSystemDisabled):
        * inspector/front-end/NetworkItemView.js:
        (WebInspector.NetworkItemView):
        * inspector/front-end/NetworkManager.js: Added.
        (WebInspector.NetworkManager):
        (WebInspector.NetworkManager.prototype._createResource):
        (WebInspector.NetworkManager.prototype.identifierForInitialRequest):
        (WebInspector.NetworkManager.prototype.willSendRequest):
        (WebInspector.NetworkManager.prototype._updateResourceWithRequest):
        (WebInspector.NetworkManager.prototype._appendRedirect):
        (WebInspector.NetworkManager.prototype.markResourceAsCached):
        (WebInspector.NetworkManager.prototype.didReceiveResponse):
        (WebInspector.NetworkManager.prototype._updateResourceWithResponse):
        (WebInspector.NetworkManager.prototype.didReceiveContentLength):
        (WebInspector.NetworkManager.prototype.didFinishLoading):
        (WebInspector.NetworkManager.prototype.didFailLoading):
        (WebInspector.NetworkManager.prototype.didLoadResourceFromMemoryCache):
        (WebInspector.NetworkManager.prototype._updateResourceWithCachedResource):
        (WebInspector.NetworkManager.prototype.setInitialContent):
        (WebInspector.NetworkManager.prototype.didCommitLoadForFrame):
        (WebInspector.NetworkManager.prototype.frameDetachedFromParent):
        (WebInspector.NetworkManager.prototype.didCreateWebSocket):
        (WebInspector.NetworkManager.prototype.willSendWebSocketHandshakeRequest):
        (WebInspector.NetworkManager.prototype.didReceiveWebSocketHandshakeResponse):
        (WebInspector.NetworkManager.prototype.didCloseWebSocket):
        (WebInspector.NetworkManager.prototype._processCachedResources):
        (WebInspector.NetworkManager.prototype._addFramesRecursively):
        (WebInspector.NetworkManager.requestContent):
        * inspector/front-end/NetworkPanel.js:
        (WebInspector.NetworkPanel.prototype.refreshResource):
        * inspector/front-end/Resource.js:
        (WebInspector.Resource.prototype._innerRequestContent):
        * inspector/front-end/ResourceManager.js: Removed.
        * inspector/front-end/ResourceTreeModel.js: Added.
        (WebInspector.ResourceTreeModel):
        (WebInspector.ResourceTreeModel.prototype.addOrUpdateFrame):
        (WebInspector.ResourceTreeModel.prototype.didCommitLoadForFrame):
        (WebInspector.ResourceTreeModel.prototype.frameDetachedFromParent):
        (WebInspector.ResourceTreeModel.prototype._clearChildFramesAndResources):
        (WebInspector.ResourceTreeModel.prototype.addResourceToFrame):
        (WebInspector.ResourceTreeModel.prototype._clearResources):
        (WebInspector.ResourceTreeModel.prototype.forAllResources):
        (WebInspector.ResourceTreeModel.prototype.addConsoleMessage):
        (WebInspector.ResourceTreeModel.prototype.clearConsoleMessages):
        (WebInspector.ResourceTreeModel.prototype._callForFrameResources):
        (WebInspector.ResourceTreeModel.prototype.resourceForURL):
        (WebInspector.ResourceTreeModel.prototype.bindResourceURL):
        (WebInspector.ResourceTreeModel.prototype._unbindResourceURL):
        (WebInspector.ResourceTreeModel.createResource):
        * inspector/front-end/ResourceView.js:
        (WebInspector.ResourceView.createResourceView):
        (WebInspector.ResourceView.resourceViewTypeMatchesResource):
        (WebInspector.ResourceView.resourceViewForResource):
        (WebInspector.ResourceView.recreateResourceView):
        (WebInspector.ResourceView.existingResourceViewForResource):
        * inspector/front-end/ResourcesPanel.js:
        (WebInspector.ResourcesPanel.prototype.canShowSourceLine):
        (WebInspector.ResourcesPanel.prototype.showSourceLine):
        (WebInspector.ResourcesPanel.prototype.showResource):
        (WebInspector.ResourcesPanel.prototype.get searchableViews.callback):
        (WebInspector.ResourcesPanel.prototype.get searchableViews):
        (WebInspector.FrameResourceTreeElement.prototype._errorsWarningsUpdated):
        (WebInspector.FrameResourceTreeElement.prototype._contentChanged):
        * inspector/front-end/ScriptsPanel.js:
        (WebInspector.ScriptsPanel.prototype._addScript):
        (WebInspector.ScriptsPanel.prototype.reset):
        (WebInspector.ScriptsPanel.prototype._sourceFrameForResource):
        (WebInspector.ScriptsPanel.prototype._showScriptOrResource):
        * inspector/front-end/WebKit.qrc:
        * inspector/front-end/inspector.html:
        * inspector/front-end/inspector.js:
        (WebInspector.forAllResources):
        (WebInspector.resourceForURL):

2010-12-27  Helder Correia  <helder@sencha.com>

        Reviewed by Ariya Hidayat.

        ContextShadow should use AffineTransform instead of TransformationMatrix
        https://bugs.webkit.org/show_bug.cgi?id=51661

        ContextShadow needs the CTM to make sure shadows are not affected by
        transformations when drawing on a canvas. AffineTransform is sufficient
        in this case.

        Existing tests: fast/canvas/canvas*shadow*html

        * platform/graphics/ContextShadow.cpp:
        (WebCore::ContextShadow::mustUseContextShadow):
        (WebCore::ContextShadow::adjustBlurDistance):
        (WebCore::ContextShadow::calculateLayerBoundingRect):
        * platform/graphics/ContextShadow.h:
        * platform/graphics/cairo/ContextShadowCairo.cpp:
        (WebCore::ContextShadow::getTransformationMatrixFromContext):
        * platform/graphics/qt/ContextShadowQt.cpp:
        (WebCore::ContextShadow::getTransformationMatrixFromContext):

2010-12-27  Daniel Bates  <dbates@rim.com>

        Reviewed by Antonio Gomes.

        Clean up: Rename HTMLFrameElementBase::getMarginWidth() and HTMLFrameElementBase::getMarginHeight()
        https://bugs.webkit.org/show_bug.cgi?id=51634

        Rename HTMLFrameElementBase::getMarginWidth() and HTMLFrameElementBase::getMarginHeight()
        to HTMLFrameElementBase::marginWidth() and HTMLFrameElementBase::marginHeight(), respectively.
        This will make the names of these getters consistent with the naming convention we use for
        getters.

        * html/HTMLBodyElement.cpp:
        (WebCore::HTMLBodyElement::insertedIntoDocument):
        * html/HTMLFrameElementBase.h:
        (WebCore::HTMLFrameElementBase::marginWidth): Renamed; Formerly getMarginWidth().
        (WebCore::HTMLFrameElementBase::marginHeight): Renamed; Formerly getMarginHeight().
        * loader/SubframeLoader.cpp:
        (WebCore::SubframeLoader::loadSubframe):
        * page/FrameView.cpp:
        (WebCore::FrameView::init):
        * rendering/RenderEmbeddedObject.cpp:
        (WebCore::RenderEmbeddedObject::viewCleared): Also renamed variables marginw and marginh
        to marginWidth and marginHeight, respectively. This makes the names of these variables
        consistent with the names of similar variables in SubframeLoader::loadSubframe() and FrameView::init().
        * rendering/RenderFrame.cpp:
        (WebCore::RenderFrame::viewCleared): Ditto.

2010-12-27  Martin Robinson  <mrobinson@igalia.com>

        Reviewed by Daniel Bates.

        [GTK] RenderThemeGtk::m_HScale and RenderThemeGtk::m_VScale are not initialized
        https://bugs.webkit.org/show_bug.cgi?id=51654

        Properly initialize slider members of RenderThemeGtk. This can lead to test crashes
        on some debug configurations.

        No new tests. This is already covered by current slider tests. It isn't crashing on
        the bots, but it does crash locally.

        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::RenderThemeGtk): Properly initialize members.

2010-12-27  Anton Muhin  <antonm@chromium.org>

        Reviewed by David Levin.

        [v8] Remove unused methods to protect/unprotect wrappers during garbage collection
        https://bugs.webkit.org/show_bug.cgi?id=51648

        * bindings/v8/ScriptController.cpp:
        * bindings/v8/ScriptController.h:
        * bindings/v8/V8GCController.cpp:
        (WebCore::V8GCController::gcEpilogue):
        * bindings/v8/V8GCController.h:

2010-12-27  Yury Semikhatsky  <yurys@chromium.org>

        Unreviewed. Removed trailing spaces from a localized
        string to make it the same as the one used in the code.

        * English.lproj/localizedStrings.js:

2010-12-27  Yael Aharon  <yael.aharon@nokia.com>

        Reviewed by Eric Seidel.

        Browser is failing 16 baseline test from Selector API Test Suite
        https://bugs.webkit.org/show_bug.cgi?id=42968

        Throw an exception if there is no argument to querySelector or 
        querySelectorAll. This replaces the current behavior of passing the string
        "undefined" as the argument.

        No new tests, just updating the existing results for 
        fast/dom/SelectorAPI/resig-SelectorAPI-test.xhtml.

        * dom/Document.idl:
        * dom/DocumentFragment.idl:
        * dom/Element.idl:

2010-12-26  MORITA Hajime  <morrita@google.com>

        Reviewed by Dan Bernstein.

        For box-shadow, non-primary shadows should have specified radii.
        https://bugs.webkit.org/show_bug.cgi?id=51386

        On paintBoxShadow(), the spread value accidentally accumulated accidentally
        during the loop, which should be applied individually for radius of each shadow. 
        This change makes the radii for rects computed for each shadow.
        
        Test: fast/box-shadow/spread-multiple-normal.html

        * rendering/RenderBoxModelObject.cpp:
        (WebCore::RenderBoxModelObject::paintBoxShadow):

2010-12-26  Patrick Gansterer  <paroga@webkit.org>

        Reviewed by Eric Seidel.

        Improve output of HTML parser benchmark
        https://bugs.webkit.org/show_bug.cgi?id=51611

        Calculate and show median, min and max values.

        * benchmarks/parser/html-parser.html:

2010-12-26  Abhishek Arya  <inferno@chromium.org>

        Reviewed by Simon Fraser.

        Remove the bad assert in paintPaginatedChildLayer, hitTestPaginatedChildLayer. 
        https://bugs.webkit.org/show_bug.cgi?id=48772

        Test: fast/multicol/renderer-positioned-assert-crash.html

        * rendering/RenderLayer.cpp:
        (WebCore::RenderLayer::paintPaginatedChildLayer):
        (WebCore::RenderLayer::hitTestPaginatedChildLayer):

2010-12-25  Peter Rybin  <peter.rybin@gmail.com>

        Reviewed by Adam Barth.

        Adds currentColumn (and currentLine) to SegmentedString. Switches
        HTMLTreeBuilder to HTMLDocumentParser::textPosition when it
        needs position for a <script> tag.

        SegmentedString should provide column position
        https://bugs.webkit.org/show_bug.cgi?id=51311

        * html/parser/HTMLDocumentParser.cpp:
        (WebCore::HTMLDocumentParser::HTMLDocumentParser):
        (WebCore::HTMLDocumentParser::textPosition):
        * html/parser/HTMLInputStream.h:
        (WebCore::HTMLInputStream::current):
        (WebCore::InsertionPointRecord::InsertionPointRecord):
        (WebCore::InsertionPointRecord::~InsertionPointRecord):
        * html/parser/HTMLTreeBuilder.cpp:
        (WebCore::HTMLTreeBuilder::HTMLTreeBuilder):
        (WebCore::HTMLTreeBuilder::processScriptStartTag):
        * html/parser/HTMLTreeBuilder.h:
        (WebCore::HTMLTreeBuilder::create):
        * platform/text/SegmentedString.cpp:
        (WebCore::SegmentedString::operator=):
        (WebCore::SegmentedString::numberOfCharactersConsumedSlow):
        (WebCore::SegmentedString::advanceSlowCase):
        (WebCore::SegmentedString::currentLine):
        (WebCore::SegmentedString::currentColumn):
        (WebCore::SegmentedString::setCurrentPosition):
        * platform/text/SegmentedString.h:
        (WebCore::SegmentedString::SegmentedString):
        (WebCore::SegmentedString::advancePastNewline):
        (WebCore::SegmentedString::advance):
        (WebCore::SegmentedString::numberOfCharactersConsumed):

2010-12-25  Andreas Kling  <kling@webkit.org>

        Reviewed by Kenneth Rohde Christiansen.

        GraphicsContext: Don't pass StrokeStyle (enum) as const reference
        https://bugs.webkit.org/show_bug.cgi?id=51608

        * platform/graphics/GraphicsContext.cpp:
        (WebCore::GraphicsContext::setStrokeStyle):
        (WebCore::GraphicsContext::setPlatformStrokeStyle):
        (WebCore::GraphicsContext::adjustLineToPixelBoundaries):
        * platform/graphics/GraphicsContext.h:
        * platform/graphics/cairo/GraphicsContextCairo.cpp:
        (WebCore::GraphicsContext::setPlatformStrokeStyle):
        * platform/graphics/haiku/GraphicsContextHaiku.cpp:
        (WebCore::GraphicsContext::setPlatformStrokeStyle):
        * platform/graphics/openvg/GraphicsContextOpenVG.cpp:
        (WebCore::GraphicsContext::setPlatformStrokeStyle):
        * platform/graphics/openvg/PainterOpenVG.cpp:
        (WebCore::PainterOpenVG::setStrokeStyle):
        * platform/graphics/openvg/PainterOpenVG.h:
        * platform/graphics/qt/GraphicsContextQt.cpp:
        (WebCore::GraphicsContext::setPlatformStrokeStyle):
        * platform/graphics/skia/GraphicsContextSkia.cpp:
        (WebCore::GraphicsContext::setPlatformStrokeStyle):

2010-12-24  Dan Bernstein  <mitz@apple.com>

        Reviewed by Alexey Proskuryakov.

        REGRESSION (r74648): XHR layout test failures
        https://bugs.webkit.org/show_bug.cgi?id=51603

        Reverted r74648.

        * WebCore.exp.in:

2010-12-24  Dan Bernstein  <mitz@apple.com>

        Try to fix the Qt build after r74648.

        * WebCore.gypi:
        * WebCore.pro:
        * platform/network/qt/CredentialStorageQt.cpp: Added.
        (WebCore::CredentialStorage::getFromPersistentStorage):

2010-12-24  Simon Fraser  <simon.fraser@apple.com>

        Reviewed by Dan Bernstein.

        CSSStyleSelector cleanup
        https://bugs.webkit.org/show_bug.cgi?id=51597

        Make some methods const. Add assertion to checkOneSelector, with the
        intention of later removing the if (!e) check (this is hot code).

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSStyleSelector::locateCousinList):
        (WebCore::CSSStyleSelector::canShareStyleWithElement):
        (WebCore::CSSStyleSelector::locateSharedStyle):
        (WebCore::CSSStyleSelector::SelectorChecker::checkOneSelector):
        (WebCore::CSSStyleSelector::mmLength):
        (WebCore::CSSStyleSelector::inchLength):
        (WebCore::CSSStyleSelector::getColorFromPrimitiveValue):
        (WebCore::CSSStyleSelector::hasSelectorForAttribute):
        * css/CSSStyleSelector.h:
        (WebCore::CSSStyleSelector::fontSelector):

2010-12-24  Dan Bernstein  <mitz@apple.com>

        Reviewed by Anders Carlsson.

        <rdar://problem/8758386> The web process uses its own credential storage
        https://bugs.webkit.org/show_bug.cgi?id=51599

        * WebCore.exp.in: Export CredentialStorage::getFromPersistentStorage(), Credential::hasPassword(),
        and Credential::isEmpty().

2010-12-24  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Darin Adler.

        [V8] Rename V8CustomEventListener.{h,cpp} to V8EventListener.{h,cpp}
        https://bugs.webkit.org/show_bug.cgi?id=51595

        * WebCore.gypi:
        * bindings/v8/V8DOMWrapper.cpp:
        * bindings/v8/V8EventListener.cpp: Renamed from WebCore/bindings/v8/custom/V8CustomEventListener.cpp.
        (WebCore::V8EventListener::V8EventListener):
        (WebCore::V8EventListener::getListenerFunction):
        (WebCore::V8EventListener::callListenerFunction):
        * bindings/v8/V8EventListener.h: Renamed from WebCore/bindings/v8/custom/V8CustomEventListener.h.
        (WebCore::V8EventListener::create):
        * bindings/v8/V8EventListenerList.h:
        * bindings/v8/V8WorkerContextEventListener.h:
        * bindings/v8/custom/V8DOMWindowCustom.cpp:
        * bindings/v8/custom/V8LocationCustom.cpp:
        * bindings/v8/custom/V8NodeCustom.cpp:
        * bindings/v8/custom/V8NotificationCenterCustom.cpp:

2010-12-24  Carlos Garcia Campos  <cgarcia@igalia.com>

        Reviewed by Xan Lopez.

        [GTK] Show current time / total in media player
        https://bugs.webkit.org/show_bug.cgi?id=51535

        * css/mediaControlsGtk.css:
        (audio::-webkit-media-controls-current-time-display, video::-webkit-media-controls-current-time-display):
        * platform/gtk/RenderThemeGtk.cpp:
        (WebCore::RenderThemeGtk::formatMediaControlsCurrentTime):
        (WebCore::RenderThemeGtk::paintMediaCurrentTime):
        * platform/gtk/RenderThemeGtk.h:

2010-12-24  Jan Erik Hanssen  <jhanssen@sencha.com>

        Reviewed by Eric Seidel.

        Clean up CSSRuleData in CSSStyleSelector.h
        https://bugs.webkit.org/show_bug.cgi?id=27753

        Move CSSRuleData and CSSRuleDataList from CSSStyleSelector.h to the .cpp file.

        * css/CSSStyleSelector.cpp:
        (WebCore::CSSRuleData::CSSRuleData):
        (WebCore::CSSRuleData::~CSSRuleData):
        (WebCore::CSSRuleData::position):
        (WebCore::CSSRuleData::rule):
        (WebCore::CSSRuleData::selector):
        (WebCore::CSSRuleData::next):
        (WebCore::CSSRuleDataList::CSSRuleDataList):
        (WebCore::CSSRuleDataList::~CSSRuleDataList):
        (WebCore::CSSRuleDataList::first):
        (WebCore::CSSRuleDataList::last):
        (WebCore::CSSRuleDataList::append):
        * css/CSSStyleSelector.h:

2010-12-24  Yury Semikhatsky  <yurys@chromium.org>

        Unreviewed. Fix compilation on Windows.

        * inspector/InspectorStyleSheet.cpp:
        (WebCore::InspectorStyle::~InspectorStyle): added explicit empty destructor
        * inspector/InspectorStyleSheet.h:

2010-12-24  Yury Semikhatsky  <yurys@chromium.org>

        Reviewed by Darin Adler.

        inspector/debugger-step-out.html crashing intermittently in the bots
        https://bugs.webkit.org/show_bug.cgi?id=50868

        Use RefPtr rather instead of raw pointers when keeping references
        to refcounted objects.

        * inspector/InspectorCSSAgent.cpp:
        (WebCore::InspectorCSSAgent::getStylesForNode2):
        (WebCore::InspectorCSSAgent::getComputedStyleForNode2):
        * inspector/InspectorStyleSheet.cpp:
        (WebCore::InspectorStyle::create):
        (WebCore::InspectorStyle::InspectorStyle):
        (WebCore::InspectorStyle::buildObjectForStyle):
        (WebCore::InspectorStyle::setPropertyText):
        (WebCore::InspectorStyle::toggleProperty):
        (WebCore::InspectorStyle::styleText):
        (WebCore::InspectorStyle::populateAllProperties):
        (WebCore::InspectorStyle::replacePropertyInStyleText):
        (WebCore::InspectorStyleSheet::create):
        (WebCore::InspectorStyleSheet::InspectorStyleSheet):
        (WebCore::InspectorStyleSheetForInlineStyle::create):
        (WebCore::InspectorStyleSheetForInlineStyle::InspectorStyleSheetForInlineStyle):
        (WebCore::InspectorStyleSheetForInlineStyle::getStyleAttributeRanges):
        * inspector/InspectorStyleSheet.h:
        (WebCore::InspectorStyle::cssStyle):
        (WebCore::InspectorStyleSheet::pageStyleSheet):

2010-12-24  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Nikolas Zimmermann.

        SVGElementInstance::m_useElement should be cleared when use element is removed from document
        https://bugs.webkit.org/show_bug.cgi?id=51486

        Test: svg/custom/use-instanceRoot-with-use-removed.svg

        * svg/SVGElementInstance.cpp:
        (WebCore::SVGElementInstance::invalidateAllInstancesOfElement):
        * svg/SVGElementInstance.h:
        (WebCore::SVGElementInstance::clearUseElement):
        * svg/SVGUseElement.cpp:
        (WebCore::SVGUseElement::removedFromDocument):
        (WebCore::ShadowTreeUpdateBlocker::if):
        (WebCore::SVGUseElement::detachInstance):
        (WebCore::SVGUseElement::detach):
        * svg/SVGUseElement.h:

2010-12-23  Joseph Pecoraro  <joepeck@webkit.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Missing Localized Strings
        https://bugs.webkit.org/show_bug.cgi?id=51542

        Added missing strings: "WebSocket",  "Frames", "Text", "Transfer",
        "Preserve Log upon Navigation", and "Go to Line".

        * English.lproj/localizedStrings.js:

2010-12-24  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Yury Semikhatsky.

        Web Inspector: Inline HTML style property out of sync with element.style in Sidebar
        https://bugs.webkit.org/show_bug.cgi?id=51478

        Now the element attribute modifications (including "style") are tracked, which results in the
        source offsets update (in the backend) and Styles/Metrics pane updates (in the frontend)
        on the "style" attribute modification through the Elements tree. Also, it appears that
        a complete "style" attribute removal destroys the inline style declaration
        (StyledElement::m_inlineStyleDecl), while the code used to rely on it being immutable (hence a crash).

        Test: inspector/elements-delete-inline-style.html

        * inspector/InspectorCSSAgent.cpp:
        (WebCore::InspectorCSSAgent::didModifyDOMAttr):
        * inspector/InspectorCSSAgent.h:
        * inspector/InspectorDOMAgent.cpp:
        (WebCore::InspectorDOMAgent::didModifyDOMAttr):
        * inspector/InspectorDOMAgent.h:
        * inspector/InspectorStyleSheet.cpp:
        (WebCore::InspectorStyleSheetForInlineStyle::InspectorStyleSheetForInlineStyle):
        (WebCore::InspectorStyleSheetForInlineStyle::didModifyElementAttribute):
        (WebCore::InspectorStyleSheetForInlineStyle::text):
        (WebCore::InspectorStyleSheetForInlineStyle::setStyleText):
        (WebCore::InspectorStyleSheetForInlineStyle::getStyleAttributeRanges):
        * inspector/InspectorStyleSheet.h:
        * inspector/front-end/ElementsTreeOutline.js:
        (WebInspector.ElementsTreeElement.prototype._attributeEditingCommitted):

2010-12-24  Noel Gordon  <noel.gordon@gmail.com>

        Reviewed by Andreas Kling.

        [chromium] Fix a style nit in the JPEG encoder
        https://bugs.webkit.org/show_bug.cgi?id=51574

        * platform/image-encoders/skia/JPEGImageEncoder.cpp: nit begone.

2010-12-23  Alexander Pavlov  <apavlov@chromium.org>

        Reviewed by Maciej Stachowiak.

        Web Inspector: CSS shorthand properties expand unnecessarily
        https://bugs.webkit.org/show_bug.cgi?id=36304

        "border-radius" is a shorthand property that has a "non-standard" format and longhands, see
        http://www.w3.org/TR/css3-background/#border-radius for reference. CSSParser does not use the
        standard parseShorthand() or parse4Values() methods but instead a custom parseBorderRadius() method.
        This method didn't use to create a ShorthandScope instance and set the m_implicitShorthand value
        appropriately when adding implicit longhands, thus they were added as normal properties
        found in the CSS (neither implicit, nor longhands). This is now fixed.

        * css/CSSParser.cpp:
        (WebCore::CSSParser::parseBorderRadius):

2010-12-24  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Darin Adler.

        setTargetAttributeAnimatedValue should check for a null shadowTreeElement.
        https://bugs.webkit.org/show_bug.cgi?id=51576

        Disallowed elements may be pruned from the shadow tree, leaving a null
        shadowTreeElement. We should check for that before setting attributes.

        Test: svg/custom/animate-disallowed-use-element.svg

        * svg/SVGAnimationElement.cpp:
        (WebCore::SVGAnimationElement::setTargetAttributeAnimatedValue):

2010-12-24  Evan Martin  <evan@chromium.org>

        Reviewed by Darin Adler.

        TextMetrics::width is an integer, but the member is a float
        https://bugs.webkit.org/show_bug.cgi?id=51566

        Change the return type to a float.

        No tests, fixing a compiler warning.
        (I was unable to produce a difference in the values exposed to pages
        with a float versus the previous conversion to an integer.)

        * html/TextMetrics.h:
        (WebCore::TextMetrics::width):

2010-12-24  Ryuan Choi  <ryuan.choi@samsung.com>

        Reviewed by Kenneth Rohde Christiansen.

        [EFL] Add option to enable Touch Events.
        https://bugs.webkit.org/show_bug.cgi?id=49125

        Add files for EFL to support TOUCH_EVENTS.

        * CMakeLists.txt:
        * CMakeListsEfl.txt:
        * platform/PlatformTouchEvent.h: Add EFL related constructor.
        * platform/PlatformTouchPoint.h: ditto.
        * platform/efl/PlatformTouchEventEfl.cpp: Added.
        (WebCore::PlatformTouchEvent::PlatformTouchEvent):
        * platform/efl/PlatformTouchPointEfl.cpp: Added.
        (WebCore::PlatformTouchPoint::PlatformTouchPoint):

2010-12-24  Gyuyoung Kim  <gyuyoung.kim@samsung.com>

        Reviewed by Kenneth Rohde Christiansen.

        [EFL] Return an empty string instead of 'application/octet-stream' in getMIMETypeForExtension()
        https://bugs.webkit.org/show_bug.cgi?id=51457

        WebKit EFL can't play html5 audio because of wrong mime type checking.
        So, 'application/octet-stream' is changed with an empty string.

        * platform/efl/MIMETypeRegistryEfl.cpp:
        (WebCore::MIMETypeRegistry::getMIMETypeForExtension):
        Returns an empty string instead of application/octet-stream when it can't find proper mime type.

2010-12-24  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Darin Adler.

        SVGFontFaceElement::rebuildFontFace() should exit when not in document
        https://bugs.webkit.org/show_bug.cgi?id=51571

        We were hitting a NULL deref crash. Since most of the callers checked
        inDocument() anyway, I moved it into the start of rebuildFontFace.

        Test: svg/custom/use-invalid-font-face.svg

        * svg/SVGFontFaceElement.cpp:
        (WebCore::SVGFontFaceElement::parseMappedAttribute):
        (WebCore::SVGFontFaceElement::rebuildFontFace):
        (WebCore::SVGFontFaceElement::childrenChanged):

2010-12-24  Justin Schuh  <jschuh@chromium.org>

        Reviewed by Darin Adler.

        Remove unnecessary check in CSSCanvasValue::canvasDestroyed().
        https://bugs.webkit.org/show_bug.cgi?id=51564

        This check was duplicating an ASSERT for a case fixed in r73927.
        Now that the bug is fixed the check is no longer necessary.

        Removing dead code, so no new tests needed.

        * css/CSSCanvasValue.cpp:
        (WebCore::CSSCanvasValue::canvasDestroyed):

2010-12-23  Evan Martin  <evan@chromium.org>

        Reviewed by Darin Adler.

        ViewportArguments.h uses an enum to intialize a bool
        https://bugs.webkit.org/show_bug.cgi?id=50982

        Initialize userScalable to true, rather than -1.
        No tests; fixes a compiler warning.

        * dom/ViewportArguments.h:
        (WebCore::ViewportArguments::ViewportArguments):

2010-12-23  Jan Erik Hanssen  <jhanssen@sencha.com>

        Reviewed by Adam Barth.

        [Qt] User name/password stripped from URLs
        https://bugs.webkit.org/show_bug.cgi?id=36232

        If a username but no password or no username but a password is present
        in a URL, QtWebKit won't send any authentication information down to Qt
        as it should.

        Tests: http/tests/xmlhttprequest/basic-auth-nopassword.html
               http/tests/xmlhttprequest/basic-auth-nouser.html

        * platform/network/qt/ResourceHandleQt.cpp:
        (WebCore::ResourceHandle::start):
        (WebCore::ResourceHandle::loadResourceSynchronously):

2010-12-23  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Darin Adler.

        queryCommandValue("FormatBlock") does not respect editing boundaries
        https://bugs.webkit.org/show_bug.cgi?id=51219

        Fixed the bug by checking the element we found in elementForFormatBlockCommand
        does not contain the editable root.

        * editing/FormatBlockCommand.cpp:
        (WebCore::FormatBlockCommand::elementForFormatBlockCommand):

2010-12-23  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Darin Adler.

        FormatBlock doesn't preserve typing style but it should
        https://bugs.webkit.org/show_bug.cgi?id=51140

        Fixed the bug by making preserveTypingStyle return true.

        Test: editing/execCommand/format-block-typing-style.html

        * editing/FormatBlockCommand.h:
        (WebCore::FormatBlockCommand::preservesTypingStyle):

2010-12-23  Jessie Berlin  <jberlin@apple.com>

        Reviewed by Sam Weinig.

        Need WebKit2 API to create a SecurityOrigin from protocol, host, and port
        https://bugs.webkit.org/show_bug.cgi?id=51563

        Add SecurityOrigin::create(const String& protocol, const String& host, int port).

        * WebCore.exp.in:
        Export the symbols for WebCore::SecurityOrigin::create(String, String, int).

        * page/SecurityOrigin.cpp:
        (WebCore::SecurityOrigin::createFromDatabaseIdentifier):
        Use the constant MaxAllowedPort.
        (WebCore::SecurityOrigin::create):
        Sanitizing based off of that done in createFromDatabaseIdentifier.
        * page/SecurityOrigin.h:

2010-12-23  Patrick Gansterer  <paroga@webkit.org>

        Unreviewed build fix for WinCE after r73802.

        Reapply r70812:
        Port ContextMenuItemWin.cpp to WinCE
        https://bugs.webkit.org/show_bug.cgi?id=48407

        * platform/win/ContextMenuItemWin.cpp:

2010-12-23  Adam Barth  <abarth@webkit.org>

        Remove include of non-existant file.

        * bindings/v8/custom/V8DOMWindowCustom.cpp:

2010-12-23  Ryosuke Niwa  <rniwa@webkit.org>

        Reviewed by Darin Adler.

        Selection becomes stale when CharacterData is manipulated directly
        https://bugs.webkit.org/show_bug.cgi?id=51389

        The bug was caused by SelectionController's not adjusting selection when CharacterData's
        m_data is modified by its API.

        Fixed the bug by adding textWillBeReplaced to SelectionController and calling it in
        CharacterData::textWillBeReplaced. Added newLength to setDataAndUpdate, which is passed to
        textWillBeReplaced because inserting, replacing, or removing data may require moving
        the offset of the selection end points (done by shouldRemovePositionAfterAdoptingTextReplacement).

        Also fixed the condition for determining whether or not a node intersects the selection
        in respondToNodeModification, which is extracted from nodeWillBeRemoved. The old condition
        failed to recognize certain cases when selection started and ended with non-zero offsets.

        Tests: editing/selection/character-data-mutation-crash.html
               editing/selection/character-data-mutation.html

        * dom/CharacterData.cpp:
        (WebCore::CharacterData::setData): Passes newLegnth to setDataAndUpdate.
        (WebCore::CharacterData::appendData): Ditto.
        (WebCore::CharacterData::insertData): Ditto.
        (WebCore::CharacterData::deleteData): Ditto.
        (WebCore::CharacterData::replaceData): Ditto.
        (WebCore::CharacterData::setDataAndUpdate): Added newLegnth to the argument list,
        and renamed lengthOfReplacedData to oldLength; calls textWillBeReplaced.
        * dom/CharacterData.h:
        * editing/SelectionController.cpp:
        (WebCore::removingNodeRemovesPosition): Removed indentations from blank lines.
        (WebCore::SelectionController::nodeWillBeRemoved): Calls nodeWillBeRemoved.
        (WebCore::SelectionController::respondToNodeModification): Extracted from nodeWillBeRemoved;
        fixed the logic to figure out whether a node is inside the range or not.
        (WebCore::shouldRemovePositionAfterAdoptingTextReplacement): Added.
        (WebCore::SelectionController::textWillBeReplaced): Added.
        * editing/SelectionController.h:

2010-12-23  Adam Barth  <abarth@webkit.org>

        Reviewed by Darin Adler.

        Remove unneeded V8 bindings files
        https://bugs.webkit.org/show_bug.cgi?id=51570

        * WebCore.gypi:
        * bindings/generic/BindingDOMWindow.h: Removed.
        * bindings/v8/specialization/V8BindingDOMWindow.h: Removed.

2010-12-23  Dan Bernstein  <mitz@apple.com>

        Build fix.

        * editing/EditorCommand.cpp:
        (WebCore::enabledDismissCorrectionPanel):

2010-12-23  Darin Adler  <darin@apple.com>

        Try to fix crash seen on GTK bot.

        * editing/EditorCommand.cpp:
        (WebCore::internalCommand): Add back empty string check I accidentally deleted in r74580.

        * WebCore.xcodeproj/project.pbxproj: Let Xcode edit the file.

2010-12-23  Sheriff Bot  <webkit.review.bot@gmail.com>

        Unreviewed, rolling out r74561.
        http://trac.webkit.org/changeset/74561
        https://bugs.webkit.org/show_bug.cgi?id=51565

        "Broke Chromium UI tests on Vista" (Requested by kbr_google on
        #webkit).

        * platform/graphics/chromium/ImageLayerChromium.cpp:
        (WebCore::ImageLayerChromium::updateContentsIfDirty):
        * platform/graphics/skia/GraphicsContext3DSkia.cpp:
        (WebCore::GraphicsContext3D::getImageData):

2010-12-23  Mihai Parparita  <mihaip@chromium.org>

        Reviewed by Kent Tamura.

        [Chromium] Add WebThemeEngine for Mac to allow scrollbar rendering to be overridden for the DRT
        https://bugs.webkit.org/show_bug.cgi?id=51507
        
        Adds WebThemeEngine for the Mac (it already has parallel definitions for
        Windows and Linux) so that scrollbar thumb rendering can be overridden
        for the DRT (to be consistent with the NSScroller-based rendering
        used by the Mac port).

        No new tests since the functionality is not exposed yet. Eventually will
        result in the Chromium/Mac port being able to use the same pixel
        baselines for layout tests as the Mac port.

        * platform/chromium/ChromiumBridge.h:
        * platform/chromium/ScrollbarThemeChromiumMac.mm:
        (WebCore::scrollbarStateToThemeState):
        (WebCore::ScrollbarThemeChromiumMac::paint):

2010-12-23  Darin Adler  <darin@apple.com>

        Reviewed by Sam Weinig.

        WKView should not try to do asynchronous validation for selectors that are not editor commands
        https://bugs.webkit.org/show_bug.cgi?id=51555

        * WebCore.exp.in: Added commandIsSupportedFromMenuOrKeyBinding.
        * editing/Editor.h: Reordered arguments in the Editor::Command constructor
        and the data members too so the frame is last. Added
        commandIsSupportedFromMenuOrKeyBinding.

        * editing/EditorCommand.cpp:
        (WebCore::supported): Removed the EditorCommandSource argument. These
        functions are now only used when called from DOM.
        (WebCore::supportedFromMenuOrKeyBinding): Ditto.
        (WebCore::supportedCopyCut): Ditto.
        (WebCore::supportedPaste): Ditto.
        (WebCore::enabledDismissCorrectionPanel): Changed the supported function to
        an enabled function. It was incorrect to say that this is "supported" only
        when the correction panel is up. Correct to say that it is "enabled" only
        then. And also probably OK to enable it even when the selection is not in
        editable text, as long as the panel is up.
        (WebCore::createCommandMap): Moved conditional commands out of the main
        array into a separate section at the end.
        (WebCore::internalCommand): Added.
        (WebCore::Editor::command): Changed to use the new internalCommand function
        and simplified by relying on the null check in the Command constructor.
        (WebCore::Editor::commandIsSupportedFromMenuOrKeyBinding): Added.
        (WebCore::Editor::Command::Command): Removed unneeded initialization of
        m_source, which is never looked at if m_command is 0. Added feature of
        passing a null command pointer to the non-default constructor.
        (WebCore::Editor::Command::isSupported): Changed to only call the
        per-command isSupported function when the command source is DOM.
        Accordingly that function is now called isSupportedFromDOM.

2010-12-23  Matthew Delaney  <mdelaney@apple.com>

        Reviewed by Simon Fraser.

        Incorrect la